Added Search_Results Page
authorKumar Rishabh <shailrishabh@gmail.com>
Wed, 15 Feb 2017 13:26:24 +0000 (18:56 +0530)
committerKumar Rishabh <shailrishabh@gmail.com>
Wed, 15 Feb 2017 13:38:18 +0000 (19:08 +0530)
Also added animations and actions pertaining
to index and search_results page.

Change-Id: If3966991f165626ca2b13a4ac62af6a777a22903
Signed-off-by: Kumar Rishabh <shailrishabh@gmail.com>
35 files changed:
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/.DS_Store [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/LICENSE [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/README.md [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/css/materialize.css [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/css/materialize.min.css [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/.DS_Store [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.eot [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.ttf [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.woff [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.woff2 [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.eot [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.ttf [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.woff [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.woff2 [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.eot [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.ttf [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.woff [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.woff2 [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.eot [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.ttf [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.woff [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.woff2 [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.eot [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.ttf [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.woff [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.woff2 [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/js/materialize.js [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/js/materialize.min.js [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/javascripts/global.js
vnfcatalogue/VNF_Catalogue/public/stylesheets/3rd_party/bootstrap.css
vnfcatalogue/VNF_Catalogue/public/stylesheets/search_projects.css [new file with mode: 0644]
vnfcatalogue/VNF_Catalogue/public/stylesheets/style.css
vnfcatalogue/VNF_Catalogue/views/index.jade
vnfcatalogue/VNF_Catalogue/views/layout.jade
vnfcatalogue/VNF_Catalogue/views/search_projects.jade

diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/.DS_Store b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/.DS_Store
new file mode 100644 (file)
index 0000000..2828ef6
Binary files /dev/null and b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/.DS_Store differ
diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/LICENSE b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/LICENSE
new file mode 100644 (file)
index 0000000..44bd03e
--- /dev/null
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2014-2017 Materialize
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/README.md b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/README.md
new file mode 100644 (file)
index 0000000..497b01a
--- /dev/null
@@ -0,0 +1,49 @@
+![alt tag](https://raw.github.com/dogfalo/materialize/master/images/materialize.gif)
+===========
+
+[![Travis CI](https://travis-ci.org/Dogfalo/materialize.svg?branch=master)](https://travis-ci.org/Dogfalo/materialize)[![devDependency Status](https://david-dm.org/Dogfalo/materialize/dev-status.svg)](https://david-dm.org/Dogfalo/materialize#info=devDependencies)[![Gitter](https://badges.gitter.im/Join Chat.svg)](https://gitter.im/Dogfalo/materialize?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
+
+[Materialize](http://materializecss.com/), a CSS Framework based on material design
+
+### Current Version : v0.97.8
+
+## Sass Requirements:
+- Ruby Sass 3.3+, LibSass 0.6+
+
+## Supported Browsers:
+Chrome 35+, Firefox 31+, Safari 7+, IE 10+
+
+## Changelog
+- v0.97.8 (October 30th, 2016)
+  - **Refactored Modal plugin**
+  - Tabs now supported in navbar
+  - Chips data can now be reinitiailized
+  - Minor side nav fixes
+  - FAB to toolbar component added
+  - Fixed dropdown options bug
+- v0.97.7 (July 23rd, 2016)
+  - Basic horizontal cards
+  - Carousel bug fixes and new features
+  - Updated sidenav styles and new component
+  - Meteor package now supports Sass
+  - Autocomplete form component
+  - Chips jQuery plugin
+- v0.97.6 (April 1st, 2016)
+  - **Removed deprecated material icons from project**
+  - **Changed /font directory to /fonts**
+  - Datepicker and ScrollSpy now compatible with jQuery 2.2.x
+  - Responsive tables now work with empty cells
+  - Added focus states to checkboxes, switches, and radio buttons
+  - Sidenav and Modals no longer cause flicker with scrollbar
+  - Materialbox overflow and z-index issues fixed
+  - Added new option for Card actions within a Card reveal
+- v0.97.5 (December 21st, 2015)
+  - Fixed Meteor package crash
+
+
+
+## Contributing
+[Please read CONTRIBUTING.md for more information](CONTRIBUTING.md)
+
+## Testing
+We use Jasmine as our testing framework and we're trying to write a robust test suite for our components. If you want to help, [here's a starting guide on how to write tests in Jasmine](https://docs.google.com/document/d/1dVM6qGt_b_y9RRhr9X7oZfFydaJIEqB9CT7yekv-4XE/edit?usp=sharing)
diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/css/materialize.css b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/css/materialize.css
new file mode 100644 (file)
index 0000000..27de210
--- /dev/null
@@ -0,0 +1,8582 @@
+/*!
+ * Materialize v0.98.0 (http://materializecss.com)
+ * Copyright 2014-2015 Materialize
+ * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
+ */
+.materialize-red {
+  background-color: #e51c23 !important;
+}
+
+.materialize-red-text {
+  color: #e51c23 !important;
+}
+
+.materialize-red.lighten-5 {
+  background-color: #fdeaeb !important;
+}
+
+.materialize-red-text.text-lighten-5 {
+  color: #fdeaeb !important;
+}
+
+.materialize-red.lighten-4 {
+  background-color: #f8c1c3 !important;
+}
+
+.materialize-red-text.text-lighten-4 {
+  color: #f8c1c3 !important;
+}
+
+.materialize-red.lighten-3 {
+  background-color: #f3989b !important;
+}
+
+.materialize-red-text.text-lighten-3 {
+  color: #f3989b !important;
+}
+
+.materialize-red.lighten-2 {
+  background-color: #ee6e73 !important;
+}
+
+.materialize-red-text.text-lighten-2 {
+  color: #ee6e73 !important;
+}
+
+.materialize-red.lighten-1 {
+  background-color: #ea454b !important;
+}
+
+.materialize-red-text.text-lighten-1 {
+  color: #ea454b !important;
+}
+
+.materialize-red.darken-1 {
+  background-color: #d0181e !important;
+}
+
+.materialize-red-text.text-darken-1 {
+  color: #d0181e !important;
+}
+
+.materialize-red.darken-2 {
+  background-color: #b9151b !important;
+}
+
+.materialize-red-text.text-darken-2 {
+  color: #b9151b !important;
+}
+
+.materialize-red.darken-3 {
+  background-color: #a21318 !important;
+}
+
+.materialize-red-text.text-darken-3 {
+  color: #a21318 !important;
+}
+
+.materialize-red.darken-4 {
+  background-color: #8b1014 !important;
+}
+
+.materialize-red-text.text-darken-4 {
+  color: #8b1014 !important;
+}
+
+.red {
+  background-color: #F44336 !important;
+}
+
+.red-text {
+  color: #F44336 !important;
+}
+
+.red.lighten-5 {
+  background-color: #FFEBEE !important;
+}
+
+.red-text.text-lighten-5 {
+  color: #FFEBEE !important;
+}
+
+.red.lighten-4 {
+  background-color: #FFCDD2 !important;
+}
+
+.red-text.text-lighten-4 {
+  color: #FFCDD2 !important;
+}
+
+.red.lighten-3 {
+  background-color: #EF9A9A !important;
+}
+
+.red-text.text-lighten-3 {
+  color: #EF9A9A !important;
+}
+
+.red.lighten-2 {
+  background-color: #E57373 !important;
+}
+
+.red-text.text-lighten-2 {
+  color: #E57373 !important;
+}
+
+.red.lighten-1 {
+  background-color: #EF5350 !important;
+}
+
+.red-text.text-lighten-1 {
+  color: #EF5350 !important;
+}
+
+.red.darken-1 {
+  background-color: #E53935 !important;
+}
+
+.red-text.text-darken-1 {
+  color: #E53935 !important;
+}
+
+.red.darken-2 {
+  background-color: #D32F2F !important;
+}
+
+.red-text.text-darken-2 {
+  color: #D32F2F !important;
+}
+
+.red.darken-3 {
+  background-color: #C62828 !important;
+}
+
+.red-text.text-darken-3 {
+  color: #C62828 !important;
+}
+
+.red.darken-4 {
+  background-color: #B71C1C !important;
+}
+
+.red-text.text-darken-4 {
+  color: #B71C1C !important;
+}
+
+.red.accent-1 {
+  background-color: #FF8A80 !important;
+}
+
+.red-text.text-accent-1 {
+  color: #FF8A80 !important;
+}
+
+.red.accent-2 {
+  background-color: #FF5252 !important;
+}
+
+.red-text.text-accent-2 {
+  color: #FF5252 !important;
+}
+
+.red.accent-3 {
+  background-color: #FF1744 !important;
+}
+
+.red-text.text-accent-3 {
+  color: #FF1744 !important;
+}
+
+.red.accent-4 {
+  background-color: #D50000 !important;
+}
+
+.red-text.text-accent-4 {
+  color: #D50000 !important;
+}
+
+.pink {
+  background-color: #e91e63 !important;
+}
+
+.pink-text {
+  color: #e91e63 !important;
+}
+
+.pink.lighten-5 {
+  background-color: #fce4ec !important;
+}
+
+.pink-text.text-lighten-5 {
+  color: #fce4ec !important;
+}
+
+.pink.lighten-4 {
+  background-color: #f8bbd0 !important;
+}
+
+.pink-text.text-lighten-4 {
+  color: #f8bbd0 !important;
+}
+
+.pink.lighten-3 {
+  background-color: #f48fb1 !important;
+}
+
+.pink-text.text-lighten-3 {
+  color: #f48fb1 !important;
+}
+
+.pink.lighten-2 {
+  background-color: #f06292 !important;
+}
+
+.pink-text.text-lighten-2 {
+  color: #f06292 !important;
+}
+
+.pink.lighten-1 {
+  background-color: #ec407a !important;
+}
+
+.pink-text.text-lighten-1 {
+  color: #ec407a !important;
+}
+
+.pink.darken-1 {
+  background-color: #d81b60 !important;
+}
+
+.pink-text.text-darken-1 {
+  color: #d81b60 !important;
+}
+
+.pink.darken-2 {
+  background-color: #c2185b !important;
+}
+
+.pink-text.text-darken-2 {
+  color: #c2185b !important;
+}
+
+.pink.darken-3 {
+  background-color: #ad1457 !important;
+}
+
+.pink-text.text-darken-3 {
+  color: #ad1457 !important;
+}
+
+.pink.darken-4 {
+  background-color: #880e4f !important;
+}
+
+.pink-text.text-darken-4 {
+  color: #880e4f !important;
+}
+
+.pink.accent-1 {
+  background-color: #ff80ab !important;
+}
+
+.pink-text.text-accent-1 {
+  color: #ff80ab !important;
+}
+
+.pink.accent-2 {
+  background-color: #ff4081 !important;
+}
+
+.pink-text.text-accent-2 {
+  color: #ff4081 !important;
+}
+
+.pink.accent-3 {
+  background-color: #f50057 !important;
+}
+
+.pink-text.text-accent-3 {
+  color: #f50057 !important;
+}
+
+.pink.accent-4 {
+  background-color: #c51162 !important;
+}
+
+.pink-text.text-accent-4 {
+  color: #c51162 !important;
+}
+
+.purple {
+  background-color: #9c27b0 !important;
+}
+
+.purple-text {
+  color: #9c27b0 !important;
+}
+
+.purple.lighten-5 {
+  background-color: #f3e5f5 !important;
+}
+
+.purple-text.text-lighten-5 {
+  color: #f3e5f5 !important;
+}
+
+.purple.lighten-4 {
+  background-color: #e1bee7 !important;
+}
+
+.purple-text.text-lighten-4 {
+  color: #e1bee7 !important;
+}
+
+.purple.lighten-3 {
+  background-color: #ce93d8 !important;
+}
+
+.purple-text.text-lighten-3 {
+  color: #ce93d8 !important;
+}
+
+.purple.lighten-2 {
+  background-color: #ba68c8 !important;
+}
+
+.purple-text.text-lighten-2 {
+  color: #ba68c8 !important;
+}
+
+.purple.lighten-1 {
+  background-color: #ab47bc !important;
+}
+
+.purple-text.text-lighten-1 {
+  color: #ab47bc !important;
+}
+
+.purple.darken-1 {
+  background-color: #8e24aa !important;
+}
+
+.purple-text.text-darken-1 {
+  color: #8e24aa !important;
+}
+
+.purple.darken-2 {
+  background-color: #7b1fa2 !important;
+}
+
+.purple-text.text-darken-2 {
+  color: #7b1fa2 !important;
+}
+
+.purple.darken-3 {
+  background-color: #6a1b9a !important;
+}
+
+.purple-text.text-darken-3 {
+  color: #6a1b9a !important;
+}
+
+.purple.darken-4 {
+  background-color: #4a148c !important;
+}
+
+.purple-text.text-darken-4 {
+  color: #4a148c !important;
+}
+
+.purple.accent-1 {
+  background-color: #ea80fc !important;
+}
+
+.purple-text.text-accent-1 {
+  color: #ea80fc !important;
+}
+
+.purple.accent-2 {
+  background-color: #e040fb !important;
+}
+
+.purple-text.text-accent-2 {
+  color: #e040fb !important;
+}
+
+.purple.accent-3 {
+  background-color: #d500f9 !important;
+}
+
+.purple-text.text-accent-3 {
+  color: #d500f9 !important;
+}
+
+.purple.accent-4 {
+  background-color: #aa00ff !important;
+}
+
+.purple-text.text-accent-4 {
+  color: #aa00ff !important;
+}
+
+.deep-purple {
+  background-color: #673ab7 !important;
+}
+
+.deep-purple-text {
+  color: #673ab7 !important;
+}
+
+.deep-purple.lighten-5 {
+  background-color: #ede7f6 !important;
+}
+
+.deep-purple-text.text-lighten-5 {
+  color: #ede7f6 !important;
+}
+
+.deep-purple.lighten-4 {
+  background-color: #d1c4e9 !important;
+}
+
+.deep-purple-text.text-lighten-4 {
+  color: #d1c4e9 !important;
+}
+
+.deep-purple.lighten-3 {
+  background-color: #b39ddb !important;
+}
+
+.deep-purple-text.text-lighten-3 {
+  color: #b39ddb !important;
+}
+
+.deep-purple.lighten-2 {
+  background-color: #9575cd !important;
+}
+
+.deep-purple-text.text-lighten-2 {
+  color: #9575cd !important;
+}
+
+.deep-purple.lighten-1 {
+  background-color: #7e57c2 !important;
+}
+
+.deep-purple-text.text-lighten-1 {
+  color: #7e57c2 !important;
+}
+
+.deep-purple.darken-1 {
+  background-color: #5e35b1 !important;
+}
+
+.deep-purple-text.text-darken-1 {
+  color: #5e35b1 !important;
+}
+
+.deep-purple.darken-2 {
+  background-color: #512da8 !important;
+}
+
+.deep-purple-text.text-darken-2 {
+  color: #512da8 !important;
+}
+
+.deep-purple.darken-3 {
+  background-color: #4527a0 !important;
+}
+
+.deep-purple-text.text-darken-3 {
+  color: #4527a0 !important;
+}
+
+.deep-purple.darken-4 {
+  background-color: #311b92 !important;
+}
+
+.deep-purple-text.text-darken-4 {
+  color: #311b92 !important;
+}
+
+.deep-purple.accent-1 {
+  background-color: #b388ff !important;
+}
+
+.deep-purple-text.text-accent-1 {
+  color: #b388ff !important;
+}
+
+.deep-purple.accent-2 {
+  background-color: #7c4dff !important;
+}
+
+.deep-purple-text.text-accent-2 {
+  color: #7c4dff !important;
+}
+
+.deep-purple.accent-3 {
+  background-color: #651fff !important;
+}
+
+.deep-purple-text.text-accent-3 {
+  color: #651fff !important;
+}
+
+.deep-purple.accent-4 {
+  background-color: #6200ea !important;
+}
+
+.deep-purple-text.text-accent-4 {
+  color: #6200ea !important;
+}
+
+.indigo {
+  background-color: #3f51b5 !important;
+}
+
+.indigo-text {
+  color: #3f51b5 !important;
+}
+
+.indigo.lighten-5 {
+  background-color: #e8eaf6 !important;
+}
+
+.indigo-text.text-lighten-5 {
+  color: #e8eaf6 !important;
+}
+
+.indigo.lighten-4 {
+  background-color: #c5cae9 !important;
+}
+
+.indigo-text.text-lighten-4 {
+  color: #c5cae9 !important;
+}
+
+.indigo.lighten-3 {
+  background-color: #9fa8da !important;
+}
+
+.indigo-text.text-lighten-3 {
+  color: #9fa8da !important;
+}
+
+.indigo.lighten-2 {
+  background-color: #7986cb !important;
+}
+
+.indigo-text.text-lighten-2 {
+  color: #7986cb !important;
+}
+
+.indigo.lighten-1 {
+  background-color: #5c6bc0 !important;
+}
+
+.indigo-text.text-lighten-1 {
+  color: #5c6bc0 !important;
+}
+
+.indigo.darken-1 {
+  background-color: #3949ab !important;
+}
+
+.indigo-text.text-darken-1 {
+  color: #3949ab !important;
+}
+
+.indigo.darken-2 {
+  background-color: #303f9f !important;
+}
+
+.indigo-text.text-darken-2 {
+  color: #303f9f !important;
+}
+
+.indigo.darken-3 {
+  background-color: #283593 !important;
+}
+
+.indigo-text.text-darken-3 {
+  color: #283593 !important;
+}
+
+.indigo.darken-4 {
+  background-color: #1a237e !important;
+}
+
+.indigo-text.text-darken-4 {
+  color: #1a237e !important;
+}
+
+.indigo.accent-1 {
+  background-color: #8c9eff !important;
+}
+
+.indigo-text.text-accent-1 {
+  color: #8c9eff !important;
+}
+
+.indigo.accent-2 {
+  background-color: #536dfe !important;
+}
+
+.indigo-text.text-accent-2 {
+  color: #536dfe !important;
+}
+
+.indigo.accent-3 {
+  background-color: #3d5afe !important;
+}
+
+.indigo-text.text-accent-3 {
+  color: #3d5afe !important;
+}
+
+.indigo.accent-4 {
+  background-color: #304ffe !important;
+}
+
+.indigo-text.text-accent-4 {
+  color: #304ffe !important;
+}
+
+.blue {
+  background-color: #2196F3 !important;
+}
+
+.blue-text {
+  color: #2196F3 !important;
+}
+
+.blue.lighten-5 {
+  background-color: #E3F2FD !important;
+}
+
+.blue-text.text-lighten-5 {
+  color: #E3F2FD !important;
+}
+
+.blue.lighten-4 {
+  background-color: #BBDEFB !important;
+}
+
+.blue-text.text-lighten-4 {
+  color: #BBDEFB !important;
+}
+
+.blue.lighten-3 {
+  background-color: #90CAF9 !important;
+}
+
+.blue-text.text-lighten-3 {
+  color: #90CAF9 !important;
+}
+
+.blue.lighten-2 {
+  background-color: #64B5F6 !important;
+}
+
+.blue-text.text-lighten-2 {
+  color: #64B5F6 !important;
+}
+
+.blue.lighten-1 {
+  background-color: #42A5F5 !important;
+}
+
+.blue-text.text-lighten-1 {
+  color: #42A5F5 !important;
+}
+
+.blue.darken-1 {
+  background-color: #1E88E5 !important;
+}
+
+.blue-text.text-darken-1 {
+  color: #1E88E5 !important;
+}
+
+.blue.darken-2 {
+  background-color: #1976D2 !important;
+}
+
+.blue-text.text-darken-2 {
+  color: #1976D2 !important;
+}
+
+.blue.darken-3 {
+  background-color: #1565C0 !important;
+}
+
+.blue-text.text-darken-3 {
+  color: #1565C0 !important;
+}
+
+.blue.darken-4 {
+  background-color: #0D47A1 !important;
+}
+
+.blue-text.text-darken-4 {
+  color: #0D47A1 !important;
+}
+
+.blue.accent-1 {
+  background-color: #82B1FF !important;
+}
+
+.blue-text.text-accent-1 {
+  color: #82B1FF !important;
+}
+
+.blue.accent-2 {
+  background-color: #448AFF !important;
+}
+
+.blue-text.text-accent-2 {
+  color: #448AFF !important;
+}
+
+.blue.accent-3 {
+  background-color: #2979FF !important;
+}
+
+.blue-text.text-accent-3 {
+  color: #2979FF !important;
+}
+
+.blue.accent-4 {
+  background-color: #2962FF !important;
+}
+
+.blue-text.text-accent-4 {
+  color: #2962FF !important;
+}
+
+.light-blue {
+  background-color: #03a9f4 !important;
+}
+
+.light-blue-text {
+  color: #03a9f4 !important;
+}
+
+.light-blue.lighten-5 {
+  background-color: #e1f5fe !important;
+}
+
+.light-blue-text.text-lighten-5 {
+  color: #e1f5fe !important;
+}
+
+.light-blue.lighten-4 {
+  background-color: #b3e5fc !important;
+}
+
+.light-blue-text.text-lighten-4 {
+  color: #b3e5fc !important;
+}
+
+.light-blue.lighten-3 {
+  background-color: #81d4fa !important;
+}
+
+.light-blue-text.text-lighten-3 {
+  color: #81d4fa !important;
+}
+
+.light-blue.lighten-2 {
+  background-color: #4fc3f7 !important;
+}
+
+.light-blue-text.text-lighten-2 {
+  color: #4fc3f7 !important;
+}
+
+.light-blue.lighten-1 {
+  background-color: #29b6f6 !important;
+}
+
+.light-blue-text.text-lighten-1 {
+  color: #29b6f6 !important;
+}
+
+.light-blue.darken-1 {
+  background-color: #039be5 !important;
+}
+
+.light-blue-text.text-darken-1 {
+  color: #039be5 !important;
+}
+
+.light-blue.darken-2 {
+  background-color: #0288d1 !important;
+}
+
+.light-blue-text.text-darken-2 {
+  color: #0288d1 !important;
+}
+
+.light-blue.darken-3 {
+  background-color: #0277bd !important;
+}
+
+.light-blue-text.text-darken-3 {
+  color: #0277bd !important;
+}
+
+.light-blue.darken-4 {
+  background-color: #01579b !important;
+}
+
+.light-blue-text.text-darken-4 {
+  color: #01579b !important;
+}
+
+.light-blue.accent-1 {
+  background-color: #80d8ff !important;
+}
+
+.light-blue-text.text-accent-1 {
+  color: #80d8ff !important;
+}
+
+.light-blue.accent-2 {
+  background-color: #40c4ff !important;
+}
+
+.light-blue-text.text-accent-2 {
+  color: #40c4ff !important;
+}
+
+.light-blue.accent-3 {
+  background-color: #00b0ff !important;
+}
+
+.light-blue-text.text-accent-3 {
+  color: #00b0ff !important;
+}
+
+.light-blue.accent-4 {
+  background-color: #0091ea !important;
+}
+
+.light-blue-text.text-accent-4 {
+  color: #0091ea !important;
+}
+
+.cyan {
+  background-color: #00bcd4 !important;
+}
+
+.cyan-text {
+  color: #00bcd4 !important;
+}
+
+.cyan.lighten-5 {
+  background-color: #e0f7fa !important;
+}
+
+.cyan-text.text-lighten-5 {
+  color: #e0f7fa !important;
+}
+
+.cyan.lighten-4 {
+  background-color: #b2ebf2 !important;
+}
+
+.cyan-text.text-lighten-4 {
+  color: #b2ebf2 !important;
+}
+
+.cyan.lighten-3 {
+  background-color: #80deea !important;
+}
+
+.cyan-text.text-lighten-3 {
+  color: #80deea !important;
+}
+
+.cyan.lighten-2 {
+  background-color: #4dd0e1 !important;
+}
+
+.cyan-text.text-lighten-2 {
+  color: #4dd0e1 !important;
+}
+
+.cyan.lighten-1 {
+  background-color: #26c6da !important;
+}
+
+.cyan-text.text-lighten-1 {
+  color: #26c6da !important;
+}
+
+.cyan.darken-1 {
+  background-color: #00acc1 !important;
+}
+
+.cyan-text.text-darken-1 {
+  color: #00acc1 !important;
+}
+
+.cyan.darken-2 {
+  background-color: #0097a7 !important;
+}
+
+.cyan-text.text-darken-2 {
+  color: #0097a7 !important;
+}
+
+.cyan.darken-3 {
+  background-color: #00838f !important;
+}
+
+.cyan-text.text-darken-3 {
+  color: #00838f !important;
+}
+
+.cyan.darken-4 {
+  background-color: #006064 !important;
+}
+
+.cyan-text.text-darken-4 {
+  color: #006064 !important;
+}
+
+.cyan.accent-1 {
+  background-color: #84ffff !important;
+}
+
+.cyan-text.text-accent-1 {
+  color: #84ffff !important;
+}
+
+.cyan.accent-2 {
+  background-color: #18ffff !important;
+}
+
+.cyan-text.text-accent-2 {
+  color: #18ffff !important;
+}
+
+.cyan.accent-3 {
+  background-color: #00e5ff !important;
+}
+
+.cyan-text.text-accent-3 {
+  color: #00e5ff !important;
+}
+
+.cyan.accent-4 {
+  background-color: #00b8d4 !important;
+}
+
+.cyan-text.text-accent-4 {
+  color: #00b8d4 !important;
+}
+
+.teal {
+  background-color: #009688 !important;
+}
+
+.teal-text {
+  color: #009688 !important;
+}
+
+.teal.lighten-5 {
+  background-color: #e0f2f1 !important;
+}
+
+.teal-text.text-lighten-5 {
+  color: #e0f2f1 !important;
+}
+
+.teal.lighten-4 {
+  background-color: #b2dfdb !important;
+}
+
+.teal-text.text-lighten-4 {
+  color: #b2dfdb !important;
+}
+
+.teal.lighten-3 {
+  background-color: #80cbc4 !important;
+}
+
+.teal-text.text-lighten-3 {
+  color: #80cbc4 !important;
+}
+
+.teal.lighten-2 {
+  background-color: #4db6ac !important;
+}
+
+.teal-text.text-lighten-2 {
+  color: #4db6ac !important;
+}
+
+.teal.lighten-1 {
+  background-color: #26a69a !important;
+}
+
+.teal-text.text-lighten-1 {
+  color: #26a69a !important;
+}
+
+.teal.darken-1 {
+  background-color: #00897b !important;
+}
+
+.teal-text.text-darken-1 {
+  color: #00897b !important;
+}
+
+.teal.darken-2 {
+  background-color: #00796b !important;
+}
+
+.teal-text.text-darken-2 {
+  color: #00796b !important;
+}
+
+.teal.darken-3 {
+  background-color: #00695c !important;
+}
+
+.teal-text.text-darken-3 {
+  color: #00695c !important;
+}
+
+.teal.darken-4 {
+  background-color: #004d40 !important;
+}
+
+.teal-text.text-darken-4 {
+  color: #004d40 !important;
+}
+
+.teal.accent-1 {
+  background-color: #a7ffeb !important;
+}
+
+.teal-text.text-accent-1 {
+  color: #a7ffeb !important;
+}
+
+.teal.accent-2 {
+  background-color: #64ffda !important;
+}
+
+.teal-text.text-accent-2 {
+  color: #64ffda !important;
+}
+
+.teal.accent-3 {
+  background-color: #1de9b6 !important;
+}
+
+.teal-text.text-accent-3 {
+  color: #1de9b6 !important;
+}
+
+.teal.accent-4 {
+  background-color: #00bfa5 !important;
+}
+
+.teal-text.text-accent-4 {
+  color: #00bfa5 !important;
+}
+
+.green {
+  background-color: #4CAF50 !important;
+}
+
+.green-text {
+  color: #4CAF50 !important;
+}
+
+.green.lighten-5 {
+  background-color: #E8F5E9 !important;
+}
+
+.green-text.text-lighten-5 {
+  color: #E8F5E9 !important;
+}
+
+.green.lighten-4 {
+  background-color: #C8E6C9 !important;
+}
+
+.green-text.text-lighten-4 {
+  color: #C8E6C9 !important;
+}
+
+.green.lighten-3 {
+  background-color: #A5D6A7 !important;
+}
+
+.green-text.text-lighten-3 {
+  color: #A5D6A7 !important;
+}
+
+.green.lighten-2 {
+  background-color: #81C784 !important;
+}
+
+.green-text.text-lighten-2 {
+  color: #81C784 !important;
+}
+
+.green.lighten-1 {
+  background-color: #66BB6A !important;
+}
+
+.green-text.text-lighten-1 {
+  color: #66BB6A !important;
+}
+
+.green.darken-1 {
+  background-color: #43A047 !important;
+}
+
+.green-text.text-darken-1 {
+  color: #43A047 !important;
+}
+
+.green.darken-2 {
+  background-color: #388E3C !important;
+}
+
+.green-text.text-darken-2 {
+  color: #388E3C !important;
+}
+
+.green.darken-3 {
+  background-color: #2E7D32 !important;
+}
+
+.green-text.text-darken-3 {
+  color: #2E7D32 !important;
+}
+
+.green.darken-4 {
+  background-color: #1B5E20 !important;
+}
+
+.green-text.text-darken-4 {
+  color: #1B5E20 !important;
+}
+
+.green.accent-1 {
+  background-color: #B9F6CA !important;
+}
+
+.green-text.text-accent-1 {
+  color: #B9F6CA !important;
+}
+
+.green.accent-2 {
+  background-color: #69F0AE !important;
+}
+
+.green-text.text-accent-2 {
+  color: #69F0AE !important;
+}
+
+.green.accent-3 {
+  background-color: #00E676 !important;
+}
+
+.green-text.text-accent-3 {
+  color: #00E676 !important;
+}
+
+.green.accent-4 {
+  background-color: #00C853 !important;
+}
+
+.green-text.text-accent-4 {
+  color: #00C853 !important;
+}
+
+.light-green {
+  background-color: #8bc34a !important;
+}
+
+.light-green-text {
+  color: #8bc34a !important;
+}
+
+.light-green.lighten-5 {
+  background-color: #f1f8e9 !important;
+}
+
+.light-green-text.text-lighten-5 {
+  color: #f1f8e9 !important;
+}
+
+.light-green.lighten-4 {
+  background-color: #dcedc8 !important;
+}
+
+.light-green-text.text-lighten-4 {
+  color: #dcedc8 !important;
+}
+
+.light-green.lighten-3 {
+  background-color: #c5e1a5 !important;
+}
+
+.light-green-text.text-lighten-3 {
+  color: #c5e1a5 !important;
+}
+
+.light-green.lighten-2 {
+  background-color: #aed581 !important;
+}
+
+.light-green-text.text-lighten-2 {
+  color: #aed581 !important;
+}
+
+.light-green.lighten-1 {
+  background-color: #9ccc65 !important;
+}
+
+.light-green-text.text-lighten-1 {
+  color: #9ccc65 !important;
+}
+
+.light-green.darken-1 {
+  background-color: #7cb342 !important;
+}
+
+.light-green-text.text-darken-1 {
+  color: #7cb342 !important;
+}
+
+.light-green.darken-2 {
+  background-color: #689f38 !important;
+}
+
+.light-green-text.text-darken-2 {
+  color: #689f38 !important;
+}
+
+.light-green.darken-3 {
+  background-color: #558b2f !important;
+}
+
+.light-green-text.text-darken-3 {
+  color: #558b2f !important;
+}
+
+.light-green.darken-4 {
+  background-color: #33691e !important;
+}
+
+.light-green-text.text-darken-4 {
+  color: #33691e !important;
+}
+
+.light-green.accent-1 {
+  background-color: #ccff90 !important;
+}
+
+.light-green-text.text-accent-1 {
+  color: #ccff90 !important;
+}
+
+.light-green.accent-2 {
+  background-color: #b2ff59 !important;
+}
+
+.light-green-text.text-accent-2 {
+  color: #b2ff59 !important;
+}
+
+.light-green.accent-3 {
+  background-color: #76ff03 !important;
+}
+
+.light-green-text.text-accent-3 {
+  color: #76ff03 !important;
+}
+
+.light-green.accent-4 {
+  background-color: #64dd17 !important;
+}
+
+.light-green-text.text-accent-4 {
+  color: #64dd17 !important;
+}
+
+.lime {
+  background-color: #cddc39 !important;
+}
+
+.lime-text {
+  color: #cddc39 !important;
+}
+
+.lime.lighten-5 {
+  background-color: #f9fbe7 !important;
+}
+
+.lime-text.text-lighten-5 {
+  color: #f9fbe7 !important;
+}
+
+.lime.lighten-4 {
+  background-color: #f0f4c3 !important;
+}
+
+.lime-text.text-lighten-4 {
+  color: #f0f4c3 !important;
+}
+
+.lime.lighten-3 {
+  background-color: #e6ee9c !important;
+}
+
+.lime-text.text-lighten-3 {
+  color: #e6ee9c !important;
+}
+
+.lime.lighten-2 {
+  background-color: #dce775 !important;
+}
+
+.lime-text.text-lighten-2 {
+  color: #dce775 !important;
+}
+
+.lime.lighten-1 {
+  background-color: #d4e157 !important;
+}
+
+.lime-text.text-lighten-1 {
+  color: #d4e157 !important;
+}
+
+.lime.darken-1 {
+  background-color: #c0ca33 !important;
+}
+
+.lime-text.text-darken-1 {
+  color: #c0ca33 !important;
+}
+
+.lime.darken-2 {
+  background-color: #afb42b !important;
+}
+
+.lime-text.text-darken-2 {
+  color: #afb42b !important;
+}
+
+.lime.darken-3 {
+  background-color: #9e9d24 !important;
+}
+
+.lime-text.text-darken-3 {
+  color: #9e9d24 !important;
+}
+
+.lime.darken-4 {
+  background-color: #827717 !important;
+}
+
+.lime-text.text-darken-4 {
+  color: #827717 !important;
+}
+
+.lime.accent-1 {
+  background-color: #f4ff81 !important;
+}
+
+.lime-text.text-accent-1 {
+  color: #f4ff81 !important;
+}
+
+.lime.accent-2 {
+  background-color: #eeff41 !important;
+}
+
+.lime-text.text-accent-2 {
+  color: #eeff41 !important;
+}
+
+.lime.accent-3 {
+  background-color: #c6ff00 !important;
+}
+
+.lime-text.text-accent-3 {
+  color: #c6ff00 !important;
+}
+
+.lime.accent-4 {
+  background-color: #aeea00 !important;
+}
+
+.lime-text.text-accent-4 {
+  color: #aeea00 !important;
+}
+
+.yellow {
+  background-color: #ffeb3b !important;
+}
+
+.yellow-text {
+  color: #ffeb3b !important;
+}
+
+.yellow.lighten-5 {
+  background-color: #fffde7 !important;
+}
+
+.yellow-text.text-lighten-5 {
+  color: #fffde7 !important;
+}
+
+.yellow.lighten-4 {
+  background-color: #fff9c4 !important;
+}
+
+.yellow-text.text-lighten-4 {
+  color: #fff9c4 !important;
+}
+
+.yellow.lighten-3 {
+  background-color: #fff59d !important;
+}
+
+.yellow-text.text-lighten-3 {
+  color: #fff59d !important;
+}
+
+.yellow.lighten-2 {
+  background-color: #fff176 !important;
+}
+
+.yellow-text.text-lighten-2 {
+  color: #fff176 !important;
+}
+
+.yellow.lighten-1 {
+  background-color: #ffee58 !important;
+}
+
+.yellow-text.text-lighten-1 {
+  color: #ffee58 !important;
+}
+
+.yellow.darken-1 {
+  background-color: #fdd835 !important;
+}
+
+.yellow-text.text-darken-1 {
+  color: #fdd835 !important;
+}
+
+.yellow.darken-2 {
+  background-color: #fbc02d !important;
+}
+
+.yellow-text.text-darken-2 {
+  color: #fbc02d !important;
+}
+
+.yellow.darken-3 {
+  background-color: #f9a825 !important;
+}
+
+.yellow-text.text-darken-3 {
+  color: #f9a825 !important;
+}
+
+.yellow.darken-4 {
+  background-color: #f57f17 !important;
+}
+
+.yellow-text.text-darken-4 {
+  color: #f57f17 !important;
+}
+
+.yellow.accent-1 {
+  background-color: #ffff8d !important;
+}
+
+.yellow-text.text-accent-1 {
+  color: #ffff8d !important;
+}
+
+.yellow.accent-2 {
+  background-color: #ffff00 !important;
+}
+
+.yellow-text.text-accent-2 {
+  color: #ffff00 !important;
+}
+
+.yellow.accent-3 {
+  background-color: #ffea00 !important;
+}
+
+.yellow-text.text-accent-3 {
+  color: #ffea00 !important;
+}
+
+.yellow.accent-4 {
+  background-color: #ffd600 !important;
+}
+
+.yellow-text.text-accent-4 {
+  color: #ffd600 !important;
+}
+
+.amber {
+  background-color: #ffc107 !important;
+}
+
+.amber-text {
+  color: #ffc107 !important;
+}
+
+.amber.lighten-5 {
+  background-color: #fff8e1 !important;
+}
+
+.amber-text.text-lighten-5 {
+  color: #fff8e1 !important;
+}
+
+.amber.lighten-4 {
+  background-color: #ffecb3 !important;
+}
+
+.amber-text.text-lighten-4 {
+  color: #ffecb3 !important;
+}
+
+.amber.lighten-3 {
+  background-color: #ffe082 !important;
+}
+
+.amber-text.text-lighten-3 {
+  color: #ffe082 !important;
+}
+
+.amber.lighten-2 {
+  background-color: #ffd54f !important;
+}
+
+.amber-text.text-lighten-2 {
+  color: #ffd54f !important;
+}
+
+.amber.lighten-1 {
+  background-color: #ffca28 !important;
+}
+
+.amber-text.text-lighten-1 {
+  color: #ffca28 !important;
+}
+
+.amber.darken-1 {
+  background-color: #ffb300 !important;
+}
+
+.amber-text.text-darken-1 {
+  color: #ffb300 !important;
+}
+
+.amber.darken-2 {
+  background-color: #ffa000 !important;
+}
+
+.amber-text.text-darken-2 {
+  color: #ffa000 !important;
+}
+
+.amber.darken-3 {
+  background-color: #ff8f00 !important;
+}
+
+.amber-text.text-darken-3 {
+  color: #ff8f00 !important;
+}
+
+.amber.darken-4 {
+  background-color: #ff6f00 !important;
+}
+
+.amber-text.text-darken-4 {
+  color: #ff6f00 !important;
+}
+
+.amber.accent-1 {
+  background-color: #ffe57f !important;
+}
+
+.amber-text.text-accent-1 {
+  color: #ffe57f !important;
+}
+
+.amber.accent-2 {
+  background-color: #ffd740 !important;
+}
+
+.amber-text.text-accent-2 {
+  color: #ffd740 !important;
+}
+
+.amber.accent-3 {
+  background-color: #ffc400 !important;
+}
+
+.amber-text.text-accent-3 {
+  color: #ffc400 !important;
+}
+
+.amber.accent-4 {
+  background-color: #ffab00 !important;
+}
+
+.amber-text.text-accent-4 {
+  color: #ffab00 !important;
+}
+
+.orange {
+  background-color: #ff9800 !important;
+}
+
+.orange-text {
+  color: #ff9800 !important;
+}
+
+.orange.lighten-5 {
+  background-color: #fff3e0 !important;
+}
+
+.orange-text.text-lighten-5 {
+  color: #fff3e0 !important;
+}
+
+.orange.lighten-4 {
+  background-color: #ffe0b2 !important;
+}
+
+.orange-text.text-lighten-4 {
+  color: #ffe0b2 !important;
+}
+
+.orange.lighten-3 {
+  background-color: #ffcc80 !important;
+}
+
+.orange-text.text-lighten-3 {
+  color: #ffcc80 !important;
+}
+
+.orange.lighten-2 {
+  background-color: #ffb74d !important;
+}
+
+.orange-text.text-lighten-2 {
+  color: #ffb74d !important;
+}
+
+.orange.lighten-1 {
+  background-color: #ffa726 !important;
+}
+
+.orange-text.text-lighten-1 {
+  color: #ffa726 !important;
+}
+
+.orange.darken-1 {
+  background-color: #fb8c00 !important;
+}
+
+.orange-text.text-darken-1 {
+  color: #fb8c00 !important;
+}
+
+.orange.darken-2 {
+  background-color: #f57c00 !important;
+}
+
+.orange-text.text-darken-2 {
+  color: #f57c00 !important;
+}
+
+.orange.darken-3 {
+  background-color: #ef6c00 !important;
+}
+
+.orange-text.text-darken-3 {
+  color: #ef6c00 !important;
+}
+
+.orange.darken-4 {
+  background-color: #e65100 !important;
+}
+
+.orange-text.text-darken-4 {
+  color: #e65100 !important;
+}
+
+.orange.accent-1 {
+  background-color: #ffd180 !important;
+}
+
+.orange-text.text-accent-1 {
+  color: #ffd180 !important;
+}
+
+.orange.accent-2 {
+  background-color: #ffab40 !important;
+}
+
+.orange-text.text-accent-2 {
+  color: #ffab40 !important;
+}
+
+.orange.accent-3 {
+  background-color: #ff9100 !important;
+}
+
+.orange-text.text-accent-3 {
+  color: #ff9100 !important;
+}
+
+.orange.accent-4 {
+  background-color: #ff6d00 !important;
+}
+
+.orange-text.text-accent-4 {
+  color: #ff6d00 !important;
+}
+
+.deep-orange {
+  background-color: #ff5722 !important;
+}
+
+.deep-orange-text {
+  color: #ff5722 !important;
+}
+
+.deep-orange.lighten-5 {
+  background-color: #fbe9e7 !important;
+}
+
+.deep-orange-text.text-lighten-5 {
+  color: #fbe9e7 !important;
+}
+
+.deep-orange.lighten-4 {
+  background-color: #ffccbc !important;
+}
+
+.deep-orange-text.text-lighten-4 {
+  color: #ffccbc !important;
+}
+
+.deep-orange.lighten-3 {
+  background-color: #ffab91 !important;
+}
+
+.deep-orange-text.text-lighten-3 {
+  color: #ffab91 !important;
+}
+
+.deep-orange.lighten-2 {
+  background-color: #ff8a65 !important;
+}
+
+.deep-orange-text.text-lighten-2 {
+  color: #ff8a65 !important;
+}
+
+.deep-orange.lighten-1 {
+  background-color: #ff7043 !important;
+}
+
+.deep-orange-text.text-lighten-1 {
+  color: #ff7043 !important;
+}
+
+.deep-orange.darken-1 {
+  background-color: #f4511e !important;
+}
+
+.deep-orange-text.text-darken-1 {
+  color: #f4511e !important;
+}
+
+.deep-orange.darken-2 {
+  background-color: #e64a19 !important;
+}
+
+.deep-orange-text.text-darken-2 {
+  color: #e64a19 !important;
+}
+
+.deep-orange.darken-3 {
+  background-color: #d84315 !important;
+}
+
+.deep-orange-text.text-darken-3 {
+  color: #d84315 !important;
+}
+
+.deep-orange.darken-4 {
+  background-color: #bf360c !important;
+}
+
+.deep-orange-text.text-darken-4 {
+  color: #bf360c !important;
+}
+
+.deep-orange.accent-1 {
+  background-color: #ff9e80 !important;
+}
+
+.deep-orange-text.text-accent-1 {
+  color: #ff9e80 !important;
+}
+
+.deep-orange.accent-2 {
+  background-color: #ff6e40 !important;
+}
+
+.deep-orange-text.text-accent-2 {
+  color: #ff6e40 !important;
+}
+
+.deep-orange.accent-3 {
+  background-color: #ff3d00 !important;
+}
+
+.deep-orange-text.text-accent-3 {
+  color: #ff3d00 !important;
+}
+
+.deep-orange.accent-4 {
+  background-color: #dd2c00 !important;
+}
+
+.deep-orange-text.text-accent-4 {
+  color: #dd2c00 !important;
+}
+
+.brown {
+  background-color: #795548 !important;
+}
+
+.brown-text {
+  color: #795548 !important;
+}
+
+.brown.lighten-5 {
+  background-color: #efebe9 !important;
+}
+
+.brown-text.text-lighten-5 {
+  color: #efebe9 !important;
+}
+
+.brown.lighten-4 {
+  background-color: #d7ccc8 !important;
+}
+
+.brown-text.text-lighten-4 {
+  color: #d7ccc8 !important;
+}
+
+.brown.lighten-3 {
+  background-color: #bcaaa4 !important;
+}
+
+.brown-text.text-lighten-3 {
+  color: #bcaaa4 !important;
+}
+
+.brown.lighten-2 {
+  background-color: #a1887f !important;
+}
+
+.brown-text.text-lighten-2 {
+  color: #a1887f !important;
+}
+
+.brown.lighten-1 {
+  background-color: #8d6e63 !important;
+}
+
+.brown-text.text-lighten-1 {
+  color: #8d6e63 !important;
+}
+
+.brown.darken-1 {
+  background-color: #6d4c41 !important;
+}
+
+.brown-text.text-darken-1 {
+  color: #6d4c41 !important;
+}
+
+.brown.darken-2 {
+  background-color: #5d4037 !important;
+}
+
+.brown-text.text-darken-2 {
+  color: #5d4037 !important;
+}
+
+.brown.darken-3 {
+  background-color: #4e342e !important;
+}
+
+.brown-text.text-darken-3 {
+  color: #4e342e !important;
+}
+
+.brown.darken-4 {
+  background-color: #3e2723 !important;
+}
+
+.brown-text.text-darken-4 {
+  color: #3e2723 !important;
+}
+
+.blue-grey {
+  background-color: #607d8b !important;
+}
+
+.blue-grey-text {
+  color: #607d8b !important;
+}
+
+.blue-grey.lighten-5 {
+  background-color: #eceff1 !important;
+}
+
+.blue-grey-text.text-lighten-5 {
+  color: #eceff1 !important;
+}
+
+.blue-grey.lighten-4 {
+  background-color: #cfd8dc !important;
+}
+
+.blue-grey-text.text-lighten-4 {
+  color: #cfd8dc !important;
+}
+
+.blue-grey.lighten-3 {
+  background-color: #b0bec5 !important;
+}
+
+.blue-grey-text.text-lighten-3 {
+  color: #b0bec5 !important;
+}
+
+.blue-grey.lighten-2 {
+  background-color: #90a4ae !important;
+}
+
+.blue-grey-text.text-lighten-2 {
+  color: #90a4ae !important;
+}
+
+.blue-grey.lighten-1 {
+  background-color: #78909c !important;
+}
+
+.blue-grey-text.text-lighten-1 {
+  color: #78909c !important;
+}
+
+.blue-grey.darken-1 {
+  background-color: #546e7a !important;
+}
+
+.blue-grey-text.text-darken-1 {
+  color: #546e7a !important;
+}
+
+.blue-grey.darken-2 {
+  background-color: #455a64 !important;
+}
+
+.blue-grey-text.text-darken-2 {
+  color: #455a64 !important;
+}
+
+.blue-grey.darken-3 {
+  background-color: #37474f !important;
+}
+
+.blue-grey-text.text-darken-3 {
+  color: #37474f !important;
+}
+
+.blue-grey.darken-4 {
+  background-color: #263238 !important;
+}
+
+.blue-grey-text.text-darken-4 {
+  color: #263238 !important;
+}
+
+.grey {
+  background-color: #9e9e9e !important;
+}
+
+.grey-text {
+  color: #9e9e9e !important;
+}
+
+.grey.lighten-5 {
+  background-color: #fafafa !important;
+}
+
+.grey-text.text-lighten-5 {
+  color: #fafafa !important;
+}
+
+.grey.lighten-4 {
+  background-color: #f5f5f5 !important;
+}
+
+.grey-text.text-lighten-4 {
+  color: #f5f5f5 !important;
+}
+
+.grey.lighten-3 {
+  background-color: #eeeeee !important;
+}
+
+.grey-text.text-lighten-3 {
+  color: #eeeeee !important;
+}
+
+.grey.lighten-2 {
+  background-color: #e0e0e0 !important;
+}
+
+.grey-text.text-lighten-2 {
+  color: #e0e0e0 !important;
+}
+
+.grey.lighten-1 {
+  background-color: #bdbdbd !important;
+}
+
+.grey-text.text-lighten-1 {
+  color: #bdbdbd !important;
+}
+
+.grey.darken-1 {
+  background-color: #757575 !important;
+}
+
+.grey-text.text-darken-1 {
+  color: #757575 !important;
+}
+
+.grey.darken-2 {
+  background-color: #616161 !important;
+}
+
+.grey-text.text-darken-2 {
+  color: #616161 !important;
+}
+
+.grey.darken-3 {
+  background-color: #424242 !important;
+}
+
+.grey-text.text-darken-3 {
+  color: #424242 !important;
+}
+
+.grey.darken-4 {
+  background-color: #212121 !important;
+}
+
+.grey-text.text-darken-4 {
+  color: #212121 !important;
+}
+
+.black {
+  background-color: #000000 !important;
+}
+
+.black-text {
+  color: #000000 !important;
+}
+
+.white {
+  background-color: #FFFFFF !important;
+}
+
+.white-text {
+  color: #FFFFFF !important;
+}
+
+.transparent {
+  background-color: transparent !important;
+}
+
+.transparent-text {
+  color: transparent !important;
+}
+
+/*! normalize.css v3.0.3 | MIT License | github.com/necolas/normalize.css */
+/**
+ * 1. Set default font family to sans-serif.
+ * 2. Prevent iOS and IE text size adjust after device orientation change,
+ *    without disabling user zoom.
+ */
+html {
+  font-family: sans-serif;
+  /* 1 */
+  -ms-text-size-adjust: 100%;
+  /* 2 */
+  -webkit-text-size-adjust: 100%;
+  /* 2 */
+}
+
+/**
+ * Remove default margin.
+ */
+body {
+  margin: 0;
+}
+
+/* HTML5 display definitions
+   ========================================================================== */
+/**
+ * Correct `block` display not defined for any HTML5 element in IE 8/9.
+ * Correct `block` display not defined for `details` or `summary` in IE 10/11
+ * and Firefox.
+ * Correct `block` display not defined for `main` in IE 11.
+ */
+article,
+aside,
+details,
+figcaption,
+figure,
+footer,
+header,
+hgroup,
+main,
+menu,
+nav,
+section,
+summary {
+  display: block;
+}
+
+/**
+ * 1. Correct `inline-block` display not defined in IE 8/9.
+ * 2. Normalize vertical alignment of `progress` in Chrome, Firefox, and Opera.
+ */
+audio,
+canvas,
+progress,
+video {
+  display: inline-block;
+  /* 1 */
+  vertical-align: baseline;
+  /* 2 */
+}
+
+/**
+ * Prevent modern browsers from displaying `audio` without controls.
+ * Remove excess height in iOS 5 devices.
+ */
+audio:not([controls]) {
+  display: none;
+  height: 0;
+}
+
+/**
+ * Address `[hidden]` styling not present in IE 8/9/10.
+ * Hide the `template` element in IE 8/9/10/11, Safari, and Firefox < 22.
+ */
+[hidden],
+template {
+  display: none;
+}
+
+/* Links
+   ========================================================================== */
+/**
+ * Remove the gray background color from active links in IE 10.
+ */
+a {
+  background-color: transparent;
+}
+
+/**
+ * Improve readability of focused elements when they are also in an
+ * active/hover state.
+ */
+a:active,
+a:hover {
+  outline: 0;
+}
+
+/* Text-level semantics
+   ========================================================================== */
+/**
+ * Address styling not present in IE 8/9/10/11, Safari, and Chrome.
+ */
+abbr[title] {
+  border-bottom: 1px dotted;
+}
+
+/**
+ * Address style set to `bolder` in Firefox 4+, Safari, and Chrome.
+ */
+b,
+strong {
+  font-weight: bold;
+}
+
+/**
+ * Address styling not present in Safari and Chrome.
+ */
+dfn {
+  font-style: italic;
+}
+
+/**
+ * Address variable `h1` font-size and margin within `section` and `article`
+ * contexts in Firefox 4+, Safari, and Chrome.
+ */
+h1 {
+  font-size: 2em;
+  margin: 0.67em 0;
+}
+
+/**
+ * Address styling not present in IE 8/9.
+ */
+mark {
+  background: #ff0;
+  color: #000;
+}
+
+/**
+ * Address inconsistent and variable font size in all browsers.
+ */
+small {
+  font-size: 80%;
+}
+
+/**
+ * Prevent `sub` and `sup` affecting `line-height` in all browsers.
+ */
+sub,
+sup {
+  font-size: 75%;
+  line-height: 0;
+  position: relative;
+  vertical-align: baseline;
+}
+
+sup {
+  top: -0.5em;
+}
+
+sub {
+  bottom: -0.25em;
+}
+
+/* Embedded content
+   ========================================================================== */
+/**
+ * Remove border when inside `a` element in IE 8/9/10.
+ */
+img {
+  border: 0;
+}
+
+/**
+ * Correct overflow not hidden in IE 9/10/11.
+ */
+svg:not(:root) {
+  overflow: hidden;
+}
+
+/* Grouping content
+   ========================================================================== */
+/**
+ * Address margin not present in IE 8/9 and Safari.
+ */
+figure {
+  margin: 1em 40px;
+}
+
+/**
+ * Address differences between Firefox and other browsers.
+ */
+hr {
+  box-sizing: content-box;
+  height: 0;
+}
+
+/**
+ * Contain overflow in all browsers.
+ */
+pre {
+  overflow: auto;
+}
+
+/**
+ * Address odd `em`-unit font size rendering in all browsers.
+ */
+code,
+kbd,
+pre,
+samp {
+  font-family: monospace, monospace;
+  font-size: 1em;
+}
+
+/* Forms
+   ========================================================================== */
+/**
+ * Known limitation: by default, Chrome and Safari on OS X allow very limited
+ * styling of `select`, unless a `border` property is set.
+ */
+/**
+ * 1. Correct color not being inherited.
+ *    Known issue: affects color of disabled elements.
+ * 2. Correct font properties not being inherited.
+ * 3. Address margins set differently in Firefox 4+, Safari, and Chrome.
+ */
+button,
+input,
+optgroup,
+select,
+textarea {
+  color: inherit;
+  /* 1 */
+  font: inherit;
+  /* 2 */
+  margin: 0;
+  /* 3 */
+}
+
+/**
+ * Address `overflow` set to `hidden` in IE 8/9/10/11.
+ */
+button {
+  overflow: visible;
+}
+
+/**
+ * Address inconsistent `text-transform` inheritance for `button` and `select`.
+ * All other form control elements do not inherit `text-transform` values.
+ * Correct `button` style inheritance in Firefox, IE 8/9/10/11, and Opera.
+ * Correct `select` style inheritance in Firefox.
+ */
+button,
+select {
+  text-transform: none;
+}
+
+/**
+ * 1. Avoid the WebKit bug in Android 4.0.* where (2) destroys native `audio`
+ *    and `video` controls.
+ * 2. Correct inability to style clickable `input` types in iOS.
+ * 3. Improve usability and consistency of cursor style between image-type
+ *    `input` and others.
+ */
+button,
+html input[type="button"],
+input[type="reset"],
+input[type="submit"] {
+  -webkit-appearance: button;
+  /* 2 */
+  cursor: pointer;
+  /* 3 */
+}
+
+/**
+ * Re-set default cursor for disabled elements.
+ */
+button[disabled],
+html input[disabled] {
+  cursor: default;
+}
+
+/**
+ * Remove inner padding and border in Firefox 4+.
+ */
+button::-moz-focus-inner,
+input::-moz-focus-inner {
+  border: 0;
+  padding: 0;
+}
+
+/**
+ * Address Firefox 4+ setting `line-height` on `input` using `!important` in
+ * the UA stylesheet.
+ */
+input {
+  line-height: normal;
+}
+
+/**
+ * It's recommended that you don't attempt to style these elements.
+ * Firefox's implementation doesn't respect box-sizing, padding, or width.
+ *
+ * 1. Address box sizing set to `content-box` in IE 8/9/10.
+ * 2. Remove excess padding in IE 8/9/10.
+ */
+input[type="checkbox"],
+input[type="radio"] {
+  box-sizing: border-box;
+  /* 1 */
+  padding: 0;
+  /* 2 */
+}
+
+/**
+ * Fix the cursor style for Chrome's increment/decrement buttons. For certain
+ * `font-size` values of the `input`, it causes the cursor style of the
+ * decrement button to change from `default` to `text`.
+ */
+input[type="number"]::-webkit-inner-spin-button,
+input[type="number"]::-webkit-outer-spin-button {
+  height: auto;
+}
+
+/**
+ * 1. Address `appearance` set to `searchfield` in Safari and Chrome.
+ * 2. Address `box-sizing` set to `border-box` in Safari and Chrome.
+ */
+input[type="search"] {
+  -webkit-appearance: textfield;
+  /* 1 */
+  box-sizing: content-box;
+  /* 2 */
+}
+
+/**
+ * Remove inner padding and search cancel button in Safari and Chrome on OS X.
+ * Safari (but not Chrome) clips the cancel button when the search input has
+ * padding (and `textfield` appearance).
+ */
+input[type="search"]::-webkit-search-cancel-button,
+input[type="search"]::-webkit-search-decoration {
+  -webkit-appearance: none;
+}
+
+/**
+ * Define consistent border, margin, and padding.
+ */
+fieldset {
+  border: 1px solid #c0c0c0;
+  margin: 0 2px;
+  padding: 0.35em 0.625em 0.75em;
+}
+
+/**
+ * 1. Correct `color` not being inherited in IE 8/9/10/11.
+ * 2. Remove padding so people aren't caught out if they zero out fieldsets.
+ */
+legend {
+  border: 0;
+  /* 1 */
+  padding: 0;
+  /* 2 */
+}
+
+/**
+ * Remove default vertical scrollbar in IE 8/9/10/11.
+ */
+textarea {
+  overflow: auto;
+}
+
+/**
+ * Don't inherit the `font-weight` (applied by a rule above).
+ * NOTE: the default cannot safely be changed in Chrome and Safari on OS X.
+ */
+optgroup {
+  font-weight: bold;
+}
+
+/* Tables
+   ========================================================================== */
+/**
+ * Remove most spacing between table cells.
+ */
+table {
+  border-collapse: collapse;
+  border-spacing: 0;
+}
+
+td,
+th {
+  padding: 0;
+}
+
+html {
+  box-sizing: border-box;
+}
+
+*, *:before, *:after {
+  box-sizing: inherit;
+}
+
+ul:not(.browser-default) {
+  padding-left: 0;
+  list-style-type: none;
+}
+
+ul:not(.browser-default) li {
+  list-style-type: none;
+}
+
+a {
+  color: #039be5;
+  text-decoration: none;
+  -webkit-tap-highlight-color: transparent;
+}
+
+.valign-wrapper {
+  display: -webkit-flex;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-align-items: center;
+      -ms-flex-align: center;
+          align-items: center;
+}
+
+.valign-wrapper .valign {
+  display: block;
+}
+
+.clearfix {
+  clear: both;
+}
+
+.z-depth-0 {
+  box-shadow: none !important;
+}
+
+.z-depth-1, nav, .card-panel, .card, .toast, .btn, .btn-large, .btn-floating, .dropdown-content, .collapsible, .side-nav {
+  box-shadow: 0 2px 2px 0 rgba(0, 0, 0, 0.14), 0 1px 5px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -2px rgba(0, 0, 0, 0.2);
+}
+
+.z-depth-1-half, .btn:hover, .btn-large:hover, .btn-floating:hover {
+  box-shadow: 0 3px 3px 0 rgba(0, 0, 0, 0.14), 0 1px 7px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -1px rgba(0, 0, 0, 0.2);
+}
+
+.z-depth-2 {
+  box-shadow: 0 4px 5px 0 rgba(0, 0, 0, 0.14), 0 1px 10px 0 rgba(0, 0, 0, 0.12), 0 2px 4px -1px rgba(0, 0, 0, 0.3);
+}
+
+.z-depth-3 {
+  box-shadow: 0 6px 10px 0 rgba(0, 0, 0, 0.14), 0 1px 18px 0 rgba(0, 0, 0, 0.12), 0 3px 5px -1px rgba(0, 0, 0, 0.3);
+}
+
+.z-depth-4, .modal {
+  box-shadow: 0 8px 10px 1px rgba(0, 0, 0, 0.14), 0 3px 14px 2px rgba(0, 0, 0, 0.12), 0 5px 5px -3px rgba(0, 0, 0, 0.3);
+}
+
+.z-depth-5 {
+  box-shadow: 0 16px 24px 2px rgba(0, 0, 0, 0.14), 0 6px 30px 5px rgba(0, 0, 0, 0.12), 0 8px 10px -5px rgba(0, 0, 0, 0.3);
+}
+
+.hoverable {
+  transition: box-shadow .25s;
+  box-shadow: 0;
+}
+
+.hoverable:hover {
+  transition: box-shadow .25s;
+  box-shadow: 0 8px 17px 0 rgba(0, 0, 0, 0.2), 0 6px 20px 0 rgba(0, 0, 0, 0.19);
+}
+
+.divider {
+  height: 1px;
+  overflow: hidden;
+  background-color: #e0e0e0;
+}
+
+blockquote {
+  margin: 20px 0;
+  padding-left: 1.5rem;
+  border-left: 5px solid #ee6e73;
+}
+
+i {
+  line-height: inherit;
+}
+
+i.left {
+  float: left;
+  margin-right: 15px;
+}
+
+i.right {
+  float: right;
+  margin-left: 15px;
+}
+
+i.tiny {
+  font-size: 1rem;
+}
+
+i.small {
+  font-size: 2rem;
+}
+
+i.medium {
+  font-size: 4rem;
+}
+
+i.large {
+  font-size: 6rem;
+}
+
+img.responsive-img,
+video.responsive-video {
+  max-width: 100%;
+  height: auto;
+}
+
+.pagination li {
+  display: inline-block;
+  border-radius: 2px;
+  text-align: center;
+  vertical-align: top;
+  height: 30px;
+}
+
+.pagination li a {
+  color: #444;
+  display: inline-block;
+  font-size: 1.2rem;
+  padding: 0 10px;
+  line-height: 30px;
+}
+
+.pagination li.active a {
+  color: #fff;
+}
+
+.pagination li.active {
+  background-color: #ee6e73;
+}
+
+.pagination li.disabled a {
+  cursor: default;
+  color: #999;
+}
+
+.pagination li i {
+  font-size: 2rem;
+}
+
+.pagination li.pages ul li {
+  display: inline-block;
+  float: none;
+}
+
+@media only screen and (max-width: 992px) {
+  .pagination {
+    width: 100%;
+  }
+  .pagination li.prev,
+  .pagination li.next {
+    width: 10%;
+  }
+  .pagination li.pages {
+    width: 80%;
+    overflow: hidden;
+    white-space: nowrap;
+  }
+}
+
+.breadcrumb {
+  font-size: 18px;
+  color: rgba(255, 255, 255, 0.7);
+}
+
+.breadcrumb i,
+.breadcrumb [class^="mdi-"], .breadcrumb [class*="mdi-"],
+.breadcrumb i.material-icons {
+  display: inline-block;
+  float: left;
+  font-size: 24px;
+}
+
+.breadcrumb:before {
+  content: '\E5CC';
+  color: rgba(255, 255, 255, 0.7);
+  vertical-align: top;
+  display: inline-block;
+  font-family: 'Material Icons';
+  font-weight: normal;
+  font-style: normal;
+  font-size: 25px;
+  margin: 0 10px 0 8px;
+  -webkit-font-smoothing: antialiased;
+}
+
+.breadcrumb:first-child:before {
+  display: none;
+}
+
+.breadcrumb:last-child {
+  color: #fff;
+}
+
+.parallax-container {
+  position: relative;
+  overflow: hidden;
+  height: 500px;
+}
+
+.parallax {
+  position: absolute;
+  top: 0;
+  left: 0;
+  right: 0;
+  bottom: 0;
+  z-index: -1;
+}
+
+.parallax img {
+  display: none;
+  position: absolute;
+  left: 50%;
+  bottom: 0;
+  min-width: 100%;
+  min-height: 100%;
+  -webkit-transform: translate3d(0, 0, 0);
+  transform: translate3d(0, 0, 0);
+  -webkit-transform: translateX(-50%);
+          transform: translateX(-50%);
+}
+
+.pin-top, .pin-bottom {
+  position: relative;
+}
+
+.pinned {
+  position: fixed !important;
+}
+
+/*********************
+  Transition Classes
+**********************/
+ul.staggered-list li {
+  opacity: 0;
+}
+
+.fade-in {
+  opacity: 0;
+  -webkit-transform-origin: 0 50%;
+          transform-origin: 0 50%;
+}
+
+/*********************
+  Media Query Classes
+**********************/
+@media only screen and (max-width: 600px) {
+  .hide-on-small-only, .hide-on-small-and-down {
+    display: none !important;
+  }
+}
+
+@media only screen and (max-width: 992px) {
+  .hide-on-med-and-down {
+    display: none !important;
+  }
+}
+
+@media only screen and (min-width: 601px) {
+  .hide-on-med-and-up {
+    display: none !important;
+  }
+}
+
+@media only screen and (min-width: 600px) and (max-width: 992px) {
+  .hide-on-med-only {
+    display: none !important;
+  }
+}
+
+@media only screen and (min-width: 993px) {
+  .hide-on-large-only {
+    display: none !important;
+  }
+}
+
+@media only screen and (min-width: 993px) {
+  .show-on-large {
+    display: block !important;
+  }
+}
+
+@media only screen and (min-width: 600px) and (max-width: 992px) {
+  .show-on-medium {
+    display: block !important;
+  }
+}
+
+@media only screen and (max-width: 600px) {
+  .show-on-small {
+    display: block !important;
+  }
+}
+
+@media only screen and (min-width: 601px) {
+  .show-on-medium-and-up {
+    display: block !important;
+  }
+}
+
+@media only screen and (max-width: 992px) {
+  .show-on-medium-and-down {
+    display: block !important;
+  }
+}
+
+@media only screen and (max-width: 600px) {
+  .center-on-small-only {
+    text-align: center;
+  }
+}
+
+footer.page-footer {
+  padding-top: 20px;
+  background-color: #ee6e73;
+}
+
+footer.page-footer .footer-copyright {
+  overflow: hidden;
+  min-height: 50px;
+  display: -webkit-flex;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-align-items: center;
+      -ms-flex-align: center;
+          align-items: center;
+  padding: 10px 0px;
+  color: rgba(255, 255, 255, 0.8);
+  background-color: rgba(51, 51, 51, 0.08);
+}
+
+table, th, td {
+  border: none;
+}
+
+table {
+  width: 100%;
+  display: table;
+}
+
+table.bordered > thead > tr,
+table.bordered > tbody > tr {
+  border-bottom: 1px solid #d0d0d0;
+}
+
+table.striped > tbody > tr:nth-child(odd) {
+  background-color: #f2f2f2;
+}
+
+table.striped > tbody > tr > td {
+  border-radius: 0;
+}
+
+table.highlight > tbody > tr {
+  transition: background-color .25s ease;
+}
+
+table.highlight > tbody > tr:hover {
+  background-color: #f2f2f2;
+}
+
+table.centered thead tr th, table.centered tbody tr td {
+  text-align: center;
+}
+
+thead {
+  border-bottom: 1px solid #d0d0d0;
+}
+
+td, th {
+  padding: 15px 5px;
+  display: table-cell;
+  text-align: left;
+  vertical-align: middle;
+  border-radius: 2px;
+}
+
+@media only screen and (max-width: 992px) {
+  table.responsive-table {
+    width: 100%;
+    border-collapse: collapse;
+    border-spacing: 0;
+    display: block;
+    position: relative;
+    /* sort out borders */
+  }
+  table.responsive-table td:empty:before {
+    content: '\00a0';
+  }
+  table.responsive-table th,
+  table.responsive-table td {
+    margin: 0;
+    vertical-align: top;
+  }
+  table.responsive-table th {
+    text-align: left;
+  }
+  table.responsive-table thead {
+    display: block;
+    float: left;
+  }
+  table.responsive-table thead tr {
+    display: block;
+    padding: 0 10px 0 0;
+  }
+  table.responsive-table thead tr th::before {
+    content: "\00a0";
+  }
+  table.responsive-table tbody {
+    display: block;
+    width: auto;
+    position: relative;
+    overflow-x: auto;
+    white-space: nowrap;
+  }
+  table.responsive-table tbody tr {
+    display: inline-block;
+    vertical-align: top;
+  }
+  table.responsive-table th {
+    display: block;
+    text-align: right;
+  }
+  table.responsive-table td {
+    display: block;
+    min-height: 1.25em;
+    text-align: left;
+  }
+  table.responsive-table tr {
+    padding: 0 10px;
+  }
+  table.responsive-table thead {
+    border: 0;
+    border-right: 1px solid #d0d0d0;
+  }
+  table.responsive-table.bordered th {
+    border-bottom: 0;
+    border-left: 0;
+  }
+  table.responsive-table.bordered td {
+    border-left: 0;
+    border-right: 0;
+    border-bottom: 0;
+  }
+  table.responsive-table.bordered tr {
+    border: 0;
+  }
+  table.responsive-table.bordered tbody tr {
+    border-right: 1px solid #d0d0d0;
+  }
+}
+
+.collection {
+  margin: 0.5rem 0 1rem 0;
+  border: 1px solid #e0e0e0;
+  border-radius: 2px;
+  overflow: hidden;
+  position: relative;
+}
+
+.collection .collection-item {
+  background-color: #fff;
+  line-height: 1.5rem;
+  padding: 10px 20px;
+  margin: 0;
+  border-bottom: 1px solid #e0e0e0;
+}
+
+.collection .collection-item.avatar {
+  min-height: 84px;
+  padding-left: 72px;
+  position: relative;
+}
+
+.collection .collection-item.avatar .circle {
+  position: absolute;
+  width: 42px;
+  height: 42px;
+  overflow: hidden;
+  left: 15px;
+  display: inline-block;
+  vertical-align: middle;
+}
+
+.collection .collection-item.avatar i.circle {
+  font-size: 18px;
+  line-height: 42px;
+  color: #fff;
+  background-color: #999;
+  text-align: center;
+}
+
+.collection .collection-item.avatar .title {
+  font-size: 16px;
+}
+
+.collection .collection-item.avatar p {
+  margin: 0;
+}
+
+.collection .collection-item.avatar .secondary-content {
+  position: absolute;
+  top: 16px;
+  right: 16px;
+}
+
+.collection .collection-item:last-child {
+  border-bottom: none;
+}
+
+.collection .collection-item.active {
+  background-color: #26a69a;
+  color: #eafaf9;
+}
+
+.collection .collection-item.active .secondary-content {
+  color: #fff;
+}
+
+.collection a.collection-item {
+  display: block;
+  transition: .25s;
+  color: #26a69a;
+}
+
+.collection a.collection-item:not(.active):hover {
+  background-color: #ddd;
+}
+
+.collection.with-header .collection-header {
+  background-color: #fff;
+  border-bottom: 1px solid #e0e0e0;
+  padding: 10px 20px;
+}
+
+.collection.with-header .collection-item {
+  padding-left: 30px;
+}
+
+.collection.with-header .collection-item.avatar {
+  padding-left: 72px;
+}
+
+.secondary-content {
+  float: right;
+  color: #26a69a;
+}
+
+.collapsible .collection {
+  margin: 0;
+  border: none;
+}
+
+.video-container {
+  position: relative;
+  padding-bottom: 56.25%;
+  height: 0;
+  overflow: hidden;
+}
+
+.video-container iframe, .video-container object, .video-container embed {
+  position: absolute;
+  top: 0;
+  left: 0;
+  width: 100%;
+  height: 100%;
+}
+
+.progress {
+  position: relative;
+  height: 4px;
+  display: block;
+  width: 100%;
+  background-color: #acece6;
+  border-radius: 2px;
+  margin: 0.5rem 0 1rem 0;
+  overflow: hidden;
+}
+
+.progress .determinate {
+  position: absolute;
+  top: 0;
+  left: 0;
+  bottom: 0;
+  background-color: #26a69a;
+  transition: width .3s linear;
+}
+
+.progress .indeterminate {
+  background-color: #26a69a;
+}
+
+.progress .indeterminate:before {
+  content: '';
+  position: absolute;
+  background-color: inherit;
+  top: 0;
+  left: 0;
+  bottom: 0;
+  will-change: left, right;
+  -webkit-animation: indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite;
+          animation: indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite;
+}
+
+.progress .indeterminate:after {
+  content: '';
+  position: absolute;
+  background-color: inherit;
+  top: 0;
+  left: 0;
+  bottom: 0;
+  will-change: left, right;
+  -webkit-animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite;
+          animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite;
+  -webkit-animation-delay: 1.15s;
+          animation-delay: 1.15s;
+}
+
+@-webkit-keyframes indeterminate {
+  0% {
+    left: -35%;
+    right: 100%;
+  }
+  60% {
+    left: 100%;
+    right: -90%;
+  }
+  100% {
+    left: 100%;
+    right: -90%;
+  }
+}
+
+@keyframes indeterminate {
+  0% {
+    left: -35%;
+    right: 100%;
+  }
+  60% {
+    left: 100%;
+    right: -90%;
+  }
+  100% {
+    left: 100%;
+    right: -90%;
+  }
+}
+
+@-webkit-keyframes indeterminate-short {
+  0% {
+    left: -200%;
+    right: 100%;
+  }
+  60% {
+    left: 107%;
+    right: -8%;
+  }
+  100% {
+    left: 107%;
+    right: -8%;
+  }
+}
+
+@keyframes indeterminate-short {
+  0% {
+    left: -200%;
+    right: 100%;
+  }
+  60% {
+    left: 107%;
+    right: -8%;
+  }
+  100% {
+    left: 107%;
+    right: -8%;
+  }
+}
+
+/*******************
+  Utility Classes
+*******************/
+.hide {
+  display: none !important;
+}
+
+.left-align {
+  text-align: left;
+}
+
+.right-align {
+  text-align: right;
+}
+
+.center, .center-align {
+  text-align: center;
+}
+
+.left {
+  float: left !important;
+}
+
+.right {
+  float: right !important;
+}
+
+.no-select, input[type=range],
+input[type=range] + .thumb {
+  -webkit-touch-callout: none;
+  -webkit-user-select: none;
+  -moz-user-select: none;
+  -ms-user-select: none;
+  user-select: none;
+}
+
+.circle {
+  border-radius: 50%;
+}
+
+.center-block {
+  display: block;
+  margin-left: auto;
+  margin-right: auto;
+}
+
+.truncate {
+  display: block;
+  white-space: nowrap;
+  overflow: hidden;
+  text-overflow: ellipsis;
+}
+
+.no-padding {
+  padding: 0 !important;
+}
+
+span.badge {
+  min-width: 3rem;
+  padding: 0 6px;
+  margin-left: 14px;
+  text-align: center;
+  font-size: 1rem;
+  line-height: 22px;
+  height: 22px;
+  color: #757575;
+  float: right;
+  box-sizing: border-box;
+}
+
+span.badge.new {
+  font-weight: 300;
+  font-size: 0.8rem;
+  color: #fff;
+  background-color: #26a69a;
+  border-radius: 2px;
+}
+
+span.badge.new:after {
+  content: " new";
+}
+
+span.badge[data-badge-caption]::after {
+  content: " " attr(data-badge-caption);
+}
+
+nav ul a span.badge {
+  display: inline-block;
+  float: none;
+  margin-left: 4px;
+  line-height: 22px;
+  height: 22px;
+}
+
+.collection-item span.badge {
+  margin-top: calc(0.75rem - 11px);
+}
+
+.collapsible span.badge {
+  margin-top: calc(1.5rem - 11px);
+}
+
+.side-nav span.badge {
+  margin-top: calc(24px - 11px);
+}
+
+/* This is needed for some mobile phones to display the Google Icon font properly */
+.material-icons {
+  text-rendering: optimizeLegibility;
+  -webkit-font-feature-settings: 'liga';
+     -moz-font-feature-settings: 'liga';
+          font-feature-settings: 'liga';
+}
+
+.container {
+  margin: 0 auto;
+  max-width: 1280px;
+  width: 90%;
+}
+
+@media only screen and (min-width: 601px) {
+  .container {
+    width: 85%;
+  }
+}
+
+@media only screen and (min-width: 993px) {
+  .container {
+    width: 70%;
+  }
+}
+
+.container .row {
+  margin-left: -0.75rem;
+  margin-right: -0.75rem;
+}
+
+.section {
+  padding-top: 1rem;
+  padding-bottom: 1rem;
+}
+
+.section.no-pad {
+  padding: 0;
+}
+
+.section.no-pad-bot {
+  padding-bottom: 0;
+}
+
+.section.no-pad-top {
+  padding-top: 0;
+}
+
+.row {
+  margin-left: auto;
+  margin-right: auto;
+  margin-bottom: 20px;
+}
+
+.row:after {
+  content: "";
+  display: table;
+  clear: both;
+}
+
+.row .col {
+  float: left;
+  box-sizing: border-box;
+  padding: 0 0.75rem;
+  min-height: 1px;
+}
+
+.row .col[class*="push-"], .row .col[class*="pull-"] {
+  position: relative;
+}
+
+.row .col.s1 {
+  width: 8.3333333333%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s2 {
+  width: 16.6666666667%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s3 {
+  width: 25%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s4 {
+  width: 33.3333333333%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s5 {
+  width: 41.6666666667%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s6 {
+  width: 50%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s7 {
+  width: 58.3333333333%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s8 {
+  width: 66.6666666667%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s9 {
+  width: 75%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s10 {
+  width: 83.3333333333%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s11 {
+  width: 91.6666666667%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s12 {
+  width: 100%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.offset-s1 {
+  margin-left: 8.3333333333%;
+}
+
+.row .col.pull-s1 {
+  right: 8.3333333333%;
+}
+
+.row .col.push-s1 {
+  left: 8.3333333333%;
+}
+
+.row .col.offset-s2 {
+  margin-left: 16.6666666667%;
+}
+
+.row .col.pull-s2 {
+  right: 16.6666666667%;
+}
+
+.row .col.push-s2 {
+  left: 16.6666666667%;
+}
+
+.row .col.offset-s3 {
+  margin-left: 25%;
+}
+
+.row .col.pull-s3 {
+  right: 25%;
+}
+
+.row .col.push-s3 {
+  left: 25%;
+}
+
+.row .col.offset-s4 {
+  margin-left: 33.3333333333%;
+}
+
+.row .col.pull-s4 {
+  right: 33.3333333333%;
+}
+
+.row .col.push-s4 {
+  left: 33.3333333333%;
+}
+
+.row .col.offset-s5 {
+  margin-left: 41.6666666667%;
+}
+
+.row .col.pull-s5 {
+  right: 41.6666666667%;
+}
+
+.row .col.push-s5 {
+  left: 41.6666666667%;
+}
+
+.row .col.offset-s6 {
+  margin-left: 50%;
+}
+
+.row .col.pull-s6 {
+  right: 50%;
+}
+
+.row .col.push-s6 {
+  left: 50%;
+}
+
+.row .col.offset-s7 {
+  margin-left: 58.3333333333%;
+}
+
+.row .col.pull-s7 {
+  right: 58.3333333333%;
+}
+
+.row .col.push-s7 {
+  left: 58.3333333333%;
+}
+
+.row .col.offset-s8 {
+  margin-left: 66.6666666667%;
+}
+
+.row .col.pull-s8 {
+  right: 66.6666666667%;
+}
+
+.row .col.push-s8 {
+  left: 66.6666666667%;
+}
+
+.row .col.offset-s9 {
+  margin-left: 75%;
+}
+
+.row .col.pull-s9 {
+  right: 75%;
+}
+
+.row .col.push-s9 {
+  left: 75%;
+}
+
+.row .col.offset-s10 {
+  margin-left: 83.3333333333%;
+}
+
+.row .col.pull-s10 {
+  right: 83.3333333333%;
+}
+
+.row .col.push-s10 {
+  left: 83.3333333333%;
+}
+
+.row .col.offset-s11 {
+  margin-left: 91.6666666667%;
+}
+
+.row .col.pull-s11 {
+  right: 91.6666666667%;
+}
+
+.row .col.push-s11 {
+  left: 91.6666666667%;
+}
+
+.row .col.offset-s12 {
+  margin-left: 100%;
+}
+
+.row .col.pull-s12 {
+  right: 100%;
+}
+
+.row .col.push-s12 {
+  left: 100%;
+}
+
+@media only screen and (min-width: 601px) {
+  .row .col.m1 {
+    width: 8.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m2 {
+    width: 16.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m3 {
+    width: 25%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m4 {
+    width: 33.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m5 {
+    width: 41.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m6 {
+    width: 50%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m7 {
+    width: 58.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m8 {
+    width: 66.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m9 {
+    width: 75%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m10 {
+    width: 83.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m11 {
+    width: 91.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m12 {
+    width: 100%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.offset-m1 {
+    margin-left: 8.3333333333%;
+  }
+  .row .col.pull-m1 {
+    right: 8.3333333333%;
+  }
+  .row .col.push-m1 {
+    left: 8.3333333333%;
+  }
+  .row .col.offset-m2 {
+    margin-left: 16.6666666667%;
+  }
+  .row .col.pull-m2 {
+    right: 16.6666666667%;
+  }
+  .row .col.push-m2 {
+    left: 16.6666666667%;
+  }
+  .row .col.offset-m3 {
+    margin-left: 25%;
+  }
+  .row .col.pull-m3 {
+    right: 25%;
+  }
+  .row .col.push-m3 {
+    left: 25%;
+  }
+  .row .col.offset-m4 {
+    margin-left: 33.3333333333%;
+  }
+  .row .col.pull-m4 {
+    right: 33.3333333333%;
+  }
+  .row .col.push-m4 {
+    left: 33.3333333333%;
+  }
+  .row .col.offset-m5 {
+    margin-left: 41.6666666667%;
+  }
+  .row .col.pull-m5 {
+    right: 41.6666666667%;
+  }
+  .row .col.push-m5 {
+    left: 41.6666666667%;
+  }
+  .row .col.offset-m6 {
+    margin-left: 50%;
+  }
+  .row .col.pull-m6 {
+    right: 50%;
+  }
+  .row .col.push-m6 {
+    left: 50%;
+  }
+  .row .col.offset-m7 {
+    margin-left: 58.3333333333%;
+  }
+  .row .col.pull-m7 {
+    right: 58.3333333333%;
+  }
+  .row .col.push-m7 {
+    left: 58.3333333333%;
+  }
+  .row .col.offset-m8 {
+    margin-left: 66.6666666667%;
+  }
+  .row .col.pull-m8 {
+    right: 66.6666666667%;
+  }
+  .row .col.push-m8 {
+    left: 66.6666666667%;
+  }
+  .row .col.offset-m9 {
+    margin-left: 75%;
+  }
+  .row .col.pull-m9 {
+    right: 75%;
+  }
+  .row .col.push-m9 {
+    left: 75%;
+  }
+  .row .col.offset-m10 {
+    margin-left: 83.3333333333%;
+  }
+  .row .col.pull-m10 {
+    right: 83.3333333333%;
+  }
+  .row .col.push-m10 {
+    left: 83.3333333333%;
+  }
+  .row .col.offset-m11 {
+    margin-left: 91.6666666667%;
+  }
+  .row .col.pull-m11 {
+    right: 91.6666666667%;
+  }
+  .row .col.push-m11 {
+    left: 91.6666666667%;
+  }
+  .row .col.offset-m12 {
+    margin-left: 100%;
+  }
+  .row .col.pull-m12 {
+    right: 100%;
+  }
+  .row .col.push-m12 {
+    left: 100%;
+  }
+}
+
+@media only screen and (min-width: 993px) {
+  .row .col.l1 {
+    width: 8.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l2 {
+    width: 16.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l3 {
+    width: 25%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l4 {
+    width: 33.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l5 {
+    width: 41.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l6 {
+    width: 50%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l7 {
+    width: 58.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l8 {
+    width: 66.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l9 {
+    width: 75%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l10 {
+    width: 83.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l11 {
+    width: 91.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l12 {
+    width: 100%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.offset-l1 {
+    margin-left: 8.3333333333%;
+  }
+  .row .col.pull-l1 {
+    right: 8.3333333333%;
+  }
+  .row .col.push-l1 {
+    left: 8.3333333333%;
+  }
+  .row .col.offset-l2 {
+    margin-left: 16.6666666667%;
+  }
+  .row .col.pull-l2 {
+    right: 16.6666666667%;
+  }
+  .row .col.push-l2 {
+    left: 16.6666666667%;
+  }
+  .row .col.offset-l3 {
+    margin-left: 25%;
+  }
+  .row .col.pull-l3 {
+    right: 25%;
+  }
+  .row .col.push-l3 {
+    left: 25%;
+  }
+  .row .col.offset-l4 {
+    margin-left: 33.3333333333%;
+  }
+  .row .col.pull-l4 {
+    right: 33.3333333333%;
+  }
+  .row .col.push-l4 {
+    left: 33.3333333333%;
+  }
+  .row .col.offset-l5 {
+    margin-left: 41.6666666667%;
+  }
+  .row .col.pull-l5 {
+    right: 41.6666666667%;
+  }
+  .row .col.push-l5 {
+    left: 41.6666666667%;
+  }
+  .row .col.offset-l6 {
+    margin-left: 50%;
+  }
+  .row .col.pull-l6 {
+    right: 50%;
+  }
+  .row .col.push-l6 {
+    left: 50%;
+  }
+  .row .col.offset-l7 {
+    margin-left: 58.3333333333%;
+  }
+  .row .col.pull-l7 {
+    right: 58.3333333333%;
+  }
+  .row .col.push-l7 {
+    left: 58.3333333333%;
+  }
+  .row .col.offset-l8 {
+    margin-left: 66.6666666667%;
+  }
+  .row .col.pull-l8 {
+    right: 66.6666666667%;
+  }
+  .row .col.push-l8 {
+    left: 66.6666666667%;
+  }
+  .row .col.offset-l9 {
+    margin-left: 75%;
+  }
+  .row .col.pull-l9 {
+    right: 75%;
+  }
+  .row .col.push-l9 {
+    left: 75%;
+  }
+  .row .col.offset-l10 {
+    margin-left: 83.3333333333%;
+  }
+  .row .col.pull-l10 {
+    right: 83.3333333333%;
+  }
+  .row .col.push-l10 {
+    left: 83.3333333333%;
+  }
+  .row .col.offset-l11 {
+    margin-left: 91.6666666667%;
+  }
+  .row .col.pull-l11 {
+    right: 91.6666666667%;
+  }
+  .row .col.push-l11 {
+    left: 91.6666666667%;
+  }
+  .row .col.offset-l12 {
+    margin-left: 100%;
+  }
+  .row .col.pull-l12 {
+    right: 100%;
+  }
+  .row .col.push-l12 {
+    left: 100%;
+  }
+}
+
+nav {
+  color: #fff;
+  background-color: #ee6e73;
+  width: 100%;
+  height: 56px;
+  line-height: 56px;
+}
+
+nav.nav-extended {
+  height: auto;
+}
+
+nav.nav-extended .nav-wrapper {
+  min-height: 56px;
+  height: auto;
+}
+
+nav.nav-extended .nav-content {
+  position: relative;
+  line-height: normal;
+}
+
+nav a {
+  color: #fff;
+}
+
+nav i,
+nav [class^="mdi-"], nav [class*="mdi-"],
+nav i.material-icons {
+  display: block;
+  font-size: 24px;
+  height: 56px;
+  line-height: 56px;
+}
+
+nav .nav-wrapper {
+  position: relative;
+  height: 100%;
+}
+
+@media only screen and (min-width: 993px) {
+  nav a.button-collapse {
+    display: none;
+  }
+}
+
+nav .button-collapse {
+  float: left;
+  position: relative;
+  z-index: 1;
+  height: 56px;
+  margin: 0 18px;
+}
+
+nav .button-collapse i {
+  height: 56px;
+  line-height: 56px;
+}
+
+nav .brand-logo {
+  position: absolute;
+  color: #fff;
+  display: inline-block;
+  font-size: 2.1rem;
+  padding: 0;
+  white-space: nowrap;
+}
+
+nav .brand-logo.center {
+  left: 50%;
+  -webkit-transform: translateX(-50%);
+          transform: translateX(-50%);
+}
+
+@media only screen and (max-width: 992px) {
+  nav .brand-logo {
+    left: 50%;
+    -webkit-transform: translateX(-50%);
+            transform: translateX(-50%);
+  }
+  nav .brand-logo.left, nav .brand-logo.right {
+    padding: 0;
+    -webkit-transform: none;
+            transform: none;
+  }
+  nav .brand-logo.left {
+    left: 0.5rem;
+  }
+  nav .brand-logo.right {
+    right: 0.5rem;
+    left: auto;
+  }
+}
+
+nav .brand-logo.right {
+  right: 0.5rem;
+  padding: 0;
+}
+
+nav .brand-logo i,
+nav .brand-logo [class^="mdi-"], nav .brand-logo [class*="mdi-"],
+nav .brand-logo i.material-icons {
+  float: left;
+  margin-right: 15px;
+}
+
+nav .nav-title {
+  display: inline-block;
+  font-size: 32px;
+  padding: 28px 0;
+}
+
+nav ul {
+  margin: 0;
+}
+
+nav ul li {
+  transition: background-color .3s;
+  float: left;
+  padding: 0;
+}
+
+nav ul li.active {
+  background-color: rgba(0, 0, 0, 0.1);
+}
+
+nav ul a {
+  transition: background-color .3s;
+  font-size: 1rem;
+  color: #fff;
+  display: block;
+  padding: 0 15px;
+  cursor: pointer;
+}
+
+nav ul a.btn, nav ul a.btn-large, nav ul a.btn-large, nav ul a.btn-flat, nav ul a.btn-floating {
+  margin-top: -2px;
+  margin-left: 15px;
+  margin-right: 15px;
+}
+
+nav ul a.btn > .material-icons, nav ul a.btn-large > .material-icons, nav ul a.btn-large > .material-icons, nav ul a.btn-flat > .material-icons, nav ul a.btn-floating > .material-icons {
+  height: inherit;
+  line-height: inherit;
+}
+
+nav ul a:hover {
+  background-color: rgba(0, 0, 0, 0.1);
+}
+
+nav ul.left {
+  float: left;
+}
+
+nav form {
+  height: 100%;
+}
+
+nav .input-field {
+  margin: 0;
+  height: 100%;
+}
+
+nav .input-field input {
+  height: 100%;
+  font-size: 1.2rem;
+  border: none;
+  padding-left: 2rem;
+}
+
+nav .input-field input:focus, nav .input-field input[type=text]:valid, nav .input-field input[type=password]:valid, nav .input-field input[type=email]:valid, nav .input-field input[type=url]:valid, nav .input-field input[type=date]:valid {
+  border: none;
+  box-shadow: none;
+}
+
+nav .input-field label {
+  top: 0;
+  left: 0;
+}
+
+nav .input-field label i {
+  color: rgba(255, 255, 255, 0.7);
+  transition: color .3s;
+}
+
+nav .input-field label.active i {
+  color: #fff;
+}
+
+.navbar-fixed {
+  position: relative;
+  height: 56px;
+  z-index: 997;
+}
+
+.navbar-fixed nav {
+  position: fixed;
+}
+
+@media only screen and (min-width: 601px) {
+  nav.nav-extended .nav-wrapper {
+    min-height: 64px;
+  }
+  nav, nav .nav-wrapper i, nav a.button-collapse, nav a.button-collapse i {
+    height: 64px;
+    line-height: 64px;
+  }
+  .navbar-fixed {
+    height: 64px;
+  }
+}
+
+@font-face {
+  font-family: "Roboto";
+  src: local(Roboto Thin), url("../fonts/roboto/Roboto-Thin.eot");
+  src: url("../fonts/roboto/Roboto-Thin.eot?#iefix") format("embedded-opentype"), url("../fonts/roboto/Roboto-Thin.woff2") format("woff2"), url("../fonts/roboto/Roboto-Thin.woff") format("woff"), url("../fonts/roboto/Roboto-Thin.ttf") format("truetype");
+  font-weight: 200;
+}
+
+@font-face {
+  font-family: "Roboto";
+  src: local(Roboto Light), url("../fonts/roboto/Roboto-Light.eot");
+  src: url("../fonts/roboto/Roboto-Light.eot?#iefix") format("embedded-opentype"), url("../fonts/roboto/Roboto-Light.woff2") format("woff2"), url("../fonts/roboto/Roboto-Light.woff") format("woff"), url("../fonts/roboto/Roboto-Light.ttf") format("truetype");
+  font-weight: 300;
+}
+
+@font-face {
+  font-family: "Roboto";
+  src: local(Roboto Regular), url("../fonts/roboto/Roboto-Regular.eot");
+  src: url("../fonts/roboto/Roboto-Regular.eot?#iefix") format("embedded-opentype"), url("../fonts/roboto/Roboto-Regular.woff2") format("woff2"), url("../fonts/roboto/Roboto-Regular.woff") format("woff"), url("../fonts/roboto/Roboto-Regular.ttf") format("truetype");
+  font-weight: 400;
+}
+
+@font-face {
+  font-family: "Roboto";
+  src: url("../fonts/roboto/Roboto-Medium.eot");
+  src: url("../fonts/roboto/Roboto-Medium.eot?#iefix") format("embedded-opentype"), url("../fonts/roboto/Roboto-Medium.woff2") format("woff2"), url("../fonts/roboto/Roboto-Medium.woff") format("woff"), url("../fonts/roboto/Roboto-Medium.ttf") format("truetype");
+  font-weight: 500;
+}
+
+@font-face {
+  font-family: "Roboto";
+  src: url("../fonts/roboto/Roboto-Bold.eot");
+  src: url("../fonts/roboto/Roboto-Bold.eot?#iefix") format("embedded-opentype"), url("../fonts/roboto/Roboto-Bold.woff2") format("woff2"), url("../fonts/roboto/Roboto-Bold.woff") format("woff"), url("../fonts/roboto/Roboto-Bold.ttf") format("truetype");
+  font-weight: 700;
+}
+
+a {
+  text-decoration: none;
+}
+
+html {
+  line-height: 1.5;
+  font-family: "Roboto", sans-serif;
+  font-weight: normal;
+  color: rgba(0, 0, 0, 0.87);
+}
+
+@media only screen and (min-width: 0) {
+  html {
+    font-size: 14px;
+  }
+}
+
+@media only screen and (min-width: 992px) {
+  html {
+    font-size: 14.5px;
+  }
+}
+
+@media only screen and (min-width: 1200px) {
+  html {
+    font-size: 15px;
+  }
+}
+
+h1, h2, h3, h4, h5, h6 {
+  font-weight: 400;
+  line-height: 1.1;
+}
+
+h1 a, h2 a, h3 a, h4 a, h5 a, h6 a {
+  font-weight: inherit;
+}
+
+h1 {
+  font-size: 4.2rem;
+  line-height: 110%;
+  margin: 2.1rem 0 1.68rem 0;
+}
+
+h2 {
+  font-size: 3.56rem;
+  line-height: 110%;
+  margin: 1.78rem 0 1.424rem 0;
+}
+
+h3 {
+  font-size: 2.92rem;
+  line-height: 110%;
+  margin: 1.46rem 0 1.168rem 0;
+}
+
+h4 {
+  font-size: 2.28rem;
+  line-height: 110%;
+  margin: 1.14rem 0 0.912rem 0;
+}
+
+h5 {
+  font-size: 1.64rem;
+  line-height: 110%;
+  margin: 0.82rem 0 0.656rem 0;
+}
+
+h6 {
+  font-size: 1rem;
+  line-height: 110%;
+  margin: 0.5rem 0 0.4rem 0;
+}
+
+em {
+  font-style: italic;
+}
+
+strong {
+  font-weight: 500;
+}
+
+small {
+  font-size: 75%;
+}
+
+.light, footer.page-footer .footer-copyright {
+  font-weight: 300;
+}
+
+.thin {
+  font-weight: 200;
+}
+
+.flow-text {
+  font-weight: 300;
+}
+
+@media only screen and (min-width: 360px) {
+  .flow-text {
+    font-size: 1.2rem;
+  }
+}
+
+@media only screen and (min-width: 390px) {
+  .flow-text {
+    font-size: 1.224rem;
+  }
+}
+
+@media only screen and (min-width: 420px) {
+  .flow-text {
+    font-size: 1.248rem;
+  }
+}
+
+@media only screen and (min-width: 450px) {
+  .flow-text {
+    font-size: 1.272rem;
+  }
+}
+
+@media only screen and (min-width: 480px) {
+  .flow-text {
+    font-size: 1.296rem;
+  }
+}
+
+@media only screen and (min-width: 510px) {
+  .flow-text {
+    font-size: 1.32rem;
+  }
+}
+
+@media only screen and (min-width: 540px) {
+  .flow-text {
+    font-size: 1.344rem;
+  }
+}
+
+@media only screen and (min-width: 570px) {
+  .flow-text {
+    font-size: 1.368rem;
+  }
+}
+
+@media only screen and (min-width: 600px) {
+  .flow-text {
+    font-size: 1.392rem;
+  }
+}
+
+@media only screen and (min-width: 630px) {
+  .flow-text {
+    font-size: 1.416rem;
+  }
+}
+
+@media only screen and (min-width: 660px) {
+  .flow-text {
+    font-size: 1.44rem;
+  }
+}
+
+@media only screen and (min-width: 690px) {
+  .flow-text {
+    font-size: 1.464rem;
+  }
+}
+
+@media only screen and (min-width: 720px) {
+  .flow-text {
+    font-size: 1.488rem;
+  }
+}
+
+@media only screen and (min-width: 750px) {
+  .flow-text {
+    font-size: 1.512rem;
+  }
+}
+
+@media only screen and (min-width: 780px) {
+  .flow-text {
+    font-size: 1.536rem;
+  }
+}
+
+@media only screen and (min-width: 810px) {
+  .flow-text {
+    font-size: 1.56rem;
+  }
+}
+
+@media only screen and (min-width: 840px) {
+  .flow-text {
+    font-size: 1.584rem;
+  }
+}
+
+@media only screen and (min-width: 870px) {
+  .flow-text {
+    font-size: 1.608rem;
+  }
+}
+
+@media only screen and (min-width: 900px) {
+  .flow-text {
+    font-size: 1.632rem;
+  }
+}
+
+@media only screen and (min-width: 930px) {
+  .flow-text {
+    font-size: 1.656rem;
+  }
+}
+
+@media only screen and (min-width: 960px) {
+  .flow-text {
+    font-size: 1.68rem;
+  }
+}
+
+@media only screen and (max-width: 360px) {
+  .flow-text {
+    font-size: 1.2rem;
+  }
+}
+
+.scale-transition {
+  transition: -webkit-transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important;
+  transition: transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important;
+  transition: transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63), -webkit-transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important;
+}
+
+.scale-transition.scale-out {
+  -webkit-transform: scale(0);
+          transform: scale(0);
+  transition: -webkit-transform .2s !important;
+  transition: transform .2s !important;
+  transition: transform .2s, -webkit-transform .2s !important;
+}
+
+.scale-transition.scale-in {
+  -webkit-transform: scale(1);
+          transform: scale(1);
+}
+
+.card-panel {
+  transition: box-shadow .25s;
+  padding: 24px;
+  margin: 0.5rem 0 1rem 0;
+  border-radius: 2px;
+  background-color: #fff;
+}
+
+.card {
+  position: relative;
+  margin: 0.5rem 0 1rem 0;
+  background-color: #fff;
+  transition: box-shadow .25s;
+  border-radius: 2px;
+}
+
+.card .card-title {
+  font-size: 24px;
+  font-weight: 300;
+}
+
+.card .card-title.activator {
+  cursor: pointer;
+}
+
+.card.small, .card.medium, .card.large {
+  position: relative;
+}
+
+.card.small .card-image, .card.medium .card-image, .card.large .card-image {
+  max-height: 60%;
+  overflow: hidden;
+}
+
+.card.small .card-image + .card-content, .card.medium .card-image + .card-content, .card.large .card-image + .card-content {
+  max-height: 40%;
+}
+
+.card.small .card-content, .card.medium .card-content, .card.large .card-content {
+  max-height: 100%;
+  overflow: hidden;
+}
+
+.card.small .card-action, .card.medium .card-action, .card.large .card-action {
+  position: absolute;
+  bottom: 0;
+  left: 0;
+  right: 0;
+}
+
+.card.small {
+  height: 300px;
+}
+
+.card.medium {
+  height: 400px;
+}
+
+.card.large {
+  height: 500px;
+}
+
+.card.horizontal {
+  display: -webkit-flex;
+  display: -ms-flexbox;
+  display: flex;
+}
+
+.card.horizontal.small .card-image, .card.horizontal.medium .card-image, .card.horizontal.large .card-image {
+  height: 100%;
+  max-height: none;
+  overflow: visible;
+}
+
+.card.horizontal.small .card-image img, .card.horizontal.medium .card-image img, .card.horizontal.large .card-image img {
+  height: 100%;
+}
+
+.card.horizontal .card-image {
+  max-width: 50%;
+}
+
+.card.horizontal .card-image img {
+  border-radius: 2px 0 0 2px;
+  max-width: 100%;
+  width: auto;
+}
+
+.card.horizontal .card-stacked {
+  display: -webkit-flex;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-flex-direction: column;
+      -ms-flex-direction: column;
+          flex-direction: column;
+  -webkit-flex: 1;
+      -ms-flex: 1;
+          flex: 1;
+  position: relative;
+}
+
+.card.horizontal .card-stacked .card-content {
+  -webkit-flex-grow: 1;
+      -ms-flex-positive: 1;
+          flex-grow: 1;
+}
+
+.card.sticky-action .card-action {
+  z-index: 2;
+}
+
+.card.sticky-action .card-reveal {
+  z-index: 1;
+  padding-bottom: 64px;
+}
+
+.card .card-image {
+  position: relative;
+}
+
+.card .card-image img {
+  display: block;
+  border-radius: 2px 2px 0 0;
+  position: relative;
+  left: 0;
+  right: 0;
+  top: 0;
+  bottom: 0;
+  width: 100%;
+}
+
+.card .card-image .card-title {
+  color: #fff;
+  position: absolute;
+  bottom: 0;
+  left: 0;
+  max-width: 100%;
+  padding: 24px;
+}
+
+.card .card-content {
+  padding: 24px;
+  border-radius: 0 0 2px 2px;
+}
+
+.card .card-content p {
+  margin: 0;
+  color: inherit;
+}
+
+.card .card-content .card-title {
+  display: block;
+  line-height: 32px;
+  margin-bottom: 8px;
+}
+
+.card .card-content .card-title i {
+  line-height: 32px;
+}
+
+.card .card-action {
+  position: relative;
+  background-color: inherit;
+  border-top: 1px solid rgba(160, 160, 160, 0.2);
+  padding: 16px 24px;
+}
+
+.card .card-action a:not(.btn):not(.btn-large):not(.btn-large):not(.btn-floating) {
+  color: #ffab40;
+  margin-right: 24px;
+  transition: color .3s ease;
+  text-transform: uppercase;
+}
+
+.card .card-action a:not(.btn):not(.btn-large):not(.btn-large):not(.btn-floating):hover {
+  color: #ffd8a6;
+}
+
+.card .card-reveal {
+  padding: 24px;
+  position: absolute;
+  background-color: #fff;
+  width: 100%;
+  overflow-y: auto;
+  left: 0;
+  top: 100%;
+  height: 100%;
+  z-index: 3;
+  display: none;
+}
+
+.card .card-reveal .card-title {
+  cursor: pointer;
+  display: block;
+}
+
+#toast-container {
+  display: block;
+  position: fixed;
+  z-index: 10000;
+}
+
+@media only screen and (max-width: 600px) {
+  #toast-container {
+    min-width: 100%;
+    bottom: 0%;
+  }
+}
+
+@media only screen and (min-width: 601px) and (max-width: 992px) {
+  #toast-container {
+    left: 5%;
+    bottom: 7%;
+    max-width: 90%;
+  }
+}
+
+@media only screen and (min-width: 993px) {
+  #toast-container {
+    top: 10%;
+    right: 7%;
+    max-width: 86%;
+  }
+}
+
+.toast {
+  border-radius: 2px;
+  top: 35px;
+  width: auto;
+  clear: both;
+  margin-top: 10px;
+  position: relative;
+  max-width: 100%;
+  height: auto;
+  min-height: 48px;
+  line-height: 1.5em;
+  word-break: break-all;
+  background-color: #323232;
+  padding: 10px 25px;
+  font-size: 1.1rem;
+  font-weight: 300;
+  color: #fff;
+  display: -webkit-flex;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-align-items: center;
+      -ms-flex-align: center;
+          align-items: center;
+  -webkit-justify-content: space-between;
+      -ms-flex-pack: justify;
+          justify-content: space-between;
+}
+
+.toast .btn, .toast .btn-large, .toast .btn-flat {
+  margin: 0;
+  margin-left: 3rem;
+}
+
+.toast.rounded {
+  border-radius: 24px;
+}
+
+@media only screen and (max-width: 600px) {
+  .toast {
+    width: 100%;
+    border-radius: 0;
+  }
+}
+
+@media only screen and (min-width: 601px) and (max-width: 992px) {
+  .toast {
+    float: left;
+  }
+}
+
+@media only screen and (min-width: 993px) {
+  .toast {
+    float: right;
+  }
+}
+
+.tabs {
+  position: relative;
+  overflow-x: auto;
+  overflow-y: hidden;
+  height: 48px;
+  width: 100%;
+  background-color: #fff;
+  margin: 0 auto;
+  white-space: nowrap;
+}
+
+.tabs.tabs-transparent {
+  background-color: transparent;
+}
+
+.tabs.tabs-transparent .tab a,
+.tabs.tabs-transparent .tab.disabled a,
+.tabs.tabs-transparent .tab.disabled a:hover {
+  color: rgba(255, 255, 255, 0.7);
+}
+
+.tabs.tabs-transparent .tab a:hover,
+.tabs.tabs-transparent .tab a.active {
+  color: #fff;
+}
+
+.tabs.tabs-transparent .indicator {
+  background-color: #fff;
+}
+
+.tabs.tabs-fixed-width {
+  display: -webkit-flex;
+  display: -ms-flexbox;
+  display: flex;
+}
+
+.tabs.tabs-fixed-width .tab {
+  -webkit-flex-grow: 1;
+  -ms-flex-positive: 1;
+  flex-grow: 1;
+}
+
+.tabs .tab {
+  display: inline-block;
+  text-align: center;
+  line-height: 48px;
+  height: 48px;
+  padding: 0;
+  margin: 0;
+  text-transform: uppercase;
+}
+
+.tabs .tab a {
+  color: rgba(238, 110, 115, 0.7);
+  display: block;
+  width: 100%;
+  height: 100%;
+  padding: 0 24px;
+  font-size: 14px;
+  text-overflow: ellipsis;
+  overflow: hidden;
+  transition: color .28s ease;
+}
+
+.tabs .tab a:hover, .tabs .tab a.active {
+  background-color: transparent;
+  color: #ee6e73;
+}
+
+.tabs .tab.disabled a,
+.tabs .tab.disabled a:hover {
+  color: rgba(238, 110, 115, 0.7);
+  cursor: default;
+}
+
+.tabs .indicator {
+  position: absolute;
+  bottom: 0;
+  height: 2px;
+  background-color: #f6b2b5;
+  will-change: left, right;
+}
+
+@media only screen and (max-width: 992px) {
+  .tabs {
+    display: -webkit-flex;
+    display: -ms-flexbox;
+    display: flex;
+  }
+  .tabs .tab {
+    -webkit-flex-grow: 1;
+    -ms-flex-positive: 1;
+    flex-grow: 1;
+  }
+  .tabs .tab a {
+    padding: 0 12px;
+  }
+}
+
+.material-tooltip {
+  padding: 10px 8px;
+  font-size: 1rem;
+  z-index: 2000;
+  background-color: transparent;
+  border-radius: 2px;
+  color: #fff;
+  min-height: 36px;
+  line-height: 120%;
+  opacity: 0;
+  position: absolute;
+  text-align: center;
+  max-width: calc(100% - 4px);
+  overflow: hidden;
+  left: 0;
+  top: 0;
+  pointer-events: none;
+  visibility: hidden;
+}
+
+.backdrop {
+  position: absolute;
+  opacity: 0;
+  height: 7px;
+  width: 14px;
+  border-radius: 0 0 50% 50%;
+  background-color: #323232;
+  z-index: -1;
+  -webkit-transform-origin: 50% 0%;
+          transform-origin: 50% 0%;
+  visibility: hidden;
+}
+
+.btn, .btn-large,
+.btn-flat {
+  border: none;
+  border-radius: 2px;
+  display: inline-block;
+  height: 36px;
+  line-height: 36px;
+  padding: 0 2rem;
+  text-transform: uppercase;
+  vertical-align: middle;
+  -webkit-tap-highlight-color: transparent;
+}
+
+.btn.disabled, .disabled.btn-large,
+.btn-floating.disabled,
+.btn-large.disabled,
+.btn-flat.disabled,
+.btn:disabled,
+.btn-large:disabled,
+.btn-floating:disabled,
+.btn-large:disabled,
+.btn-flat:disabled,
+.btn[disabled],
+[disabled].btn-large,
+.btn-floating[disabled],
+.btn-large[disabled],
+.btn-flat[disabled] {
+  pointer-events: none;
+  background-color: #DFDFDF !important;
+  box-shadow: none;
+  color: #9F9F9F !important;
+  cursor: default;
+}
+
+.btn.disabled:hover, .disabled.btn-large:hover,
+.btn-floating.disabled:hover,
+.btn-large.disabled:hover,
+.btn-flat.disabled:hover,
+.btn:disabled:hover,
+.btn-large:disabled:hover,
+.btn-floating:disabled:hover,
+.btn-large:disabled:hover,
+.btn-flat:disabled:hover,
+.btn[disabled]:hover,
+[disabled].btn-large:hover,
+.btn-floating[disabled]:hover,
+.btn-large[disabled]:hover,
+.btn-flat[disabled]:hover {
+  background-color: #DFDFDF !important;
+  color: #9F9F9F !important;
+}
+
+.btn, .btn-large,
+.btn-floating,
+.btn-large,
+.btn-flat {
+  outline: 0;
+}
+
+.btn i, .btn-large i,
+.btn-floating i,
+.btn-large i,
+.btn-flat i {
+  font-size: 1.3rem;
+  line-height: inherit;
+}
+
+.btn:focus, .btn-large:focus,
+.btn-floating:focus {
+  background-color: #1d7d74;
+}
+
+.btn, .btn-large {
+  text-decoration: none;
+  color: #fff;
+  background-color: #26a69a;
+  text-align: center;
+  letter-spacing: .5px;
+  transition: .2s ease-out;
+  cursor: pointer;
+}
+
+.btn:hover, .btn-large:hover {
+  background-color: #2bbbad;
+}
+
+.btn-floating {
+  display: inline-block;
+  color: #fff;
+  position: relative;
+  overflow: hidden;
+  z-index: 1;
+  width: 40px;
+  height: 40px;
+  line-height: 40px;
+  padding: 0;
+  background-color: #26a69a;
+  border-radius: 50%;
+  transition: .3s;
+  cursor: pointer;
+  vertical-align: middle;
+}
+
+.btn-floating:hover {
+  background-color: #26a69a;
+}
+
+.btn-floating:before {
+  border-radius: 0;
+}
+
+.btn-floating.btn-large {
+  width: 56px;
+  height: 56px;
+}
+
+.btn-floating.btn-large i {
+  line-height: 56px;
+}
+
+.btn-floating.halfway-fab {
+  position: absolute;
+  right: 24px;
+  bottom: 0;
+  -webkit-transform: translateY(50%);
+          transform: translateY(50%);
+}
+
+.btn-floating.halfway-fab.left {
+  right: auto;
+  left: 24px;
+}
+
+.btn-floating i {
+  width: inherit;
+  display: inline-block;
+  text-align: center;
+  color: #fff;
+  font-size: 1.6rem;
+  line-height: 40px;
+}
+
+button.btn-floating {
+  border: none;
+}
+
+.fixed-action-btn {
+  position: fixed;
+  right: 23px;
+  bottom: 23px;
+  padding-top: 15px;
+  margin-bottom: 0;
+  z-index: 998;
+}
+
+.fixed-action-btn.active ul {
+  visibility: visible;
+}
+
+.fixed-action-btn.horizontal {
+  padding: 0 0 0 15px;
+}
+
+.fixed-action-btn.horizontal ul {
+  text-align: right;
+  right: 64px;
+  top: 50%;
+  -webkit-transform: translateY(-50%);
+          transform: translateY(-50%);
+  height: 100%;
+  left: auto;
+  width: 500px;
+  /*width 100% only goes to width of button container */
+}
+
+.fixed-action-btn.horizontal ul li {
+  display: inline-block;
+  margin: 15px 15px 0 0;
+}
+
+.fixed-action-btn.toolbar {
+  padding: 0;
+  height: 56px;
+}
+
+.fixed-action-btn.toolbar.active > a i {
+  opacity: 0;
+}
+
+.fixed-action-btn.toolbar ul {
+  display: -webkit-flex;
+  display: -ms-flexbox;
+  display: flex;
+  top: 0;
+  bottom: 0;
+}
+
+.fixed-action-btn.toolbar ul li {
+  -webkit-flex: 1;
+      -ms-flex: 1;
+          flex: 1;
+  display: inline-block;
+  margin: 0;
+  height: 100%;
+  transition: none;
+}
+
+.fixed-action-btn.toolbar ul li a {
+  display: block;
+  overflow: hidden;
+  position: relative;
+  width: 100%;
+  height: 100%;
+  background-color: transparent;
+  box-shadow: none;
+  color: #fff;
+  line-height: 56px;
+  z-index: 1;
+}
+
+.fixed-action-btn.toolbar ul li a i {
+  line-height: inherit;
+}
+
+.fixed-action-btn ul {
+  left: 0;
+  right: 0;
+  text-align: center;
+  position: absolute;
+  bottom: 64px;
+  margin: 0;
+  visibility: hidden;
+}
+
+.fixed-action-btn ul li {
+  margin-bottom: 15px;
+}
+
+.fixed-action-btn ul a.btn-floating {
+  opacity: 0;
+}
+
+.fixed-action-btn .fab-backdrop {
+  position: absolute;
+  top: 0;
+  left: 0;
+  z-index: -1;
+  width: 40px;
+  height: 40px;
+  background-color: #26a69a;
+  border-radius: 50%;
+  -webkit-transform: scale(0);
+          transform: scale(0);
+}
+
+.btn-flat {
+  box-shadow: none;
+  background-color: transparent;
+  color: #343434;
+  cursor: pointer;
+  transition: background-color .2s;
+}
+
+.btn-flat:focus, .btn-flat:active {
+  background-color: transparent;
+}
+
+.btn-flat:focus, .btn-flat:hover {
+  background-color: rgba(0, 0, 0, 0.1);
+  box-shadow: none;
+}
+
+.btn-flat:active {
+  background-color: rgba(0, 0, 0, 0.2);
+}
+
+.btn-flat.disabled {
+  background-color: transparent !important;
+  color: #b3b3b3 !important;
+  cursor: default;
+}
+
+.btn-large {
+  height: 54px;
+  line-height: 54px;
+}
+
+.btn-large i {
+  font-size: 1.6rem;
+}
+
+.btn-block {
+  display: block;
+}
+
+.dropdown-content {
+  background-color: #fff;
+  margin: 0;
+  display: none;
+  min-width: 100px;
+  max-height: 650px;
+  overflow-y: auto;
+  opacity: 0;
+  position: absolute;
+  z-index: 999;
+  will-change: width, height;
+}
+
+.dropdown-content li {
+  clear: both;
+  color: rgba(0, 0, 0, 0.87);
+  cursor: pointer;
+  min-height: 50px;
+  line-height: 1.5rem;
+  width: 100%;
+  text-align: left;
+  text-transform: none;
+}
+
+.dropdown-content li:hover, .dropdown-content li.active, .dropdown-content li.selected {
+  background-color: #eee;
+}
+
+.dropdown-content li.active.selected {
+  background-color: #e1e1e1;
+}
+
+.dropdown-content li.divider {
+  min-height: 0;
+  height: 1px;
+}
+
+.dropdown-content li > a, .dropdown-content li > span {
+  font-size: 16px;
+  color: #26a69a;
+  display: block;
+  line-height: 22px;
+  padding: 14px 16px;
+}
+
+.dropdown-content li > span > label {
+  top: 1px;
+  left: 0;
+  height: 18px;
+}
+
+.dropdown-content li > a > i {
+  height: inherit;
+  line-height: inherit;
+}
+
+.input-field.col .dropdown-content [type="checkbox"] + label {
+  top: 1px;
+  left: 0;
+  height: 18px;
+}
+
+/*!
+ * Waves v0.6.0
+ * http://fian.my.id/Waves
+ *
+ * Copyright 2014 Alfiana E. Sibuea and other contributors
+ * Released under the MIT license
+ * https://github.com/fians/Waves/blob/master/LICENSE
+ */
+.waves-effect {
+  position: relative;
+  cursor: pointer;
+  display: inline-block;
+  overflow: hidden;
+  -webkit-user-select: none;
+     -moz-user-select: none;
+      -ms-user-select: none;
+          user-select: none;
+  -webkit-tap-highlight-color: transparent;
+  vertical-align: middle;
+  z-index: 1;
+  transition: .3s ease-out;
+}
+
+.waves-effect .waves-ripple {
+  position: absolute;
+  border-radius: 50%;
+  width: 20px;
+  height: 20px;
+  margin-top: -10px;
+  margin-left: -10px;
+  opacity: 0;
+  background: rgba(0, 0, 0, 0.2);
+  transition: all 0.7s ease-out;
+  transition-property: opacity, -webkit-transform;
+  transition-property: transform, opacity;
+  transition-property: transform, opacity, -webkit-transform;
+  -webkit-transform: scale(0);
+          transform: scale(0);
+  pointer-events: none;
+}
+
+.waves-effect.waves-light .waves-ripple {
+  background-color: rgba(255, 255, 255, 0.45);
+}
+
+.waves-effect.waves-red .waves-ripple {
+  background-color: rgba(244, 67, 54, 0.7);
+}
+
+.waves-effect.waves-yellow .waves-ripple {
+  background-color: rgba(255, 235, 59, 0.7);
+}
+
+.waves-effect.waves-orange .waves-ripple {
+  background-color: rgba(255, 152, 0, 0.7);
+}
+
+.waves-effect.waves-purple .waves-ripple {
+  background-color: rgba(156, 39, 176, 0.7);
+}
+
+.waves-effect.waves-green .waves-ripple {
+  background-color: rgba(76, 175, 80, 0.7);
+}
+
+.waves-effect.waves-teal .waves-ripple {
+  background-color: rgba(0, 150, 136, 0.7);
+}
+
+.waves-effect input[type="button"], .waves-effect input[type="reset"], .waves-effect input[type="submit"] {
+  border: 0;
+  font-style: normal;
+  font-size: inherit;
+  text-transform: inherit;
+  background: none;
+}
+
+.waves-effect img {
+  position: relative;
+  z-index: -1;
+}
+
+.waves-notransition {
+  transition: none !important;
+}
+
+.waves-circle {
+  -webkit-transform: translateZ(0);
+          transform: translateZ(0);
+  -webkit-mask-image: -webkit-radial-gradient(circle, white 100%, black 100%);
+}
+
+.waves-input-wrapper {
+  border-radius: 0.2em;
+  vertical-align: bottom;
+}
+
+.waves-input-wrapper .waves-button-input {
+  position: relative;
+  top: 0;
+  left: 0;
+  z-index: 1;
+}
+
+.waves-circle {
+  text-align: center;
+  width: 2.5em;
+  height: 2.5em;
+  line-height: 2.5em;
+  border-radius: 50%;
+  -webkit-mask-image: none;
+}
+
+.waves-block {
+  display: block;
+}
+
+/* Firefox Bug: link not triggered */
+.waves-effect .waves-ripple {
+  z-index: -1;
+}
+
+.modal {
+  display: none;
+  position: fixed;
+  left: 0;
+  right: 0;
+  background-color: #fafafa;
+  padding: 0;
+  max-height: 70%;
+  width: 55%;
+  margin: auto;
+  overflow-y: auto;
+  border-radius: 2px;
+  will-change: top, opacity;
+}
+
+@media only screen and (max-width: 992px) {
+  .modal {
+    width: 80%;
+  }
+}
+
+.modal h1, .modal h2, .modal h3, .modal h4 {
+  margin-top: 0;
+}
+
+.modal .modal-content {
+  padding: 24px;
+}
+
+.modal .modal-close {
+  cursor: pointer;
+}
+
+.modal .modal-footer {
+  border-radius: 0 0 2px 2px;
+  background-color: #fafafa;
+  padding: 4px 6px;
+  height: 56px;
+  width: 100%;
+}
+
+.modal .modal-footer .btn, .modal .modal-footer .btn-large, .modal .modal-footer .btn-flat {
+  float: right;
+  margin: 6px 0;
+}
+
+.modal-overlay {
+  position: fixed;
+  z-index: 999;
+  top: -100px;
+  left: 0;
+  bottom: 0;
+  right: 0;
+  height: 125%;
+  width: 100%;
+  background: #000;
+  display: none;
+  will-change: opacity;
+}
+
+.modal.modal-fixed-footer {
+  padding: 0;
+  height: 70%;
+}
+
+.modal.modal-fixed-footer .modal-content {
+  position: absolute;
+  height: calc(100% - 56px);
+  max-height: 100%;
+  width: 100%;
+  overflow-y: auto;
+}
+
+.modal.modal-fixed-footer .modal-footer {
+  border-top: 1px solid rgba(0, 0, 0, 0.1);
+  position: absolute;
+  bottom: 0;
+}
+
+.modal.bottom-sheet {
+  top: auto;
+  bottom: -100%;
+  margin: 0;
+  width: 100%;
+  max-height: 45%;
+  border-radius: 0;
+  will-change: bottom, opacity;
+}
+
+.collapsible {
+  border-top: 1px solid #ddd;
+  border-right: 1px solid #ddd;
+  border-left: 1px solid #ddd;
+  margin: 0.5rem 0 1rem 0;
+}
+
+.collapsible-header {
+  display: block;
+  cursor: pointer;
+  min-height: 3rem;
+  line-height: 3rem;
+  padding: 0 1rem;
+  background-color: #fff;
+  border-bottom: 1px solid #ddd;
+}
+
+.collapsible-header i {
+  width: 2rem;
+  font-size: 1.6rem;
+  line-height: 3rem;
+  display: block;
+  float: left;
+  text-align: center;
+  margin-right: 1rem;
+}
+
+.collapsible-body {
+  display: none;
+  border-bottom: 1px solid #ddd;
+  box-sizing: border-box;
+  padding: 2rem;
+}
+
+.side-nav .collapsible,
+.side-nav.fixed .collapsible {
+  border: none;
+  box-shadow: none;
+}
+
+.side-nav .collapsible li,
+.side-nav.fixed .collapsible li {
+  padding: 0;
+}
+
+.side-nav .collapsible-header,
+.side-nav.fixed .collapsible-header {
+  background-color: transparent;
+  border: none;
+  line-height: inherit;
+  height: inherit;
+  padding: 0 16px;
+}
+
+.side-nav .collapsible-header:hover,
+.side-nav.fixed .collapsible-header:hover {
+  background-color: rgba(0, 0, 0, 0.05);
+}
+
+.side-nav .collapsible-header i,
+.side-nav.fixed .collapsible-header i {
+  line-height: inherit;
+}
+
+.side-nav .collapsible-body,
+.side-nav.fixed .collapsible-body {
+  border: 0;
+  background-color: #fff;
+}
+
+.side-nav .collapsible-body li a,
+.side-nav.fixed .collapsible-body li a {
+  padding: 0 23.5px 0 31px;
+}
+
+.collapsible.popout {
+  border: none;
+  box-shadow: none;
+}
+
+.collapsible.popout > li {
+  box-shadow: 0 2px 5px 0 rgba(0, 0, 0, 0.16), 0 2px 10px 0 rgba(0, 0, 0, 0.12);
+  margin: 0 24px;
+  transition: margin 0.35s cubic-bezier(0.25, 0.46, 0.45, 0.94);
+}
+
+.collapsible.popout > li.active {
+  box-shadow: 0 5px 11px 0 rgba(0, 0, 0, 0.18), 0 4px 15px 0 rgba(0, 0, 0, 0.15);
+  margin: 16px 0;
+}
+
+.chip {
+  display: inline-block;
+  height: 32px;
+  font-size: 13px;
+  font-weight: 500;
+  color: rgba(0, 0, 0, 0.6);
+  line-height: 32px;
+  padding: 0 12px;
+  border-radius: 16px;
+  background-color: #e4e4e4;
+  margin-bottom: 5px;
+  margin-right: 5px;
+}
+
+.chip img {
+  float: left;
+  margin: 0 8px 0 -12px;
+  height: 32px;
+  width: 32px;
+  border-radius: 50%;
+}
+
+.chip .close {
+  cursor: pointer;
+  float: right;
+  font-size: 16px;
+  line-height: 32px;
+  padding-left: 8px;
+}
+
+.chips {
+  border: none;
+  border-bottom: 1px solid #9e9e9e;
+  box-shadow: none;
+  margin: 0 0 20px 0;
+  min-height: 45px;
+  outline: none;
+  transition: all .3s;
+}
+
+.chips.focus {
+  border-bottom: 1px solid #26a69a;
+  box-shadow: 0 1px 0 0 #26a69a;
+}
+
+.chips:hover {
+  cursor: text;
+}
+
+.chips .chip.selected {
+  background-color: #26a69a;
+  color: #fff;
+}
+
+.chips .input {
+  background: none;
+  border: 0;
+  color: rgba(0, 0, 0, 0.6);
+  display: inline-block;
+  font-size: 1rem;
+  height: 3rem;
+  line-height: 32px;
+  outline: 0;
+  margin: 0;
+  padding: 0 !important;
+  width: 120px !important;
+}
+
+.chips .input:focus {
+  border: 0 !important;
+  box-shadow: none !important;
+}
+
+.prefix ~ .chips {
+  margin-left: 3rem;
+  width: 92%;
+  width: calc(100% - 3rem);
+}
+
+.chips:empty ~ label {
+  font-size: 0.8rem;
+  -webkit-transform: translateY(-140%);
+          transform: translateY(-140%);
+}
+
+.materialboxed {
+  display: block;
+  cursor: -webkit-zoom-in;
+  cursor: zoom-in;
+  position: relative;
+  transition: opacity .4s;
+  -webkit-backface-visibility: hidden;
+}
+
+.materialboxed:hover:not(.active) {
+  opacity: .8;
+}
+
+.materialboxed.active {
+  cursor: -webkit-zoom-out;
+  cursor: zoom-out;
+}
+
+#materialbox-overlay {
+  position: fixed;
+  top: 0;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  background-color: #292929;
+  z-index: 1000;
+  will-change: opacity;
+}
+
+.materialbox-caption {
+  position: fixed;
+  display: none;
+  color: #fff;
+  line-height: 50px;
+  bottom: 0;
+  left: 0;
+  width: 100%;
+  text-align: center;
+  padding: 0% 15%;
+  height: 50px;
+  z-index: 1000;
+  -webkit-font-smoothing: antialiased;
+}
+
+select:focus {
+  outline: 1px solid #c9f3ef;
+}
+
+button:focus {
+  outline: none;
+  background-color: #2ab7a9;
+}
+
+label {
+  font-size: 0.8rem;
+  color: #9e9e9e;
+}
+
+/* Text Inputs + Textarea
+   ========================================================================== */
+/* Style Placeholders */
+::-webkit-input-placeholder {
+  color: #d1d1d1;
+}
+
+:-moz-placeholder {
+  /* Firefox 18- */
+  color: #d1d1d1;
+}
+
+::-moz-placeholder {
+  /* Firefox 19+ */
+  color: #d1d1d1;
+}
+
+:-ms-input-placeholder {
+  color: #d1d1d1;
+}
+
+/* Text inputs */
+input:not([type]),
+input[type=text],
+input[type=password],
+input[type=email],
+input[type=url],
+input[type=time],
+input[type=date],
+input[type=datetime],
+input[type=datetime-local],
+input[type=tel],
+input[type=number],
+input[type=search],
+textarea.materialize-textarea {
+  background-color: transparent;
+  border: none;
+  border-bottom: 1px solid #9e9e9e;
+  border-radius: 0;
+  outline: none;
+  height: 3rem;
+  width: 100%;
+  font-size: 1rem;
+  margin: 0 0 20px 0;
+  padding: 0;
+  box-shadow: none;
+  box-sizing: content-box;
+  transition: all 0.3s;
+}
+
+input:not([type]):disabled, input:not([type])[readonly="readonly"],
+input[type=text]:disabled,
+input[type=text][readonly="readonly"],
+input[type=password]:disabled,
+input[type=password][readonly="readonly"],
+input[type=email]:disabled,
+input[type=email][readonly="readonly"],
+input[type=url]:disabled,
+input[type=url][readonly="readonly"],
+input[type=time]:disabled,
+input[type=time][readonly="readonly"],
+input[type=date]:disabled,
+input[type=date][readonly="readonly"],
+input[type=datetime]:disabled,
+input[type=datetime][readonly="readonly"],
+input[type=datetime-local]:disabled,
+input[type=datetime-local][readonly="readonly"],
+input[type=tel]:disabled,
+input[type=tel][readonly="readonly"],
+input[type=number]:disabled,
+input[type=number][readonly="readonly"],
+input[type=search]:disabled,
+input[type=search][readonly="readonly"],
+textarea.materialize-textarea:disabled,
+textarea.materialize-textarea[readonly="readonly"] {
+  color: rgba(0, 0, 0, 0.26);
+  border-bottom: 1px dotted rgba(0, 0, 0, 0.26);
+}
+
+input:not([type]):disabled + label,
+input:not([type])[readonly="readonly"] + label,
+input[type=text]:disabled + label,
+input[type=text][readonly="readonly"] + label,
+input[type=password]:disabled + label,
+input[type=password][readonly="readonly"] + label,
+input[type=email]:disabled + label,
+input[type=email][readonly="readonly"] + label,
+input[type=url]:disabled + label,
+input[type=url][readonly="readonly"] + label,
+input[type=time]:disabled + label,
+input[type=time][readonly="readonly"] + label,
+input[type=date]:disabled + label,
+input[type=date][readonly="readonly"] + label,
+input[type=datetime]:disabled + label,
+input[type=datetime][readonly="readonly"] + label,
+input[type=datetime-local]:disabled + label,
+input[type=datetime-local][readonly="readonly"] + label,
+input[type=tel]:disabled + label,
+input[type=tel][readonly="readonly"] + label,
+input[type=number]:disabled + label,
+input[type=number][readonly="readonly"] + label,
+input[type=search]:disabled + label,
+input[type=search][readonly="readonly"] + label,
+textarea.materialize-textarea:disabled + label,
+textarea.materialize-textarea[readonly="readonly"] + label {
+  color: rgba(0, 0, 0, 0.26);
+}
+
+input:not([type]):focus:not([readonly]),
+input[type=text]:focus:not([readonly]),
+input[type=password]:focus:not([readonly]),
+input[type=email]:focus:not([readonly]),
+input[type=url]:focus:not([readonly]),
+input[type=time]:focus:not([readonly]),
+input[type=date]:focus:not([readonly]),
+input[type=datetime]:focus:not([readonly]),
+input[type=datetime-local]:focus:not([readonly]),
+input[type=tel]:focus:not([readonly]),
+input[type=number]:focus:not([readonly]),
+input[type=search]:focus:not([readonly]),
+textarea.materialize-textarea:focus:not([readonly]) {
+  border-bottom: 1px solid #26a69a;
+  box-shadow: 0 1px 0 0 #26a69a;
+}
+
+input:not([type]):focus:not([readonly]) + label,
+input[type=text]:focus:not([readonly]) + label,
+input[type=password]:focus:not([readonly]) + label,
+input[type=email]:focus:not([readonly]) + label,
+input[type=url]:focus:not([readonly]) + label,
+input[type=time]:focus:not([readonly]) + label,
+input[type=date]:focus:not([readonly]) + label,
+input[type=datetime]:focus:not([readonly]) + label,
+input[type=datetime-local]:focus:not([readonly]) + label,
+input[type=tel]:focus:not([readonly]) + label,
+input[type=number]:focus:not([readonly]) + label,
+input[type=search]:focus:not([readonly]) + label,
+textarea.materialize-textarea:focus:not([readonly]) + label {
+  color: #26a69a;
+}
+
+input:not([type]).valid, input:not([type]):focus.valid,
+input[type=text].valid,
+input[type=text]:focus.valid,
+input[type=password].valid,
+input[type=password]:focus.valid,
+input[type=email].valid,
+input[type=email]:focus.valid,
+input[type=url].valid,
+input[type=url]:focus.valid,
+input[type=time].valid,
+input[type=time]:focus.valid,
+input[type=date].valid,
+input[type=date]:focus.valid,
+input[type=datetime].valid,
+input[type=datetime]:focus.valid,
+input[type=datetime-local].valid,
+input[type=datetime-local]:focus.valid,
+input[type=tel].valid,
+input[type=tel]:focus.valid,
+input[type=number].valid,
+input[type=number]:focus.valid,
+input[type=search].valid,
+input[type=search]:focus.valid,
+textarea.materialize-textarea.valid,
+textarea.materialize-textarea:focus.valid {
+  border-bottom: 1px solid #4CAF50;
+  box-shadow: 0 1px 0 0 #4CAF50;
+}
+
+input:not([type]).valid + label:after,
+input:not([type]):focus.valid + label:after,
+input[type=text].valid + label:after,
+input[type=text]:focus.valid + label:after,
+input[type=password].valid + label:after,
+input[type=password]:focus.valid + label:after,
+input[type=email].valid + label:after,
+input[type=email]:focus.valid + label:after,
+input[type=url].valid + label:after,
+input[type=url]:focus.valid + label:after,
+input[type=time].valid + label:after,
+input[type=time]:focus.valid + label:after,
+input[type=date].valid + label:after,
+input[type=date]:focus.valid + label:after,
+input[type=datetime].valid + label:after,
+input[type=datetime]:focus.valid + label:after,
+input[type=datetime-local].valid + label:after,
+input[type=datetime-local]:focus.valid + label:after,
+input[type=tel].valid + label:after,
+input[type=tel]:focus.valid + label:after,
+input[type=number].valid + label:after,
+input[type=number]:focus.valid + label:after,
+input[type=search].valid + label:after,
+input[type=search]:focus.valid + label:after,
+textarea.materialize-textarea.valid + label:after,
+textarea.materialize-textarea:focus.valid + label:after {
+  content: attr(data-success);
+  color: #4CAF50;
+  opacity: 1;
+}
+
+input:not([type]).invalid, input:not([type]):focus.invalid,
+input[type=text].invalid,
+input[type=text]:focus.invalid,
+input[type=password].invalid,
+input[type=password]:focus.invalid,
+input[type=email].invalid,
+input[type=email]:focus.invalid,
+input[type=url].invalid,
+input[type=url]:focus.invalid,
+input[type=time].invalid,
+input[type=time]:focus.invalid,
+input[type=date].invalid,
+input[type=date]:focus.invalid,
+input[type=datetime].invalid,
+input[type=datetime]:focus.invalid,
+input[type=datetime-local].invalid,
+input[type=datetime-local]:focus.invalid,
+input[type=tel].invalid,
+input[type=tel]:focus.invalid,
+input[type=number].invalid,
+input[type=number]:focus.invalid,
+input[type=search].invalid,
+input[type=search]:focus.invalid,
+textarea.materialize-textarea.invalid,
+textarea.materialize-textarea:focus.invalid {
+  border-bottom: 1px solid #F44336;
+  box-shadow: 0 1px 0 0 #F44336;
+}
+
+input:not([type]).invalid + label:after,
+input:not([type]):focus.invalid + label:after,
+input[type=text].invalid + label:after,
+input[type=text]:focus.invalid + label:after,
+input[type=password].invalid + label:after,
+input[type=password]:focus.invalid + label:after,
+input[type=email].invalid + label:after,
+input[type=email]:focus.invalid + label:after,
+input[type=url].invalid + label:after,
+input[type=url]:focus.invalid + label:after,
+input[type=time].invalid + label:after,
+input[type=time]:focus.invalid + label:after,
+input[type=date].invalid + label:after,
+input[type=date]:focus.invalid + label:after,
+input[type=datetime].invalid + label:after,
+input[type=datetime]:focus.invalid + label:after,
+input[type=datetime-local].invalid + label:after,
+input[type=datetime-local]:focus.invalid + label:after,
+input[type=tel].invalid + label:after,
+input[type=tel]:focus.invalid + label:after,
+input[type=number].invalid + label:after,
+input[type=number]:focus.invalid + label:after,
+input[type=search].invalid + label:after,
+input[type=search]:focus.invalid + label:after,
+textarea.materialize-textarea.invalid + label:after,
+textarea.materialize-textarea:focus.invalid + label:after {
+  content: attr(data-error);
+  color: #F44336;
+  opacity: 1;
+}
+
+input:not([type]).validate + label,
+input[type=text].validate + label,
+input[type=password].validate + label,
+input[type=email].validate + label,
+input[type=url].validate + label,
+input[type=time].validate + label,
+input[type=date].validate + label,
+input[type=datetime].validate + label,
+input[type=datetime-local].validate + label,
+input[type=tel].validate + label,
+input[type=number].validate + label,
+input[type=search].validate + label,
+textarea.materialize-textarea.validate + label {
+  width: 100%;
+  pointer-events: none;
+}
+
+input:not([type]) + label:after,
+input[type=text] + label:after,
+input[type=password] + label:after,
+input[type=email] + label:after,
+input[type=url] + label:after,
+input[type=time] + label:after,
+input[type=date] + label:after,
+input[type=datetime] + label:after,
+input[type=datetime-local] + label:after,
+input[type=tel] + label:after,
+input[type=number] + label:after,
+input[type=search] + label:after,
+textarea.materialize-textarea + label:after {
+  display: block;
+  content: "";
+  position: absolute;
+  top: 60px;
+  opacity: 0;
+  transition: .2s opacity ease-out, .2s color ease-out;
+}
+
+.input-field {
+  position: relative;
+  margin-top: 1rem;
+}
+
+.input-field.inline {
+  display: inline-block;
+  vertical-align: middle;
+  margin-left: 5px;
+}
+
+.input-field.inline input,
+.input-field.inline .select-dropdown {
+  margin-bottom: 1rem;
+}
+
+.input-field.col label {
+  left: 0.75rem;
+}
+
+.input-field.col .prefix ~ label,
+.input-field.col .prefix ~ .validate ~ label {
+  width: calc(100% - 3rem - 1.5rem);
+}
+
+.input-field label {
+  color: #9e9e9e;
+  position: absolute;
+  top: 0.8rem;
+  left: 0;
+  font-size: 1rem;
+  cursor: text;
+  transition: .2s ease-out;
+}
+
+.input-field label:not(.label-icon).active {
+  font-size: 0.8rem;
+  -webkit-transform: translateY(-140%);
+          transform: translateY(-140%);
+}
+
+.input-field .prefix {
+  position: absolute;
+  width: 3rem;
+  font-size: 2rem;
+  transition: color .2s;
+}
+
+.input-field .prefix.active {
+  color: #26a69a;
+}
+
+.input-field .prefix ~ input,
+.input-field .prefix ~ textarea,
+.input-field .prefix ~ label,
+.input-field .prefix ~ .validate ~ label,
+.input-field .prefix ~ .autocomplete-content {
+  margin-left: 3rem;
+  width: 92%;
+  width: calc(100% - 3rem);
+}
+
+.input-field .prefix ~ label {
+  margin-left: 3rem;
+}
+
+@media only screen and (max-width: 992px) {
+  .input-field .prefix ~ input {
+    width: 86%;
+    width: calc(100% - 3rem);
+  }
+}
+
+@media only screen and (max-width: 600px) {
+  .input-field .prefix ~ input {
+    width: 80%;
+    width: calc(100% - 3rem);
+  }
+}
+
+/* Search Field */
+.input-field input[type=search] {
+  display: block;
+  line-height: inherit;
+  padding-left: 4rem;
+  width: calc(100% - 4rem);
+}
+
+.input-field input[type=search]:focus {
+  background-color: #fff;
+  border: 0;
+  box-shadow: none;
+  color: #444;
+}
+
+.input-field input[type=search]:focus + label i,
+.input-field input[type=search]:focus ~ .mdi-navigation-close,
+.input-field input[type=search]:focus ~ .material-icons {
+  color: #444;
+}
+
+.input-field input[type=search] + label {
+  left: 1rem;
+}
+
+.input-field input[type=search] ~ .mdi-navigation-close,
+.input-field input[type=search] ~ .material-icons {
+  position: absolute;
+  top: 0;
+  right: 1rem;
+  color: transparent;
+  cursor: pointer;
+  font-size: 2rem;
+  transition: .3s color;
+}
+
+/* Textarea */
+textarea {
+  width: 100%;
+  height: 3rem;
+  background-color: transparent;
+}
+
+textarea.materialize-textarea {
+  overflow-y: hidden;
+  /* prevents scroll bar flash */
+  padding: .8rem 0 1.6rem 0;
+  /* prevents text jump on Enter keypress */
+  resize: none;
+  min-height: 3rem;
+}
+
+.hiddendiv {
+  display: none;
+  white-space: pre-wrap;
+  word-wrap: break-word;
+  overflow-wrap: break-word;
+  /* future version of deprecated 'word-wrap' */
+  padding-top: 1.2rem;
+  /* prevents text jump on Enter keypress */
+}
+
+/* Autocomplete */
+.autocomplete-content {
+  margin-top: -15px;
+  display: block;
+  opacity: 1;
+  position: static;
+}
+
+.autocomplete-content li .highlight {
+  color: #444;
+}
+
+.autocomplete-content li img {
+  height: 40px;
+  width: 40px;
+  margin: 5px 15px;
+}
+
+/* Radio Buttons
+   ========================================================================== */
+[type="radio"]:not(:checked),
+[type="radio"]:checked {
+  position: absolute;
+  left: -9999px;
+  opacity: 0;
+}
+
+[type="radio"]:not(:checked) + label,
+[type="radio"]:checked + label {
+  position: relative;
+  padding-left: 35px;
+  cursor: pointer;
+  display: inline-block;
+  height: 25px;
+  line-height: 25px;
+  font-size: 1rem;
+  transition: .28s ease;
+  /* webkit (konqueror) browsers */
+  -webkit-user-select: none;
+     -moz-user-select: none;
+      -ms-user-select: none;
+          user-select: none;
+}
+
+[type="radio"] + label:before,
+[type="radio"] + label:after {
+  content: '';
+  position: absolute;
+  left: 0;
+  top: 0;
+  margin: 4px;
+  width: 16px;
+  height: 16px;
+  z-index: 0;
+  transition: .28s ease;
+}
+
+/* Unchecked styles */
+[type="radio"]:not(:checked) + label:before,
+[type="radio"]:not(:checked) + label:after,
+[type="radio"]:checked + label:before,
+[type="radio"]:checked + label:after,
+[type="radio"].with-gap:checked + label:before,
+[type="radio"].with-gap:checked + label:after {
+  border-radius: 50%;
+}
+
+[type="radio"]:not(:checked) + label:before,
+[type="radio"]:not(:checked) + label:after {
+  border: 2px solid #5a5a5a;
+}
+
+[type="radio"]:not(:checked) + label:after {
+  -webkit-transform: scale(0);
+          transform: scale(0);
+}
+
+/* Checked styles */
+[type="radio"]:checked + label:before {
+  border: 2px solid transparent;
+}
+
+[type="radio"]:checked + label:after,
+[type="radio"].with-gap:checked + label:before,
+[type="radio"].with-gap:checked + label:after {
+  border: 2px solid #26a69a;
+}
+
+[type="radio"]:checked + label:after,
+[type="radio"].with-gap:checked + label:after {
+  background-color: #26a69a;
+}
+
+[type="radio"]:checked + label:after {
+  -webkit-transform: scale(1.02);
+          transform: scale(1.02);
+}
+
+/* Radio With gap */
+[type="radio"].with-gap:checked + label:after {
+  -webkit-transform: scale(0.5);
+          transform: scale(0.5);
+}
+
+/* Focused styles */
+[type="radio"].tabbed:focus + label:before {
+  box-shadow: 0 0 0 10px rgba(0, 0, 0, 0.1);
+}
+
+/* Disabled Radio With gap */
+[type="radio"].with-gap:disabled:checked + label:before {
+  border: 2px solid rgba(0, 0, 0, 0.26);
+}
+
+[type="radio"].with-gap:disabled:checked + label:after {
+  border: none;
+  background-color: rgba(0, 0, 0, 0.26);
+}
+
+/* Disabled style */
+[type="radio"]:disabled:not(:checked) + label:before,
+[type="radio"]:disabled:checked + label:before {
+  background-color: transparent;
+  border-color: rgba(0, 0, 0, 0.26);
+}
+
+[type="radio"]:disabled + label {
+  color: rgba(0, 0, 0, 0.26);
+}
+
+[type="radio"]:disabled:not(:checked) + label:before {
+  border-color: rgba(0, 0, 0, 0.26);
+}
+
+[type="radio"]:disabled:checked + label:after {
+  background-color: rgba(0, 0, 0, 0.26);
+  border-color: #BDBDBD;
+}
+
+/* Checkboxes
+   ========================================================================== */
+/* CUSTOM CSS CHECKBOXES */
+form p {
+  margin-bottom: 10px;
+  text-align: left;
+}
+
+form p:last-child {
+  margin-bottom: 0;
+}
+
+/* Remove default checkbox */
+[type="checkbox"]:not(:checked),
+[type="checkbox"]:checked {
+  position: absolute;
+  left: -9999px;
+  opacity: 0;
+}
+
+[type="checkbox"] {
+  /* checkbox aspect */
+}
+
+[type="checkbox"] + label {
+  position: relative;
+  padding-left: 35px;
+  cursor: pointer;
+  display: inline-block;
+  height: 25px;
+  line-height: 25px;
+  font-size: 1rem;
+  -webkit-user-select: none;
+  /* webkit (safari, chrome) browsers */
+  -moz-user-select: none;
+  /* mozilla browsers */
+  -khtml-user-select: none;
+  /* webkit (konqueror) browsers */
+  -ms-user-select: none;
+  /* IE10+ */
+}
+
+[type="checkbox"] + label:before,
+[type="checkbox"]:not(.filled-in) + label:after {
+  content: '';
+  position: absolute;
+  top: 0;
+  left: 0;
+  width: 18px;
+  height: 18px;
+  z-index: 0;
+  border: 2px solid #5a5a5a;
+  border-radius: 1px;
+  margin-top: 2px;
+  transition: .2s;
+}
+
+[type="checkbox"]:not(.filled-in) + label:after {
+  border: 0;
+  -webkit-transform: scale(0);
+          transform: scale(0);
+}
+
+[type="checkbox"]:not(:checked):disabled + label:before {
+  border: none;
+  background-color: rgba(0, 0, 0, 0.26);
+}
+
+[type="checkbox"].tabbed:focus + label:after {
+  -webkit-transform: scale(1);
+          transform: scale(1);
+  border: 0;
+  border-radius: 50%;
+  box-shadow: 0 0 0 10px rgba(0, 0, 0, 0.1);
+  background-color: rgba(0, 0, 0, 0.1);
+}
+
+[type="checkbox"]:checked + label:before {
+  top: -4px;
+  left: -5px;
+  width: 12px;
+  height: 22px;
+  border-top: 2px solid transparent;
+  border-left: 2px solid transparent;
+  border-right: 2px solid #26a69a;
+  border-bottom: 2px solid #26a69a;
+  -webkit-transform: rotate(40deg);
+          transform: rotate(40deg);
+  -webkit-backface-visibility: hidden;
+          backface-visibility: hidden;
+  -webkit-transform-origin: 100% 100%;
+          transform-origin: 100% 100%;
+}
+
+[type="checkbox"]:checked:disabled + label:before {
+  border-right: 2px solid rgba(0, 0, 0, 0.26);
+  border-bottom: 2px solid rgba(0, 0, 0, 0.26);
+}
+
+/* Indeterminate checkbox */
+[type="checkbox"]:indeterminate + label:before {
+  top: -11px;
+  left: -12px;
+  width: 10px;
+  height: 22px;
+  border-top: none;
+  border-left: none;
+  border-right: 2px solid #26a69a;
+  border-bottom: none;
+  -webkit-transform: rotate(90deg);
+          transform: rotate(90deg);
+  -webkit-backface-visibility: hidden;
+          backface-visibility: hidden;
+  -webkit-transform-origin: 100% 100%;
+          transform-origin: 100% 100%;
+}
+
+[type="checkbox"]:indeterminate:disabled + label:before {
+  border-right: 2px solid rgba(0, 0, 0, 0.26);
+  background-color: transparent;
+}
+
+[type="checkbox"].filled-in + label:after {
+  border-radius: 2px;
+}
+
+[type="checkbox"].filled-in + label:before,
+[type="checkbox"].filled-in + label:after {
+  content: '';
+  left: 0;
+  position: absolute;
+  /* .1s delay is for check animation */
+  transition: border .25s, background-color .25s, width .20s .1s, height .20s .1s, top .20s .1s, left .20s .1s;
+  z-index: 1;
+}
+
+[type="checkbox"].filled-in:not(:checked) + label:before {
+  width: 0;
+  height: 0;
+  border: 3px solid transparent;
+  left: 6px;
+  top: 10px;
+  -webkit-transform: rotateZ(37deg);
+  transform: rotateZ(37deg);
+  -webkit-transform-origin: 20% 40%;
+  transform-origin: 100% 100%;
+}
+
+[type="checkbox"].filled-in:not(:checked) + label:after {
+  height: 20px;
+  width: 20px;
+  background-color: transparent;
+  border: 2px solid #5a5a5a;
+  top: 0px;
+  z-index: 0;
+}
+
+[type="checkbox"].filled-in:checked + label:before {
+  top: 0;
+  left: 1px;
+  width: 8px;
+  height: 13px;
+  border-top: 2px solid transparent;
+  border-left: 2px solid transparent;
+  border-right: 2px solid #fff;
+  border-bottom: 2px solid #fff;
+  -webkit-transform: rotateZ(37deg);
+  transform: rotateZ(37deg);
+  -webkit-transform-origin: 100% 100%;
+  transform-origin: 100% 100%;
+}
+
+[type="checkbox"].filled-in:checked + label:after {
+  top: 0;
+  width: 20px;
+  height: 20px;
+  border: 2px solid #26a69a;
+  background-color: #26a69a;
+  z-index: 0;
+}
+
+[type="checkbox"].filled-in.tabbed:focus + label:after {
+  border-radius: 2px;
+  border-color: #5a5a5a;
+  background-color: rgba(0, 0, 0, 0.1);
+}
+
+[type="checkbox"].filled-in.tabbed:checked:focus + label:after {
+  border-radius: 2px;
+  background-color: #26a69a;
+  border-color: #26a69a;
+}
+
+[type="checkbox"].filled-in:disabled:not(:checked) + label:before {
+  background-color: transparent;
+  border: 2px solid transparent;
+}
+
+[type="checkbox"].filled-in:disabled:not(:checked) + label:after {
+  border-color: transparent;
+  background-color: #BDBDBD;
+}
+
+[type="checkbox"].filled-in:disabled:checked + label:before {
+  background-color: transparent;
+}
+
+[type="checkbox"].filled-in:disabled:checked + label:after {
+  background-color: #BDBDBD;
+  border-color: #BDBDBD;
+}
+
+/* Switch
+   ========================================================================== */
+.switch,
+.switch * {
+  -webkit-user-select: none;
+  -moz-user-select: none;
+  -khtml-user-select: none;
+  -ms-user-select: none;
+}
+
+.switch label {
+  cursor: pointer;
+}
+
+.switch label input[type=checkbox] {
+  opacity: 0;
+  width: 0;
+  height: 0;
+}
+
+.switch label input[type=checkbox]:checked + .lever {
+  background-color: #84c7c1;
+}
+
+.switch label input[type=checkbox]:checked + .lever:after {
+  background-color: #26a69a;
+  left: 24px;
+}
+
+.switch label .lever {
+  content: "";
+  display: inline-block;
+  position: relative;
+  width: 40px;
+  height: 15px;
+  background-color: #818181;
+  border-radius: 15px;
+  margin-right: 10px;
+  transition: background 0.3s ease;
+  vertical-align: middle;
+  margin: 0 16px;
+}
+
+.switch label .lever:after {
+  content: "";
+  position: absolute;
+  display: inline-block;
+  width: 21px;
+  height: 21px;
+  background-color: #F1F1F1;
+  border-radius: 21px;
+  box-shadow: 0 1px 3px 1px rgba(0, 0, 0, 0.4);
+  left: -5px;
+  top: -3px;
+  transition: left 0.3s ease, background .3s ease, box-shadow 0.1s ease;
+}
+
+input[type=checkbox]:checked:not(:disabled) ~ .lever:active::after,
+input[type=checkbox]:checked:not(:disabled).tabbed:focus ~ .lever::after {
+  box-shadow: 0 1px 3px 1px rgba(0, 0, 0, 0.4), 0 0 0 15px rgba(38, 166, 154, 0.1);
+}
+
+input[type=checkbox]:not(:disabled) ~ .lever:active:after,
+input[type=checkbox]:not(:disabled).tabbed:focus ~ .lever::after {
+  box-shadow: 0 1px 3px 1px rgba(0, 0, 0, 0.4), 0 0 0 15px rgba(0, 0, 0, 0.08);
+}
+
+.switch input[type=checkbox][disabled] + .lever {
+  cursor: default;
+}
+
+.switch label input[type=checkbox][disabled] + .lever:after,
+.switch label input[type=checkbox][disabled]:checked + .lever:after {
+  background-color: #BDBDBD;
+}
+
+/* Select Field
+   ========================================================================== */
+select {
+  display: none;
+}
+
+select.browser-default {
+  display: block;
+}
+
+select {
+  background-color: rgba(255, 255, 255, 0.9);
+  width: 100%;
+  padding: 5px;
+  border: 1px solid #f2f2f2;
+  border-radius: 2px;
+  height: 3rem;
+}
+
+.select-label {
+  position: absolute;
+}
+
+.select-wrapper {
+  position: relative;
+}
+
+.select-wrapper input.select-dropdown {
+  position: relative;
+  cursor: pointer;
+  background-color: transparent;
+  border: none;
+  border-bottom: 1px solid #9e9e9e;
+  outline: none;
+  height: 3rem;
+  line-height: 3rem;
+  width: 100%;
+  font-size: 1rem;
+  margin: 0 0 20px 0;
+  padding: 0;
+  display: block;
+}
+
+.select-wrapper span.caret {
+  color: initial;
+  position: absolute;
+  right: 0;
+  top: 0;
+  bottom: 0;
+  height: 10px;
+  margin: auto 0;
+  font-size: 10px;
+  line-height: 10px;
+}
+
+.select-wrapper span.caret.disabled {
+  color: rgba(0, 0, 0, 0.26);
+}
+
+.select-wrapper + label {
+  position: absolute;
+  top: -14px;
+  font-size: 0.8rem;
+}
+
+select:disabled {
+  color: rgba(0, 0, 0, 0.3);
+}
+
+.select-wrapper input.select-dropdown:disabled {
+  color: rgba(0, 0, 0, 0.3);
+  cursor: default;
+  -webkit-user-select: none;
+  /* webkit (safari, chrome) browsers */
+  -moz-user-select: none;
+  /* mozilla browsers */
+  -ms-user-select: none;
+  /* IE10+ */
+  border-bottom: 1px solid rgba(0, 0, 0, 0.3);
+}
+
+.select-wrapper i {
+  color: rgba(0, 0, 0, 0.3);
+}
+
+.select-dropdown li.disabled,
+.select-dropdown li.disabled > span,
+.select-dropdown li.optgroup {
+  color: rgba(0, 0, 0, 0.3);
+  background-color: transparent;
+}
+
+.prefix ~ .select-wrapper {
+  margin-left: 3rem;
+  width: 92%;
+  width: calc(100% - 3rem);
+}
+
+.prefix ~ label {
+  margin-left: 3rem;
+}
+
+.select-dropdown li img {
+  height: 40px;
+  width: 40px;
+  margin: 5px 15px;
+  float: right;
+}
+
+.select-dropdown li.optgroup {
+  border-top: 1px solid #eee;
+}
+
+.select-dropdown li.optgroup.selected > span {
+  color: rgba(0, 0, 0, 0.7);
+}
+
+.select-dropdown li.optgroup > span {
+  color: rgba(0, 0, 0, 0.4);
+}
+
+.select-dropdown li.optgroup ~ li.optgroup-option {
+  padding-left: 1rem;
+}
+
+/* File Input
+   ========================================================================== */
+.file-field {
+  position: relative;
+}
+
+.file-field .file-path-wrapper {
+  overflow: hidden;
+  padding-left: 10px;
+}
+
+.file-field input.file-path {
+  width: 100%;
+}
+
+.file-field .btn, .file-field .btn-large {
+  float: left;
+  height: 3rem;
+  line-height: 3rem;
+}
+
+.file-field span {
+  cursor: pointer;
+}
+
+.file-field input[type=file] {
+  position: absolute;
+  top: 0;
+  right: 0;
+  left: 0;
+  bottom: 0;
+  width: 100%;
+  margin: 0;
+  padding: 0;
+  font-size: 20px;
+  cursor: pointer;
+  opacity: 0;
+  filter: alpha(opacity=0);
+}
+
+/* Range
+   ========================================================================== */
+.range-field {
+  position: relative;
+}
+
+input[type=range],
+input[type=range] + .thumb {
+  cursor: pointer;
+}
+
+input[type=range] {
+  position: relative;
+  background-color: transparent;
+  border: none;
+  outline: none;
+  width: 100%;
+  margin: 15px 0;
+  padding: 0;
+}
+
+input[type=range]:focus {
+  outline: none;
+}
+
+input[type=range] + .thumb {
+  position: absolute;
+  border: none;
+  height: 0;
+  width: 0;
+  border-radius: 50%;
+  background-color: #26a69a;
+  top: 10px;
+  margin-left: -6px;
+  -webkit-transform-origin: 50% 50%;
+          transform-origin: 50% 50%;
+  -webkit-transform: rotate(-45deg);
+          transform: rotate(-45deg);
+}
+
+input[type=range] + .thumb .value {
+  display: block;
+  width: 30px;
+  text-align: center;
+  color: #26a69a;
+  font-size: 0;
+  -webkit-transform: rotate(45deg);
+          transform: rotate(45deg);
+}
+
+input[type=range] + .thumb.active {
+  border-radius: 50% 50% 50% 0;
+}
+
+input[type=range] + .thumb.active .value {
+  color: #fff;
+  margin-left: -1px;
+  margin-top: 8px;
+  font-size: 10px;
+}
+
+input[type=range] {
+  -webkit-appearance: none;
+}
+
+input[type=range]::-webkit-slider-runnable-track {
+  height: 3px;
+  background: #c2c0c2;
+  border: none;
+}
+
+input[type=range]::-webkit-slider-thumb {
+  -webkit-appearance: none;
+  border: none;
+  height: 14px;
+  width: 14px;
+  border-radius: 50%;
+  background-color: #26a69a;
+  -webkit-transform-origin: 50% 50%;
+          transform-origin: 50% 50%;
+  margin: -5px 0 0 0;
+  transition: .3s;
+}
+
+input[type=range]:focus::-webkit-slider-runnable-track {
+  background: #ccc;
+}
+
+input[type=range] {
+  /* fix for FF unable to apply focus style bug  */
+  border: 1px solid white;
+  /*required for proper track sizing in FF*/
+}
+
+input[type=range]::-moz-range-track {
+  height: 3px;
+  background: #ddd;
+  border: none;
+}
+
+input[type=range]::-moz-range-thumb {
+  border: none;
+  height: 14px;
+  width: 14px;
+  border-radius: 50%;
+  background: #26a69a;
+  margin-top: -5px;
+}
+
+input[type=range]:-moz-focusring {
+  outline: 1px solid #fff;
+  outline-offset: -1px;
+}
+
+input[type=range]:focus::-moz-range-track {
+  background: #ccc;
+}
+
+input[type=range]::-ms-track {
+  height: 3px;
+  background: transparent;
+  border-color: transparent;
+  border-width: 6px 0;
+  /*remove default tick marks*/
+  color: transparent;
+}
+
+input[type=range]::-ms-fill-lower {
+  background: #777;
+}
+
+input[type=range]::-ms-fill-upper {
+  background: #ddd;
+}
+
+input[type=range]::-ms-thumb {
+  border: none;
+  height: 14px;
+  width: 14px;
+  border-radius: 50%;
+  background: #26a69a;
+}
+
+input[type=range]:focus::-ms-fill-lower {
+  background: #888;
+}
+
+input[type=range]:focus::-ms-fill-upper {
+  background: #ccc;
+}
+
+/***************
+    Nav List
+***************/
+.table-of-contents.fixed {
+  position: fixed;
+}
+
+.table-of-contents li {
+  padding: 2px 0;
+}
+
+.table-of-contents a {
+  display: inline-block;
+  font-weight: 300;
+  color: #757575;
+  padding-left: 20px;
+  height: 1.5rem;
+  line-height: 1.5rem;
+  letter-spacing: .4;
+  display: inline-block;
+}
+
+.table-of-contents a:hover {
+  color: #a8a8a8;
+  padding-left: 19px;
+  border-left: 1px solid #ee6e73;
+}
+
+.table-of-contents a.active {
+  font-weight: 500;
+  padding-left: 18px;
+  border-left: 2px solid #ee6e73;
+}
+
+.side-nav {
+  position: fixed;
+  width: 300px;
+  left: 0;
+  top: 0;
+  margin: 0;
+  -webkit-transform: translateX(-100%);
+          transform: translateX(-100%);
+  height: 100%;
+  height: calc(100% + 60px);
+  height: -moz-calc(100%);
+  padding-bottom: 60px;
+  background-color: #fff;
+  z-index: 999;
+  overflow-y: auto;
+  will-change: transform;
+  -webkit-backface-visibility: hidden;
+          backface-visibility: hidden;
+  -webkit-transform: translateX(-105%);
+          transform: translateX(-105%);
+}
+
+.side-nav.right-aligned {
+  right: 0;
+  -webkit-transform: translateX(105%);
+          transform: translateX(105%);
+  left: auto;
+  -webkit-transform: translateX(100%);
+          transform: translateX(100%);
+}
+
+.side-nav .collapsible {
+  margin: 0;
+}
+
+.side-nav li {
+  float: none;
+  line-height: 48px;
+}
+
+.side-nav li.active {
+  background-color: rgba(0, 0, 0, 0.05);
+}
+
+.side-nav a {
+  color: rgba(0, 0, 0, 0.87);
+  display: block;
+  font-size: 14px;
+  font-weight: 500;
+  height: 48px;
+  line-height: 48px;
+  padding: 0 32px;
+}
+
+.side-nav a:hover {
+  background-color: rgba(0, 0, 0, 0.05);
+}
+
+.side-nav a.btn, .side-nav a.btn-large, .side-nav a.btn-large, .side-nav a.btn-flat, .side-nav a.btn-floating {
+  margin: 10px 15px;
+}
+
+.side-nav a.btn, .side-nav a.btn-large, .side-nav a.btn-large, .side-nav a.btn-floating {
+  color: #fff;
+}
+
+.side-nav a.btn-flat {
+  color: #343434;
+}
+
+.side-nav a.btn:hover, .side-nav a.btn-large:hover, .side-nav a.btn-large:hover {
+  background-color: #2bbbad;
+}
+
+.side-nav a.btn-floating:hover {
+  background-color: #26a69a;
+}
+
+.side-nav li > a > i,
+.side-nav li > a > [class^="mdi-"], .side-nav li > a > [class*="mdi-"],
+.side-nav li > a > i.material-icons {
+  float: left;
+  height: 48px;
+  line-height: 48px;
+  margin: 0 32px 0 0;
+  width: 24px;
+  color: rgba(0, 0, 0, 0.54);
+}
+
+.side-nav .divider {
+  margin: 8px 0 0 0;
+}
+
+.side-nav .subheader {
+  cursor: initial;
+  pointer-events: none;
+  color: rgba(0, 0, 0, 0.54);
+  font-size: 14px;
+  font-weight: 500;
+  line-height: 48px;
+}
+
+.side-nav .subheader:hover {
+  background-color: transparent;
+}
+
+.side-nav .userView {
+  position: relative;
+  padding: 32px 32px 0;
+  margin-bottom: 8px;
+}
+
+.side-nav .userView > a {
+  height: auto;
+  padding: 0;
+}
+
+.side-nav .userView > a:hover {
+  background-color: transparent;
+}
+
+.side-nav .userView .background {
+  overflow: hidden;
+  position: absolute;
+  top: 0;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  z-index: -1;
+}
+
+.side-nav .userView .circle, .side-nav .userView .name, .side-nav .userView .email {
+  display: block;
+}
+
+.side-nav .userView .circle {
+  height: 64px;
+  width: 64px;
+}
+
+.side-nav .userView .name,
+.side-nav .userView .email {
+  font-size: 14px;
+  line-height: 24px;
+}
+
+.side-nav .userView .name {
+  margin-top: 16px;
+  font-weight: 500;
+}
+
+.side-nav .userView .email {
+  padding-bottom: 16px;
+  font-weight: 400;
+}
+
+.drag-target {
+  height: 100%;
+  width: 10px;
+  position: fixed;
+  top: 0;
+  z-index: 998;
+}
+
+.side-nav.fixed {
+  left: 0;
+  -webkit-transform: translateX(0);
+          transform: translateX(0);
+  position: fixed;
+}
+
+.side-nav.fixed.right-aligned {
+  right: 0;
+  left: auto;
+}
+
+@media only screen and (max-width: 992px) {
+  .side-nav.fixed {
+    -webkit-transform: translateX(-105%);
+            transform: translateX(-105%);
+  }
+  .side-nav.fixed.right-aligned {
+    -webkit-transform: translateX(105%);
+            transform: translateX(105%);
+  }
+  .side-nav a {
+    padding: 0 16px;
+  }
+  .side-nav .userView {
+    padding: 16px 16px 0;
+  }
+}
+
+.side-nav .collapsible-body > ul:not(.collapsible) > li.active,
+.side-nav.fixed .collapsible-body > ul:not(.collapsible) > li.active {
+  background-color: #ee6e73;
+}
+
+.side-nav .collapsible-body > ul:not(.collapsible) > li.active a,
+.side-nav.fixed .collapsible-body > ul:not(.collapsible) > li.active a {
+  color: #fff;
+}
+
+#sidenav-overlay {
+  position: fixed;
+  top: 0;
+  left: 0;
+  right: 0;
+  height: 120vh;
+  background-color: rgba(0, 0, 0, 0.5);
+  z-index: 997;
+  will-change: opacity;
+}
+
+/*
+    @license
+    Copyright (c) 2014 The Polymer Project Authors. All rights reserved.
+    This code may only be used under the BSD style license found at http://polymer.github.io/LICENSE.txt
+    The complete set of authors may be found at http://polymer.github.io/AUTHORS.txt
+    The complete set of contributors may be found at http://polymer.github.io/CONTRIBUTORS.txt
+    Code distributed by Google as part of the polymer project is also
+    subject to an additional IP rights grant found at http://polymer.github.io/PATENTS.txt
+ */
+/**************************/
+/* STYLES FOR THE SPINNER */
+/**************************/
+/*
+ * Constants:
+ *      STROKEWIDTH = 3px
+ *      ARCSIZE     = 270 degrees (amount of circle the arc takes up)
+ *      ARCTIME     = 1333ms (time it takes to expand and contract arc)
+ *      ARCSTARTROT = 216 degrees (how much the start location of the arc
+ *                                should rotate each time, 216 gives us a
+ *                                5 pointed star shape (it's 360/5 * 3).
+ *                                For a 7 pointed star, we might do
+ *                                360/7 * 3 = 154.286)
+ *      CONTAINERWIDTH = 28px
+ *      SHRINK_TIME = 400ms
+ */
+.preloader-wrapper {
+  display: inline-block;
+  position: relative;
+  width: 48px;
+  height: 48px;
+}
+
+.preloader-wrapper.small {
+  width: 36px;
+  height: 36px;
+}
+
+.preloader-wrapper.big {
+  width: 64px;
+  height: 64px;
+}
+
+.preloader-wrapper.active {
+  /* duration: 360 * ARCTIME / (ARCSTARTROT + (360-ARCSIZE)) */
+  -webkit-animation: container-rotate 1568ms linear infinite;
+  animation: container-rotate 1568ms linear infinite;
+}
+
+@-webkit-keyframes container-rotate {
+  to {
+    -webkit-transform: rotate(360deg);
+  }
+}
+
+@keyframes container-rotate {
+  to {
+    -webkit-transform: rotate(360deg);
+            transform: rotate(360deg);
+  }
+}
+
+.spinner-layer {
+  position: absolute;
+  width: 100%;
+  height: 100%;
+  opacity: 0;
+  border-color: #26a69a;
+}
+
+.spinner-blue,
+.spinner-blue-only {
+  border-color: #4285f4;
+}
+
+.spinner-red,
+.spinner-red-only {
+  border-color: #db4437;
+}
+
+.spinner-yellow,
+.spinner-yellow-only {
+  border-color: #f4b400;
+}
+
+.spinner-green,
+.spinner-green-only {
+  border-color: #0f9d58;
+}
+
+/**
+ * IMPORTANT NOTE ABOUT CSS ANIMATION PROPERTIES (keanulee):
+ *
+ * iOS Safari (tested on iOS 8.1) does not handle animation-delay very well - it doesn't
+ * guarantee that the animation will start _exactly_ after that value. So we avoid using
+ * animation-delay and instead set custom keyframes for each color (as redundant as it
+ * seems).
+ *
+ * We write out each animation in full (instead of separating animation-name,
+ * animation-duration, etc.) because under the polyfill, Safari does not recognize those
+ * specific properties properly, treats them as -webkit-animation, and overrides the
+ * other animation rules. See https://github.com/Polymer/platform/issues/53.
+ */
+.active .spinner-layer.spinner-blue {
+  /* durations: 4 * ARCTIME */
+  -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, blue-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+  animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, blue-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+.active .spinner-layer.spinner-red {
+  /* durations: 4 * ARCTIME */
+  -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, red-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+  animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, red-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+.active .spinner-layer.spinner-yellow {
+  /* durations: 4 * ARCTIME */
+  -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, yellow-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+  animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, yellow-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+.active .spinner-layer.spinner-green {
+  /* durations: 4 * ARCTIME */
+  -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, green-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+  animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, green-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+.active .spinner-layer,
+.active .spinner-layer.spinner-blue-only,
+.active .spinner-layer.spinner-red-only,
+.active .spinner-layer.spinner-yellow-only,
+.active .spinner-layer.spinner-green-only {
+  /* durations: 4 * ARCTIME */
+  opacity: 1;
+  -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+  animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+@-webkit-keyframes fill-unfill-rotate {
+  12.5% {
+    -webkit-transform: rotate(135deg);
+  }
+  /* 0.5 * ARCSIZE */
+  25% {
+    -webkit-transform: rotate(270deg);
+  }
+  /* 1   * ARCSIZE */
+  37.5% {
+    -webkit-transform: rotate(405deg);
+  }
+  /* 1.5 * ARCSIZE */
+  50% {
+    -webkit-transform: rotate(540deg);
+  }
+  /* 2   * ARCSIZE */
+  62.5% {
+    -webkit-transform: rotate(675deg);
+  }
+  /* 2.5 * ARCSIZE */
+  75% {
+    -webkit-transform: rotate(810deg);
+  }
+  /* 3   * ARCSIZE */
+  87.5% {
+    -webkit-transform: rotate(945deg);
+  }
+  /* 3.5 * ARCSIZE */
+  to {
+    -webkit-transform: rotate(1080deg);
+  }
+  /* 4   * ARCSIZE */
+}
+
+@keyframes fill-unfill-rotate {
+  12.5% {
+    -webkit-transform: rotate(135deg);
+            transform: rotate(135deg);
+  }
+  /* 0.5 * ARCSIZE */
+  25% {
+    -webkit-transform: rotate(270deg);
+            transform: rotate(270deg);
+  }
+  /* 1   * ARCSIZE */
+  37.5% {
+    -webkit-transform: rotate(405deg);
+            transform: rotate(405deg);
+  }
+  /* 1.5 * ARCSIZE */
+  50% {
+    -webkit-transform: rotate(540deg);
+            transform: rotate(540deg);
+  }
+  /* 2   * ARCSIZE */
+  62.5% {
+    -webkit-transform: rotate(675deg);
+            transform: rotate(675deg);
+  }
+  /* 2.5 * ARCSIZE */
+  75% {
+    -webkit-transform: rotate(810deg);
+            transform: rotate(810deg);
+  }
+  /* 3   * ARCSIZE */
+  87.5% {
+    -webkit-transform: rotate(945deg);
+            transform: rotate(945deg);
+  }
+  /* 3.5 * ARCSIZE */
+  to {
+    -webkit-transform: rotate(1080deg);
+            transform: rotate(1080deg);
+  }
+  /* 4   * ARCSIZE */
+}
+
+@-webkit-keyframes blue-fade-in-out {
+  from {
+    opacity: 1;
+  }
+  25% {
+    opacity: 1;
+  }
+  26% {
+    opacity: 0;
+  }
+  89% {
+    opacity: 0;
+  }
+  90% {
+    opacity: 1;
+  }
+  100% {
+    opacity: 1;
+  }
+}
+
+@keyframes blue-fade-in-out {
+  from {
+    opacity: 1;
+  }
+  25% {
+    opacity: 1;
+  }
+  26% {
+    opacity: 0;
+  }
+  89% {
+    opacity: 0;
+  }
+  90% {
+    opacity: 1;
+  }
+  100% {
+    opacity: 1;
+  }
+}
+
+@-webkit-keyframes red-fade-in-out {
+  from {
+    opacity: 0;
+  }
+  15% {
+    opacity: 0;
+  }
+  25% {
+    opacity: 1;
+  }
+  50% {
+    opacity: 1;
+  }
+  51% {
+    opacity: 0;
+  }
+}
+
+@keyframes red-fade-in-out {
+  from {
+    opacity: 0;
+  }
+  15% {
+    opacity: 0;
+  }
+  25% {
+    opacity: 1;
+  }
+  50% {
+    opacity: 1;
+  }
+  51% {
+    opacity: 0;
+  }
+}
+
+@-webkit-keyframes yellow-fade-in-out {
+  from {
+    opacity: 0;
+  }
+  40% {
+    opacity: 0;
+  }
+  50% {
+    opacity: 1;
+  }
+  75% {
+    opacity: 1;
+  }
+  76% {
+    opacity: 0;
+  }
+}
+
+@keyframes yellow-fade-in-out {
+  from {
+    opacity: 0;
+  }
+  40% {
+    opacity: 0;
+  }
+  50% {
+    opacity: 1;
+  }
+  75% {
+    opacity: 1;
+  }
+  76% {
+    opacity: 0;
+  }
+}
+
+@-webkit-keyframes green-fade-in-out {
+  from {
+    opacity: 0;
+  }
+  65% {
+    opacity: 0;
+  }
+  75% {
+    opacity: 1;
+  }
+  90% {
+    opacity: 1;
+  }
+  100% {
+    opacity: 0;
+  }
+}
+
+@keyframes green-fade-in-out {
+  from {
+    opacity: 0;
+  }
+  65% {
+    opacity: 0;
+  }
+  75% {
+    opacity: 1;
+  }
+  90% {
+    opacity: 1;
+  }
+  100% {
+    opacity: 0;
+  }
+}
+
+/**
+ * Patch the gap that appear between the two adjacent div.circle-clipper while the
+ * spinner is rotating (appears on Chrome 38, Safari 7.1, and IE 11).
+ */
+.gap-patch {
+  position: absolute;
+  top: 0;
+  left: 45%;
+  width: 10%;
+  height: 100%;
+  overflow: hidden;
+  border-color: inherit;
+}
+
+.gap-patch .circle {
+  width: 1000%;
+  left: -450%;
+}
+
+.circle-clipper {
+  display: inline-block;
+  position: relative;
+  width: 50%;
+  height: 100%;
+  overflow: hidden;
+  border-color: inherit;
+}
+
+.circle-clipper .circle {
+  width: 200%;
+  height: 100%;
+  border-width: 3px;
+  /* STROKEWIDTH */
+  border-style: solid;
+  border-color: inherit;
+  border-bottom-color: transparent !important;
+  border-radius: 50%;
+  -webkit-animation: none;
+  animation: none;
+  position: absolute;
+  top: 0;
+  right: 0;
+  bottom: 0;
+}
+
+.circle-clipper.left .circle {
+  left: 0;
+  border-right-color: transparent !important;
+  -webkit-transform: rotate(129deg);
+  transform: rotate(129deg);
+}
+
+.circle-clipper.right .circle {
+  left: -100%;
+  border-left-color: transparent !important;
+  -webkit-transform: rotate(-129deg);
+  transform: rotate(-129deg);
+}
+
+.active .circle-clipper.left .circle {
+  /* duration: ARCTIME */
+  -webkit-animation: left-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+  animation: left-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+.active .circle-clipper.right .circle {
+  /* duration: ARCTIME */
+  -webkit-animation: right-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+  animation: right-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+@-webkit-keyframes left-spin {
+  from {
+    -webkit-transform: rotate(130deg);
+  }
+  50% {
+    -webkit-transform: rotate(-5deg);
+  }
+  to {
+    -webkit-transform: rotate(130deg);
+  }
+}
+
+@keyframes left-spin {
+  from {
+    -webkit-transform: rotate(130deg);
+            transform: rotate(130deg);
+  }
+  50% {
+    -webkit-transform: rotate(-5deg);
+            transform: rotate(-5deg);
+  }
+  to {
+    -webkit-transform: rotate(130deg);
+            transform: rotate(130deg);
+  }
+}
+
+@-webkit-keyframes right-spin {
+  from {
+    -webkit-transform: rotate(-130deg);
+  }
+  50% {
+    -webkit-transform: rotate(5deg);
+  }
+  to {
+    -webkit-transform: rotate(-130deg);
+  }
+}
+
+@keyframes right-spin {
+  from {
+    -webkit-transform: rotate(-130deg);
+            transform: rotate(-130deg);
+  }
+  50% {
+    -webkit-transform: rotate(5deg);
+            transform: rotate(5deg);
+  }
+  to {
+    -webkit-transform: rotate(-130deg);
+            transform: rotate(-130deg);
+  }
+}
+
+#spinnerContainer.cooldown {
+  /* duration: SHRINK_TIME */
+  -webkit-animation: container-rotate 1568ms linear infinite, fade-out 400ms cubic-bezier(0.4, 0, 0.2, 1);
+  animation: container-rotate 1568ms linear infinite, fade-out 400ms cubic-bezier(0.4, 0, 0.2, 1);
+}
+
+@-webkit-keyframes fade-out {
+  from {
+    opacity: 1;
+  }
+  to {
+    opacity: 0;
+  }
+}
+
+@keyframes fade-out {
+  from {
+    opacity: 1;
+  }
+  to {
+    opacity: 0;
+  }
+}
+
+.slider {
+  position: relative;
+  height: 400px;
+  width: 100%;
+}
+
+.slider.fullscreen {
+  height: 100%;
+  width: 100%;
+  position: absolute;
+  top: 0;
+  left: 0;
+  right: 0;
+  bottom: 0;
+}
+
+.slider.fullscreen ul.slides {
+  height: 100%;
+}
+
+.slider.fullscreen ul.indicators {
+  z-index: 2;
+  bottom: 30px;
+}
+
+.slider .slides {
+  background-color: #9e9e9e;
+  margin: 0;
+  height: 400px;
+}
+
+.slider .slides li {
+  opacity: 0;
+  position: absolute;
+  top: 0;
+  left: 0;
+  z-index: 1;
+  width: 100%;
+  height: inherit;
+  overflow: hidden;
+}
+
+.slider .slides li img {
+  height: 100%;
+  width: 100%;
+  background-size: cover;
+  background-position: center;
+}
+
+.slider .slides li .caption {
+  color: #fff;
+  position: absolute;
+  top: 15%;
+  left: 15%;
+  width: 70%;
+  opacity: 0;
+}
+
+.slider .slides li .caption p {
+  color: #e0e0e0;
+}
+
+.slider .slides li.active {
+  z-index: 2;
+}
+
+.slider .indicators {
+  position: absolute;
+  text-align: center;
+  left: 0;
+  right: 0;
+  bottom: 0;
+  margin: 0;
+}
+
+.slider .indicators .indicator-item {
+  display: inline-block;
+  position: relative;
+  cursor: pointer;
+  height: 16px;
+  width: 16px;
+  margin: 0 12px;
+  background-color: #e0e0e0;
+  transition: background-color .3s;
+  border-radius: 50%;
+}
+
+.slider .indicators .indicator-item.active {
+  background-color: #4CAF50;
+}
+
+.carousel {
+  overflow: hidden;
+  position: relative;
+  width: 100%;
+  height: 400px;
+  -webkit-perspective: 500px;
+          perspective: 500px;
+  -webkit-transform-style: preserve-3d;
+          transform-style: preserve-3d;
+  -webkit-transform-origin: 0% 50%;
+          transform-origin: 0% 50%;
+}
+
+.carousel.carousel-slider {
+  top: 0;
+  left: 0;
+  height: 0;
+}
+
+.carousel.carousel-slider .carousel-fixed-item {
+  position: absolute;
+  left: 0;
+  right: 0;
+  bottom: 20px;
+  z-index: 1;
+}
+
+.carousel.carousel-slider .carousel-fixed-item.with-indicators {
+  bottom: 68px;
+}
+
+.carousel.carousel-slider .carousel-item {
+  width: 100%;
+  height: 100%;
+  min-height: 400px;
+  position: absolute;
+  top: 0;
+  left: 0;
+}
+
+.carousel.carousel-slider .carousel-item h2 {
+  font-size: 24px;
+  font-weight: 500;
+  line-height: 32px;
+}
+
+.carousel.carousel-slider .carousel-item p {
+  font-size: 15px;
+}
+
+.carousel .carousel-item {
+  display: none;
+  width: 200px;
+  height: 200px;
+  position: absolute;
+  top: 0;
+  left: 0;
+}
+
+.carousel .carousel-item img {
+  width: 100%;
+}
+
+.carousel .indicators {
+  position: absolute;
+  text-align: center;
+  left: 0;
+  right: 0;
+  bottom: 0;
+  margin: 0;
+}
+
+.carousel .indicators .indicator-item {
+  display: inline-block;
+  position: relative;
+  cursor: pointer;
+  height: 8px;
+  width: 8px;
+  margin: 24px 4px;
+  background-color: rgba(255, 255, 255, 0.5);
+  transition: background-color .3s;
+  border-radius: 50%;
+}
+
+.carousel .indicators .indicator-item.active {
+  background-color: #fff;
+}
+
+/* ==========================================================================
+   $BASE-PICKER
+   ========================================================================== */
+/**
+ * Note: the root picker element should *NOT* be styled more than what's here.
+ */
+.picker {
+  font-size: 16px;
+  text-align: left;
+  line-height: 1.2;
+  color: #000000;
+  position: absolute;
+  z-index: 10000;
+  -webkit-user-select: none;
+  -moz-user-select: none;
+  -ms-user-select: none;
+  user-select: none;
+}
+
+/**
+ * The picker input element.
+ */
+.picker__input {
+  cursor: default;
+}
+
+/**
+ * When the picker is opened, the input element is "activated".
+ */
+.picker__input.picker__input--active {
+  border-color: #0089ec;
+}
+
+/**
+ * The holder is the only "scrollable" top-level container element.
+ */
+.picker__holder {
+  width: 100%;
+  overflow-y: auto;
+  -webkit-overflow-scrolling: touch;
+}
+
+/*!
+ * Default mobile-first, responsive styling for pickadate.js
+ * Demo: http://amsul.github.io/pickadate.js
+ */
+/**
+ * Note: the root picker element should *NOT* be styled more than what's here.
+ */
+/**
+ * Make the holder and frame fullscreen.
+ */
+.picker__holder,
+.picker__frame {
+  bottom: 0;
+  left: 0;
+  right: 0;
+  top: 100%;
+}
+
+/**
+ * The holder should overlay the entire screen.
+ */
+.picker__holder {
+  position: fixed;
+  transition: background 0.15s ease-out, top 0s 0.15s;
+  -webkit-backface-visibility: hidden;
+}
+
+/**
+ * The frame that bounds the box contents of the picker.
+ */
+.picker__frame {
+  position: absolute;
+  margin: 0 auto;
+  min-width: 256px;
+  width: 300px;
+  max-height: 350px;
+  -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)";
+  filter: alpha(opacity=0);
+  -moz-opacity: 0;
+  opacity: 0;
+  transition: all 0.15s ease-out;
+}
+
+@media (min-height: 28.875em) {
+  .picker__frame {
+    overflow: visible;
+    top: auto;
+    bottom: -100%;
+    max-height: 80%;
+  }
+}
+
+@media (min-height: 40.125em) {
+  .picker__frame {
+    margin-bottom: 7.5%;
+  }
+}
+
+/**
+ * The wrapper sets the stage to vertically align the box contents.
+ */
+.picker__wrap {
+  display: table;
+  width: 100%;
+  height: 100%;
+}
+
+@media (min-height: 28.875em) {
+  .picker__wrap {
+    display: block;
+  }
+}
+
+/**
+ * The box contains all the picker contents.
+ */
+.picker__box {
+  background: #ffffff;
+  display: table-cell;
+  vertical-align: middle;
+}
+
+@media (min-height: 28.875em) {
+  .picker__box {
+    display: block;
+    border: 1px solid #777777;
+    border-top-color: #898989;
+    border-bottom-width: 0;
+    border-radius: 5px 5px 0 0;
+    box-shadow: 0 12px 36px 16px rgba(0, 0, 0, 0.24);
+  }
+}
+
+/**
+ * When the picker opens...
+ */
+.picker--opened .picker__holder {
+  top: 0;
+  background: transparent;
+  -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorstr=#1E000000,endColorstr=#1E000000)";
+  zoom: 1;
+  background: rgba(0, 0, 0, 0.32);
+  transition: background 0.15s ease-out;
+}
+
+.picker--opened .picker__frame {
+  top: 0;
+  -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=100)";
+  filter: alpha(opacity=100);
+  -moz-opacity: 1;
+  opacity: 1;
+}
+
+@media (min-height: 35.875em) {
+  .picker--opened .picker__frame {
+    top: 10%;
+    bottom: auto;
+  }
+}
+
+/**
+ * For `large` screens, transform into an inline picker.
+ */
+/* ==========================================================================
+   CUSTOM MATERIALIZE STYLES
+   ========================================================================== */
+.picker__input.picker__input--active {
+  border-color: #E3F2FD;
+}
+
+.picker__frame {
+  margin: 0 auto;
+  max-width: 325px;
+}
+
+@media (min-height: 38.875em) {
+  .picker--opened .picker__frame {
+    top: 10%;
+    bottom: auto;
+  }
+}
+
+/* ==========================================================================
+   $BASE-DATE-PICKER
+   ========================================================================== */
+/**
+ * The picker box.
+ */
+.picker__box {
+  padding: 0 1em;
+}
+
+/**
+ * The header containing the month and year stuff.
+ */
+.picker__header {
+  text-align: center;
+  position: relative;
+  margin-top: .75em;
+}
+
+/**
+ * The month and year labels.
+ */
+.picker__month,
+.picker__year {
+  display: inline-block;
+  margin-left: .25em;
+  margin-right: .25em;
+}
+
+/**
+ * The month and year selectors.
+ */
+.picker__select--month,
+.picker__select--year {
+  height: 2em;
+  padding: 0;
+  margin-left: .25em;
+  margin-right: .25em;
+}
+
+.picker__select--month.browser-default {
+  display: inline;
+  background-color: #FFFFFF;
+  width: 40%;
+}
+
+.picker__select--year.browser-default {
+  display: inline;
+  background-color: #FFFFFF;
+  width: 26%;
+}
+
+.picker__select--month:focus,
+.picker__select--year:focus {
+  border-color: rgba(0, 0, 0, 0.05);
+}
+
+/**
+ * The month navigation buttons.
+ */
+.picker__nav--prev,
+.picker__nav--next {
+  position: absolute;
+  padding: .5em 1.25em;
+  width: 1em;
+  height: 1em;
+  box-sizing: content-box;
+  top: -0.25em;
+}
+
+.picker__nav--prev {
+  left: -1em;
+  padding-right: 1.25em;
+}
+
+.picker__nav--next {
+  right: -1em;
+  padding-left: 1.25em;
+}
+
+.picker__nav--disabled,
+.picker__nav--disabled:hover,
+.picker__nav--disabled:before,
+.picker__nav--disabled:before:hover {
+  cursor: default;
+  background: none;
+  border-right-color: #f5f5f5;
+  border-left-color: #f5f5f5;
+}
+
+/**
+ * The calendar table of dates
+ */
+.picker__table {
+  text-align: center;
+  border-collapse: collapse;
+  border-spacing: 0;
+  table-layout: fixed;
+  font-size: 1rem;
+  width: 100%;
+  margin-top: .75em;
+  margin-bottom: .5em;
+}
+
+.picker__table th, .picker__table td {
+  text-align: center;
+}
+
+.picker__table td {
+  margin: 0;
+  padding: 0;
+}
+
+/**
+ * The weekday labels
+ */
+.picker__weekday {
+  width: 14.285714286%;
+  font-size: .75em;
+  padding-bottom: .25em;
+  color: #999999;
+  font-weight: 500;
+  /* Increase the spacing a tad */
+}
+
+@media (min-height: 33.875em) {
+  .picker__weekday {
+    padding-bottom: .5em;
+  }
+}
+
+/**
+ * The days on the calendar
+ */
+.picker__day--today {
+  position: relative;
+  color: #595959;
+  letter-spacing: -.3;
+  padding: .75rem 0;
+  font-weight: 400;
+  border: 1px solid transparent;
+}
+
+.picker__day--disabled:before {
+  border-top-color: #aaaaaa;
+}
+
+.picker__day--infocus:hover {
+  cursor: pointer;
+  color: #000;
+  font-weight: 500;
+}
+
+.picker__day--outfocus {
+  display: none;
+  padding: .75rem 0;
+  color: #fff;
+}
+
+.picker__day--outfocus:hover {
+  cursor: pointer;
+  color: #dddddd;
+  font-weight: 500;
+}
+
+.picker__day--highlighted:hover,
+.picker--focused .picker__day--highlighted {
+  cursor: pointer;
+}
+
+.picker__day--selected,
+.picker__day--selected:hover,
+.picker--focused .picker__day--selected {
+  border-radius: 50%;
+  -webkit-transform: scale(0.75);
+          transform: scale(0.75);
+  background: #0089ec;
+  color: #ffffff;
+}
+
+.picker__day--disabled,
+.picker__day--disabled:hover,
+.picker--focused .picker__day--disabled {
+  background: #f5f5f5;
+  border-color: #f5f5f5;
+  color: #dddddd;
+  cursor: default;
+}
+
+.picker__day--highlighted.picker__day--disabled,
+.picker__day--highlighted.picker__day--disabled:hover {
+  background: #bbbbbb;
+}
+
+/**
+ * The footer containing the "today", "clear", and "close" buttons.
+ */
+.picker__footer {
+  text-align: center;
+  display: -webkit-flex;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-align-items: center;
+      -ms-flex-align: center;
+          align-items: center;
+  -webkit-justify-content: space-between;
+      -ms-flex-pack: justify;
+          justify-content: space-between;
+}
+
+.picker__button--today,
+.picker__button--clear,
+.picker__button--close {
+  border: 1px solid #ffffff;
+  background: #ffffff;
+  font-size: .8em;
+  padding: .66em 0;
+  font-weight: bold;
+  width: 33%;
+  display: inline-block;
+  vertical-align: bottom;
+}
+
+.picker__button--today:hover,
+.picker__button--clear:hover,
+.picker__button--close:hover {
+  cursor: pointer;
+  color: #000000;
+  background: #b1dcfb;
+  border-bottom-color: #b1dcfb;
+}
+
+.picker__button--today:focus,
+.picker__button--clear:focus,
+.picker__button--close:focus {
+  background: #b1dcfb;
+  border-color: rgba(0, 0, 0, 0.05);
+  outline: none;
+}
+
+.picker__button--today:before,
+.picker__button--clear:before,
+.picker__button--close:before {
+  position: relative;
+  display: inline-block;
+  height: 0;
+}
+
+.picker__button--today:before,
+.picker__button--clear:before {
+  content: " ";
+  margin-right: .45em;
+}
+
+.picker__button--today:before {
+  top: -0.05em;
+  width: 0;
+  border-top: 0.66em solid #0059bc;
+  border-left: .66em solid transparent;
+}
+
+.picker__button--clear:before {
+  top: -0.25em;
+  width: .66em;
+  border-top: 3px solid #ee2200;
+}
+
+.picker__button--close:before {
+  content: "\D7";
+  top: -0.1em;
+  vertical-align: top;
+  font-size: 1.1em;
+  margin-right: .35em;
+  color: #777777;
+}
+
+.picker__button--today[disabled],
+.picker__button--today[disabled]:hover {
+  background: #f5f5f5;
+  border-color: #f5f5f5;
+  color: #dddddd;
+  cursor: default;
+}
+
+.picker__button--today[disabled]:before {
+  border-top-color: #aaaaaa;
+}
+
+/* ==========================================================================
+   CUSTOM MATERIALIZE STYLES
+   ========================================================================== */
+.picker__box {
+  border-radius: 2px;
+  overflow: hidden;
+}
+
+.picker__date-display {
+  text-align: center;
+  background-color: #26a69a;
+  color: #fff;
+  padding-bottom: 15px;
+  font-weight: 300;
+}
+
+.picker__nav--prev:hover,
+.picker__nav--next:hover {
+  cursor: pointer;
+  color: #000000;
+  background: #a1ded8;
+}
+
+.picker__weekday-display {
+  background-color: #1f897f;
+  padding: 10px;
+  font-weight: 200;
+  letter-spacing: .5;
+  font-size: 1rem;
+  margin-bottom: 15px;
+}
+
+.picker__month-display {
+  text-transform: uppercase;
+  font-size: 2rem;
+}
+
+.picker__day-display {
+  font-size: 4.5rem;
+  font-weight: 400;
+}
+
+.picker__year-display {
+  font-size: 1.8rem;
+  color: rgba(255, 255, 255, 0.4);
+}
+
+.picker__box {
+  padding: 0;
+}
+
+.picker__calendar-container {
+  padding: 0 1rem;
+}
+
+.picker__calendar-container thead {
+  border: none;
+}
+
+.picker__table {
+  margin-top: 0;
+  margin-bottom: .5em;
+}
+
+.picker__day--infocus {
+  color: #595959;
+  letter-spacing: -.3;
+  padding: .75rem 0;
+  font-weight: 400;
+  border: 1px solid transparent;
+}
+
+.picker__day.picker__day--today {
+  color: #26a69a;
+}
+
+.picker__day.picker__day--today.picker__day--selected {
+  color: #fff;
+}
+
+.picker__weekday {
+  font-size: .9rem;
+}
+
+.picker__day--selected,
+.picker__day--selected:hover,
+.picker--focused .picker__day--selected {
+  border-radius: 50%;
+  -webkit-transform: scale(0.9);
+          transform: scale(0.9);
+  background-color: #26a69a;
+  color: #ffffff;
+}
+
+.picker__day--selected.picker__day--outfocus,
+.picker__day--selected:hover.picker__day--outfocus,
+.picker--focused .picker__day--selected.picker__day--outfocus {
+  background-color: #a1ded8;
+}
+
+.picker__footer {
+  text-align: right;
+  padding: 5px 10px;
+}
+
+.picker__close, .picker__today {
+  font-size: 1.1rem;
+  padding: 0 1rem;
+  color: #26a69a;
+}
+
+.picker__nav--prev:before,
+.picker__nav--next:before {
+  content: " ";
+  border-top: .5em solid transparent;
+  border-bottom: .5em solid transparent;
+  border-right: 0.75em solid #676767;
+  width: 0;
+  height: 0;
+  display: block;
+  margin: 0 auto;
+}
+
+.picker__nav--next:before {
+  border-right: 0;
+  border-left: 0.75em solid #676767;
+}
+
+button.picker__today:focus, button.picker__clear:focus, button.picker__close:focus {
+  background-color: #a1ded8;
+}
+
+/* ==========================================================================
+   $BASE-TIME-PICKER
+   ========================================================================== */
+/**
+ * The list of times.
+ */
+.picker__list {
+  list-style: none;
+  padding: 0.75em 0 4.2em;
+  margin: 0;
+}
+
+/**
+ * The times on the clock.
+ */
+.picker__list-item {
+  border-bottom: 1px solid #dddddd;
+  border-top: 1px solid #dddddd;
+  margin-bottom: -1px;
+  position: relative;
+  background: #ffffff;
+  padding: .75em 1.25em;
+}
+
+@media (min-height: 46.75em) {
+  .picker__list-item {
+    padding: .5em 1em;
+  }
+}
+
+/* Hovered time */
+.picker__list-item:hover {
+  cursor: pointer;
+  color: #000000;
+  background: #b1dcfb;
+  border-color: #0089ec;
+  z-index: 10;
+}
+
+/* Highlighted and hovered/focused time */
+.picker__list-item--highlighted {
+  border-color: #0089ec;
+  z-index: 10;
+}
+
+.picker__list-item--highlighted:hover,
+.picker--focused .picker__list-item--highlighted {
+  cursor: pointer;
+  color: #000000;
+  background: #b1dcfb;
+}
+
+/* Selected and hovered/focused time */
+.picker__list-item--selected,
+.picker__list-item--selected:hover,
+.picker--focused .picker__list-item--selected {
+  background: #0089ec;
+  color: #ffffff;
+  z-index: 10;
+}
+
+/* Disabled time */
+.picker__list-item--disabled,
+.picker__list-item--disabled:hover,
+.picker--focused .picker__list-item--disabled {
+  background: #f5f5f5;
+  border-color: #f5f5f5;
+  color: #dddddd;
+  cursor: default;
+  border-color: #dddddd;
+  z-index: auto;
+}
+
+/**
+ * The clear button
+ */
+.picker--time .picker__button--clear {
+  display: block;
+  width: 80%;
+  margin: 1em auto 0;
+  padding: 1em 1.25em;
+  background: none;
+  border: 0;
+  font-weight: 500;
+  font-size: .67em;
+  text-align: center;
+  text-transform: uppercase;
+  color: #666;
+}
+
+.picker--time .picker__button--clear:hover,
+.picker--time .picker__button--clear:focus {
+  color: #000000;
+  background: #b1dcfb;
+  background: #ee2200;
+  border-color: #ee2200;
+  cursor: pointer;
+  color: #ffffff;
+  outline: none;
+}
+
+.picker--time .picker__button--clear:before {
+  top: -0.25em;
+  color: #666;
+  font-size: 1.25em;
+  font-weight: bold;
+}
+
+.picker--time .picker__button--clear:hover:before,
+.picker--time .picker__button--clear:focus:before {
+  color: #ffffff;
+}
+
+/* ==========================================================================
+   $DEFAULT-TIME-PICKER
+   ========================================================================== */
+/**
+ * The frame the bounds the time picker.
+ */
+.picker--time .picker__frame {
+  min-width: 256px;
+  max-width: 320px;
+}
+
+/**
+ * The picker box.
+ */
+.picker--time .picker__box {
+  font-size: 1em;
+  background: #f2f2f2;
+  padding: 0;
+}
+
+@media (min-height: 40.125em) {
+  .picker--time .picker__box {
+    margin-bottom: 5em;
+  }
+}
diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/css/materialize.min.css b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/css/materialize.min.css
new file mode 100644 (file)
index 0000000..9104745
--- /dev/null
@@ -0,0 +1,16 @@
+/*!
+ * Materialize v0.98.0 (http://materializecss.com)
+ * Copyright 2014-2015 Materialize
+ * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
+ */
+.materialize-red{background-color:#e51c23 !important}.materialize-red-text{color:#e51c23 !important}.materialize-red.lighten-5{background-color:#fdeaeb !important}.materialize-red-text.text-lighten-5{color:#fdeaeb !important}.materialize-red.lighten-4{background-color:#f8c1c3 !important}.materialize-red-text.text-lighten-4{color:#f8c1c3 !important}.materialize-red.lighten-3{background-color:#f3989b !important}.materialize-red-text.text-lighten-3{color:#f3989b !important}.materialize-red.lighten-2{background-color:#ee6e73 !important}.materialize-red-text.text-lighten-2{color:#ee6e73 !important}.materialize-red.lighten-1{background-color:#ea454b !important}.materialize-red-text.text-lighten-1{color:#ea454b !important}.materialize-red.darken-1{background-color:#d0181e !important}.materialize-red-text.text-darken-1{color:#d0181e !important}.materialize-red.darken-2{background-color:#b9151b !important}.materialize-red-text.text-darken-2{color:#b9151b !important}.materialize-red.darken-3{background-color:#a21318 !important}.materialize-red-text.text-darken-3{color:#a21318 !important}.materialize-red.darken-4{background-color:#8b1014 !important}.materialize-red-text.text-darken-4{color:#8b1014 !important}.red{background-color:#F44336 !important}.red-text{color:#F44336 !important}.red.lighten-5{background-color:#FFEBEE !important}.red-text.text-lighten-5{color:#FFEBEE !important}.red.lighten-4{background-color:#FFCDD2 !important}.red-text.text-lighten-4{color:#FFCDD2 !important}.red.lighten-3{background-color:#EF9A9A !important}.red-text.text-lighten-3{color:#EF9A9A !important}.red.lighten-2{background-color:#E57373 !important}.red-text.text-lighten-2{color:#E57373 !important}.red.lighten-1{background-color:#EF5350 !important}.red-text.text-lighten-1{color:#EF5350 !important}.red.darken-1{background-color:#E53935 !important}.red-text.text-darken-1{color:#E53935 !important}.red.darken-2{background-color:#D32F2F !important}.red-text.text-darken-2{color:#D32F2F !important}.red.darken-3{background-color:#C62828 !important}.red-text.text-darken-3{color:#C62828 !important}.red.darken-4{background-color:#B71C1C !important}.red-text.text-darken-4{color:#B71C1C !important}.red.accent-1{background-color:#FF8A80 !important}.red-text.text-accent-1{color:#FF8A80 !important}.red.accent-2{background-color:#FF5252 !important}.red-text.text-accent-2{color:#FF5252 !important}.red.accent-3{background-color:#FF1744 !important}.red-text.text-accent-3{color:#FF1744 !important}.red.accent-4{background-color:#D50000 !important}.red-text.text-accent-4{color:#D50000 !important}.pink{background-color:#e91e63 !important}.pink-text{color:#e91e63 !important}.pink.lighten-5{background-color:#fce4ec !important}.pink-text.text-lighten-5{color:#fce4ec !important}.pink.lighten-4{background-color:#f8bbd0 !important}.pink-text.text-lighten-4{color:#f8bbd0 !important}.pink.lighten-3{background-color:#f48fb1 !important}.pink-text.text-lighten-3{color:#f48fb1 !important}.pink.lighten-2{background-color:#f06292 !important}.pink-text.text-lighten-2{color:#f06292 !important}.pink.lighten-1{background-color:#ec407a !important}.pink-text.text-lighten-1{color:#ec407a !important}.pink.darken-1{background-color:#d81b60 !important}.pink-text.text-darken-1{color:#d81b60 !important}.pink.darken-2{background-color:#c2185b !important}.pink-text.text-darken-2{color:#c2185b !important}.pink.darken-3{background-color:#ad1457 !important}.pink-text.text-darken-3{color:#ad1457 !important}.pink.darken-4{background-color:#880e4f !important}.pink-text.text-darken-4{color:#880e4f !important}.pink.accent-1{background-color:#ff80ab !important}.pink-text.text-accent-1{color:#ff80ab !important}.pink.accent-2{background-color:#ff4081 !important}.pink-text.text-accent-2{color:#ff4081 !important}.pink.accent-3{background-color:#f50057 !important}.pink-text.text-accent-3{color:#f50057 !important}.pink.accent-4{background-color:#c51162 !important}.pink-text.text-accent-4{color:#c51162 !important}.purple{background-color:#9c27b0 !important}.purple-text{color:#9c27b0 !important}.purple.lighten-5{background-color:#f3e5f5 !important}.purple-text.text-lighten-5{color:#f3e5f5 !important}.purple.lighten-4{background-color:#e1bee7 !important}.purple-text.text-lighten-4{color:#e1bee7 !important}.purple.lighten-3{background-color:#ce93d8 !important}.purple-text.text-lighten-3{color:#ce93d8 !important}.purple.lighten-2{background-color:#ba68c8 !important}.purple-text.text-lighten-2{color:#ba68c8 !important}.purple.lighten-1{background-color:#ab47bc !important}.purple-text.text-lighten-1{color:#ab47bc !important}.purple.darken-1{background-color:#8e24aa !important}.purple-text.text-darken-1{color:#8e24aa !important}.purple.darken-2{background-color:#7b1fa2 !important}.purple-text.text-darken-2{color:#7b1fa2 !important}.purple.darken-3{background-color:#6a1b9a !important}.purple-text.text-darken-3{color:#6a1b9a !important}.purple.darken-4{background-color:#4a148c !important}.purple-text.text-darken-4{color:#4a148c !important}.purple.accent-1{background-color:#ea80fc !important}.purple-text.text-accent-1{color:#ea80fc !important}.purple.accent-2{background-color:#e040fb !important}.purple-text.text-accent-2{color:#e040fb !important}.purple.accent-3{background-color:#d500f9 !important}.purple-text.text-accent-3{color:#d500f9 !important}.purple.accent-4{background-color:#a0f !important}.purple-text.text-accent-4{color:#a0f !important}.deep-purple{background-color:#673ab7 !important}.deep-purple-text{color:#673ab7 !important}.deep-purple.lighten-5{background-color:#ede7f6 !important}.deep-purple-text.text-lighten-5{color:#ede7f6 !important}.deep-purple.lighten-4{background-color:#d1c4e9 !important}.deep-purple-text.text-lighten-4{color:#d1c4e9 !important}.deep-purple.lighten-3{background-color:#b39ddb !important}.deep-purple-text.text-lighten-3{color:#b39ddb !important}.deep-purple.lighten-2{background-color:#9575cd !important}.deep-purple-text.text-lighten-2{color:#9575cd !important}.deep-purple.lighten-1{background-color:#7e57c2 !important}.deep-purple-text.text-lighten-1{color:#7e57c2 !important}.deep-purple.darken-1{background-color:#5e35b1 !important}.deep-purple-text.text-darken-1{color:#5e35b1 !important}.deep-purple.darken-2{background-color:#512da8 !important}.deep-purple-text.text-darken-2{color:#512da8 !important}.deep-purple.darken-3{background-color:#4527a0 !important}.deep-purple-text.text-darken-3{color:#4527a0 !important}.deep-purple.darken-4{background-color:#311b92 !important}.deep-purple-text.text-darken-4{color:#311b92 !important}.deep-purple.accent-1{background-color:#b388ff !important}.deep-purple-text.text-accent-1{color:#b388ff !important}.deep-purple.accent-2{background-color:#7c4dff !important}.deep-purple-text.text-accent-2{color:#7c4dff !important}.deep-purple.accent-3{background-color:#651fff !important}.deep-purple-text.text-accent-3{color:#651fff !important}.deep-purple.accent-4{background-color:#6200ea !important}.deep-purple-text.text-accent-4{color:#6200ea !important}.indigo{background-color:#3f51b5 !important}.indigo-text{color:#3f51b5 !important}.indigo.lighten-5{background-color:#e8eaf6 !important}.indigo-text.text-lighten-5{color:#e8eaf6 !important}.indigo.lighten-4{background-color:#c5cae9 !important}.indigo-text.text-lighten-4{color:#c5cae9 !important}.indigo.lighten-3{background-color:#9fa8da !important}.indigo-text.text-lighten-3{color:#9fa8da !important}.indigo.lighten-2{background-color:#7986cb !important}.indigo-text.text-lighten-2{color:#7986cb !important}.indigo.lighten-1{background-color:#5c6bc0 !important}.indigo-text.text-lighten-1{color:#5c6bc0 !important}.indigo.darken-1{background-color:#3949ab !important}.indigo-text.text-darken-1{color:#3949ab !important}.indigo.darken-2{background-color:#303f9f !important}.indigo-text.text-darken-2{color:#303f9f !important}.indigo.darken-3{background-color:#283593 !important}.indigo-text.text-darken-3{color:#283593 !important}.indigo.darken-4{background-color:#1a237e !important}.indigo-text.text-darken-4{color:#1a237e !important}.indigo.accent-1{background-color:#8c9eff !important}.indigo-text.text-accent-1{color:#8c9eff !important}.indigo.accent-2{background-color:#536dfe !important}.indigo-text.text-accent-2{color:#536dfe !important}.indigo.accent-3{background-color:#3d5afe !important}.indigo-text.text-accent-3{color:#3d5afe !important}.indigo.accent-4{background-color:#304ffe !important}.indigo-text.text-accent-4{color:#304ffe !important}.blue{background-color:#2196F3 !important}.blue-text{color:#2196F3 !important}.blue.lighten-5{background-color:#E3F2FD !important}.blue-text.text-lighten-5{color:#E3F2FD !important}.blue.lighten-4{background-color:#BBDEFB !important}.blue-text.text-lighten-4{color:#BBDEFB !important}.blue.lighten-3{background-color:#90CAF9 !important}.blue-text.text-lighten-3{color:#90CAF9 !important}.blue.lighten-2{background-color:#64B5F6 !important}.blue-text.text-lighten-2{color:#64B5F6 !important}.blue.lighten-1{background-color:#42A5F5 !important}.blue-text.text-lighten-1{color:#42A5F5 !important}.blue.darken-1{background-color:#1E88E5 !important}.blue-text.text-darken-1{color:#1E88E5 !important}.blue.darken-2{background-color:#1976D2 !important}.blue-text.text-darken-2{color:#1976D2 !important}.blue.darken-3{background-color:#1565C0 !important}.blue-text.text-darken-3{color:#1565C0 !important}.blue.darken-4{background-color:#0D47A1 !important}.blue-text.text-darken-4{color:#0D47A1 !important}.blue.accent-1{background-color:#82B1FF !important}.blue-text.text-accent-1{color:#82B1FF !important}.blue.accent-2{background-color:#448AFF !important}.blue-text.text-accent-2{color:#448AFF !important}.blue.accent-3{background-color:#2979FF !important}.blue-text.text-accent-3{color:#2979FF !important}.blue.accent-4{background-color:#2962FF !important}.blue-text.text-accent-4{color:#2962FF !important}.light-blue{background-color:#03a9f4 !important}.light-blue-text{color:#03a9f4 !important}.light-blue.lighten-5{background-color:#e1f5fe !important}.light-blue-text.text-lighten-5{color:#e1f5fe !important}.light-blue.lighten-4{background-color:#b3e5fc !important}.light-blue-text.text-lighten-4{color:#b3e5fc !important}.light-blue.lighten-3{background-color:#81d4fa !important}.light-blue-text.text-lighten-3{color:#81d4fa !important}.light-blue.lighten-2{background-color:#4fc3f7 !important}.light-blue-text.text-lighten-2{color:#4fc3f7 !important}.light-blue.lighten-1{background-color:#29b6f6 !important}.light-blue-text.text-lighten-1{color:#29b6f6 !important}.light-blue.darken-1{background-color:#039be5 !important}.light-blue-text.text-darken-1{color:#039be5 !important}.light-blue.darken-2{background-color:#0288d1 !important}.light-blue-text.text-darken-2{color:#0288d1 !important}.light-blue.darken-3{background-color:#0277bd !important}.light-blue-text.text-darken-3{color:#0277bd !important}.light-blue.darken-4{background-color:#01579b !important}.light-blue-text.text-darken-4{color:#01579b !important}.light-blue.accent-1{background-color:#80d8ff !important}.light-blue-text.text-accent-1{color:#80d8ff !important}.light-blue.accent-2{background-color:#40c4ff !important}.light-blue-text.text-accent-2{color:#40c4ff !important}.light-blue.accent-3{background-color:#00b0ff !important}.light-blue-text.text-accent-3{color:#00b0ff !important}.light-blue.accent-4{background-color:#0091ea !important}.light-blue-text.text-accent-4{color:#0091ea !important}.cyan{background-color:#00bcd4 !important}.cyan-text{color:#00bcd4 !important}.cyan.lighten-5{background-color:#e0f7fa !important}.cyan-text.text-lighten-5{color:#e0f7fa !important}.cyan.lighten-4{background-color:#b2ebf2 !important}.cyan-text.text-lighten-4{color:#b2ebf2 !important}.cyan.lighten-3{background-color:#80deea !important}.cyan-text.text-lighten-3{color:#80deea !important}.cyan.lighten-2{background-color:#4dd0e1 !important}.cyan-text.text-lighten-2{color:#4dd0e1 !important}.cyan.lighten-1{background-color:#26c6da !important}.cyan-text.text-lighten-1{color:#26c6da !important}.cyan.darken-1{background-color:#00acc1 !important}.cyan-text.text-darken-1{color:#00acc1 !important}.cyan.darken-2{background-color:#0097a7 !important}.cyan-text.text-darken-2{color:#0097a7 !important}.cyan.darken-3{background-color:#00838f !important}.cyan-text.text-darken-3{color:#00838f !important}.cyan.darken-4{background-color:#006064 !important}.cyan-text.text-darken-4{color:#006064 !important}.cyan.accent-1{background-color:#84ffff !important}.cyan-text.text-accent-1{color:#84ffff !important}.cyan.accent-2{background-color:#18ffff !important}.cyan-text.text-accent-2{color:#18ffff !important}.cyan.accent-3{background-color:#00e5ff !important}.cyan-text.text-accent-3{color:#00e5ff !important}.cyan.accent-4{background-color:#00b8d4 !important}.cyan-text.text-accent-4{color:#00b8d4 !important}.teal{background-color:#009688 !important}.teal-text{color:#009688 !important}.teal.lighten-5{background-color:#e0f2f1 !important}.teal-text.text-lighten-5{color:#e0f2f1 !important}.teal.lighten-4{background-color:#b2dfdb !important}.teal-text.text-lighten-4{color:#b2dfdb !important}.teal.lighten-3{background-color:#80cbc4 !important}.teal-text.text-lighten-3{color:#80cbc4 !important}.teal.lighten-2{background-color:#4db6ac !important}.teal-text.text-lighten-2{color:#4db6ac !important}.teal.lighten-1{background-color:#26a69a !important}.teal-text.text-lighten-1{color:#26a69a !important}.teal.darken-1{background-color:#00897b !important}.teal-text.text-darken-1{color:#00897b !important}.teal.darken-2{background-color:#00796b !important}.teal-text.text-darken-2{color:#00796b !important}.teal.darken-3{background-color:#00695c !important}.teal-text.text-darken-3{color:#00695c !important}.teal.darken-4{background-color:#004d40 !important}.teal-text.text-darken-4{color:#004d40 !important}.teal.accent-1{background-color:#a7ffeb !important}.teal-text.text-accent-1{color:#a7ffeb !important}.teal.accent-2{background-color:#64ffda !important}.teal-text.text-accent-2{color:#64ffda !important}.teal.accent-3{background-color:#1de9b6 !important}.teal-text.text-accent-3{color:#1de9b6 !important}.teal.accent-4{background-color:#00bfa5 !important}.teal-text.text-accent-4{color:#00bfa5 !important}.green{background-color:#4CAF50 !important}.green-text{color:#4CAF50 !important}.green.lighten-5{background-color:#E8F5E9 !important}.green-text.text-lighten-5{color:#E8F5E9 !important}.green.lighten-4{background-color:#C8E6C9 !important}.green-text.text-lighten-4{color:#C8E6C9 !important}.green.lighten-3{background-color:#A5D6A7 !important}.green-text.text-lighten-3{color:#A5D6A7 !important}.green.lighten-2{background-color:#81C784 !important}.green-text.text-lighten-2{color:#81C784 !important}.green.lighten-1{background-color:#66BB6A !important}.green-text.text-lighten-1{color:#66BB6A !important}.green.darken-1{background-color:#43A047 !important}.green-text.text-darken-1{color:#43A047 !important}.green.darken-2{background-color:#388E3C !important}.green-text.text-darken-2{color:#388E3C !important}.green.darken-3{background-color:#2E7D32 !important}.green-text.text-darken-3{color:#2E7D32 !important}.green.darken-4{background-color:#1B5E20 !important}.green-text.text-darken-4{color:#1B5E20 !important}.green.accent-1{background-color:#B9F6CA !important}.green-text.text-accent-1{color:#B9F6CA !important}.green.accent-2{background-color:#69F0AE !important}.green-text.text-accent-2{color:#69F0AE !important}.green.accent-3{background-color:#00E676 !important}.green-text.text-accent-3{color:#00E676 !important}.green.accent-4{background-color:#00C853 !important}.green-text.text-accent-4{color:#00C853 !important}.light-green{background-color:#8bc34a !important}.light-green-text{color:#8bc34a !important}.light-green.lighten-5{background-color:#f1f8e9 !important}.light-green-text.text-lighten-5{color:#f1f8e9 !important}.light-green.lighten-4{background-color:#dcedc8 !important}.light-green-text.text-lighten-4{color:#dcedc8 !important}.light-green.lighten-3{background-color:#c5e1a5 !important}.light-green-text.text-lighten-3{color:#c5e1a5 !important}.light-green.lighten-2{background-color:#aed581 !important}.light-green-text.text-lighten-2{color:#aed581 !important}.light-green.lighten-1{background-color:#9ccc65 !important}.light-green-text.text-lighten-1{color:#9ccc65 !important}.light-green.darken-1{background-color:#7cb342 !important}.light-green-text.text-darken-1{color:#7cb342 !important}.light-green.darken-2{background-color:#689f38 !important}.light-green-text.text-darken-2{color:#689f38 !important}.light-green.darken-3{background-color:#558b2f !important}.light-green-text.text-darken-3{color:#558b2f !important}.light-green.darken-4{background-color:#33691e !important}.light-green-text.text-darken-4{color:#33691e !important}.light-green.accent-1{background-color:#ccff90 !important}.light-green-text.text-accent-1{color:#ccff90 !important}.light-green.accent-2{background-color:#b2ff59 !important}.light-green-text.text-accent-2{color:#b2ff59 !important}.light-green.accent-3{background-color:#76ff03 !important}.light-green-text.text-accent-3{color:#76ff03 !important}.light-green.accent-4{background-color:#64dd17 !important}.light-green-text.text-accent-4{color:#64dd17 !important}.lime{background-color:#cddc39 !important}.lime-text{color:#cddc39 !important}.lime.lighten-5{background-color:#f9fbe7 !important}.lime-text.text-lighten-5{color:#f9fbe7 !important}.lime.lighten-4{background-color:#f0f4c3 !important}.lime-text.text-lighten-4{color:#f0f4c3 !important}.lime.lighten-3{background-color:#e6ee9c !important}.lime-text.text-lighten-3{color:#e6ee9c !important}.lime.lighten-2{background-color:#dce775 !important}.lime-text.text-lighten-2{color:#dce775 !important}.lime.lighten-1{background-color:#d4e157 !important}.lime-text.text-lighten-1{color:#d4e157 !important}.lime.darken-1{background-color:#c0ca33 !important}.lime-text.text-darken-1{color:#c0ca33 !important}.lime.darken-2{background-color:#afb42b !important}.lime-text.text-darken-2{color:#afb42b !important}.lime.darken-3{background-color:#9e9d24 !important}.lime-text.text-darken-3{color:#9e9d24 !important}.lime.darken-4{background-color:#827717 !important}.lime-text.text-darken-4{color:#827717 !important}.lime.accent-1{background-color:#f4ff81 !important}.lime-text.text-accent-1{color:#f4ff81 !important}.lime.accent-2{background-color:#eeff41 !important}.lime-text.text-accent-2{color:#eeff41 !important}.lime.accent-3{background-color:#c6ff00 !important}.lime-text.text-accent-3{color:#c6ff00 !important}.lime.accent-4{background-color:#aeea00 !important}.lime-text.text-accent-4{color:#aeea00 !important}.yellow{background-color:#ffeb3b !important}.yellow-text{color:#ffeb3b !important}.yellow.lighten-5{background-color:#fffde7 !important}.yellow-text.text-lighten-5{color:#fffde7 !important}.yellow.lighten-4{background-color:#fff9c4 !important}.yellow-text.text-lighten-4{color:#fff9c4 !important}.yellow.lighten-3{background-color:#fff59d !important}.yellow-text.text-lighten-3{color:#fff59d !important}.yellow.lighten-2{background-color:#fff176 !important}.yellow-text.text-lighten-2{color:#fff176 !important}.yellow.lighten-1{background-color:#ffee58 !important}.yellow-text.text-lighten-1{color:#ffee58 !important}.yellow.darken-1{background-color:#fdd835 !important}.yellow-text.text-darken-1{color:#fdd835 !important}.yellow.darken-2{background-color:#fbc02d !important}.yellow-text.text-darken-2{color:#fbc02d !important}.yellow.darken-3{background-color:#f9a825 !important}.yellow-text.text-darken-3{color:#f9a825 !important}.yellow.darken-4{background-color:#f57f17 !important}.yellow-text.text-darken-4{color:#f57f17 !important}.yellow.accent-1{background-color:#ffff8d !important}.yellow-text.text-accent-1{color:#ffff8d !important}.yellow.accent-2{background-color:#ff0 !important}.yellow-text.text-accent-2{color:#ff0 !important}.yellow.accent-3{background-color:#ffea00 !important}.yellow-text.text-accent-3{color:#ffea00 !important}.yellow.accent-4{background-color:#ffd600 !important}.yellow-text.text-accent-4{color:#ffd600 !important}.amber{background-color:#ffc107 !important}.amber-text{color:#ffc107 !important}.amber.lighten-5{background-color:#fff8e1 !important}.amber-text.text-lighten-5{color:#fff8e1 !important}.amber.lighten-4{background-color:#ffecb3 !important}.amber-text.text-lighten-4{color:#ffecb3 !important}.amber.lighten-3{background-color:#ffe082 !important}.amber-text.text-lighten-3{color:#ffe082 !important}.amber.lighten-2{background-color:#ffd54f !important}.amber-text.text-lighten-2{color:#ffd54f !important}.amber.lighten-1{background-color:#ffca28 !important}.amber-text.text-lighten-1{color:#ffca28 !important}.amber.darken-1{background-color:#ffb300 !important}.amber-text.text-darken-1{color:#ffb300 !important}.amber.darken-2{background-color:#ffa000 !important}.amber-text.text-darken-2{color:#ffa000 !important}.amber.darken-3{background-color:#ff8f00 !important}.amber-text.text-darken-3{color:#ff8f00 !important}.amber.darken-4{background-color:#ff6f00 !important}.amber-text.text-darken-4{color:#ff6f00 !important}.amber.accent-1{background-color:#ffe57f !important}.amber-text.text-accent-1{color:#ffe57f !important}.amber.accent-2{background-color:#ffd740 !important}.amber-text.text-accent-2{color:#ffd740 !important}.amber.accent-3{background-color:#ffc400 !important}.amber-text.text-accent-3{color:#ffc400 !important}.amber.accent-4{background-color:#ffab00 !important}.amber-text.text-accent-4{color:#ffab00 !important}.orange{background-color:#ff9800 !important}.orange-text{color:#ff9800 !important}.orange.lighten-5{background-color:#fff3e0 !important}.orange-text.text-lighten-5{color:#fff3e0 !important}.orange.lighten-4{background-color:#ffe0b2 !important}.orange-text.text-lighten-4{color:#ffe0b2 !important}.orange.lighten-3{background-color:#ffcc80 !important}.orange-text.text-lighten-3{color:#ffcc80 !important}.orange.lighten-2{background-color:#ffb74d !important}.orange-text.text-lighten-2{color:#ffb74d !important}.orange.lighten-1{background-color:#ffa726 !important}.orange-text.text-lighten-1{color:#ffa726 !important}.orange.darken-1{background-color:#fb8c00 !important}.orange-text.text-darken-1{color:#fb8c00 !important}.orange.darken-2{background-color:#f57c00 !important}.orange-text.text-darken-2{color:#f57c00 !important}.orange.darken-3{background-color:#ef6c00 !important}.orange-text.text-darken-3{color:#ef6c00 !important}.orange.darken-4{background-color:#e65100 !important}.orange-text.text-darken-4{color:#e65100 !important}.orange.accent-1{background-color:#ffd180 !important}.orange-text.text-accent-1{color:#ffd180 !important}.orange.accent-2{background-color:#ffab40 !important}.orange-text.text-accent-2{color:#ffab40 !important}.orange.accent-3{background-color:#ff9100 !important}.orange-text.text-accent-3{color:#ff9100 !important}.orange.accent-4{background-color:#ff6d00 !important}.orange-text.text-accent-4{color:#ff6d00 !important}.deep-orange{background-color:#ff5722 !important}.deep-orange-text{color:#ff5722 !important}.deep-orange.lighten-5{background-color:#fbe9e7 !important}.deep-orange-text.text-lighten-5{color:#fbe9e7 !important}.deep-orange.lighten-4{background-color:#ffccbc !important}.deep-orange-text.text-lighten-4{color:#ffccbc !important}.deep-orange.lighten-3{background-color:#ffab91 !important}.deep-orange-text.text-lighten-3{color:#ffab91 !important}.deep-orange.lighten-2{background-color:#ff8a65 !important}.deep-orange-text.text-lighten-2{color:#ff8a65 !important}.deep-orange.lighten-1{background-color:#ff7043 !important}.deep-orange-text.text-lighten-1{color:#ff7043 !important}.deep-orange.darken-1{background-color:#f4511e !important}.deep-orange-text.text-darken-1{color:#f4511e !important}.deep-orange.darken-2{background-color:#e64a19 !important}.deep-orange-text.text-darken-2{color:#e64a19 !important}.deep-orange.darken-3{background-color:#d84315 !important}.deep-orange-text.text-darken-3{color:#d84315 !important}.deep-orange.darken-4{background-color:#bf360c !important}.deep-orange-text.text-darken-4{color:#bf360c !important}.deep-orange.accent-1{background-color:#ff9e80 !important}.deep-orange-text.text-accent-1{color:#ff9e80 !important}.deep-orange.accent-2{background-color:#ff6e40 !important}.deep-orange-text.text-accent-2{color:#ff6e40 !important}.deep-orange.accent-3{background-color:#ff3d00 !important}.deep-orange-text.text-accent-3{color:#ff3d00 !important}.deep-orange.accent-4{background-color:#dd2c00 !important}.deep-orange-text.text-accent-4{color:#dd2c00 !important}.brown{background-color:#795548 !important}.brown-text{color:#795548 !important}.brown.lighten-5{background-color:#efebe9 !important}.brown-text.text-lighten-5{color:#efebe9 !important}.brown.lighten-4{background-color:#d7ccc8 !important}.brown-text.text-lighten-4{color:#d7ccc8 !important}.brown.lighten-3{background-color:#bcaaa4 !important}.brown-text.text-lighten-3{color:#bcaaa4 !important}.brown.lighten-2{background-color:#a1887f !important}.brown-text.text-lighten-2{color:#a1887f !important}.brown.lighten-1{background-color:#8d6e63 !important}.brown-text.text-lighten-1{color:#8d6e63 !important}.brown.darken-1{background-color:#6d4c41 !important}.brown-text.text-darken-1{color:#6d4c41 !important}.brown.darken-2{background-color:#5d4037 !important}.brown-text.text-darken-2{color:#5d4037 !important}.brown.darken-3{background-color:#4e342e !important}.brown-text.text-darken-3{color:#4e342e !important}.brown.darken-4{background-color:#3e2723 !important}.brown-text.text-darken-4{color:#3e2723 !important}.blue-grey{background-color:#607d8b !important}.blue-grey-text{color:#607d8b !important}.blue-grey.lighten-5{background-color:#eceff1 !important}.blue-grey-text.text-lighten-5{color:#eceff1 !important}.blue-grey.lighten-4{background-color:#cfd8dc !important}.blue-grey-text.text-lighten-4{color:#cfd8dc !important}.blue-grey.lighten-3{background-color:#b0bec5 !important}.blue-grey-text.text-lighten-3{color:#b0bec5 !important}.blue-grey.lighten-2{background-color:#90a4ae !important}.blue-grey-text.text-lighten-2{color:#90a4ae !important}.blue-grey.lighten-1{background-color:#78909c !important}.blue-grey-text.text-lighten-1{color:#78909c !important}.blue-grey.darken-1{background-color:#546e7a !important}.blue-grey-text.text-darken-1{color:#546e7a !important}.blue-grey.darken-2{background-color:#455a64 !important}.blue-grey-text.text-darken-2{color:#455a64 !important}.blue-grey.darken-3{background-color:#37474f !important}.blue-grey-text.text-darken-3{color:#37474f !important}.blue-grey.darken-4{background-color:#263238 !important}.blue-grey-text.text-darken-4{color:#263238 !important}.grey{background-color:#9e9e9e !important}.grey-text{color:#9e9e9e !important}.grey.lighten-5{background-color:#fafafa !important}.grey-text.text-lighten-5{color:#fafafa !important}.grey.lighten-4{background-color:#f5f5f5 !important}.grey-text.text-lighten-4{color:#f5f5f5 !important}.grey.lighten-3{background-color:#eee !important}.grey-text.text-lighten-3{color:#eee !important}.grey.lighten-2{background-color:#e0e0e0 !important}.grey-text.text-lighten-2{color:#e0e0e0 !important}.grey.lighten-1{background-color:#bdbdbd !important}.grey-text.text-lighten-1{color:#bdbdbd !important}.grey.darken-1{background-color:#757575 !important}.grey-text.text-darken-1{color:#757575 !important}.grey.darken-2{background-color:#616161 !important}.grey-text.text-darken-2{color:#616161 !important}.grey.darken-3{background-color:#424242 !important}.grey-text.text-darken-3{color:#424242 !important}.grey.darken-4{background-color:#212121 !important}.grey-text.text-darken-4{color:#212121 !important}.black{background-color:#000 !important}.black-text{color:#000 !important}.white{background-color:#fff !important}.white-text{color:#fff !important}.transparent{background-color:transparent !important}.transparent-text{color:transparent !important}/*! normalize.css v3.0.3 | MIT License | github.com/necolas/normalize.css */html{font-family:sans-serif;-ms-text-size-adjust:100%;-webkit-text-size-adjust:100%}body{margin:0}article,aside,details,figcaption,figure,footer,header,hgroup,main,menu,nav,section,summary{display:block}audio,canvas,progress,video{display:inline-block;vertical-align:baseline}audio:not([controls]){display:none;height:0}[hidden],template{display:none}a{background-color:transparent}a:active,a:hover{outline:0}abbr[title]{border-bottom:1px dotted}b,strong{font-weight:bold}dfn{font-style:italic}h1{font-size:2em;margin:0.67em 0}mark{background:#ff0;color:#000}small{font-size:80%}sub,sup{font-size:75%;line-height:0;position:relative;vertical-align:baseline}sup{top:-0.5em}sub{bottom:-0.25em}img{border:0}svg:not(:root){overflow:hidden}figure{margin:1em 40px}hr{box-sizing:content-box;height:0}pre{overflow:auto}code,kbd,pre,samp{font-family:monospace, monospace;font-size:1em}button,input,optgroup,select,textarea{color:inherit;font:inherit;margin:0}button{overflow:visible}button,select{text-transform:none}button,html input[type="button"],input[type="reset"],input[type="submit"]{-webkit-appearance:button;cursor:pointer}button[disabled],html input[disabled]{cursor:default}button::-moz-focus-inner,input::-moz-focus-inner{border:0;padding:0}input{line-height:normal}input[type="checkbox"],input[type="radio"]{box-sizing:border-box;padding:0}input[type="number"]::-webkit-inner-spin-button,input[type="number"]::-webkit-outer-spin-button{height:auto}input[type="search"]{-webkit-appearance:textfield;box-sizing:content-box}input[type="search"]::-webkit-search-cancel-button,input[type="search"]::-webkit-search-decoration{-webkit-appearance:none}fieldset{border:1px solid #c0c0c0;margin:0 2px;padding:0.35em 0.625em 0.75em}legend{border:0;padding:0}textarea{overflow:auto}optgroup{font-weight:bold}table{border-collapse:collapse;border-spacing:0}td,th{padding:0}html{box-sizing:border-box}*,*:before,*:after{box-sizing:inherit}ul:not(.browser-default){padding-left:0;list-style-type:none}ul:not(.browser-default) li{list-style-type:none}a{color:#039be5;text-decoration:none;-webkit-tap-highlight-color:transparent}.valign-wrapper{display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-align-items:center;-ms-flex-align:center;align-items:center}.valign-wrapper .valign{display:block}.clearfix{clear:both}.z-depth-0{box-shadow:none !important}.z-depth-1,nav,.card-panel,.card,.toast,.btn,.btn-large,.btn-floating,.dropdown-content,.collapsible,.side-nav{box-shadow:0 2px 2px 0 rgba(0,0,0,0.14),0 1px 5px 0 rgba(0,0,0,0.12),0 3px 1px -2px rgba(0,0,0,0.2)}.z-depth-1-half,.btn:hover,.btn-large:hover,.btn-floating:hover{box-shadow:0 3px 3px 0 rgba(0,0,0,0.14),0 1px 7px 0 rgba(0,0,0,0.12),0 3px 1px -1px rgba(0,0,0,0.2)}.z-depth-2{box-shadow:0 4px 5px 0 rgba(0,0,0,0.14),0 1px 10px 0 rgba(0,0,0,0.12),0 2px 4px -1px rgba(0,0,0,0.3)}.z-depth-3{box-shadow:0 6px 10px 0 rgba(0,0,0,0.14),0 1px 18px 0 rgba(0,0,0,0.12),0 3px 5px -1px rgba(0,0,0,0.3)}.z-depth-4,.modal{box-shadow:0 8px 10px 1px rgba(0,0,0,0.14),0 3px 14px 2px rgba(0,0,0,0.12),0 5px 5px -3px rgba(0,0,0,0.3)}.z-depth-5{box-shadow:0 16px 24px 2px rgba(0,0,0,0.14),0 6px 30px 5px rgba(0,0,0,0.12),0 8px 10px -5px rgba(0,0,0,0.3)}.hoverable{transition:box-shadow .25s;box-shadow:0}.hoverable:hover{transition:box-shadow .25s;box-shadow:0 8px 17px 0 rgba(0,0,0,0.2),0 6px 20px 0 rgba(0,0,0,0.19)}.divider{height:1px;overflow:hidden;background-color:#e0e0e0}blockquote{margin:20px 0;padding-left:1.5rem;border-left:5px solid #ee6e73}i{line-height:inherit}i.left{float:left;margin-right:15px}i.right{float:right;margin-left:15px}i.tiny{font-size:1rem}i.small{font-size:2rem}i.medium{font-size:4rem}i.large{font-size:6rem}img.responsive-img,video.responsive-video{max-width:100%;height:auto}.pagination li{display:inline-block;border-radius:2px;text-align:center;vertical-align:top;height:30px}.pagination li a{color:#444;display:inline-block;font-size:1.2rem;padding:0 10px;line-height:30px}.pagination li.active a{color:#fff}.pagination li.active{background-color:#ee6e73}.pagination li.disabled a{cursor:default;color:#999}.pagination li i{font-size:2rem}.pagination li.pages ul li{display:inline-block;float:none}@media only screen and (max-width: 992px){.pagination{width:100%}.pagination li.prev,.pagination li.next{width:10%}.pagination li.pages{width:80%;overflow:hidden;white-space:nowrap}}.breadcrumb{font-size:18px;color:rgba(255,255,255,0.7)}.breadcrumb i,.breadcrumb [class^="mdi-"],.breadcrumb [class*="mdi-"],.breadcrumb i.material-icons{display:inline-block;float:left;font-size:24px}.breadcrumb:before{content:'\E5CC';color:rgba(255,255,255,0.7);vertical-align:top;display:inline-block;font-family:'Material Icons';font-weight:normal;font-style:normal;font-size:25px;margin:0 10px 0 8px;-webkit-font-smoothing:antialiased}.breadcrumb:first-child:before{display:none}.breadcrumb:last-child{color:#fff}.parallax-container{position:relative;overflow:hidden;height:500px}.parallax{position:absolute;top:0;left:0;right:0;bottom:0;z-index:-1}.parallax img{display:none;position:absolute;left:50%;bottom:0;min-width:100%;min-height:100%;-webkit-transform:translate3d(0, 0, 0);transform:translate3d(0, 0, 0);-webkit-transform:translateX(-50%);transform:translateX(-50%)}.pin-top,.pin-bottom{position:relative}.pinned{position:fixed !important}ul.staggered-list li{opacity:0}.fade-in{opacity:0;-webkit-transform-origin:0 50%;transform-origin:0 50%}@media only screen and (max-width: 600px){.hide-on-small-only,.hide-on-small-and-down{display:none !important}}@media only screen and (max-width: 992px){.hide-on-med-and-down{display:none !important}}@media only screen and (min-width: 601px){.hide-on-med-and-up{display:none !important}}@media only screen and (min-width: 600px) and (max-width: 992px){.hide-on-med-only{display:none !important}}@media only screen and (min-width: 993px){.hide-on-large-only{display:none !important}}@media only screen and (min-width: 993px){.show-on-large{display:block !important}}@media only screen and (min-width: 600px) and (max-width: 992px){.show-on-medium{display:block !important}}@media only screen and (max-width: 600px){.show-on-small{display:block !important}}@media only screen and (min-width: 601px){.show-on-medium-and-up{display:block !important}}@media only screen and (max-width: 992px){.show-on-medium-and-down{display:block !important}}@media only screen and (max-width: 600px){.center-on-small-only{text-align:center}}footer.page-footer{padding-top:20px;background-color:#ee6e73}footer.page-footer .footer-copyright{overflow:hidden;min-height:50px;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-align-items:center;-ms-flex-align:center;align-items:center;padding:10px 0px;color:rgba(255,255,255,0.8);background-color:rgba(51,51,51,0.08)}table,th,td{border:none}table{width:100%;display:table}table.bordered>thead>tr,table.bordered>tbody>tr{border-bottom:1px solid #d0d0d0}table.striped>tbody>tr:nth-child(odd){background-color:#f2f2f2}table.striped>tbody>tr>td{border-radius:0}table.highlight>tbody>tr{transition:background-color .25s ease}table.highlight>tbody>tr:hover{background-color:#f2f2f2}table.centered thead tr th,table.centered tbody tr td{text-align:center}thead{border-bottom:1px solid #d0d0d0}td,th{padding:15px 5px;display:table-cell;text-align:left;vertical-align:middle;border-radius:2px}@media only screen and (max-width: 992px){table.responsive-table{width:100%;border-collapse:collapse;border-spacing:0;display:block;position:relative}table.responsive-table td:empty:before{content:'\00a0'}table.responsive-table th,table.responsive-table td{margin:0;vertical-align:top}table.responsive-table th{text-align:left}table.responsive-table thead{display:block;float:left}table.responsive-table thead tr{display:block;padding:0 10px 0 0}table.responsive-table thead tr th::before{content:"\00a0"}table.responsive-table tbody{display:block;width:auto;position:relative;overflow-x:auto;white-space:nowrap}table.responsive-table tbody tr{display:inline-block;vertical-align:top}table.responsive-table th{display:block;text-align:right}table.responsive-table td{display:block;min-height:1.25em;text-align:left}table.responsive-table tr{padding:0 10px}table.responsive-table thead{border:0;border-right:1px solid #d0d0d0}table.responsive-table.bordered th{border-bottom:0;border-left:0}table.responsive-table.bordered td{border-left:0;border-right:0;border-bottom:0}table.responsive-table.bordered tr{border:0}table.responsive-table.bordered tbody tr{border-right:1px solid #d0d0d0}}.collection{margin:.5rem 0 1rem 0;border:1px solid #e0e0e0;border-radius:2px;overflow:hidden;position:relative}.collection .collection-item{background-color:#fff;line-height:1.5rem;padding:10px 20px;margin:0;border-bottom:1px solid #e0e0e0}.collection .collection-item.avatar{min-height:84px;padding-left:72px;position:relative}.collection .collection-item.avatar .circle{position:absolute;width:42px;height:42px;overflow:hidden;left:15px;display:inline-block;vertical-align:middle}.collection .collection-item.avatar i.circle{font-size:18px;line-height:42px;color:#fff;background-color:#999;text-align:center}.collection .collection-item.avatar .title{font-size:16px}.collection .collection-item.avatar p{margin:0}.collection .collection-item.avatar .secondary-content{position:absolute;top:16px;right:16px}.collection .collection-item:last-child{border-bottom:none}.collection .collection-item.active{background-color:#26a69a;color:#eafaf9}.collection .collection-item.active .secondary-content{color:#fff}.collection a.collection-item{display:block;transition:.25s;color:#26a69a}.collection a.collection-item:not(.active):hover{background-color:#ddd}.collection.with-header .collection-header{background-color:#fff;border-bottom:1px solid #e0e0e0;padding:10px 20px}.collection.with-header .collection-item{padding-left:30px}.collection.with-header .collection-item.avatar{padding-left:72px}.secondary-content{float:right;color:#26a69a}.collapsible .collection{margin:0;border:none}.video-container{position:relative;padding-bottom:56.25%;height:0;overflow:hidden}.video-container iframe,.video-container object,.video-container embed{position:absolute;top:0;left:0;width:100%;height:100%}.progress{position:relative;height:4px;display:block;width:100%;background-color:#acece6;border-radius:2px;margin:.5rem 0 1rem 0;overflow:hidden}.progress .determinate{position:absolute;top:0;left:0;bottom:0;background-color:#26a69a;transition:width .3s linear}.progress .indeterminate{background-color:#26a69a}.progress .indeterminate:before{content:'';position:absolute;background-color:inherit;top:0;left:0;bottom:0;will-change:left, right;-webkit-animation:indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite;animation:indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite}.progress .indeterminate:after{content:'';position:absolute;background-color:inherit;top:0;left:0;bottom:0;will-change:left, right;-webkit-animation:indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite;animation:indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite;-webkit-animation-delay:1.15s;animation-delay:1.15s}@-webkit-keyframes indeterminate{0%{left:-35%;right:100%}60%{left:100%;right:-90%}100%{left:100%;right:-90%}}@keyframes indeterminate{0%{left:-35%;right:100%}60%{left:100%;right:-90%}100%{left:100%;right:-90%}}@-webkit-keyframes indeterminate-short{0%{left:-200%;right:100%}60%{left:107%;right:-8%}100%{left:107%;right:-8%}}@keyframes indeterminate-short{0%{left:-200%;right:100%}60%{left:107%;right:-8%}100%{left:107%;right:-8%}}.hide{display:none !important}.left-align{text-align:left}.right-align{text-align:right}.center,.center-align{text-align:center}.left{float:left !important}.right{float:right !important}.no-select,input[type=range],input[type=range]+.thumb{-webkit-touch-callout:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.circle{border-radius:50%}.center-block{display:block;margin-left:auto;margin-right:auto}.truncate{display:block;white-space:nowrap;overflow:hidden;text-overflow:ellipsis}.no-padding{padding:0 !important}span.badge{min-width:3rem;padding:0 6px;margin-left:14px;text-align:center;font-size:1rem;line-height:22px;height:22px;color:#757575;float:right;box-sizing:border-box}span.badge.new{font-weight:300;font-size:0.8rem;color:#fff;background-color:#26a69a;border-radius:2px}span.badge.new:after{content:" new"}span.badge[data-badge-caption]::after{content:" " attr(data-badge-caption)}nav ul a span.badge{display:inline-block;float:none;margin-left:4px;line-height:22px;height:22px}.collection-item span.badge{margin-top:calc(.75rem - 11px)}.collapsible span.badge{margin-top:calc(1.5rem - 11px)}.side-nav span.badge{margin-top:calc(24px - 11px)}.material-icons{text-rendering:optimizeLegibility;-webkit-font-feature-settings:'liga';-moz-font-feature-settings:'liga';font-feature-settings:'liga'}.container{margin:0 auto;max-width:1280px;width:90%}@media only screen and (min-width: 601px){.container{width:85%}}@media only screen and (min-width: 993px){.container{width:70%}}.container .row{margin-left:-.75rem;margin-right:-.75rem}.section{padding-top:1rem;padding-bottom:1rem}.section.no-pad{padding:0}.section.no-pad-bot{padding-bottom:0}.section.no-pad-top{padding-top:0}.row{margin-left:auto;margin-right:auto;margin-bottom:20px}.row:after{content:"";display:table;clear:both}.row .col{float:left;box-sizing:border-box;padding:0 .75rem;min-height:1px}.row .col[class*="push-"],.row .col[class*="pull-"]{position:relative}.row .col.s1{width:8.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.s2{width:16.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.s3{width:25%;margin-left:auto;left:auto;right:auto}.row .col.s4{width:33.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.s5{width:41.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.s6{width:50%;margin-left:auto;left:auto;right:auto}.row .col.s7{width:58.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.s8{width:66.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.s9{width:75%;margin-left:auto;left:auto;right:auto}.row .col.s10{width:83.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.s11{width:91.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.s12{width:100%;margin-left:auto;left:auto;right:auto}.row .col.offset-s1{margin-left:8.3333333333%}.row .col.pull-s1{right:8.3333333333%}.row .col.push-s1{left:8.3333333333%}.row .col.offset-s2{margin-left:16.6666666667%}.row .col.pull-s2{right:16.6666666667%}.row .col.push-s2{left:16.6666666667%}.row .col.offset-s3{margin-left:25%}.row .col.pull-s3{right:25%}.row .col.push-s3{left:25%}.row .col.offset-s4{margin-left:33.3333333333%}.row .col.pull-s4{right:33.3333333333%}.row .col.push-s4{left:33.3333333333%}.row .col.offset-s5{margin-left:41.6666666667%}.row .col.pull-s5{right:41.6666666667%}.row .col.push-s5{left:41.6666666667%}.row .col.offset-s6{margin-left:50%}.row .col.pull-s6{right:50%}.row .col.push-s6{left:50%}.row .col.offset-s7{margin-left:58.3333333333%}.row .col.pull-s7{right:58.3333333333%}.row .col.push-s7{left:58.3333333333%}.row .col.offset-s8{margin-left:66.6666666667%}.row .col.pull-s8{right:66.6666666667%}.row .col.push-s8{left:66.6666666667%}.row .col.offset-s9{margin-left:75%}.row .col.pull-s9{right:75%}.row .col.push-s9{left:75%}.row .col.offset-s10{margin-left:83.3333333333%}.row .col.pull-s10{right:83.3333333333%}.row .col.push-s10{left:83.3333333333%}.row .col.offset-s11{margin-left:91.6666666667%}.row .col.pull-s11{right:91.6666666667%}.row .col.push-s11{left:91.6666666667%}.row .col.offset-s12{margin-left:100%}.row .col.pull-s12{right:100%}.row .col.push-s12{left:100%}@media only screen and (min-width: 601px){.row .col.m1{width:8.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.m2{width:16.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.m3{width:25%;margin-left:auto;left:auto;right:auto}.row .col.m4{width:33.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.m5{width:41.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.m6{width:50%;margin-left:auto;left:auto;right:auto}.row .col.m7{width:58.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.m8{width:66.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.m9{width:75%;margin-left:auto;left:auto;right:auto}.row .col.m10{width:83.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.m11{width:91.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.m12{width:100%;margin-left:auto;left:auto;right:auto}.row .col.offset-m1{margin-left:8.3333333333%}.row .col.pull-m1{right:8.3333333333%}.row .col.push-m1{left:8.3333333333%}.row .col.offset-m2{margin-left:16.6666666667%}.row .col.pull-m2{right:16.6666666667%}.row .col.push-m2{left:16.6666666667%}.row .col.offset-m3{margin-left:25%}.row .col.pull-m3{right:25%}.row .col.push-m3{left:25%}.row .col.offset-m4{margin-left:33.3333333333%}.row .col.pull-m4{right:33.3333333333%}.row .col.push-m4{left:33.3333333333%}.row .col.offset-m5{margin-left:41.6666666667%}.row .col.pull-m5{right:41.6666666667%}.row .col.push-m5{left:41.6666666667%}.row .col.offset-m6{margin-left:50%}.row .col.pull-m6{right:50%}.row .col.push-m6{left:50%}.row .col.offset-m7{margin-left:58.3333333333%}.row .col.pull-m7{right:58.3333333333%}.row .col.push-m7{left:58.3333333333%}.row .col.offset-m8{margin-left:66.6666666667%}.row .col.pull-m8{right:66.6666666667%}.row .col.push-m8{left:66.6666666667%}.row .col.offset-m9{margin-left:75%}.row .col.pull-m9{right:75%}.row .col.push-m9{left:75%}.row .col.offset-m10{margin-left:83.3333333333%}.row .col.pull-m10{right:83.3333333333%}.row .col.push-m10{left:83.3333333333%}.row .col.offset-m11{margin-left:91.6666666667%}.row .col.pull-m11{right:91.6666666667%}.row .col.push-m11{left:91.6666666667%}.row .col.offset-m12{margin-left:100%}.row .col.pull-m12{right:100%}.row .col.push-m12{left:100%}}@media only screen and (min-width: 993px){.row .col.l1{width:8.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.l2{width:16.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.l3{width:25%;margin-left:auto;left:auto;right:auto}.row .col.l4{width:33.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.l5{width:41.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.l6{width:50%;margin-left:auto;left:auto;right:auto}.row .col.l7{width:58.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.l8{width:66.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.l9{width:75%;margin-left:auto;left:auto;right:auto}.row .col.l10{width:83.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.l11{width:91.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.l12{width:100%;margin-left:auto;left:auto;right:auto}.row .col.offset-l1{margin-left:8.3333333333%}.row .col.pull-l1{right:8.3333333333%}.row .col.push-l1{left:8.3333333333%}.row .col.offset-l2{margin-left:16.6666666667%}.row .col.pull-l2{right:16.6666666667%}.row .col.push-l2{left:16.6666666667%}.row .col.offset-l3{margin-left:25%}.row .col.pull-l3{right:25%}.row .col.push-l3{left:25%}.row .col.offset-l4{margin-left:33.3333333333%}.row .col.pull-l4{right:33.3333333333%}.row .col.push-l4{left:33.3333333333%}.row .col.offset-l5{margin-left:41.6666666667%}.row .col.pull-l5{right:41.6666666667%}.row .col.push-l5{left:41.6666666667%}.row .col.offset-l6{margin-left:50%}.row .col.pull-l6{right:50%}.row .col.push-l6{left:50%}.row .col.offset-l7{margin-left:58.3333333333%}.row .col.pull-l7{right:58.3333333333%}.row .col.push-l7{left:58.3333333333%}.row .col.offset-l8{margin-left:66.6666666667%}.row .col.pull-l8{right:66.6666666667%}.row .col.push-l8{left:66.6666666667%}.row .col.offset-l9{margin-left:75%}.row .col.pull-l9{right:75%}.row .col.push-l9{left:75%}.row .col.offset-l10{margin-left:83.3333333333%}.row .col.pull-l10{right:83.3333333333%}.row .col.push-l10{left:83.3333333333%}.row .col.offset-l11{margin-left:91.6666666667%}.row .col.pull-l11{right:91.6666666667%}.row .col.push-l11{left:91.6666666667%}.row .col.offset-l12{margin-left:100%}.row .col.pull-l12{right:100%}.row .col.push-l12{left:100%}}nav{color:#fff;background-color:#ee6e73;width:100%;height:56px;line-height:56px}nav.nav-extended{height:auto}nav.nav-extended .nav-wrapper{min-height:56px;height:auto}nav.nav-extended .nav-content{position:relative;line-height:normal}nav a{color:#fff}nav i,nav [class^="mdi-"],nav [class*="mdi-"],nav i.material-icons{display:block;font-size:24px;height:56px;line-height:56px}nav .nav-wrapper{position:relative;height:100%}@media only screen and (min-width: 993px){nav a.button-collapse{display:none}}nav .button-collapse{float:left;position:relative;z-index:1;height:56px;margin:0 18px}nav .button-collapse i{height:56px;line-height:56px}nav .brand-logo{position:absolute;color:#fff;display:inline-block;font-size:2.1rem;padding:0;white-space:nowrap}nav .brand-logo.center{left:50%;-webkit-transform:translateX(-50%);transform:translateX(-50%)}@media only screen and (max-width: 992px){nav .brand-logo{left:50%;-webkit-transform:translateX(-50%);transform:translateX(-50%)}nav .brand-logo.left,nav .brand-logo.right{padding:0;-webkit-transform:none;transform:none}nav .brand-logo.left{left:0.5rem}nav .brand-logo.right{right:0.5rem;left:auto}}nav .brand-logo.right{right:0.5rem;padding:0}nav .brand-logo i,nav .brand-logo [class^="mdi-"],nav .brand-logo [class*="mdi-"],nav .brand-logo i.material-icons{float:left;margin-right:15px}nav .nav-title{display:inline-block;font-size:32px;padding:28px 0}nav ul{margin:0}nav ul li{transition:background-color .3s;float:left;padding:0}nav ul li.active{background-color:rgba(0,0,0,0.1)}nav ul a{transition:background-color .3s;font-size:1rem;color:#fff;display:block;padding:0 15px;cursor:pointer}nav ul a.btn,nav ul a.btn-large,nav ul a.btn-large,nav ul a.btn-flat,nav ul a.btn-floating{margin-top:-2px;margin-left:15px;margin-right:15px}nav ul a.btn>.material-icons,nav ul a.btn-large>.material-icons,nav ul a.btn-large>.material-icons,nav ul a.btn-flat>.material-icons,nav ul a.btn-floating>.material-icons{height:inherit;line-height:inherit}nav ul a:hover{background-color:rgba(0,0,0,0.1)}nav ul.left{float:left}nav form{height:100%}nav .input-field{margin:0;height:100%}nav .input-field input{height:100%;font-size:1.2rem;border:none;padding-left:2rem}nav .input-field input:focus,nav .input-field input[type=text]:valid,nav .input-field input[type=password]:valid,nav .input-field input[type=email]:valid,nav .input-field input[type=url]:valid,nav .input-field input[type=date]:valid{border:none;box-shadow:none}nav .input-field label{top:0;left:0}nav .input-field label i{color:rgba(255,255,255,0.7);transition:color .3s}nav .input-field label.active i{color:#fff}.navbar-fixed{position:relative;height:56px;z-index:997}.navbar-fixed nav{position:fixed}@media only screen and (min-width: 601px){nav.nav-extended .nav-wrapper{min-height:64px}nav,nav .nav-wrapper i,nav a.button-collapse,nav a.button-collapse i{height:64px;line-height:64px}.navbar-fixed{height:64px}}@font-face{font-family:"Roboto";src:local(Roboto Thin),url("../fonts/roboto/Roboto-Thin.eot");src:url("../fonts/roboto/Roboto-Thin.eot?#iefix") format("embedded-opentype"),url("../fonts/roboto/Roboto-Thin.woff2") format("woff2"),url("../fonts/roboto/Roboto-Thin.woff") format("woff"),url("../fonts/roboto/Roboto-Thin.ttf") format("truetype");font-weight:200}@font-face{font-family:"Roboto";src:local(Roboto Light),url("../fonts/roboto/Roboto-Light.eot");src:url("../fonts/roboto/Roboto-Light.eot?#iefix") format("embedded-opentype"),url("../fonts/roboto/Roboto-Light.woff2") format("woff2"),url("../fonts/roboto/Roboto-Light.woff") format("woff"),url("../fonts/roboto/Roboto-Light.ttf") format("truetype");font-weight:300}@font-face{font-family:"Roboto";src:local(Roboto Regular),url("../fonts/roboto/Roboto-Regular.eot");src:url("../fonts/roboto/Roboto-Regular.eot?#iefix") format("embedded-opentype"),url("../fonts/roboto/Roboto-Regular.woff2") format("woff2"),url("../fonts/roboto/Roboto-Regular.woff") format("woff"),url("../fonts/roboto/Roboto-Regular.ttf") format("truetype");font-weight:400}@font-face{font-family:"Roboto";src:url("../fonts/roboto/Roboto-Medium.eot");src:url("../fonts/roboto/Roboto-Medium.eot?#iefix") format("embedded-opentype"),url("../fonts/roboto/Roboto-Medium.woff2") format("woff2"),url("../fonts/roboto/Roboto-Medium.woff") format("woff"),url("../fonts/roboto/Roboto-Medium.ttf") format("truetype");font-weight:500}@font-face{font-family:"Roboto";src:url("../fonts/roboto/Roboto-Bold.eot");src:url("../fonts/roboto/Roboto-Bold.eot?#iefix") format("embedded-opentype"),url("../fonts/roboto/Roboto-Bold.woff2") format("woff2"),url("../fonts/roboto/Roboto-Bold.woff") format("woff"),url("../fonts/roboto/Roboto-Bold.ttf") format("truetype");font-weight:700}a{text-decoration:none}html{line-height:1.5;font-family:"Roboto", sans-serif;font-weight:normal;color:rgba(0,0,0,0.87)}@media only screen and (min-width: 0){html{font-size:14px}}@media only screen and (min-width: 992px){html{font-size:14.5px}}@media only screen and (min-width: 1200px){html{font-size:15px}}h1,h2,h3,h4,h5,h6{font-weight:400;line-height:1.1}h1 a,h2 a,h3 a,h4 a,h5 a,h6 a{font-weight:inherit}h1{font-size:4.2rem;line-height:110%;margin:2.1rem 0 1.68rem 0}h2{font-size:3.56rem;line-height:110%;margin:1.78rem 0 1.424rem 0}h3{font-size:2.92rem;line-height:110%;margin:1.46rem 0 1.168rem 0}h4{font-size:2.28rem;line-height:110%;margin:1.14rem 0 .912rem 0}h5{font-size:1.64rem;line-height:110%;margin:.82rem 0 .656rem 0}h6{font-size:1rem;line-height:110%;margin:.5rem 0 .4rem 0}em{font-style:italic}strong{font-weight:500}small{font-size:75%}.light,footer.page-footer .footer-copyright{font-weight:300}.thin{font-weight:200}.flow-text{font-weight:300}@media only screen and (min-width: 360px){.flow-text{font-size:1.2rem}}@media only screen and (min-width: 390px){.flow-text{font-size:1.224rem}}@media only screen and (min-width: 420px){.flow-text{font-size:1.248rem}}@media only screen and (min-width: 450px){.flow-text{font-size:1.272rem}}@media only screen and (min-width: 480px){.flow-text{font-size:1.296rem}}@media only screen and (min-width: 510px){.flow-text{font-size:1.32rem}}@media only screen and (min-width: 540px){.flow-text{font-size:1.344rem}}@media only screen and (min-width: 570px){.flow-text{font-size:1.368rem}}@media only screen and (min-width: 600px){.flow-text{font-size:1.392rem}}@media only screen and (min-width: 630px){.flow-text{font-size:1.416rem}}@media only screen and (min-width: 660px){.flow-text{font-size:1.44rem}}@media only screen and (min-width: 690px){.flow-text{font-size:1.464rem}}@media only screen and (min-width: 720px){.flow-text{font-size:1.488rem}}@media only screen and (min-width: 750px){.flow-text{font-size:1.512rem}}@media only screen and (min-width: 780px){.flow-text{font-size:1.536rem}}@media only screen and (min-width: 810px){.flow-text{font-size:1.56rem}}@media only screen and (min-width: 840px){.flow-text{font-size:1.584rem}}@media only screen and (min-width: 870px){.flow-text{font-size:1.608rem}}@media only screen and (min-width: 900px){.flow-text{font-size:1.632rem}}@media only screen and (min-width: 930px){.flow-text{font-size:1.656rem}}@media only screen and (min-width: 960px){.flow-text{font-size:1.68rem}}@media only screen and (max-width: 360px){.flow-text{font-size:1.2rem}}.scale-transition{transition:-webkit-transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important;transition:transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important;transition:transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63), -webkit-transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important}.scale-transition.scale-out{-webkit-transform:scale(0);transform:scale(0);transition:-webkit-transform .2s !important;transition:transform .2s !important;transition:transform .2s, -webkit-transform .2s !important}.scale-transition.scale-in{-webkit-transform:scale(1);transform:scale(1)}.card-panel{transition:box-shadow .25s;padding:24px;margin:.5rem 0 1rem 0;border-radius:2px;background-color:#fff}.card{position:relative;margin:.5rem 0 1rem 0;background-color:#fff;transition:box-shadow .25s;border-radius:2px}.card .card-title{font-size:24px;font-weight:300}.card .card-title.activator{cursor:pointer}.card.small,.card.medium,.card.large{position:relative}.card.small .card-image,.card.medium .card-image,.card.large .card-image{max-height:60%;overflow:hidden}.card.small .card-image+.card-content,.card.medium .card-image+.card-content,.card.large .card-image+.card-content{max-height:40%}.card.small .card-content,.card.medium .card-content,.card.large .card-content{max-height:100%;overflow:hidden}.card.small .card-action,.card.medium .card-action,.card.large .card-action{position:absolute;bottom:0;left:0;right:0}.card.small{height:300px}.card.medium{height:400px}.card.large{height:500px}.card.horizontal{display:-webkit-flex;display:-ms-flexbox;display:flex}.card.horizontal.small .card-image,.card.horizontal.medium .card-image,.card.horizontal.large .card-image{height:100%;max-height:none;overflow:visible}.card.horizontal.small .card-image img,.card.horizontal.medium .card-image img,.card.horizontal.large .card-image img{height:100%}.card.horizontal .card-image{max-width:50%}.card.horizontal .card-image img{border-radius:2px 0 0 2px;max-width:100%;width:auto}.card.horizontal .card-stacked{display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;-webkit-flex:1;-ms-flex:1;flex:1;position:relative}.card.horizontal .card-stacked .card-content{-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1}.card.sticky-action .card-action{z-index:2}.card.sticky-action .card-reveal{z-index:1;padding-bottom:64px}.card .card-image{position:relative}.card .card-image img{display:block;border-radius:2px 2px 0 0;position:relative;left:0;right:0;top:0;bottom:0;width:100%}.card .card-image .card-title{color:#fff;position:absolute;bottom:0;left:0;max-width:100%;padding:24px}.card .card-content{padding:24px;border-radius:0 0 2px 2px}.card .card-content p{margin:0;color:inherit}.card .card-content .card-title{display:block;line-height:32px;margin-bottom:8px}.card .card-content .card-title i{line-height:32px}.card .card-action{position:relative;background-color:inherit;border-top:1px solid rgba(160,160,160,0.2);padding:16px 24px}.card .card-action a:not(.btn):not(.btn-large):not(.btn-large):not(.btn-floating){color:#ffab40;margin-right:24px;transition:color .3s ease;text-transform:uppercase}.card .card-action a:not(.btn):not(.btn-large):not(.btn-large):not(.btn-floating):hover{color:#ffd8a6}.card .card-reveal{padding:24px;position:absolute;background-color:#fff;width:100%;overflow-y:auto;left:0;top:100%;height:100%;z-index:3;display:none}.card .card-reveal .card-title{cursor:pointer;display:block}#toast-container{display:block;position:fixed;z-index:10000}@media only screen and (max-width: 600px){#toast-container{min-width:100%;bottom:0%}}@media only screen and (min-width: 601px) and (max-width: 992px){#toast-container{left:5%;bottom:7%;max-width:90%}}@media only screen and (min-width: 993px){#toast-container{top:10%;right:7%;max-width:86%}}.toast{border-radius:2px;top:35px;width:auto;clear:both;margin-top:10px;position:relative;max-width:100%;height:auto;min-height:48px;line-height:1.5em;word-break:break-all;background-color:#323232;padding:10px 25px;font-size:1.1rem;font-weight:300;color:#fff;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-align-items:center;-ms-flex-align:center;align-items:center;-webkit-justify-content:space-between;-ms-flex-pack:justify;justify-content:space-between}.toast .btn,.toast .btn-large,.toast .btn-flat{margin:0;margin-left:3rem}.toast.rounded{border-radius:24px}@media only screen and (max-width: 600px){.toast{width:100%;border-radius:0}}@media only screen and (min-width: 601px) and (max-width: 992px){.toast{float:left}}@media only screen and (min-width: 993px){.toast{float:right}}.tabs{position:relative;overflow-x:auto;overflow-y:hidden;height:48px;width:100%;background-color:#fff;margin:0 auto;white-space:nowrap}.tabs.tabs-transparent{background-color:transparent}.tabs.tabs-transparent .tab a,.tabs.tabs-transparent .tab.disabled a,.tabs.tabs-transparent .tab.disabled a:hover{color:rgba(255,255,255,0.7)}.tabs.tabs-transparent .tab a:hover,.tabs.tabs-transparent .tab a.active{color:#fff}.tabs.tabs-transparent .indicator{background-color:#fff}.tabs.tabs-fixed-width{display:-webkit-flex;display:-ms-flexbox;display:flex}.tabs.tabs-fixed-width .tab{-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1}.tabs .tab{display:inline-block;text-align:center;line-height:48px;height:48px;padding:0;margin:0;text-transform:uppercase}.tabs .tab a{color:rgba(238,110,115,0.7);display:block;width:100%;height:100%;padding:0 24px;font-size:14px;text-overflow:ellipsis;overflow:hidden;transition:color .28s ease}.tabs .tab a:hover,.tabs .tab a.active{background-color:transparent;color:#ee6e73}.tabs .tab.disabled a,.tabs .tab.disabled a:hover{color:rgba(238,110,115,0.7);cursor:default}.tabs .indicator{position:absolute;bottom:0;height:2px;background-color:#f6b2b5;will-change:left, right}@media only screen and (max-width: 992px){.tabs{display:-webkit-flex;display:-ms-flexbox;display:flex}.tabs .tab{-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1}.tabs .tab a{padding:0 12px}}.material-tooltip{padding:10px 8px;font-size:1rem;z-index:2000;background-color:transparent;border-radius:2px;color:#fff;min-height:36px;line-height:120%;opacity:0;position:absolute;text-align:center;max-width:calc(100% - 4px);overflow:hidden;left:0;top:0;pointer-events:none;visibility:hidden}.backdrop{position:absolute;opacity:0;height:7px;width:14px;border-radius:0 0 50% 50%;background-color:#323232;z-index:-1;-webkit-transform-origin:50% 0%;transform-origin:50% 0%;visibility:hidden}.btn,.btn-large,.btn-flat{border:none;border-radius:2px;display:inline-block;height:36px;line-height:36px;padding:0 2rem;text-transform:uppercase;vertical-align:middle;-webkit-tap-highlight-color:transparent}.btn.disabled,.disabled.btn-large,.btn-floating.disabled,.btn-large.disabled,.btn-flat.disabled,.btn:disabled,.btn-large:disabled,.btn-floating:disabled,.btn-large:disabled,.btn-flat:disabled,.btn[disabled],[disabled].btn-large,.btn-floating[disabled],.btn-large[disabled],.btn-flat[disabled]{pointer-events:none;background-color:#DFDFDF !important;box-shadow:none;color:#9F9F9F !important;cursor:default}.btn.disabled:hover,.disabled.btn-large:hover,.btn-floating.disabled:hover,.btn-large.disabled:hover,.btn-flat.disabled:hover,.btn:disabled:hover,.btn-large:disabled:hover,.btn-floating:disabled:hover,.btn-large:disabled:hover,.btn-flat:disabled:hover,.btn[disabled]:hover,[disabled].btn-large:hover,.btn-floating[disabled]:hover,.btn-large[disabled]:hover,.btn-flat[disabled]:hover{background-color:#DFDFDF !important;color:#9F9F9F !important}.btn,.btn-large,.btn-floating,.btn-large,.btn-flat{outline:0}.btn i,.btn-large i,.btn-floating i,.btn-large i,.btn-flat i{font-size:1.3rem;line-height:inherit}.btn:focus,.btn-large:focus,.btn-floating:focus{background-color:#1d7d74}.btn,.btn-large{text-decoration:none;color:#fff;background-color:#26a69a;text-align:center;letter-spacing:.5px;transition:.2s ease-out;cursor:pointer}.btn:hover,.btn-large:hover{background-color:#2bbbad}.btn-floating{display:inline-block;color:#fff;position:relative;overflow:hidden;z-index:1;width:40px;height:40px;line-height:40px;padding:0;background-color:#26a69a;border-radius:50%;transition:.3s;cursor:pointer;vertical-align:middle}.btn-floating:hover{background-color:#26a69a}.btn-floating:before{border-radius:0}.btn-floating.btn-large{width:56px;height:56px}.btn-floating.btn-large i{line-height:56px}.btn-floating.halfway-fab{position:absolute;right:24px;bottom:0;-webkit-transform:translateY(50%);transform:translateY(50%)}.btn-floating.halfway-fab.left{right:auto;left:24px}.btn-floating i{width:inherit;display:inline-block;text-align:center;color:#fff;font-size:1.6rem;line-height:40px}button.btn-floating{border:none}.fixed-action-btn{position:fixed;right:23px;bottom:23px;padding-top:15px;margin-bottom:0;z-index:998}.fixed-action-btn.active ul{visibility:visible}.fixed-action-btn.horizontal{padding:0 0 0 15px}.fixed-action-btn.horizontal ul{text-align:right;right:64px;top:50%;-webkit-transform:translateY(-50%);transform:translateY(-50%);height:100%;left:auto;width:500px}.fixed-action-btn.horizontal ul li{display:inline-block;margin:15px 15px 0 0}.fixed-action-btn.toolbar{padding:0;height:56px}.fixed-action-btn.toolbar.active>a i{opacity:0}.fixed-action-btn.toolbar ul{display:-webkit-flex;display:-ms-flexbox;display:flex;top:0;bottom:0}.fixed-action-btn.toolbar ul li{-webkit-flex:1;-ms-flex:1;flex:1;display:inline-block;margin:0;height:100%;transition:none}.fixed-action-btn.toolbar ul li a{display:block;overflow:hidden;position:relative;width:100%;height:100%;background-color:transparent;box-shadow:none;color:#fff;line-height:56px;z-index:1}.fixed-action-btn.toolbar ul li a i{line-height:inherit}.fixed-action-btn ul{left:0;right:0;text-align:center;position:absolute;bottom:64px;margin:0;visibility:hidden}.fixed-action-btn ul li{margin-bottom:15px}.fixed-action-btn ul a.btn-floating{opacity:0}.fixed-action-btn .fab-backdrop{position:absolute;top:0;left:0;z-index:-1;width:40px;height:40px;background-color:#26a69a;border-radius:50%;-webkit-transform:scale(0);transform:scale(0)}.btn-flat{box-shadow:none;background-color:transparent;color:#343434;cursor:pointer;transition:background-color .2s}.btn-flat:focus,.btn-flat:active{background-color:transparent}.btn-flat:focus,.btn-flat:hover{background-color:rgba(0,0,0,0.1);box-shadow:none}.btn-flat:active{background-color:rgba(0,0,0,0.2)}.btn-flat.disabled{background-color:transparent !important;color:#b3b3b3 !important;cursor:default}.btn-large{height:54px;line-height:54px}.btn-large i{font-size:1.6rem}.btn-block{display:block}.dropdown-content{background-color:#fff;margin:0;display:none;min-width:100px;max-height:650px;overflow-y:auto;opacity:0;position:absolute;z-index:999;will-change:width, height}.dropdown-content li{clear:both;color:rgba(0,0,0,0.87);cursor:pointer;min-height:50px;line-height:1.5rem;width:100%;text-align:left;text-transform:none}.dropdown-content li:hover,.dropdown-content li.active,.dropdown-content li.selected{background-color:#eee}.dropdown-content li.active.selected{background-color:#e1e1e1}.dropdown-content li.divider{min-height:0;height:1px}.dropdown-content li>a,.dropdown-content li>span{font-size:16px;color:#26a69a;display:block;line-height:22px;padding:14px 16px}.dropdown-content li>span>label{top:1px;left:0;height:18px}.dropdown-content li>a>i{height:inherit;line-height:inherit}.input-field.col .dropdown-content [type="checkbox"]+label{top:1px;left:0;height:18px}/*!
+ * Waves v0.6.0
+ * http://fian.my.id/Waves
+ *
+ * Copyright 2014 Alfiana E. Sibuea and other contributors
+ * Released under the MIT license
+ * https://github.com/fians/Waves/blob/master/LICENSE
+ */.waves-effect{position:relative;cursor:pointer;display:inline-block;overflow:hidden;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;-webkit-tap-highlight-color:transparent;vertical-align:middle;z-index:1;transition:.3s ease-out}.waves-effect .waves-ripple{position:absolute;border-radius:50%;width:20px;height:20px;margin-top:-10px;margin-left:-10px;opacity:0;background:rgba(0,0,0,0.2);transition:all 0.7s ease-out;transition-property:opacity, -webkit-transform;transition-property:transform, opacity;transition-property:transform, opacity, -webkit-transform;-webkit-transform:scale(0);transform:scale(0);pointer-events:none}.waves-effect.waves-light .waves-ripple{background-color:rgba(255,255,255,0.45)}.waves-effect.waves-red .waves-ripple{background-color:rgba(244,67,54,0.7)}.waves-effect.waves-yellow .waves-ripple{background-color:rgba(255,235,59,0.7)}.waves-effect.waves-orange .waves-ripple{background-color:rgba(255,152,0,0.7)}.waves-effect.waves-purple .waves-ripple{background-color:rgba(156,39,176,0.7)}.waves-effect.waves-green .waves-ripple{background-color:rgba(76,175,80,0.7)}.waves-effect.waves-teal .waves-ripple{background-color:rgba(0,150,136,0.7)}.waves-effect input[type="button"],.waves-effect input[type="reset"],.waves-effect input[type="submit"]{border:0;font-style:normal;font-size:inherit;text-transform:inherit;background:none}.waves-effect img{position:relative;z-index:-1}.waves-notransition{transition:none !important}.waves-circle{-webkit-transform:translateZ(0);transform:translateZ(0);-webkit-mask-image:-webkit-radial-gradient(circle, #fff 100%, #000 100%)}.waves-input-wrapper{border-radius:0.2em;vertical-align:bottom}.waves-input-wrapper .waves-button-input{position:relative;top:0;left:0;z-index:1}.waves-circle{text-align:center;width:2.5em;height:2.5em;line-height:2.5em;border-radius:50%;-webkit-mask-image:none}.waves-block{display:block}.waves-effect .waves-ripple{z-index:-1}.modal{display:none;position:fixed;left:0;right:0;background-color:#fafafa;padding:0;max-height:70%;width:55%;margin:auto;overflow-y:auto;border-radius:2px;will-change:top, opacity}@media only screen and (max-width: 992px){.modal{width:80%}}.modal h1,.modal h2,.modal h3,.modal h4{margin-top:0}.modal .modal-content{padding:24px}.modal .modal-close{cursor:pointer}.modal .modal-footer{border-radius:0 0 2px 2px;background-color:#fafafa;padding:4px 6px;height:56px;width:100%}.modal .modal-footer .btn,.modal .modal-footer .btn-large,.modal .modal-footer .btn-flat{float:right;margin:6px 0}.modal-overlay{position:fixed;z-index:999;top:-100px;left:0;bottom:0;right:0;height:125%;width:100%;background:#000;display:none;will-change:opacity}.modal.modal-fixed-footer{padding:0;height:70%}.modal.modal-fixed-footer .modal-content{position:absolute;height:calc(100% - 56px);max-height:100%;width:100%;overflow-y:auto}.modal.modal-fixed-footer .modal-footer{border-top:1px solid rgba(0,0,0,0.1);position:absolute;bottom:0}.modal.bottom-sheet{top:auto;bottom:-100%;margin:0;width:100%;max-height:45%;border-radius:0;will-change:bottom, opacity}.collapsible{border-top:1px solid #ddd;border-right:1px solid #ddd;border-left:1px solid #ddd;margin:.5rem 0 1rem 0}.collapsible-header{display:block;cursor:pointer;min-height:3rem;line-height:3rem;padding:0 1rem;background-color:#fff;border-bottom:1px solid #ddd}.collapsible-header i{width:2rem;font-size:1.6rem;line-height:3rem;display:block;float:left;text-align:center;margin-right:1rem}.collapsible-body{display:none;border-bottom:1px solid #ddd;box-sizing:border-box;padding:2rem}.side-nav .collapsible,.side-nav.fixed .collapsible{border:none;box-shadow:none}.side-nav .collapsible li,.side-nav.fixed .collapsible li{padding:0}.side-nav .collapsible-header,.side-nav.fixed .collapsible-header{background-color:transparent;border:none;line-height:inherit;height:inherit;padding:0 16px}.side-nav .collapsible-header:hover,.side-nav.fixed .collapsible-header:hover{background-color:rgba(0,0,0,0.05)}.side-nav .collapsible-header i,.side-nav.fixed .collapsible-header i{line-height:inherit}.side-nav .collapsible-body,.side-nav.fixed .collapsible-body{border:0;background-color:#fff}.side-nav .collapsible-body li a,.side-nav.fixed .collapsible-body li a{padding:0 23.5px 0 31px}.collapsible.popout{border:none;box-shadow:none}.collapsible.popout>li{box-shadow:0 2px 5px 0 rgba(0,0,0,0.16),0 2px 10px 0 rgba(0,0,0,0.12);margin:0 24px;transition:margin 0.35s cubic-bezier(0.25, 0.46, 0.45, 0.94)}.collapsible.popout>li.active{box-shadow:0 5px 11px 0 rgba(0,0,0,0.18),0 4px 15px 0 rgba(0,0,0,0.15);margin:16px 0}.chip{display:inline-block;height:32px;font-size:13px;font-weight:500;color:rgba(0,0,0,0.6);line-height:32px;padding:0 12px;border-radius:16px;background-color:#e4e4e4;margin-bottom:5px;margin-right:5px}.chip img{float:left;margin:0 8px 0 -12px;height:32px;width:32px;border-radius:50%}.chip .close{cursor:pointer;float:right;font-size:16px;line-height:32px;padding-left:8px}.chips{border:none;border-bottom:1px solid #9e9e9e;box-shadow:none;margin:0 0 20px 0;min-height:45px;outline:none;transition:all .3s}.chips.focus{border-bottom:1px solid #26a69a;box-shadow:0 1px 0 0 #26a69a}.chips:hover{cursor:text}.chips .chip.selected{background-color:#26a69a;color:#fff}.chips .input{background:none;border:0;color:rgba(0,0,0,0.6);display:inline-block;font-size:1rem;height:3rem;line-height:32px;outline:0;margin:0;padding:0 !important;width:120px !important}.chips .input:focus{border:0 !important;box-shadow:none !important}.prefix ~ .chips{margin-left:3rem;width:92%;width:calc(100% - 3rem)}.chips:empty ~ label{font-size:0.8rem;-webkit-transform:translateY(-140%);transform:translateY(-140%)}.materialboxed{display:block;cursor:-webkit-zoom-in;cursor:zoom-in;position:relative;transition:opacity .4s;-webkit-backface-visibility:hidden}.materialboxed:hover:not(.active){opacity:.8}.materialboxed.active{cursor:-webkit-zoom-out;cursor:zoom-out}#materialbox-overlay{position:fixed;top:0;right:0;bottom:0;left:0;background-color:#292929;z-index:1000;will-change:opacity}.materialbox-caption{position:fixed;display:none;color:#fff;line-height:50px;bottom:0;left:0;width:100%;text-align:center;padding:0% 15%;height:50px;z-index:1000;-webkit-font-smoothing:antialiased}select:focus{outline:1px solid #c9f3ef}button:focus{outline:none;background-color:#2ab7a9}label{font-size:.8rem;color:#9e9e9e}::-webkit-input-placeholder{color:#d1d1d1}:-moz-placeholder{color:#d1d1d1}::-moz-placeholder{color:#d1d1d1}:-ms-input-placeholder{color:#d1d1d1}input:not([type]),input[type=text],input[type=password],input[type=email],input[type=url],input[type=time],input[type=date],input[type=datetime],input[type=datetime-local],input[type=tel],input[type=number],input[type=search],textarea.materialize-textarea{background-color:transparent;border:none;border-bottom:1px solid #9e9e9e;border-radius:0;outline:none;height:3rem;width:100%;font-size:1rem;margin:0 0 20px 0;padding:0;box-shadow:none;box-sizing:content-box;transition:all 0.3s}input:not([type]):disabled,input:not([type])[readonly="readonly"],input[type=text]:disabled,input[type=text][readonly="readonly"],input[type=password]:disabled,input[type=password][readonly="readonly"],input[type=email]:disabled,input[type=email][readonly="readonly"],input[type=url]:disabled,input[type=url][readonly="readonly"],input[type=time]:disabled,input[type=time][readonly="readonly"],input[type=date]:disabled,input[type=date][readonly="readonly"],input[type=datetime]:disabled,input[type=datetime][readonly="readonly"],input[type=datetime-local]:disabled,input[type=datetime-local][readonly="readonly"],input[type=tel]:disabled,input[type=tel][readonly="readonly"],input[type=number]:disabled,input[type=number][readonly="readonly"],input[type=search]:disabled,input[type=search][readonly="readonly"],textarea.materialize-textarea:disabled,textarea.materialize-textarea[readonly="readonly"]{color:rgba(0,0,0,0.26);border-bottom:1px dotted rgba(0,0,0,0.26)}input:not([type]):disabled+label,input:not([type])[readonly="readonly"]+label,input[type=text]:disabled+label,input[type=text][readonly="readonly"]+label,input[type=password]:disabled+label,input[type=password][readonly="readonly"]+label,input[type=email]:disabled+label,input[type=email][readonly="readonly"]+label,input[type=url]:disabled+label,input[type=url][readonly="readonly"]+label,input[type=time]:disabled+label,input[type=time][readonly="readonly"]+label,input[type=date]:disabled+label,input[type=date][readonly="readonly"]+label,input[type=datetime]:disabled+label,input[type=datetime][readonly="readonly"]+label,input[type=datetime-local]:disabled+label,input[type=datetime-local][readonly="readonly"]+label,input[type=tel]:disabled+label,input[type=tel][readonly="readonly"]+label,input[type=number]:disabled+label,input[type=number][readonly="readonly"]+label,input[type=search]:disabled+label,input[type=search][readonly="readonly"]+label,textarea.materialize-textarea:disabled+label,textarea.materialize-textarea[readonly="readonly"]+label{color:rgba(0,0,0,0.26)}input:not([type]):focus:not([readonly]),input[type=text]:focus:not([readonly]),input[type=password]:focus:not([readonly]),input[type=email]:focus:not([readonly]),input[type=url]:focus:not([readonly]),input[type=time]:focus:not([readonly]),input[type=date]:focus:not([readonly]),input[type=datetime]:focus:not([readonly]),input[type=datetime-local]:focus:not([readonly]),input[type=tel]:focus:not([readonly]),input[type=number]:focus:not([readonly]),input[type=search]:focus:not([readonly]),textarea.materialize-textarea:focus:not([readonly]){border-bottom:1px solid #26a69a;box-shadow:0 1px 0 0 #26a69a}input:not([type]):focus:not([readonly])+label,input[type=text]:focus:not([readonly])+label,input[type=password]:focus:not([readonly])+label,input[type=email]:focus:not([readonly])+label,input[type=url]:focus:not([readonly])+label,input[type=time]:focus:not([readonly])+label,input[type=date]:focus:not([readonly])+label,input[type=datetime]:focus:not([readonly])+label,input[type=datetime-local]:focus:not([readonly])+label,input[type=tel]:focus:not([readonly])+label,input[type=number]:focus:not([readonly])+label,input[type=search]:focus:not([readonly])+label,textarea.materialize-textarea:focus:not([readonly])+label{color:#26a69a}input:not([type]).valid,input:not([type]):focus.valid,input[type=text].valid,input[type=text]:focus.valid,input[type=password].valid,input[type=password]:focus.valid,input[type=email].valid,input[type=email]:focus.valid,input[type=url].valid,input[type=url]:focus.valid,input[type=time].valid,input[type=time]:focus.valid,input[type=date].valid,input[type=date]:focus.valid,input[type=datetime].valid,input[type=datetime]:focus.valid,input[type=datetime-local].valid,input[type=datetime-local]:focus.valid,input[type=tel].valid,input[type=tel]:focus.valid,input[type=number].valid,input[type=number]:focus.valid,input[type=search].valid,input[type=search]:focus.valid,textarea.materialize-textarea.valid,textarea.materialize-textarea:focus.valid{border-bottom:1px solid #4CAF50;box-shadow:0 1px 0 0 #4CAF50}input:not([type]).valid+label:after,input:not([type]):focus.valid+label:after,input[type=text].valid+label:after,input[type=text]:focus.valid+label:after,input[type=password].valid+label:after,input[type=password]:focus.valid+label:after,input[type=email].valid+label:after,input[type=email]:focus.valid+label:after,input[type=url].valid+label:after,input[type=url]:focus.valid+label:after,input[type=time].valid+label:after,input[type=time]:focus.valid+label:after,input[type=date].valid+label:after,input[type=date]:focus.valid+label:after,input[type=datetime].valid+label:after,input[type=datetime]:focus.valid+label:after,input[type=datetime-local].valid+label:after,input[type=datetime-local]:focus.valid+label:after,input[type=tel].valid+label:after,input[type=tel]:focus.valid+label:after,input[type=number].valid+label:after,input[type=number]:focus.valid+label:after,input[type=search].valid+label:after,input[type=search]:focus.valid+label:after,textarea.materialize-textarea.valid+label:after,textarea.materialize-textarea:focus.valid+label:after{content:attr(data-success);color:#4CAF50;opacity:1}input:not([type]).invalid,input:not([type]):focus.invalid,input[type=text].invalid,input[type=text]:focus.invalid,input[type=password].invalid,input[type=password]:focus.invalid,input[type=email].invalid,input[type=email]:focus.invalid,input[type=url].invalid,input[type=url]:focus.invalid,input[type=time].invalid,input[type=time]:focus.invalid,input[type=date].invalid,input[type=date]:focus.invalid,input[type=datetime].invalid,input[type=datetime]:focus.invalid,input[type=datetime-local].invalid,input[type=datetime-local]:focus.invalid,input[type=tel].invalid,input[type=tel]:focus.invalid,input[type=number].invalid,input[type=number]:focus.invalid,input[type=search].invalid,input[type=search]:focus.invalid,textarea.materialize-textarea.invalid,textarea.materialize-textarea:focus.invalid{border-bottom:1px solid #F44336;box-shadow:0 1px 0 0 #F44336}input:not([type]).invalid+label:after,input:not([type]):focus.invalid+label:after,input[type=text].invalid+label:after,input[type=text]:focus.invalid+label:after,input[type=password].invalid+label:after,input[type=password]:focus.invalid+label:after,input[type=email].invalid+label:after,input[type=email]:focus.invalid+label:after,input[type=url].invalid+label:after,input[type=url]:focus.invalid+label:after,input[type=time].invalid+label:after,input[type=time]:focus.invalid+label:after,input[type=date].invalid+label:after,input[type=date]:focus.invalid+label:after,input[type=datetime].invalid+label:after,input[type=datetime]:focus.invalid+label:after,input[type=datetime-local].invalid+label:after,input[type=datetime-local]:focus.invalid+label:after,input[type=tel].invalid+label:after,input[type=tel]:focus.invalid+label:after,input[type=number].invalid+label:after,input[type=number]:focus.invalid+label:after,input[type=search].invalid+label:after,input[type=search]:focus.invalid+label:after,textarea.materialize-textarea.invalid+label:after,textarea.materialize-textarea:focus.invalid+label:after{content:attr(data-error);color:#F44336;opacity:1}input:not([type]).validate+label,input[type=text].validate+label,input[type=password].validate+label,input[type=email].validate+label,input[type=url].validate+label,input[type=time].validate+label,input[type=date].validate+label,input[type=datetime].validate+label,input[type=datetime-local].validate+label,input[type=tel].validate+label,input[type=number].validate+label,input[type=search].validate+label,textarea.materialize-textarea.validate+label{width:100%;pointer-events:none}input:not([type])+label:after,input[type=text]+label:after,input[type=password]+label:after,input[type=email]+label:after,input[type=url]+label:after,input[type=time]+label:after,input[type=date]+label:after,input[type=datetime]+label:after,input[type=datetime-local]+label:after,input[type=tel]+label:after,input[type=number]+label:after,input[type=search]+label:after,textarea.materialize-textarea+label:after{display:block;content:"";position:absolute;top:60px;opacity:0;transition:.2s opacity ease-out, .2s color ease-out}.input-field{position:relative;margin-top:1rem}.input-field.inline{display:inline-block;vertical-align:middle;margin-left:5px}.input-field.inline input,.input-field.inline .select-dropdown{margin-bottom:1rem}.input-field.col label{left:.75rem}.input-field.col .prefix ~ label,.input-field.col .prefix ~ .validate ~ label{width:calc(100% - 3rem - 1.5rem)}.input-field label{color:#9e9e9e;position:absolute;top:0.8rem;left:0;font-size:1rem;cursor:text;transition:.2s ease-out}.input-field label:not(.label-icon).active{font-size:.8rem;-webkit-transform:translateY(-140%);transform:translateY(-140%)}.input-field .prefix{position:absolute;width:3rem;font-size:2rem;transition:color .2s}.input-field .prefix.active{color:#26a69a}.input-field .prefix ~ input,.input-field .prefix ~ textarea,.input-field .prefix ~ label,.input-field .prefix ~ .validate ~ label,.input-field .prefix ~ .autocomplete-content{margin-left:3rem;width:92%;width:calc(100% - 3rem)}.input-field .prefix ~ label{margin-left:3rem}@media only screen and (max-width: 992px){.input-field .prefix ~ input{width:86%;width:calc(100% - 3rem)}}@media only screen and (max-width: 600px){.input-field .prefix ~ input{width:80%;width:calc(100% - 3rem)}}.input-field input[type=search]{display:block;line-height:inherit;padding-left:4rem;width:calc(100% - 4rem)}.input-field input[type=search]:focus{background-color:#fff;border:0;box-shadow:none;color:#444}.input-field input[type=search]:focus+label i,.input-field input[type=search]:focus ~ .mdi-navigation-close,.input-field input[type=search]:focus ~ .material-icons{color:#444}.input-field input[type=search]+label{left:1rem}.input-field input[type=search] ~ .mdi-navigation-close,.input-field input[type=search] ~ .material-icons{position:absolute;top:0;right:1rem;color:transparent;cursor:pointer;font-size:2rem;transition:.3s color}textarea{width:100%;height:3rem;background-color:transparent}textarea.materialize-textarea{overflow-y:hidden;padding:.8rem 0 1.6rem 0;resize:none;min-height:3rem}.hiddendiv{display:none;white-space:pre-wrap;word-wrap:break-word;overflow-wrap:break-word;padding-top:1.2rem}.autocomplete-content{margin-top:-15px;display:block;opacity:1;position:static}.autocomplete-content li .highlight{color:#444}.autocomplete-content li img{height:40px;width:40px;margin:5px 15px}[type="radio"]:not(:checked),[type="radio"]:checked{position:absolute;left:-9999px;opacity:0}[type="radio"]:not(:checked)+label,[type="radio"]:checked+label{position:relative;padding-left:35px;cursor:pointer;display:inline-block;height:25px;line-height:25px;font-size:1rem;transition:.28s ease;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}[type="radio"]+label:before,[type="radio"]+label:after{content:'';position:absolute;left:0;top:0;margin:4px;width:16px;height:16px;z-index:0;transition:.28s ease}[type="radio"]:not(:checked)+label:before,[type="radio"]:not(:checked)+label:after,[type="radio"]:checked+label:before,[type="radio"]:checked+label:after,[type="radio"].with-gap:checked+label:before,[type="radio"].with-gap:checked+label:after{border-radius:50%}[type="radio"]:not(:checked)+label:before,[type="radio"]:not(:checked)+label:after{border:2px solid #5a5a5a}[type="radio"]:not(:checked)+label:after{-webkit-transform:scale(0);transform:scale(0)}[type="radio"]:checked+label:before{border:2px solid transparent}[type="radio"]:checked+label:after,[type="radio"].with-gap:checked+label:before,[type="radio"].with-gap:checked+label:after{border:2px solid #26a69a}[type="radio"]:checked+label:after,[type="radio"].with-gap:checked+label:after{background-color:#26a69a}[type="radio"]:checked+label:after{-webkit-transform:scale(1.02);transform:scale(1.02)}[type="radio"].with-gap:checked+label:after{-webkit-transform:scale(0.5);transform:scale(0.5)}[type="radio"].tabbed:focus+label:before{box-shadow:0 0 0 10px rgba(0,0,0,0.1)}[type="radio"].with-gap:disabled:checked+label:before{border:2px solid rgba(0,0,0,0.26)}[type="radio"].with-gap:disabled:checked+label:after{border:none;background-color:rgba(0,0,0,0.26)}[type="radio"]:disabled:not(:checked)+label:before,[type="radio"]:disabled:checked+label:before{background-color:transparent;border-color:rgba(0,0,0,0.26)}[type="radio"]:disabled+label{color:rgba(0,0,0,0.26)}[type="radio"]:disabled:not(:checked)+label:before{border-color:rgba(0,0,0,0.26)}[type="radio"]:disabled:checked+label:after{background-color:rgba(0,0,0,0.26);border-color:#BDBDBD}form p{margin-bottom:10px;text-align:left}form p:last-child{margin-bottom:0}[type="checkbox"]:not(:checked),[type="checkbox"]:checked{position:absolute;left:-9999px;opacity:0}[type="checkbox"]+label{position:relative;padding-left:35px;cursor:pointer;display:inline-block;height:25px;line-height:25px;font-size:1rem;-webkit-user-select:none;-moz-user-select:none;-khtml-user-select:none;-ms-user-select:none}[type="checkbox"]+label:before,[type="checkbox"]:not(.filled-in)+label:after{content:'';position:absolute;top:0;left:0;width:18px;height:18px;z-index:0;border:2px solid #5a5a5a;border-radius:1px;margin-top:2px;transition:.2s}[type="checkbox"]:not(.filled-in)+label:after{border:0;-webkit-transform:scale(0);transform:scale(0)}[type="checkbox"]:not(:checked):disabled+label:before{border:none;background-color:rgba(0,0,0,0.26)}[type="checkbox"].tabbed:focus+label:after{-webkit-transform:scale(1);transform:scale(1);border:0;border-radius:50%;box-shadow:0 0 0 10px rgba(0,0,0,0.1);background-color:rgba(0,0,0,0.1)}[type="checkbox"]:checked+label:before{top:-4px;left:-5px;width:12px;height:22px;border-top:2px solid transparent;border-left:2px solid transparent;border-right:2px solid #26a69a;border-bottom:2px solid #26a69a;-webkit-transform:rotate(40deg);transform:rotate(40deg);-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-transform-origin:100% 100%;transform-origin:100% 100%}[type="checkbox"]:checked:disabled+label:before{border-right:2px solid rgba(0,0,0,0.26);border-bottom:2px solid rgba(0,0,0,0.26)}[type="checkbox"]:indeterminate+label:before{top:-11px;left:-12px;width:10px;height:22px;border-top:none;border-left:none;border-right:2px solid #26a69a;border-bottom:none;-webkit-transform:rotate(90deg);transform:rotate(90deg);-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-transform-origin:100% 100%;transform-origin:100% 100%}[type="checkbox"]:indeterminate:disabled+label:before{border-right:2px solid rgba(0,0,0,0.26);background-color:transparent}[type="checkbox"].filled-in+label:after{border-radius:2px}[type="checkbox"].filled-in+label:before,[type="checkbox"].filled-in+label:after{content:'';left:0;position:absolute;transition:border .25s, background-color .25s, width .20s .1s, height .20s .1s, top .20s .1s, left .20s .1s;z-index:1}[type="checkbox"].filled-in:not(:checked)+label:before{width:0;height:0;border:3px solid transparent;left:6px;top:10px;-webkit-transform:rotateZ(37deg);transform:rotateZ(37deg);-webkit-transform-origin:20% 40%;transform-origin:100% 100%}[type="checkbox"].filled-in:not(:checked)+label:after{height:20px;width:20px;background-color:transparent;border:2px solid #5a5a5a;top:0px;z-index:0}[type="checkbox"].filled-in:checked+label:before{top:0;left:1px;width:8px;height:13px;border-top:2px solid transparent;border-left:2px solid transparent;border-right:2px solid #fff;border-bottom:2px solid #fff;-webkit-transform:rotateZ(37deg);transform:rotateZ(37deg);-webkit-transform-origin:100% 100%;transform-origin:100% 100%}[type="checkbox"].filled-in:checked+label:after{top:0;width:20px;height:20px;border:2px solid #26a69a;background-color:#26a69a;z-index:0}[type="checkbox"].filled-in.tabbed:focus+label:after{border-radius:2px;border-color:#5a5a5a;background-color:rgba(0,0,0,0.1)}[type="checkbox"].filled-in.tabbed:checked:focus+label:after{border-radius:2px;background-color:#26a69a;border-color:#26a69a}[type="checkbox"].filled-in:disabled:not(:checked)+label:before{background-color:transparent;border:2px solid transparent}[type="checkbox"].filled-in:disabled:not(:checked)+label:after{border-color:transparent;background-color:#BDBDBD}[type="checkbox"].filled-in:disabled:checked+label:before{background-color:transparent}[type="checkbox"].filled-in:disabled:checked+label:after{background-color:#BDBDBD;border-color:#BDBDBD}.switch,.switch *{-webkit-user-select:none;-moz-user-select:none;-khtml-user-select:none;-ms-user-select:none}.switch label{cursor:pointer}.switch label input[type=checkbox]{opacity:0;width:0;height:0}.switch label input[type=checkbox]:checked+.lever{background-color:#84c7c1}.switch label input[type=checkbox]:checked+.lever:after{background-color:#26a69a;left:24px}.switch label .lever{content:"";display:inline-block;position:relative;width:40px;height:15px;background-color:#818181;border-radius:15px;margin-right:10px;transition:background 0.3s ease;vertical-align:middle;margin:0 16px}.switch label .lever:after{content:"";position:absolute;display:inline-block;width:21px;height:21px;background-color:#F1F1F1;border-radius:21px;box-shadow:0 1px 3px 1px rgba(0,0,0,0.4);left:-5px;top:-3px;transition:left 0.3s ease, background .3s ease, box-shadow 0.1s ease}input[type=checkbox]:checked:not(:disabled) ~ .lever:active::after,input[type=checkbox]:checked:not(:disabled).tabbed:focus ~ .lever::after{box-shadow:0 1px 3px 1px rgba(0,0,0,0.4),0 0 0 15px rgba(38,166,154,0.1)}input[type=checkbox]:not(:disabled) ~ .lever:active:after,input[type=checkbox]:not(:disabled).tabbed:focus ~ .lever::after{box-shadow:0 1px 3px 1px rgba(0,0,0,0.4),0 0 0 15px rgba(0,0,0,0.08)}.switch input[type=checkbox][disabled]+.lever{cursor:default}.switch label input[type=checkbox][disabled]+.lever:after,.switch label input[type=checkbox][disabled]:checked+.lever:after{background-color:#BDBDBD}select{display:none}select.browser-default{display:block}select{background-color:rgba(255,255,255,0.9);width:100%;padding:5px;border:1px solid #f2f2f2;border-radius:2px;height:3rem}.select-label{position:absolute}.select-wrapper{position:relative}.select-wrapper input.select-dropdown{position:relative;cursor:pointer;background-color:transparent;border:none;border-bottom:1px solid #9e9e9e;outline:none;height:3rem;line-height:3rem;width:100%;font-size:1rem;margin:0 0 20px 0;padding:0;display:block}.select-wrapper span.caret{color:initial;position:absolute;right:0;top:0;bottom:0;height:10px;margin:auto 0;font-size:10px;line-height:10px}.select-wrapper span.caret.disabled{color:rgba(0,0,0,0.26)}.select-wrapper+label{position:absolute;top:-14px;font-size:.8rem}select:disabled{color:rgba(0,0,0,0.3)}.select-wrapper input.select-dropdown:disabled{color:rgba(0,0,0,0.3);cursor:default;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;border-bottom:1px solid rgba(0,0,0,0.3)}.select-wrapper i{color:rgba(0,0,0,0.3)}.select-dropdown li.disabled,.select-dropdown li.disabled>span,.select-dropdown li.optgroup{color:rgba(0,0,0,0.3);background-color:transparent}.prefix ~ .select-wrapper{margin-left:3rem;width:92%;width:calc(100% - 3rem)}.prefix ~ label{margin-left:3rem}.select-dropdown li img{height:40px;width:40px;margin:5px 15px;float:right}.select-dropdown li.optgroup{border-top:1px solid #eee}.select-dropdown li.optgroup.selected>span{color:rgba(0,0,0,0.7)}.select-dropdown li.optgroup>span{color:rgba(0,0,0,0.4)}.select-dropdown li.optgroup ~ li.optgroup-option{padding-left:1rem}.file-field{position:relative}.file-field .file-path-wrapper{overflow:hidden;padding-left:10px}.file-field input.file-path{width:100%}.file-field .btn,.file-field .btn-large{float:left;height:3rem;line-height:3rem}.file-field span{cursor:pointer}.file-field input[type=file]{position:absolute;top:0;right:0;left:0;bottom:0;width:100%;margin:0;padding:0;font-size:20px;cursor:pointer;opacity:0;filter:alpha(opacity=0)}.range-field{position:relative}input[type=range],input[type=range]+.thumb{cursor:pointer}input[type=range]{position:relative;background-color:transparent;border:none;outline:none;width:100%;margin:15px 0;padding:0}input[type=range]:focus{outline:none}input[type=range]+.thumb{position:absolute;border:none;height:0;width:0;border-radius:50%;background-color:#26a69a;top:10px;margin-left:-6px;-webkit-transform-origin:50% 50%;transform-origin:50% 50%;-webkit-transform:rotate(-45deg);transform:rotate(-45deg)}input[type=range]+.thumb .value{display:block;width:30px;text-align:center;color:#26a69a;font-size:0;-webkit-transform:rotate(45deg);transform:rotate(45deg)}input[type=range]+.thumb.active{border-radius:50% 50% 50% 0}input[type=range]+.thumb.active .value{color:#fff;margin-left:-1px;margin-top:8px;font-size:10px}input[type=range]{-webkit-appearance:none}input[type=range]::-webkit-slider-runnable-track{height:3px;background:#c2c0c2;border:none}input[type=range]::-webkit-slider-thumb{-webkit-appearance:none;border:none;height:14px;width:14px;border-radius:50%;background-color:#26a69a;-webkit-transform-origin:50% 50%;transform-origin:50% 50%;margin:-5px 0 0 0;transition:.3s}input[type=range]:focus::-webkit-slider-runnable-track{background:#ccc}input[type=range]{border:1px solid white}input[type=range]::-moz-range-track{height:3px;background:#ddd;border:none}input[type=range]::-moz-range-thumb{border:none;height:14px;width:14px;border-radius:50%;background:#26a69a;margin-top:-5px}input[type=range]:-moz-focusring{outline:1px solid #fff;outline-offset:-1px}input[type=range]:focus::-moz-range-track{background:#ccc}input[type=range]::-ms-track{height:3px;background:transparent;border-color:transparent;border-width:6px 0;color:transparent}input[type=range]::-ms-fill-lower{background:#777}input[type=range]::-ms-fill-upper{background:#ddd}input[type=range]::-ms-thumb{border:none;height:14px;width:14px;border-radius:50%;background:#26a69a}input[type=range]:focus::-ms-fill-lower{background:#888}input[type=range]:focus::-ms-fill-upper{background:#ccc}.table-of-contents.fixed{position:fixed}.table-of-contents li{padding:2px 0}.table-of-contents a{display:inline-block;font-weight:300;color:#757575;padding-left:20px;height:1.5rem;line-height:1.5rem;letter-spacing:.4;display:inline-block}.table-of-contents a:hover{color:#a8a8a8;padding-left:19px;border-left:1px solid #ee6e73}.table-of-contents a.active{font-weight:500;padding-left:18px;border-left:2px solid #ee6e73}.side-nav{position:fixed;width:300px;left:0;top:0;margin:0;-webkit-transform:translateX(-100%);transform:translateX(-100%);height:100%;height:calc(100% + 60px);height:-moz-calc(100%);padding-bottom:60px;background-color:#fff;z-index:999;overflow-y:auto;will-change:transform;-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-transform:translateX(-105%);transform:translateX(-105%)}.side-nav.right-aligned{right:0;-webkit-transform:translateX(105%);transform:translateX(105%);left:auto;-webkit-transform:translateX(100%);transform:translateX(100%)}.side-nav .collapsible{margin:0}.side-nav li{float:none;line-height:48px}.side-nav li.active{background-color:rgba(0,0,0,0.05)}.side-nav a{color:rgba(0,0,0,0.87);display:block;font-size:14px;font-weight:500;height:48px;line-height:48px;padding:0 32px}.side-nav a:hover{background-color:rgba(0,0,0,0.05)}.side-nav a.btn,.side-nav a.btn-large,.side-nav a.btn-large,.side-nav a.btn-flat,.side-nav a.btn-floating{margin:10px 15px}.side-nav a.btn,.side-nav a.btn-large,.side-nav a.btn-large,.side-nav a.btn-floating{color:#fff}.side-nav a.btn-flat{color:#343434}.side-nav a.btn:hover,.side-nav a.btn-large:hover,.side-nav a.btn-large:hover{background-color:#2bbbad}.side-nav a.btn-floating:hover{background-color:#26a69a}.side-nav li>a>i,.side-nav li>a>[class^="mdi-"],.side-nav li>a>[class*="mdi-"],.side-nav li>a>i.material-icons{float:left;height:48px;line-height:48px;margin:0 32px 0 0;width:24px;color:rgba(0,0,0,0.54)}.side-nav .divider{margin:8px 0 0 0}.side-nav .subheader{cursor:initial;pointer-events:none;color:rgba(0,0,0,0.54);font-size:14px;font-weight:500;line-height:48px}.side-nav .subheader:hover{background-color:transparent}.side-nav .userView{position:relative;padding:32px 32px 0;margin-bottom:8px}.side-nav .userView>a{height:auto;padding:0}.side-nav .userView>a:hover{background-color:transparent}.side-nav .userView .background{overflow:hidden;position:absolute;top:0;right:0;bottom:0;left:0;z-index:-1}.side-nav .userView .circle,.side-nav .userView .name,.side-nav .userView .email{display:block}.side-nav .userView .circle{height:64px;width:64px}.side-nav .userView .name,.side-nav .userView .email{font-size:14px;line-height:24px}.side-nav .userView .name{margin-top:16px;font-weight:500}.side-nav .userView .email{padding-bottom:16px;font-weight:400}.drag-target{height:100%;width:10px;position:fixed;top:0;z-index:998}.side-nav.fixed{left:0;-webkit-transform:translateX(0);transform:translateX(0);position:fixed}.side-nav.fixed.right-aligned{right:0;left:auto}@media only screen and (max-width: 992px){.side-nav.fixed{-webkit-transform:translateX(-105%);transform:translateX(-105%)}.side-nav.fixed.right-aligned{-webkit-transform:translateX(105%);transform:translateX(105%)}.side-nav a{padding:0 16px}.side-nav .userView{padding:16px 16px 0}}.side-nav .collapsible-body>ul:not(.collapsible)>li.active,.side-nav.fixed .collapsible-body>ul:not(.collapsible)>li.active{background-color:#ee6e73}.side-nav .collapsible-body>ul:not(.collapsible)>li.active a,.side-nav.fixed .collapsible-body>ul:not(.collapsible)>li.active a{color:#fff}#sidenav-overlay{position:fixed;top:0;left:0;right:0;height:120vh;background-color:rgba(0,0,0,0.5);z-index:997;will-change:opacity}.preloader-wrapper{display:inline-block;position:relative;width:48px;height:48px}.preloader-wrapper.small{width:36px;height:36px}.preloader-wrapper.big{width:64px;height:64px}.preloader-wrapper.active{-webkit-animation:container-rotate 1568ms linear infinite;animation:container-rotate 1568ms linear infinite}@-webkit-keyframes container-rotate{to{-webkit-transform:rotate(360deg)}}@keyframes container-rotate{to{-webkit-transform:rotate(360deg);transform:rotate(360deg)}}.spinner-layer{position:absolute;width:100%;height:100%;opacity:0;border-color:#26a69a}.spinner-blue,.spinner-blue-only{border-color:#4285f4}.spinner-red,.spinner-red-only{border-color:#db4437}.spinner-yellow,.spinner-yellow-only{border-color:#f4b400}.spinner-green,.spinner-green-only{border-color:#0f9d58}.active .spinner-layer.spinner-blue{-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,blue-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,blue-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .spinner-layer.spinner-red{-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,red-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,red-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .spinner-layer.spinner-yellow{-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,yellow-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,yellow-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .spinner-layer.spinner-green{-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,green-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,green-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .spinner-layer,.active .spinner-layer.spinner-blue-only,.active .spinner-layer.spinner-red-only,.active .spinner-layer.spinner-yellow-only,.active .spinner-layer.spinner-green-only{opacity:1;-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}@-webkit-keyframes fill-unfill-rotate{12.5%{-webkit-transform:rotate(135deg)}25%{-webkit-transform:rotate(270deg)}37.5%{-webkit-transform:rotate(405deg)}50%{-webkit-transform:rotate(540deg)}62.5%{-webkit-transform:rotate(675deg)}75%{-webkit-transform:rotate(810deg)}87.5%{-webkit-transform:rotate(945deg)}to{-webkit-transform:rotate(1080deg)}}@keyframes fill-unfill-rotate{12.5%{-webkit-transform:rotate(135deg);transform:rotate(135deg)}25%{-webkit-transform:rotate(270deg);transform:rotate(270deg)}37.5%{-webkit-transform:rotate(405deg);transform:rotate(405deg)}50%{-webkit-transform:rotate(540deg);transform:rotate(540deg)}62.5%{-webkit-transform:rotate(675deg);transform:rotate(675deg)}75%{-webkit-transform:rotate(810deg);transform:rotate(810deg)}87.5%{-webkit-transform:rotate(945deg);transform:rotate(945deg)}to{-webkit-transform:rotate(1080deg);transform:rotate(1080deg)}}@-webkit-keyframes blue-fade-in-out{from{opacity:1}25%{opacity:1}26%{opacity:0}89%{opacity:0}90%{opacity:1}100%{opacity:1}}@keyframes blue-fade-in-out{from{opacity:1}25%{opacity:1}26%{opacity:0}89%{opacity:0}90%{opacity:1}100%{opacity:1}}@-webkit-keyframes red-fade-in-out{from{opacity:0}15%{opacity:0}25%{opacity:1}50%{opacity:1}51%{opacity:0}}@keyframes red-fade-in-out{from{opacity:0}15%{opacity:0}25%{opacity:1}50%{opacity:1}51%{opacity:0}}@-webkit-keyframes yellow-fade-in-out{from{opacity:0}40%{opacity:0}50%{opacity:1}75%{opacity:1}76%{opacity:0}}@keyframes yellow-fade-in-out{from{opacity:0}40%{opacity:0}50%{opacity:1}75%{opacity:1}76%{opacity:0}}@-webkit-keyframes green-fade-in-out{from{opacity:0}65%{opacity:0}75%{opacity:1}90%{opacity:1}100%{opacity:0}}@keyframes green-fade-in-out{from{opacity:0}65%{opacity:0}75%{opacity:1}90%{opacity:1}100%{opacity:0}}.gap-patch{position:absolute;top:0;left:45%;width:10%;height:100%;overflow:hidden;border-color:inherit}.gap-patch .circle{width:1000%;left:-450%}.circle-clipper{display:inline-block;position:relative;width:50%;height:100%;overflow:hidden;border-color:inherit}.circle-clipper .circle{width:200%;height:100%;border-width:3px;border-style:solid;border-color:inherit;border-bottom-color:transparent !important;border-radius:50%;-webkit-animation:none;animation:none;position:absolute;top:0;right:0;bottom:0}.circle-clipper.left .circle{left:0;border-right-color:transparent !important;-webkit-transform:rotate(129deg);transform:rotate(129deg)}.circle-clipper.right .circle{left:-100%;border-left-color:transparent !important;-webkit-transform:rotate(-129deg);transform:rotate(-129deg)}.active .circle-clipper.left .circle{-webkit-animation:left-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:left-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .circle-clipper.right .circle{-webkit-animation:right-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:right-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}@-webkit-keyframes left-spin{from{-webkit-transform:rotate(130deg)}50%{-webkit-transform:rotate(-5deg)}to{-webkit-transform:rotate(130deg)}}@keyframes left-spin{from{-webkit-transform:rotate(130deg);transform:rotate(130deg)}50%{-webkit-transform:rotate(-5deg);transform:rotate(-5deg)}to{-webkit-transform:rotate(130deg);transform:rotate(130deg)}}@-webkit-keyframes right-spin{from{-webkit-transform:rotate(-130deg)}50%{-webkit-transform:rotate(5deg)}to{-webkit-transform:rotate(-130deg)}}@keyframes right-spin{from{-webkit-transform:rotate(-130deg);transform:rotate(-130deg)}50%{-webkit-transform:rotate(5deg);transform:rotate(5deg)}to{-webkit-transform:rotate(-130deg);transform:rotate(-130deg)}}#spinnerContainer.cooldown{-webkit-animation:container-rotate 1568ms linear infinite,fade-out 400ms cubic-bezier(0.4, 0, 0.2, 1);animation:container-rotate 1568ms linear infinite,fade-out 400ms cubic-bezier(0.4, 0, 0.2, 1)}@-webkit-keyframes fade-out{from{opacity:1}to{opacity:0}}@keyframes fade-out{from{opacity:1}to{opacity:0}}.slider{position:relative;height:400px;width:100%}.slider.fullscreen{height:100%;width:100%;position:absolute;top:0;left:0;right:0;bottom:0}.slider.fullscreen ul.slides{height:100%}.slider.fullscreen ul.indicators{z-index:2;bottom:30px}.slider .slides{background-color:#9e9e9e;margin:0;height:400px}.slider .slides li{opacity:0;position:absolute;top:0;left:0;z-index:1;width:100%;height:inherit;overflow:hidden}.slider .slides li img{height:100%;width:100%;background-size:cover;background-position:center}.slider .slides li .caption{color:#fff;position:absolute;top:15%;left:15%;width:70%;opacity:0}.slider .slides li .caption p{color:#e0e0e0}.slider .slides li.active{z-index:2}.slider .indicators{position:absolute;text-align:center;left:0;right:0;bottom:0;margin:0}.slider .indicators .indicator-item{display:inline-block;position:relative;cursor:pointer;height:16px;width:16px;margin:0 12px;background-color:#e0e0e0;transition:background-color .3s;border-radius:50%}.slider .indicators .indicator-item.active{background-color:#4CAF50}.carousel{overflow:hidden;position:relative;width:100%;height:400px;-webkit-perspective:500px;perspective:500px;-webkit-transform-style:preserve-3d;transform-style:preserve-3d;-webkit-transform-origin:0% 50%;transform-origin:0% 50%}.carousel.carousel-slider{top:0;left:0;height:0}.carousel.carousel-slider .carousel-fixed-item{position:absolute;left:0;right:0;bottom:20px;z-index:1}.carousel.carousel-slider .carousel-fixed-item.with-indicators{bottom:68px}.carousel.carousel-slider .carousel-item{width:100%;height:100%;min-height:400px;position:absolute;top:0;left:0}.carousel.carousel-slider .carousel-item h2{font-size:24px;font-weight:500;line-height:32px}.carousel.carousel-slider .carousel-item p{font-size:15px}.carousel .carousel-item{display:none;width:200px;height:200px;position:absolute;top:0;left:0}.carousel .carousel-item img{width:100%}.carousel .indicators{position:absolute;text-align:center;left:0;right:0;bottom:0;margin:0}.carousel .indicators .indicator-item{display:inline-block;position:relative;cursor:pointer;height:8px;width:8px;margin:24px 4px;background-color:rgba(255,255,255,0.5);transition:background-color .3s;border-radius:50%}.carousel .indicators .indicator-item.active{background-color:#fff}.picker{font-size:16px;text-align:left;line-height:1.2;color:#000000;position:absolute;z-index:10000;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.picker__input{cursor:default}.picker__input.picker__input--active{border-color:#0089ec}.picker__holder{width:100%;overflow-y:auto;-webkit-overflow-scrolling:touch}/*!
+ * Default mobile-first, responsive styling for pickadate.js
+ * Demo: http://amsul.github.io/pickadate.js
+ */.picker__holder,.picker__frame{bottom:0;left:0;right:0;top:100%}.picker__holder{position:fixed;transition:background 0.15s ease-out, top 0s 0.15s;-webkit-backface-visibility:hidden}.picker__frame{position:absolute;margin:0 auto;min-width:256px;width:300px;max-height:350px;-ms-filter:"progid:DXImageTransform.Microsoft.Alpha(Opacity=0)";filter:alpha(opacity=0);-moz-opacity:0;opacity:0;transition:all 0.15s ease-out}@media (min-height: 28.875em){.picker__frame{overflow:visible;top:auto;bottom:-100%;max-height:80%}}@media (min-height: 40.125em){.picker__frame{margin-bottom:7.5%}}.picker__wrap{display:table;width:100%;height:100%}@media (min-height: 28.875em){.picker__wrap{display:block}}.picker__box{background:#ffffff;display:table-cell;vertical-align:middle}@media (min-height: 28.875em){.picker__box{display:block;border:1px solid #777777;border-top-color:#898989;border-bottom-width:0;border-radius:5px 5px 0 0;box-shadow:0 12px 36px 16px rgba(0,0,0,0.24)}}.picker--opened .picker__holder{top:0;background:transparent;-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorstr=#1E000000,endColorstr=#1E000000)";zoom:1;background:rgba(0,0,0,0.32);transition:background 0.15s ease-out}.picker--opened .picker__frame{top:0;-ms-filter:"progid:DXImageTransform.Microsoft.Alpha(Opacity=100)";filter:alpha(opacity=100);-moz-opacity:1;opacity:1}@media (min-height: 35.875em){.picker--opened .picker__frame{top:10%;bottom:auto}}.picker__input.picker__input--active{border-color:#E3F2FD}.picker__frame{margin:0 auto;max-width:325px}@media (min-height: 38.875em){.picker--opened .picker__frame{top:10%;bottom:auto}}.picker__box{padding:0 1em}.picker__header{text-align:center;position:relative;margin-top:.75em}.picker__month,.picker__year{display:inline-block;margin-left:.25em;margin-right:.25em}.picker__select--month,.picker__select--year{height:2em;padding:0;margin-left:.25em;margin-right:.25em}.picker__select--month.browser-default{display:inline;background-color:#FFFFFF;width:40%}.picker__select--year.browser-default{display:inline;background-color:#FFFFFF;width:26%}.picker__select--month:focus,.picker__select--year:focus{border-color:rgba(0,0,0,0.05)}.picker__nav--prev,.picker__nav--next{position:absolute;padding:.5em 1.25em;width:1em;height:1em;box-sizing:content-box;top:-0.25em}.picker__nav--prev{left:-1em;padding-right:1.25em}.picker__nav--next{right:-1em;padding-left:1.25em}.picker__nav--disabled,.picker__nav--disabled:hover,.picker__nav--disabled:before,.picker__nav--disabled:before:hover{cursor:default;background:none;border-right-color:#f5f5f5;border-left-color:#f5f5f5}.picker__table{text-align:center;border-collapse:collapse;border-spacing:0;table-layout:fixed;font-size:1rem;width:100%;margin-top:.75em;margin-bottom:.5em}.picker__table th,.picker__table td{text-align:center}.picker__table td{margin:0;padding:0}.picker__weekday{width:14.285714286%;font-size:.75em;padding-bottom:.25em;color:#999999;font-weight:500}@media (min-height: 33.875em){.picker__weekday{padding-bottom:.5em}}.picker__day--today{position:relative;color:#595959;letter-spacing:-.3;padding:.75rem 0;font-weight:400;border:1px solid transparent}.picker__day--disabled:before{border-top-color:#aaaaaa}.picker__day--infocus:hover{cursor:pointer;color:#000;font-weight:500}.picker__day--outfocus{display:none;padding:.75rem 0;color:#fff}.picker__day--outfocus:hover{cursor:pointer;color:#dddddd;font-weight:500}.picker__day--highlighted:hover,.picker--focused .picker__day--highlighted{cursor:pointer}.picker__day--selected,.picker__day--selected:hover,.picker--focused .picker__day--selected{border-radius:50%;-webkit-transform:scale(0.75);transform:scale(0.75);background:#0089ec;color:#ffffff}.picker__day--disabled,.picker__day--disabled:hover,.picker--focused .picker__day--disabled{background:#f5f5f5;border-color:#f5f5f5;color:#dddddd;cursor:default}.picker__day--highlighted.picker__day--disabled,.picker__day--highlighted.picker__day--disabled:hover{background:#bbbbbb}.picker__footer{text-align:center;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-align-items:center;-ms-flex-align:center;align-items:center;-webkit-justify-content:space-between;-ms-flex-pack:justify;justify-content:space-between}.picker__button--today,.picker__button--clear,.picker__button--close{border:1px solid #ffffff;background:#ffffff;font-size:.8em;padding:.66em 0;font-weight:bold;width:33%;display:inline-block;vertical-align:bottom}.picker__button--today:hover,.picker__button--clear:hover,.picker__button--close:hover{cursor:pointer;color:#000000;background:#b1dcfb;border-bottom-color:#b1dcfb}.picker__button--today:focus,.picker__button--clear:focus,.picker__button--close:focus{background:#b1dcfb;border-color:rgba(0,0,0,0.05);outline:none}.picker__button--today:before,.picker__button--clear:before,.picker__button--close:before{position:relative;display:inline-block;height:0}.picker__button--today:before,.picker__button--clear:before{content:" ";margin-right:.45em}.picker__button--today:before{top:-0.05em;width:0;border-top:0.66em solid #0059bc;border-left:.66em solid transparent}.picker__button--clear:before{top:-0.25em;width:.66em;border-top:3px solid #ee2200}.picker__button--close:before{content:"\D7";top:-0.1em;vertical-align:top;font-size:1.1em;margin-right:.35em;color:#777777}.picker__button--today[disabled],.picker__button--today[disabled]:hover{background:#f5f5f5;border-color:#f5f5f5;color:#dddddd;cursor:default}.picker__button--today[disabled]:before{border-top-color:#aaaaaa}.picker__box{border-radius:2px;overflow:hidden}.picker__date-display{text-align:center;background-color:#26a69a;color:#fff;padding-bottom:15px;font-weight:300}.picker__nav--prev:hover,.picker__nav--next:hover{cursor:pointer;color:#000000;background:#a1ded8}.picker__weekday-display{background-color:#1f897f;padding:10px;font-weight:200;letter-spacing:.5;font-size:1rem;margin-bottom:15px}.picker__month-display{text-transform:uppercase;font-size:2rem}.picker__day-display{font-size:4.5rem;font-weight:400}.picker__year-display{font-size:1.8rem;color:rgba(255,255,255,0.4)}.picker__box{padding:0}.picker__calendar-container{padding:0 1rem}.picker__calendar-container thead{border:none}.picker__table{margin-top:0;margin-bottom:.5em}.picker__day--infocus{color:#595959;letter-spacing:-.3;padding:.75rem 0;font-weight:400;border:1px solid transparent}.picker__day.picker__day--today{color:#26a69a}.picker__day.picker__day--today.picker__day--selected{color:#fff}.picker__weekday{font-size:.9rem}.picker__day--selected,.picker__day--selected:hover,.picker--focused .picker__day--selected{border-radius:50%;-webkit-transform:scale(0.9);transform:scale(0.9);background-color:#26a69a;color:#ffffff}.picker__day--selected.picker__day--outfocus,.picker__day--selected:hover.picker__day--outfocus,.picker--focused .picker__day--selected.picker__day--outfocus{background-color:#a1ded8}.picker__footer{text-align:right;padding:5px 10px}.picker__close,.picker__today{font-size:1.1rem;padding:0 1rem;color:#26a69a}.picker__nav--prev:before,.picker__nav--next:before{content:" ";border-top:.5em solid transparent;border-bottom:.5em solid transparent;border-right:0.75em solid #676767;width:0;height:0;display:block;margin:0 auto}.picker__nav--next:before{border-right:0;border-left:0.75em solid #676767}button.picker__today:focus,button.picker__clear:focus,button.picker__close:focus{background-color:#a1ded8}.picker__list{list-style:none;padding:0.75em 0 4.2em;margin:0}.picker__list-item{border-bottom:1px solid #dddddd;border-top:1px solid #dddddd;margin-bottom:-1px;position:relative;background:#ffffff;padding:.75em 1.25em}@media (min-height: 46.75em){.picker__list-item{padding:.5em 1em}}.picker__list-item:hover{cursor:pointer;color:#000000;background:#b1dcfb;border-color:#0089ec;z-index:10}.picker__list-item--highlighted{border-color:#0089ec;z-index:10}.picker__list-item--highlighted:hover,.picker--focused .picker__list-item--highlighted{cursor:pointer;color:#000000;background:#b1dcfb}.picker__list-item--selected,.picker__list-item--selected:hover,.picker--focused .picker__list-item--selected{background:#0089ec;color:#ffffff;z-index:10}.picker__list-item--disabled,.picker__list-item--disabled:hover,.picker--focused .picker__list-item--disabled{background:#f5f5f5;border-color:#f5f5f5;color:#dddddd;cursor:default;border-color:#dddddd;z-index:auto}.picker--time .picker__button--clear{display:block;width:80%;margin:1em auto 0;padding:1em 1.25em;background:none;border:0;font-weight:500;font-size:.67em;text-align:center;text-transform:uppercase;color:#666}.picker--time .picker__button--clear:hover,.picker--time .picker__button--clear:focus{color:#000000;background:#b1dcfb;background:#ee2200;border-color:#ee2200;cursor:pointer;color:#ffffff;outline:none}.picker--time .picker__button--clear:before{top:-0.25em;color:#666;font-size:1.25em;font-weight:bold}.picker--time .picker__button--clear:hover:before,.picker--time .picker__button--clear:focus:before{color:#ffffff}.picker--time .picker__frame{min-width:256px;max-width:320px}.picker--time .picker__box{font-size:1em;background:#f2f2f2;padding:0}@media (min-height: 40.125em){.picker--time .picker__box{margin-bottom:5em}}
diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/.DS_Store b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/.DS_Store
new file mode 100644 (file)
index 0000000..ae0d28e
Binary files /dev/null and b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/.DS_Store differ
diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.eot b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.eot
new file mode 100644 (file)
index 0000000..b73776e
Binary files /dev/null and b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.eot differ
diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.ttf b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.ttf
new file mode 100644 (file)
index 0000000..68822ca
Binary files /dev/null and b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.ttf differ
diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.woff b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.woff
new file mode 100644 (file)
index 0000000..1f75afd
Binary files /dev/null and b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.woff differ
diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.woff2 b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.woff2
new file mode 100644 (file)
index 0000000..350d1c3
Binary files /dev/null and b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.woff2 differ
diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.eot b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.eot
new file mode 100644 (file)
index 0000000..072cdc4
Binary files /dev/null and b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.eot differ
diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.ttf b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.ttf
new file mode 100644 (file)
index 0000000..aa45340
Binary files /dev/null and b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.ttf differ
diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.woff b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.woff
new file mode 100644 (file)
index 0000000..3480c6c
Binary files /dev/null and b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.woff differ
diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.woff2 b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.woff2
new file mode 100644 (file)
index 0000000..9a4d98c
Binary files /dev/null and b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.woff2 differ
diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.eot b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.eot
new file mode 100644 (file)
index 0000000..f9ad995
Binary files /dev/null and b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.eot differ
diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.ttf b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.ttf
new file mode 100644 (file)
index 0000000..a3c1a1f
Binary files /dev/null and b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.ttf differ
diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.woff b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.woff
new file mode 100644 (file)
index 0000000..1186773
Binary files /dev/null and b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.woff differ
diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.woff2 b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.woff2
new file mode 100644 (file)
index 0000000..d10a592
Binary files /dev/null and b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.woff2 differ
diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.eot b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.eot
new file mode 100644 (file)
index 0000000..9b5e8e4
Binary files /dev/null and b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.eot differ
diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.ttf b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.ttf
new file mode 100644 (file)
index 0000000..0e58508
Binary files /dev/null and b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.ttf differ
diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.woff b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.woff
new file mode 100644 (file)
index 0000000..f823258
Binary files /dev/null and b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.woff differ
diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.woff2 b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.woff2
new file mode 100644 (file)
index 0000000..b7082ef
Binary files /dev/null and b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.woff2 differ
diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.eot b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.eot
new file mode 100644 (file)
index 0000000..2284a3b
Binary files /dev/null and b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.eot differ
diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.ttf b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.ttf
new file mode 100644 (file)
index 0000000..8779333
Binary files /dev/null and b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.ttf differ
diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.woff b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.woff
new file mode 100644 (file)
index 0000000..2a98c1e
Binary files /dev/null and b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.woff differ
diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.woff2 b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.woff2
new file mode 100644 (file)
index 0000000..a38025a
Binary files /dev/null and b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.woff2 differ
diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/js/materialize.js b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/js/materialize.js
new file mode 100644 (file)
index 0000000..8c994c4
--- /dev/null
@@ -0,0 +1,8031 @@
+/*!
+ * Materialize v0.98.0 (http://materializecss.com)
+ * Copyright 2014-2015 Materialize
+ * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
+ */
+// Check for jQuery.
+if (typeof(jQuery) === 'undefined') {
+  var jQuery;
+  // Check if require is a defined function.
+  if (typeof(require) === 'function') {
+    jQuery = $ = require('jquery');
+  // Else use the dollar sign alias.
+  } else {
+    jQuery = $;
+  }
+}
+;/*
+ * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/
+ *
+ * Uses the built in easing capabilities added In jQuery 1.1
+ * to offer multiple easing options
+ *
+ * TERMS OF USE - jQuery Easing
+ *
+ * Open source under the BSD License.
+ *
+ * Copyright © 2008 George McGinley Smith
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without modification,
+ * are permitted provided that the following conditions are met:
+ *
+ * Redistributions of source code must retain the above copyright notice, this list of
+ * conditions and the following disclaimer.
+ * Redistributions in binary form must reproduce the above copyright notice, this list
+ * of conditions and the following disclaimer in the documentation and/or other materials
+ * provided with the distribution.
+ *
+ * Neither the name of the author nor the names of contributors may be used to endorse
+ * or promote products derived from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
+ * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+ *  COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+ *  EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ *  GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
+ * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ *  NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+ * OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+*/
+
+// t: current time, b: begInnIng value, c: change In value, d: duration
+jQuery.easing['jswing'] = jQuery.easing['swing'];
+
+jQuery.extend( jQuery.easing,
+{
+       def: 'easeOutQuad',
+       swing: function (x, t, b, c, d) {
+               //alert(jQuery.easing.default);
+               return jQuery.easing[jQuery.easing.def](x, t, b, c, d);
+       },
+       easeInQuad: function (x, t, b, c, d) {
+               return c*(t/=d)*t + b;
+       },
+       easeOutQuad: function (x, t, b, c, d) {
+               return -c *(t/=d)*(t-2) + b;
+       },
+       easeInOutQuad: function (x, t, b, c, d) {
+               if ((t/=d/2) < 1) return c/2*t*t + b;
+               return -c/2 * ((--t)*(t-2) - 1) + b;
+       },
+       easeInCubic: function (x, t, b, c, d) {
+               return c*(t/=d)*t*t + b;
+       },
+       easeOutCubic: function (x, t, b, c, d) {
+               return c*((t=t/d-1)*t*t + 1) + b;
+       },
+       easeInOutCubic: function (x, t, b, c, d) {
+               if ((t/=d/2) < 1) return c/2*t*t*t + b;
+               return c/2*((t-=2)*t*t + 2) + b;
+       },
+       easeInQuart: function (x, t, b, c, d) {
+               return c*(t/=d)*t*t*t + b;
+       },
+       easeOutQuart: function (x, t, b, c, d) {
+               return -c * ((t=t/d-1)*t*t*t - 1) + b;
+       },
+       easeInOutQuart: function (x, t, b, c, d) {
+               if ((t/=d/2) < 1) return c/2*t*t*t*t + b;
+               return -c/2 * ((t-=2)*t*t*t - 2) + b;
+       },
+       easeInQuint: function (x, t, b, c, d) {
+               return c*(t/=d)*t*t*t*t + b;
+       },
+       easeOutQuint: function (x, t, b, c, d) {
+               return c*((t=t/d-1)*t*t*t*t + 1) + b;
+       },
+       easeInOutQuint: function (x, t, b, c, d) {
+               if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b;
+               return c/2*((t-=2)*t*t*t*t + 2) + b;
+       },
+       easeInSine: function (x, t, b, c, d) {
+               return -c * Math.cos(t/d * (Math.PI/2)) + c + b;
+       },
+       easeOutSine: function (x, t, b, c, d) {
+               return c * Math.sin(t/d * (Math.PI/2)) + b;
+       },
+       easeInOutSine: function (x, t, b, c, d) {
+               return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b;
+       },
+       easeInExpo: function (x, t, b, c, d) {
+               return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b;
+       },
+       easeOutExpo: function (x, t, b, c, d) {
+               return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b;
+       },
+       easeInOutExpo: function (x, t, b, c, d) {
+               if (t==0) return b;
+               if (t==d) return b+c;
+               if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b;
+               return c/2 * (-Math.pow(2, -10 * --t) + 2) + b;
+       },
+       easeInCirc: function (x, t, b, c, d) {
+               return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b;
+       },
+       easeOutCirc: function (x, t, b, c, d) {
+               return c * Math.sqrt(1 - (t=t/d-1)*t) + b;
+       },
+       easeInOutCirc: function (x, t, b, c, d) {
+               if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b;
+               return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b;
+       },
+       easeInElastic: function (x, t, b, c, d) {
+               var s=1.70158;var p=0;var a=c;
+               if (t==0) return b;  if ((t/=d)==1) return b+c;  if (!p) p=d*.3;
+               if (a < Math.abs(c)) { a=c; var s=p/4; }
+               else var s = p/(2*Math.PI) * Math.asin (c/a);
+               return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
+       },
+       easeOutElastic: function (x, t, b, c, d) {
+               var s=1.70158;var p=0;var a=c;
+               if (t==0) return b;  if ((t/=d)==1) return b+c;  if (!p) p=d*.3;
+               if (a < Math.abs(c)) { a=c; var s=p/4; }
+               else var s = p/(2*Math.PI) * Math.asin (c/a);
+               return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b;
+       },
+       easeInOutElastic: function (x, t, b, c, d) {
+               var s=1.70158;var p=0;var a=c;
+               if (t==0) return b;  if ((t/=d/2)==2) return b+c;  if (!p) p=d*(.3*1.5);
+               if (a < Math.abs(c)) { a=c; var s=p/4; }
+               else var s = p/(2*Math.PI) * Math.asin (c/a);
+               if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
+               return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b;
+       },
+       easeInBack: function (x, t, b, c, d, s) {
+               if (s == undefined) s = 1.70158;
+               return c*(t/=d)*t*((s+1)*t - s) + b;
+       },
+       easeOutBack: function (x, t, b, c, d, s) {
+               if (s == undefined) s = 1.70158;
+               return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b;
+       },
+       easeInOutBack: function (x, t, b, c, d, s) {
+               if (s == undefined) s = 1.70158;
+               if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b;
+               return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b;
+       },
+       easeInBounce: function (x, t, b, c, d) {
+               return c - jQuery.easing.easeOutBounce (x, d-t, 0, c, d) + b;
+       },
+       easeOutBounce: function (x, t, b, c, d) {
+               if ((t/=d) < (1/2.75)) {
+                       return c*(7.5625*t*t) + b;
+               } else if (t < (2/2.75)) {
+                       return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b;
+               } else if (t < (2.5/2.75)) {
+                       return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b;
+               } else {
+                       return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b;
+               }
+       },
+       easeInOutBounce: function (x, t, b, c, d) {
+               if (t < d/2) return jQuery.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b;
+               return jQuery.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b;
+       }
+});
+
+/*
+ *
+ * TERMS OF USE - EASING EQUATIONS
+ *
+ * Open source under the BSD License.
+ *
+ * Copyright © 2001 Robert Penner
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without modification,
+ * are permitted provided that the following conditions are met:
+ *
+ * Redistributions of source code must retain the above copyright notice, this list of
+ * conditions and the following disclaimer.
+ * Redistributions in binary form must reproduce the above copyright notice, this list
+ * of conditions and the following disclaimer in the documentation and/or other materials
+ * provided with the distribution.
+ *
+ * Neither the name of the author nor the names of contributors may be used to endorse
+ * or promote products derived from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
+ * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+ *  COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+ *  EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ *  GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
+ * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ *  NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+ * OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+ */;// Custom Easing
+jQuery.extend( jQuery.easing,
+{
+  easeInOutMaterial: function (x, t, b, c, d) {
+    if ((t/=d/2) < 1) return c/2*t*t + b;
+    return c/4*((t-=2)*t*t + 2) + b;
+  }
+});;/*! VelocityJS.org (1.2.3). (C) 2014 Julian Shapiro. MIT @license: en.wikipedia.org/wiki/MIT_License */
+/*! VelocityJS.org jQuery Shim (1.0.1). (C) 2014 The jQuery Foundation. MIT @license: en.wikipedia.org/wiki/MIT_License. */
+/*! Note that this has been modified by Materialize to confirm that Velocity is not already being imported. */
+jQuery.Velocity?console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity."):(!function(e){function t(e){var t=e.length,a=r.type(e);return"function"===a||r.isWindow(e)?!1:1===e.nodeType&&t?!0:"array"===a||0===t||"number"==typeof t&&t>0&&t-1 in e}if(!e.jQuery){var r=function(e,t){return new r.fn.init(e,t)};r.isWindow=function(e){return null!=e&&e==e.window},r.type=function(e){return null==e?e+"":"object"==typeof e||"function"==typeof e?n[i.call(e)]||"object":typeof e},r.isArray=Array.isArray||function(e){return"array"===r.type(e)},r.isPlainObject=function(e){var t;if(!e||"object"!==r.type(e)||e.nodeType||r.isWindow(e))return!1;try{if(e.constructor&&!o.call(e,"constructor")&&!o.call(e.constructor.prototype,"isPrototypeOf"))return!1}catch(a){return!1}for(t in e);return void 0===t||o.call(e,t)},r.each=function(e,r,a){var n,o=0,i=e.length,s=t(e);if(a){if(s)for(;i>o&&(n=r.apply(e[o],a),n!==!1);o++);else for(o in e)if(n=r.apply(e[o],a),n===!1)break}else if(s)for(;i>o&&(n=r.call(e[o],o,e[o]),n!==!1);o++);else for(o in e)if(n=r.call(e[o],o,e[o]),n===!1)break;return e},r.data=function(e,t,n){if(void 0===n){var o=e[r.expando],i=o&&a[o];if(void 0===t)return i;if(i&&t in i)return i[t]}else if(void 0!==t){var o=e[r.expando]||(e[r.expando]=++r.uuid);return a[o]=a[o]||{},a[o][t]=n,n}},r.removeData=function(e,t){var n=e[r.expando],o=n&&a[n];o&&r.each(t,function(e,t){delete o[t]})},r.extend=function(){var e,t,a,n,o,i,s=arguments[0]||{},l=1,u=arguments.length,c=!1;for("boolean"==typeof s&&(c=s,s=arguments[l]||{},l++),"object"!=typeof s&&"function"!==r.type(s)&&(s={}),l===u&&(s=this,l--);u>l;l++)if(null!=(o=arguments[l]))for(n in o)e=s[n],a=o[n],s!==a&&(c&&a&&(r.isPlainObject(a)||(t=r.isArray(a)))?(t?(t=!1,i=e&&r.isArray(e)?e:[]):i=e&&r.isPlainObject(e)?e:{},s[n]=r.extend(c,i,a)):void 0!==a&&(s[n]=a));return s},r.queue=function(e,a,n){function o(e,r){var a=r||[];return null!=e&&(t(Object(e))?!function(e,t){for(var r=+t.length,a=0,n=e.length;r>a;)e[n++]=t[a++];if(r!==r)for(;void 0!==t[a];)e[n++]=t[a++];return e.length=n,e}(a,"string"==typeof e?[e]:e):[].push.call(a,e)),a}if(e){a=(a||"fx")+"queue";var i=r.data(e,a);return n?(!i||r.isArray(n)?i=r.data(e,a,o(n)):i.push(n),i):i||[]}},r.dequeue=function(e,t){r.each(e.nodeType?[e]:e,function(e,a){t=t||"fx";var n=r.queue(a,t),o=n.shift();"inprogress"===o&&(o=n.shift()),o&&("fx"===t&&n.unshift("inprogress"),o.call(a,function(){r.dequeue(a,t)}))})},r.fn=r.prototype={init:function(e){if(e.nodeType)return this[0]=e,this;throw new Error("Not a DOM node.")},offset:function(){var t=this[0].getBoundingClientRect?this[0].getBoundingClientRect():{top:0,left:0};return{top:t.top+(e.pageYOffset||document.scrollTop||0)-(document.clientTop||0),left:t.left+(e.pageXOffset||document.scrollLeft||0)-(document.clientLeft||0)}},position:function(){function e(){for(var e=this.offsetParent||document;e&&"html"===!e.nodeType.toLowerCase&&"static"===e.style.position;)e=e.offsetParent;return e||document}var t=this[0],e=e.apply(t),a=this.offset(),n=/^(?:body|html)$/i.test(e.nodeName)?{top:0,left:0}:r(e).offset();return a.top-=parseFloat(t.style.marginTop)||0,a.left-=parseFloat(t.style.marginLeft)||0,e.style&&(n.top+=parseFloat(e.style.borderTopWidth)||0,n.left+=parseFloat(e.style.borderLeftWidth)||0),{top:a.top-n.top,left:a.left-n.left}}};var a={};r.expando="velocity"+(new Date).getTime(),r.uuid=0;for(var n={},o=n.hasOwnProperty,i=n.toString,s="Boolean Number String Function Array Date RegExp Object Error".split(" "),l=0;l<s.length;l++)n["[object "+s[l]+"]"]=s[l].toLowerCase();r.fn.init.prototype=r.fn,e.Velocity={Utilities:r}}}(window),function(e){"object"==typeof module&&"object"==typeof module.exports?module.exports=e():"function"==typeof define&&define.amd?define(e):e()}(function(){return function(e,t,r,a){function n(e){for(var t=-1,r=e?e.length:0,a=[];++t<r;){var n=e[t];n&&a.push(n)}return a}function o(e){return m.isWrapped(e)?e=[].slice.call(e):m.isNode(e)&&(e=[e]),e}function i(e){var t=f.data(e,"velocity");return null===t?a:t}function s(e){return function(t){return Math.round(t*e)*(1/e)}}function l(e,r,a,n){function o(e,t){return 1-3*t+3*e}function i(e,t){return 3*t-6*e}function s(e){return 3*e}function l(e,t,r){return((o(t,r)*e+i(t,r))*e+s(t))*e}function u(e,t,r){return 3*o(t,r)*e*e+2*i(t,r)*e+s(t)}function c(t,r){for(var n=0;m>n;++n){var o=u(r,e,a);if(0===o)return r;var i=l(r,e,a)-t;r-=i/o}return r}function p(){for(var t=0;b>t;++t)w[t]=l(t*x,e,a)}function f(t,r,n){var o,i,s=0;do i=r+(n-r)/2,o=l(i,e,a)-t,o>0?n=i:r=i;while(Math.abs(o)>h&&++s<v);return i}function d(t){for(var r=0,n=1,o=b-1;n!=o&&w[n]<=t;++n)r+=x;--n;var i=(t-w[n])/(w[n+1]-w[n]),s=r+i*x,l=u(s,e,a);return l>=y?c(t,s):0==l?s:f(t,r,r+x)}function g(){V=!0,(e!=r||a!=n)&&p()}var m=4,y=.001,h=1e-7,v=10,b=11,x=1/(b-1),S="Float32Array"in t;if(4!==arguments.length)return!1;for(var P=0;4>P;++P)if("number"!=typeof arguments[P]||isNaN(arguments[P])||!isFinite(arguments[P]))return!1;e=Math.min(e,1),a=Math.min(a,1),e=Math.max(e,0),a=Math.max(a,0);var w=S?new Float32Array(b):new Array(b),V=!1,C=function(t){return V||g(),e===r&&a===n?t:0===t?0:1===t?1:l(d(t),r,n)};C.getControlPoints=function(){return[{x:e,y:r},{x:a,y:n}]};var T="generateBezier("+[e,r,a,n]+")";return C.toString=function(){return T},C}function u(e,t){var r=e;return m.isString(e)?b.Easings[e]||(r=!1):r=m.isArray(e)&&1===e.length?s.apply(null,e):m.isArray(e)&&2===e.length?x.apply(null,e.concat([t])):m.isArray(e)&&4===e.length?l.apply(null,e):!1,r===!1&&(r=b.Easings[b.defaults.easing]?b.defaults.easing:v),r}function c(e){if(e){var t=(new Date).getTime(),r=b.State.calls.length;r>1e4&&(b.State.calls=n(b.State.calls));for(var o=0;r>o;o++)if(b.State.calls[o]){var s=b.State.calls[o],l=s[0],u=s[2],d=s[3],g=!!d,y=null;d||(d=b.State.calls[o][3]=t-16);for(var h=Math.min((t-d)/u.duration,1),v=0,x=l.length;x>v;v++){var P=l[v],V=P.element;if(i(V)){var C=!1;if(u.display!==a&&null!==u.display&&"none"!==u.display){if("flex"===u.display){var T=["-webkit-box","-moz-box","-ms-flexbox","-webkit-flex"];f.each(T,function(e,t){S.setPropertyValue(V,"display",t)})}S.setPropertyValue(V,"display",u.display)}u.visibility!==a&&"hidden"!==u.visibility&&S.setPropertyValue(V,"visibility",u.visibility);for(var k in P)if("element"!==k){var A,F=P[k],j=m.isString(F.easing)?b.Easings[F.easing]:F.easing;if(1===h)A=F.endValue;else{var E=F.endValue-F.startValue;if(A=F.startValue+E*j(h,u,E),!g&&A===F.currentValue)continue}if(F.currentValue=A,"tween"===k)y=A;else{if(S.Hooks.registered[k]){var H=S.Hooks.getRoot(k),N=i(V).rootPropertyValueCache[H];N&&(F.rootPropertyValue=N)}var L=S.setPropertyValue(V,k,F.currentValue+(0===parseFloat(A)?"":F.unitType),F.rootPropertyValue,F.scrollData);S.Hooks.registered[k]&&(i(V).rootPropertyValueCache[H]=S.Normalizations.registered[H]?S.Normalizations.registered[H]("extract",null,L[1]):L[1]),"transform"===L[0]&&(C=!0)}}u.mobileHA&&i(V).transformCache.translate3d===a&&(i(V).transformCache.translate3d="(0px, 0px, 0px)",C=!0),C&&S.flushTransformCache(V)}}u.display!==a&&"none"!==u.display&&(b.State.calls[o][2].display=!1),u.visibility!==a&&"hidden"!==u.visibility&&(b.State.calls[o][2].visibility=!1),u.progress&&u.progress.call(s[1],s[1],h,Math.max(0,d+u.duration-t),d,y),1===h&&p(o)}}b.State.isTicking&&w(c)}function p(e,t){if(!b.State.calls[e])return!1;for(var r=b.State.calls[e][0],n=b.State.calls[e][1],o=b.State.calls[e][2],s=b.State.calls[e][4],l=!1,u=0,c=r.length;c>u;u++){var p=r[u].element;if(t||o.loop||("none"===o.display&&S.setPropertyValue(p,"display",o.display),"hidden"===o.visibility&&S.setPropertyValue(p,"visibility",o.visibility)),o.loop!==!0&&(f.queue(p)[1]===a||!/\.velocityQueueEntryFlag/i.test(f.queue(p)[1]))&&i(p)){i(p).isAnimating=!1,i(p).rootPropertyValueCache={};var d=!1;f.each(S.Lists.transforms3D,function(e,t){var r=/^scale/.test(t)?1:0,n=i(p).transformCache[t];i(p).transformCache[t]!==a&&new RegExp("^\\("+r+"[^.]").test(n)&&(d=!0,delete i(p).transformCache[t])}),o.mobileHA&&(d=!0,delete i(p).transformCache.translate3d),d&&S.flushTransformCache(p),S.Values.removeClass(p,"velocity-animating")}if(!t&&o.complete&&!o.loop&&u===c-1)try{o.complete.call(n,n)}catch(g){setTimeout(function(){throw g},1)}s&&o.loop!==!0&&s(n),i(p)&&o.loop===!0&&!t&&(f.each(i(p).tweensContainer,function(e,t){/^rotate/.test(e)&&360===parseFloat(t.endValue)&&(t.endValue=0,t.startValue=360),/^backgroundPosition/.test(e)&&100===parseFloat(t.endValue)&&"%"===t.unitType&&(t.endValue=0,t.startValue=100)}),b(p,"reverse",{loop:!0,delay:o.delay})),o.queue!==!1&&f.dequeue(p,o.queue)}b.State.calls[e]=!1;for(var m=0,y=b.State.calls.length;y>m;m++)if(b.State.calls[m]!==!1){l=!0;break}l===!1&&(b.State.isTicking=!1,delete b.State.calls,b.State.calls=[])}var f,d=function(){if(r.documentMode)return r.documentMode;for(var e=7;e>4;e--){var t=r.createElement("div");if(t.innerHTML="<!--[if IE "+e+"]><span></span><![endif]-->",t.getElementsByTagName("span").length)return t=null,e}return a}(),g=function(){var e=0;return t.webkitRequestAnimationFrame||t.mozRequestAnimationFrame||function(t){var r,a=(new Date).getTime();return r=Math.max(0,16-(a-e)),e=a+r,setTimeout(function(){t(a+r)},r)}}(),m={isString:function(e){return"string"==typeof e},isArray:Array.isArray||function(e){return"[object Array]"===Object.prototype.toString.call(e)},isFunction:function(e){return"[object Function]"===Object.prototype.toString.call(e)},isNode:function(e){return e&&e.nodeType},isNodeList:function(e){return"object"==typeof e&&/^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(e))&&e.length!==a&&(0===e.length||"object"==typeof e[0]&&e[0].nodeType>0)},isWrapped:function(e){return e&&(e.jquery||t.Zepto&&t.Zepto.zepto.isZ(e))},isSVG:function(e){return t.SVGElement&&e instanceof t.SVGElement},isEmptyObject:function(e){for(var t in e)return!1;return!0}},y=!1;if(e.fn&&e.fn.jquery?(f=e,y=!0):f=t.Velocity.Utilities,8>=d&&!y)throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");if(7>=d)return void(jQuery.fn.velocity=jQuery.fn.animate);var h=400,v="swing",b={State:{isMobile:/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),isAndroid:/Android/i.test(navigator.userAgent),isGingerbread:/Android 2\.3\.[3-7]/i.test(navigator.userAgent),isChrome:t.chrome,isFirefox:/Firefox/i.test(navigator.userAgent),prefixElement:r.createElement("div"),prefixMatches:{},scrollAnchor:null,scrollPropertyLeft:null,scrollPropertyTop:null,isTicking:!1,calls:[]},CSS:{},Utilities:f,Redirects:{},Easings:{},Promise:t.Promise,defaults:{queue:"",duration:h,easing:v,begin:a,complete:a,progress:a,display:a,visibility:a,loop:!1,delay:!1,mobileHA:!0,_cacheValues:!0},init:function(e){f.data(e,"velocity",{isSVG:m.isSVG(e),isAnimating:!1,computedStyle:null,tweensContainer:null,rootPropertyValueCache:{},transformCache:{}})},hook:null,mock:!1,version:{major:1,minor:2,patch:2},debug:!1};t.pageYOffset!==a?(b.State.scrollAnchor=t,b.State.scrollPropertyLeft="pageXOffset",b.State.scrollPropertyTop="pageYOffset"):(b.State.scrollAnchor=r.documentElement||r.body.parentNode||r.body,b.State.scrollPropertyLeft="scrollLeft",b.State.scrollPropertyTop="scrollTop");var x=function(){function e(e){return-e.tension*e.x-e.friction*e.v}function t(t,r,a){var n={x:t.x+a.dx*r,v:t.v+a.dv*r,tension:t.tension,friction:t.friction};return{dx:n.v,dv:e(n)}}function r(r,a){var n={dx:r.v,dv:e(r)},o=t(r,.5*a,n),i=t(r,.5*a,o),s=t(r,a,i),l=1/6*(n.dx+2*(o.dx+i.dx)+s.dx),u=1/6*(n.dv+2*(o.dv+i.dv)+s.dv);return r.x=r.x+l*a,r.v=r.v+u*a,r}return function a(e,t,n){var o,i,s,l={x:-1,v:0,tension:null,friction:null},u=[0],c=0,p=1e-4,f=.016;for(e=parseFloat(e)||500,t=parseFloat(t)||20,n=n||null,l.tension=e,l.friction=t,o=null!==n,o?(c=a(e,t),i=c/n*f):i=f;s=r(s||l,i),u.push(1+s.x),c+=16,Math.abs(s.x)>p&&Math.abs(s.v)>p;);return o?function(e){return u[e*(u.length-1)|0]}:c}}();b.Easings={linear:function(e){return e},swing:function(e){return.5-Math.cos(e*Math.PI)/2},spring:function(e){return 1-Math.cos(4.5*e*Math.PI)*Math.exp(6*-e)}},f.each([["ease",[.25,.1,.25,1]],["ease-in",[.42,0,1,1]],["ease-out",[0,0,.58,1]],["ease-in-out",[.42,0,.58,1]],["easeInSine",[.47,0,.745,.715]],["easeOutSine",[.39,.575,.565,1]],["easeInOutSine",[.445,.05,.55,.95]],["easeInQuad",[.55,.085,.68,.53]],["easeOutQuad",[.25,.46,.45,.94]],["easeInOutQuad",[.455,.03,.515,.955]],["easeInCubic",[.55,.055,.675,.19]],["easeOutCubic",[.215,.61,.355,1]],["easeInOutCubic",[.645,.045,.355,1]],["easeInQuart",[.895,.03,.685,.22]],["easeOutQuart",[.165,.84,.44,1]],["easeInOutQuart",[.77,0,.175,1]],["easeInQuint",[.755,.05,.855,.06]],["easeOutQuint",[.23,1,.32,1]],["easeInOutQuint",[.86,0,.07,1]],["easeInExpo",[.95,.05,.795,.035]],["easeOutExpo",[.19,1,.22,1]],["easeInOutExpo",[1,0,0,1]],["easeInCirc",[.6,.04,.98,.335]],["easeOutCirc",[.075,.82,.165,1]],["easeInOutCirc",[.785,.135,.15,.86]]],function(e,t){b.Easings[t[0]]=l.apply(null,t[1])});var S=b.CSS={RegEx:{isHex:/^#([A-f\d]{3}){1,2}$/i,valueUnwrap:/^[A-z]+\((.*)\)$/i,wrappedValueAlreadyExtracted:/[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/,valueSplit:/([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi},Lists:{colors:["fill","stroke","stopColor","color","backgroundColor","borderColor","borderTopColor","borderRightColor","borderBottomColor","borderLeftColor","outlineColor"],transformsBase:["translateX","translateY","scale","scaleX","scaleY","skewX","skewY","rotateZ"],transforms3D:["transformPerspective","translateZ","scaleZ","rotateX","rotateY"]},Hooks:{templates:{textShadow:["Color X Y Blur","black 0px 0px 0px"],boxShadow:["Color X Y Blur Spread","black 0px 0px 0px 0px"],clip:["Top Right Bottom Left","0px 0px 0px 0px"],backgroundPosition:["X Y","0% 0%"],transformOrigin:["X Y Z","50% 50% 0px"],perspectiveOrigin:["X Y","50% 50%"]},registered:{},register:function(){for(var e=0;e<S.Lists.colors.length;e++){var t="color"===S.Lists.colors[e]?"0 0 0 1":"255 255 255 1";S.Hooks.templates[S.Lists.colors[e]]=["Red Green Blue Alpha",t]}var r,a,n;if(d)for(r in S.Hooks.templates){a=S.Hooks.templates[r],n=a[0].split(" ");var o=a[1].match(S.RegEx.valueSplit);"Color"===n[0]&&(n.push(n.shift()),o.push(o.shift()),S.Hooks.templates[r]=[n.join(" "),o.join(" ")])}for(r in S.Hooks.templates){a=S.Hooks.templates[r],n=a[0].split(" ");for(var e in n){var i=r+n[e],s=e;S.Hooks.registered[i]=[r,s]}}},getRoot:function(e){var t=S.Hooks.registered[e];return t?t[0]:e},cleanRootPropertyValue:function(e,t){return S.RegEx.valueUnwrap.test(t)&&(t=t.match(S.RegEx.valueUnwrap)[1]),S.Values.isCSSNullValue(t)&&(t=S.Hooks.templates[e][1]),t},extractValue:function(e,t){var r=S.Hooks.registered[e];if(r){var a=r[0],n=r[1];return t=S.Hooks.cleanRootPropertyValue(a,t),t.toString().match(S.RegEx.valueSplit)[n]}return t},injectValue:function(e,t,r){var a=S.Hooks.registered[e];if(a){var n,o,i=a[0],s=a[1];return r=S.Hooks.cleanRootPropertyValue(i,r),n=r.toString().match(S.RegEx.valueSplit),n[s]=t,o=n.join(" ")}return r}},Normalizations:{registered:{clip:function(e,t,r){switch(e){case"name":return"clip";case"extract":var a;return S.RegEx.wrappedValueAlreadyExtracted.test(r)?a=r:(a=r.toString().match(S.RegEx.valueUnwrap),a=a?a[1].replace(/,(\s+)?/g," "):r),a;case"inject":return"rect("+r+")"}},blur:function(e,t,r){switch(e){case"name":return b.State.isFirefox?"filter":"-webkit-filter";case"extract":var a=parseFloat(r);if(!a&&0!==a){var n=r.toString().match(/blur\(([0-9]+[A-z]+)\)/i);a=n?n[1]:0}return a;case"inject":return parseFloat(r)?"blur("+r+")":"none"}},opacity:function(e,t,r){if(8>=d)switch(e){case"name":return"filter";case"extract":var a=r.toString().match(/alpha\(opacity=(.*)\)/i);return r=a?a[1]/100:1;case"inject":return t.style.zoom=1,parseFloat(r)>=1?"":"alpha(opacity="+parseInt(100*parseFloat(r),10)+")"}else switch(e){case"name":return"opacity";case"extract":return r;case"inject":return r}}},register:function(){9>=d||b.State.isGingerbread||(S.Lists.transformsBase=S.Lists.transformsBase.concat(S.Lists.transforms3D));for(var e=0;e<S.Lists.transformsBase.length;e++)!function(){var t=S.Lists.transformsBase[e];S.Normalizations.registered[t]=function(e,r,n){switch(e){case"name":return"transform";case"extract":return i(r)===a||i(r).transformCache[t]===a?/^scale/i.test(t)?1:0:i(r).transformCache[t].replace(/[()]/g,"");case"inject":var o=!1;switch(t.substr(0,t.length-1)){case"translate":o=!/(%|px|em|rem|vw|vh|\d)$/i.test(n);break;case"scal":case"scale":b.State.isAndroid&&i(r).transformCache[t]===a&&1>n&&(n=1),o=!/(\d)$/i.test(n);break;case"skew":o=!/(deg|\d)$/i.test(n);break;case"rotate":o=!/(deg|\d)$/i.test(n)}return o||(i(r).transformCache[t]="("+n+")"),i(r).transformCache[t]}}}();for(var e=0;e<S.Lists.colors.length;e++)!function(){var t=S.Lists.colors[e];S.Normalizations.registered[t]=function(e,r,n){switch(e){case"name":return t;case"extract":var o;if(S.RegEx.wrappedValueAlreadyExtracted.test(n))o=n;else{var i,s={black:"rgb(0, 0, 0)",blue:"rgb(0, 0, 255)",gray:"rgb(128, 128, 128)",green:"rgb(0, 128, 0)",red:"rgb(255, 0, 0)",white:"rgb(255, 255, 255)"};/^[A-z]+$/i.test(n)?i=s[n]!==a?s[n]:s.black:S.RegEx.isHex.test(n)?i="rgb("+S.Values.hexToRgb(n).join(" ")+")":/^rgba?\(/i.test(n)||(i=s.black),o=(i||n).toString().match(S.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g," ")}return 8>=d||3!==o.split(" ").length||(o+=" 1"),o;case"inject":return 8>=d?4===n.split(" ").length&&(n=n.split(/\s+/).slice(0,3).join(" ")):3===n.split(" ").length&&(n+=" 1"),(8>=d?"rgb":"rgba")+"("+n.replace(/\s+/g,",").replace(/\.(\d)+(?=,)/g,"")+")"}}}()}},Names:{camelCase:function(e){return e.replace(/-(\w)/g,function(e,t){return t.toUpperCase()})},SVGAttribute:function(e){var t="width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return(d||b.State.isAndroid&&!b.State.isChrome)&&(t+="|transform"),new RegExp("^("+t+")$","i").test(e)},prefixCheck:function(e){if(b.State.prefixMatches[e])return[b.State.prefixMatches[e],!0];for(var t=["","Webkit","Moz","ms","O"],r=0,a=t.length;a>r;r++){var n;if(n=0===r?e:t[r]+e.replace(/^\w/,function(e){return e.toUpperCase()}),m.isString(b.State.prefixElement.style[n]))return b.State.prefixMatches[e]=n,[n,!0]}return[e,!1]}},Values:{hexToRgb:function(e){var t,r=/^#?([a-f\d])([a-f\d])([a-f\d])$/i,a=/^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return e=e.replace(r,function(e,t,r,a){return t+t+r+r+a+a}),t=a.exec(e),t?[parseInt(t[1],16),parseInt(t[2],16),parseInt(t[3],16)]:[0,0,0]},isCSSNullValue:function(e){return 0==e||/^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(e)},getUnitType:function(e){return/^(rotate|skew)/i.test(e)?"deg":/(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(e)?"":"px"},getDisplayType:function(e){var t=e&&e.tagName.toString().toLowerCase();return/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(t)?"inline":/^(li)$/i.test(t)?"list-item":/^(tr)$/i.test(t)?"table-row":/^(table)$/i.test(t)?"table":/^(tbody)$/i.test(t)?"table-row-group":"block"},addClass:function(e,t){e.classList?e.classList.add(t):e.className+=(e.className.length?" ":"")+t},removeClass:function(e,t){e.classList?e.classList.remove(t):e.className=e.className.toString().replace(new RegExp("(^|\\s)"+t.split(" ").join("|")+"(\\s|$)","gi")," ")}},getPropertyValue:function(e,r,n,o){function s(e,r){function n(){u&&S.setPropertyValue(e,"display","none")}var l=0;if(8>=d)l=f.css(e,r);else{var u=!1;if(/^(width|height)$/.test(r)&&0===S.getPropertyValue(e,"display")&&(u=!0,S.setPropertyValue(e,"display",S.Values.getDisplayType(e))),!o){if("height"===r&&"border-box"!==S.getPropertyValue(e,"boxSizing").toString().toLowerCase()){var c=e.offsetHeight-(parseFloat(S.getPropertyValue(e,"borderTopWidth"))||0)-(parseFloat(S.getPropertyValue(e,"borderBottomWidth"))||0)-(parseFloat(S.getPropertyValue(e,"paddingTop"))||0)-(parseFloat(S.getPropertyValue(e,"paddingBottom"))||0);return n(),c}if("width"===r&&"border-box"!==S.getPropertyValue(e,"boxSizing").toString().toLowerCase()){var p=e.offsetWidth-(parseFloat(S.getPropertyValue(e,"borderLeftWidth"))||0)-(parseFloat(S.getPropertyValue(e,"borderRightWidth"))||0)-(parseFloat(S.getPropertyValue(e,"paddingLeft"))||0)-(parseFloat(S.getPropertyValue(e,"paddingRight"))||0);return n(),p}}var g;g=i(e)===a?t.getComputedStyle(e,null):i(e).computedStyle?i(e).computedStyle:i(e).computedStyle=t.getComputedStyle(e,null),"borderColor"===r&&(r="borderTopColor"),l=9===d&&"filter"===r?g.getPropertyValue(r):g[r],(""===l||null===l)&&(l=e.style[r]),n()}if("auto"===l&&/^(top|right|bottom|left)$/i.test(r)){var m=s(e,"position");("fixed"===m||"absolute"===m&&/top|left/i.test(r))&&(l=f(e).position()[r]+"px")}return l}var l;if(S.Hooks.registered[r]){var u=r,c=S.Hooks.getRoot(u);n===a&&(n=S.getPropertyValue(e,S.Names.prefixCheck(c)[0])),S.Normalizations.registered[c]&&(n=S.Normalizations.registered[c]("extract",e,n)),l=S.Hooks.extractValue(u,n)}else if(S.Normalizations.registered[r]){var p,g;p=S.Normalizations.registered[r]("name",e),"transform"!==p&&(g=s(e,S.Names.prefixCheck(p)[0]),S.Values.isCSSNullValue(g)&&S.Hooks.templates[r]&&(g=S.Hooks.templates[r][1])),l=S.Normalizations.registered[r]("extract",e,g)}if(!/^[\d-]/.test(l))if(i(e)&&i(e).isSVG&&S.Names.SVGAttribute(r))if(/^(height|width)$/i.test(r))try{l=e.getBBox()[r]}catch(m){l=0}else l=e.getAttribute(r);else l=s(e,S.Names.prefixCheck(r)[0]);return S.Values.isCSSNullValue(l)&&(l=0),b.debug>=2&&console.log("Get "+r+": "+l),l},setPropertyValue:function(e,r,a,n,o){var s=r;if("scroll"===r)o.container?o.container["scroll"+o.direction]=a:"Left"===o.direction?t.scrollTo(a,o.alternateValue):t.scrollTo(o.alternateValue,a);else if(S.Normalizations.registered[r]&&"transform"===S.Normalizations.registered[r]("name",e))S.Normalizations.registered[r]("inject",e,a),s="transform",a=i(e).transformCache[r];else{if(S.Hooks.registered[r]){var l=r,u=S.Hooks.getRoot(r);n=n||S.getPropertyValue(e,u),a=S.Hooks.injectValue(l,a,n),r=u}if(S.Normalizations.registered[r]&&(a=S.Normalizations.registered[r]("inject",e,a),r=S.Normalizations.registered[r]("name",e)),s=S.Names.prefixCheck(r)[0],8>=d)try{e.style[s]=a}catch(c){b.debug&&console.log("Browser does not support ["+a+"] for ["+s+"]")}else i(e)&&i(e).isSVG&&S.Names.SVGAttribute(r)?e.setAttribute(r,a):e.style[s]=a;b.debug>=2&&console.log("Set "+r+" ("+s+"): "+a)}return[s,a]},flushTransformCache:function(e){function t(t){return parseFloat(S.getPropertyValue(e,t))}var r="";if((d||b.State.isAndroid&&!b.State.isChrome)&&i(e).isSVG){var a={translate:[t("translateX"),t("translateY")],skewX:[t("skewX")],skewY:[t("skewY")],scale:1!==t("scale")?[t("scale"),t("scale")]:[t("scaleX"),t("scaleY")],rotate:[t("rotateZ"),0,0]};f.each(i(e).transformCache,function(e){/^translate/i.test(e)?e="translate":/^scale/i.test(e)?e="scale":/^rotate/i.test(e)&&(e="rotate"),a[e]&&(r+=e+"("+a[e].join(" ")+") ",delete a[e])})}else{var n,o;f.each(i(e).transformCache,function(t){return n=i(e).transformCache[t],"transformPerspective"===t?(o=n,!0):(9===d&&"rotateZ"===t&&(t="rotate"),void(r+=t+n+" "))}),o&&(r="perspective"+o+" "+r)}S.setPropertyValue(e,"transform",r)}};S.Hooks.register(),S.Normalizations.register(),b.hook=function(e,t,r){var n=a;return e=o(e),f.each(e,function(e,o){if(i(o)===a&&b.init(o),r===a)n===a&&(n=b.CSS.getPropertyValue(o,t));else{var s=b.CSS.setPropertyValue(o,t,r);"transform"===s[0]&&b.CSS.flushTransformCache(o),n=s}}),n};var P=function(){function e(){return s?k.promise||null:l}function n(){function e(e){function p(e,t){var r=a,n=a,i=a;return m.isArray(e)?(r=e[0],!m.isArray(e[1])&&/^[\d-]/.test(e[1])||m.isFunction(e[1])||S.RegEx.isHex.test(e[1])?i=e[1]:(m.isString(e[1])&&!S.RegEx.isHex.test(e[1])||m.isArray(e[1]))&&(n=t?e[1]:u(e[1],s.duration),e[2]!==a&&(i=e[2]))):r=e,t||(n=n||s.easing),m.isFunction(r)&&(r=r.call(o,V,w)),m.isFunction(i)&&(i=i.call(o,V,w)),[r||0,n,i]}function d(e,t){var r,a;return a=(t||"0").toString().toLowerCase().replace(/[%A-z]+$/,function(e){return r=e,""}),r||(r=S.Values.getUnitType(e)),[a,r]}function h(){var e={myParent:o.parentNode||r.body,position:S.getPropertyValue(o,"position"),fontSize:S.getPropertyValue(o,"fontSize")},a=e.position===L.lastPosition&&e.myParent===L.lastParent,n=e.fontSize===L.lastFontSize;L.lastParent=e.myParent,L.lastPosition=e.position,L.lastFontSize=e.fontSize;var s=100,l={};if(n&&a)l.emToPx=L.lastEmToPx,l.percentToPxWidth=L.lastPercentToPxWidth,l.percentToPxHeight=L.lastPercentToPxHeight;else{var u=i(o).isSVG?r.createElementNS("http://www.w3.org/2000/svg","rect"):r.createElement("div");b.init(u),e.myParent.appendChild(u),f.each(["overflow","overflowX","overflowY"],function(e,t){b.CSS.setPropertyValue(u,t,"hidden")}),b.CSS.setPropertyValue(u,"position",e.position),b.CSS.setPropertyValue(u,"fontSize",e.fontSize),b.CSS.setPropertyValue(u,"boxSizing","content-box"),f.each(["minWidth","maxWidth","width","minHeight","maxHeight","height"],function(e,t){b.CSS.setPropertyValue(u,t,s+"%")}),b.CSS.setPropertyValue(u,"paddingLeft",s+"em"),l.percentToPxWidth=L.lastPercentToPxWidth=(parseFloat(S.getPropertyValue(u,"width",null,!0))||1)/s,l.percentToPxHeight=L.lastPercentToPxHeight=(parseFloat(S.getPropertyValue(u,"height",null,!0))||1)/s,l.emToPx=L.lastEmToPx=(parseFloat(S.getPropertyValue(u,"paddingLeft"))||1)/s,e.myParent.removeChild(u)}return null===L.remToPx&&(L.remToPx=parseFloat(S.getPropertyValue(r.body,"fontSize"))||16),null===L.vwToPx&&(L.vwToPx=parseFloat(t.innerWidth)/100,L.vhToPx=parseFloat(t.innerHeight)/100),l.remToPx=L.remToPx,l.vwToPx=L.vwToPx,l.vhToPx=L.vhToPx,b.debug>=1&&console.log("Unit ratios: "+JSON.stringify(l),o),l}if(s.begin&&0===V)try{s.begin.call(g,g)}catch(x){setTimeout(function(){throw x},1)}if("scroll"===A){var P,C,T,F=/^x$/i.test(s.axis)?"Left":"Top",j=parseFloat(s.offset)||0;s.container?m.isWrapped(s.container)||m.isNode(s.container)?(s.container=s.container[0]||s.container,P=s.container["scroll"+F],T=P+f(o).position()[F.toLowerCase()]+j):s.container=null:(P=b.State.scrollAnchor[b.State["scrollProperty"+F]],C=b.State.scrollAnchor[b.State["scrollProperty"+("Left"===F?"Top":"Left")]],T=f(o).offset()[F.toLowerCase()]+j),l={scroll:{rootPropertyValue:!1,startValue:P,currentValue:P,endValue:T,unitType:"",easing:s.easing,scrollData:{container:s.container,direction:F,alternateValue:C}},element:o},b.debug&&console.log("tweensContainer (scroll): ",l.scroll,o)}else if("reverse"===A){if(!i(o).tweensContainer)return void f.dequeue(o,s.queue);"none"===i(o).opts.display&&(i(o).opts.display="auto"),"hidden"===i(o).opts.visibility&&(i(o).opts.visibility="visible"),i(o).opts.loop=!1,i(o).opts.begin=null,i(o).opts.complete=null,v.easing||delete s.easing,v.duration||delete s.duration,s=f.extend({},i(o).opts,s);var E=f.extend(!0,{},i(o).tweensContainer);for(var H in E)if("element"!==H){var N=E[H].startValue;E[H].startValue=E[H].currentValue=E[H].endValue,E[H].endValue=N,m.isEmptyObject(v)||(E[H].easing=s.easing),b.debug&&console.log("reverse tweensContainer ("+H+"): "+JSON.stringify(E[H]),o)}l=E}else if("start"===A){var E;i(o).tweensContainer&&i(o).isAnimating===!0&&(E=i(o).tweensContainer),f.each(y,function(e,t){if(RegExp("^"+S.Lists.colors.join("$|^")+"$").test(e)){var r=p(t,!0),n=r[0],o=r[1],i=r[2];if(S.RegEx.isHex.test(n)){for(var s=["Red","Green","Blue"],l=S.Values.hexToRgb(n),u=i?S.Values.hexToRgb(i):a,c=0;c<s.length;c++){var f=[l[c]];o&&f.push(o),u!==a&&f.push(u[c]),y[e+s[c]]=f}delete y[e]}}});for(var z in y){var O=p(y[z]),q=O[0],$=O[1],M=O[2];z=S.Names.camelCase(z);var I=S.Hooks.getRoot(z),B=!1;if(i(o).isSVG||"tween"===I||S.Names.prefixCheck(I)[1]!==!1||S.Normalizations.registered[I]!==a){(s.display!==a&&null!==s.display&&"none"!==s.display||s.visibility!==a&&"hidden"!==s.visibility)&&/opacity|filter/.test(z)&&!M&&0!==q&&(M=0),s._cacheValues&&E&&E[z]?(M===a&&(M=E[z].endValue+E[z].unitType),B=i(o).rootPropertyValueCache[I]):S.Hooks.registered[z]?M===a?(B=S.getPropertyValue(o,I),M=S.getPropertyValue(o,z,B)):B=S.Hooks.templates[I][1]:M===a&&(M=S.getPropertyValue(o,z));var W,G,Y,D=!1;if(W=d(z,M),M=W[0],Y=W[1],W=d(z,q),q=W[0].replace(/^([+-\/*])=/,function(e,t){return D=t,""}),G=W[1],M=parseFloat(M)||0,q=parseFloat(q)||0,"%"===G&&(/^(fontSize|lineHeight)$/.test(z)?(q/=100,G="em"):/^scale/.test(z)?(q/=100,G=""):/(Red|Green|Blue)$/i.test(z)&&(q=q/100*255,G="")),/[\/*]/.test(D))G=Y;else if(Y!==G&&0!==M)if(0===q)G=Y;else{n=n||h();var Q=/margin|padding|left|right|width|text|word|letter/i.test(z)||/X$/.test(z)||"x"===z?"x":"y";switch(Y){case"%":M*="x"===Q?n.percentToPxWidth:n.percentToPxHeight;break;case"px":break;default:M*=n[Y+"ToPx"]}switch(G){case"%":M*=1/("x"===Q?n.percentToPxWidth:n.percentToPxHeight);break;case"px":break;default:M*=1/n[G+"ToPx"]}}switch(D){case"+":q=M+q;break;case"-":q=M-q;break;case"*":q=M*q;break;case"/":q=M/q}l[z]={rootPropertyValue:B,startValue:M,currentValue:M,endValue:q,unitType:G,easing:$},b.debug&&console.log("tweensContainer ("+z+"): "+JSON.stringify(l[z]),o)}else b.debug&&console.log("Skipping ["+I+"] due to a lack of browser support.")}l.element=o}l.element&&(S.Values.addClass(o,"velocity-animating"),R.push(l),""===s.queue&&(i(o).tweensContainer=l,i(o).opts=s),i(o).isAnimating=!0,V===w-1?(b.State.calls.push([R,g,s,null,k.resolver]),b.State.isTicking===!1&&(b.State.isTicking=!0,c())):V++)}var n,o=this,s=f.extend({},b.defaults,v),l={};switch(i(o)===a&&b.init(o),parseFloat(s.delay)&&s.queue!==!1&&f.queue(o,s.queue,function(e){b.velocityQueueEntryFlag=!0,i(o).delayTimer={setTimeout:setTimeout(e,parseFloat(s.delay)),next:e}}),s.duration.toString().toLowerCase()){case"fast":s.duration=200;break;case"normal":s.duration=h;break;case"slow":s.duration=600;break;default:s.duration=parseFloat(s.duration)||1}b.mock!==!1&&(b.mock===!0?s.duration=s.delay=1:(s.duration*=parseFloat(b.mock)||1,s.delay*=parseFloat(b.mock)||1)),s.easing=u(s.easing,s.duration),s.begin&&!m.isFunction(s.begin)&&(s.begin=null),s.progress&&!m.isFunction(s.progress)&&(s.progress=null),s.complete&&!m.isFunction(s.complete)&&(s.complete=null),s.display!==a&&null!==s.display&&(s.display=s.display.toString().toLowerCase(),"auto"===s.display&&(s.display=b.CSS.Values.getDisplayType(o))),s.visibility!==a&&null!==s.visibility&&(s.visibility=s.visibility.toString().toLowerCase()),s.mobileHA=s.mobileHA&&b.State.isMobile&&!b.State.isGingerbread,s.queue===!1?s.delay?setTimeout(e,s.delay):e():f.queue(o,s.queue,function(t,r){return r===!0?(k.promise&&k.resolver(g),!0):(b.velocityQueueEntryFlag=!0,void e(t))}),""!==s.queue&&"fx"!==s.queue||"inprogress"===f.queue(o)[0]||f.dequeue(o)}var s,l,d,g,y,v,x=arguments[0]&&(arguments[0].p||f.isPlainObject(arguments[0].properties)&&!arguments[0].properties.names||m.isString(arguments[0].properties));if(m.isWrapped(this)?(s=!1,d=0,g=this,l=this):(s=!0,d=1,g=x?arguments[0].elements||arguments[0].e:arguments[0]),g=o(g)){x?(y=arguments[0].properties||arguments[0].p,v=arguments[0].options||arguments[0].o):(y=arguments[d],v=arguments[d+1]);var w=g.length,V=0;if(!/^(stop|finish)$/i.test(y)&&!f.isPlainObject(v)){var C=d+1;v={};for(var T=C;T<arguments.length;T++)m.isArray(arguments[T])||!/^(fast|normal|slow)$/i.test(arguments[T])&&!/^\d/.test(arguments[T])?m.isString(arguments[T])||m.isArray(arguments[T])?v.easing=arguments[T]:m.isFunction(arguments[T])&&(v.complete=arguments[T]):v.duration=arguments[T]}var k={promise:null,resolver:null,rejecter:null};s&&b.Promise&&(k.promise=new b.Promise(function(e,t){k.resolver=e,k.rejecter=t}));var A;switch(y){case"scroll":A="scroll";break;case"reverse":A="reverse";break;case"finish":case"stop":f.each(g,function(e,t){i(t)&&i(t).delayTimer&&(clearTimeout(i(t).delayTimer.setTimeout),i(t).delayTimer.next&&i(t).delayTimer.next(),delete i(t).delayTimer)});var F=[];return f.each(b.State.calls,function(e,t){t&&f.each(t[1],function(r,n){var o=v===a?"":v;return o===!0||t[2].queue===o||v===a&&t[2].queue===!1?void f.each(g,function(r,a){a===n&&((v===!0||m.isString(v))&&(f.each(f.queue(a,m.isString(v)?v:""),function(e,t){
+m.isFunction(t)&&t(null,!0)}),f.queue(a,m.isString(v)?v:"",[])),"stop"===y?(i(a)&&i(a).tweensContainer&&o!==!1&&f.each(i(a).tweensContainer,function(e,t){t.endValue=t.currentValue}),F.push(e)):"finish"===y&&(t[2].duration=1))}):!0})}),"stop"===y&&(f.each(F,function(e,t){p(t,!0)}),k.promise&&k.resolver(g)),e();default:if(!f.isPlainObject(y)||m.isEmptyObject(y)){if(m.isString(y)&&b.Redirects[y]){var j=f.extend({},v),E=j.duration,H=j.delay||0;return j.backwards===!0&&(g=f.extend(!0,[],g).reverse()),f.each(g,function(e,t){parseFloat(j.stagger)?j.delay=H+parseFloat(j.stagger)*e:m.isFunction(j.stagger)&&(j.delay=H+j.stagger.call(t,e,w)),j.drag&&(j.duration=parseFloat(E)||(/^(callout|transition)/.test(y)?1e3:h),j.duration=Math.max(j.duration*(j.backwards?1-e/w:(e+1)/w),.75*j.duration,200)),b.Redirects[y].call(t,t,j||{},e,w,g,k.promise?k:a)}),e()}var N="Velocity: First argument ("+y+") was not a property map, a known action, or a registered redirect. Aborting.";return k.promise?k.rejecter(new Error(N)):console.log(N),e()}A="start"}var L={lastParent:null,lastPosition:null,lastFontSize:null,lastPercentToPxWidth:null,lastPercentToPxHeight:null,lastEmToPx:null,remToPx:null,vwToPx:null,vhToPx:null},R=[];f.each(g,function(e,t){m.isNode(t)&&n.call(t)});var z,j=f.extend({},b.defaults,v);if(j.loop=parseInt(j.loop),z=2*j.loop-1,j.loop)for(var O=0;z>O;O++){var q={delay:j.delay,progress:j.progress};O===z-1&&(q.display=j.display,q.visibility=j.visibility,q.complete=j.complete),P(g,"reverse",q)}return e()}};b=f.extend(P,b),b.animate=P;var w=t.requestAnimationFrame||g;return b.State.isMobile||r.hidden===a||r.addEventListener("visibilitychange",function(){r.hidden?(w=function(e){return setTimeout(function(){e(!0)},16)},c()):w=t.requestAnimationFrame||g}),e.Velocity=b,e!==t&&(e.fn.velocity=P,e.fn.velocity.defaults=b.defaults),f.each(["Down","Up"],function(e,t){b.Redirects["slide"+t]=function(e,r,n,o,i,s){var l=f.extend({},r),u=l.begin,c=l.complete,p={height:"",marginTop:"",marginBottom:"",paddingTop:"",paddingBottom:""},d={};l.display===a&&(l.display="Down"===t?"inline"===b.CSS.Values.getDisplayType(e)?"inline-block":"block":"none"),l.begin=function(){u&&u.call(i,i);for(var r in p){d[r]=e.style[r];var a=b.CSS.getPropertyValue(e,r);p[r]="Down"===t?[a,0]:[0,a]}d.overflow=e.style.overflow,e.style.overflow="hidden"},l.complete=function(){for(var t in d)e.style[t]=d[t];c&&c.call(i,i),s&&s.resolver(i)},b(e,p,l)}}),f.each(["In","Out"],function(e,t){b.Redirects["fade"+t]=function(e,r,n,o,i,s){var l=f.extend({},r),u={opacity:"In"===t?1:0},c=l.complete;l.complete=n!==o-1?l.begin=null:function(){c&&c.call(i,i),s&&s.resolver(i)},l.display===a&&(l.display="In"===t?"auto":"none"),b(this,u,l)}}),b}(window.jQuery||window.Zepto||window,window,document)}));
+;!function(a,b,c,d){"use strict";function k(a,b,c){return setTimeout(q(a,c),b)}function l(a,b,c){return Array.isArray(a)?(m(a,c[b],c),!0):!1}function m(a,b,c){var e;if(a)if(a.forEach)a.forEach(b,c);else if(a.length!==d)for(e=0;e<a.length;)b.call(c,a[e],e,a),e++;else for(e in a)a.hasOwnProperty(e)&&b.call(c,a[e],e,a)}function n(a,b,c){for(var e=Object.keys(b),f=0;f<e.length;)(!c||c&&a[e[f]]===d)&&(a[e[f]]=b[e[f]]),f++;return a}function o(a,b){return n(a,b,!0)}function p(a,b,c){var e,d=b.prototype;e=a.prototype=Object.create(d),e.constructor=a,e._super=d,c&&n(e,c)}function q(a,b){return function(){return a.apply(b,arguments)}}function r(a,b){return typeof a==g?a.apply(b?b[0]||d:d,b):a}function s(a,b){return a===d?b:a}function t(a,b,c){m(x(b),function(b){a.addEventListener(b,c,!1)})}function u(a,b,c){m(x(b),function(b){a.removeEventListener(b,c,!1)})}function v(a,b){for(;a;){if(a==b)return!0;a=a.parentNode}return!1}function w(a,b){return a.indexOf(b)>-1}function x(a){return a.trim().split(/\s+/g)}function y(a,b,c){if(a.indexOf&&!c)return a.indexOf(b);for(var d=0;d<a.length;){if(c&&a[d][c]==b||!c&&a[d]===b)return d;d++}return-1}function z(a){return Array.prototype.slice.call(a,0)}function A(a,b,c){for(var d=[],e=[],f=0;f<a.length;){var g=b?a[f][b]:a[f];y(e,g)<0&&d.push(a[f]),e[f]=g,f++}return c&&(d=b?d.sort(function(a,c){return a[b]>c[b]}):d.sort()),d}function B(a,b){for(var c,f,g=b[0].toUpperCase()+b.slice(1),h=0;h<e.length;){if(c=e[h],f=c?c+g:b,f in a)return f;h++}return d}function D(){return C++}function E(a){var b=a.ownerDocument;return b.defaultView||b.parentWindow}function ab(a,b){var c=this;this.manager=a,this.callback=b,this.element=a.element,this.target=a.options.inputTarget,this.domHandler=function(b){r(a.options.enable,[a])&&c.handler(b)},this.init()}function bb(a){var b,c=a.options.inputClass;return b=c?c:H?wb:I?Eb:G?Gb:rb,new b(a,cb)}function cb(a,b,c){var d=c.pointers.length,e=c.changedPointers.length,f=b&O&&0===d-e,g=b&(Q|R)&&0===d-e;c.isFirst=!!f,c.isFinal=!!g,f&&(a.session={}),c.eventType=b,db(a,c),a.emit("hammer.input",c),a.recognize(c),a.session.prevInput=c}function db(a,b){var c=a.session,d=b.pointers,e=d.length;c.firstInput||(c.firstInput=gb(b)),e>1&&!c.firstMultiple?c.firstMultiple=gb(b):1===e&&(c.firstMultiple=!1);var f=c.firstInput,g=c.firstMultiple,h=g?g.center:f.center,i=b.center=hb(d);b.timeStamp=j(),b.deltaTime=b.timeStamp-f.timeStamp,b.angle=lb(h,i),b.distance=kb(h,i),eb(c,b),b.offsetDirection=jb(b.deltaX,b.deltaY),b.scale=g?nb(g.pointers,d):1,b.rotation=g?mb(g.pointers,d):0,fb(c,b);var k=a.element;v(b.srcEvent.target,k)&&(k=b.srcEvent.target),b.target=k}function eb(a,b){var c=b.center,d=a.offsetDelta||{},e=a.prevDelta||{},f=a.prevInput||{};(b.eventType===O||f.eventType===Q)&&(e=a.prevDelta={x:f.deltaX||0,y:f.deltaY||0},d=a.offsetDelta={x:c.x,y:c.y}),b.deltaX=e.x+(c.x-d.x),b.deltaY=e.y+(c.y-d.y)}function fb(a,b){var f,g,h,j,c=a.lastInterval||b,e=b.timeStamp-c.timeStamp;if(b.eventType!=R&&(e>N||c.velocity===d)){var k=c.deltaX-b.deltaX,l=c.deltaY-b.deltaY,m=ib(e,k,l);g=m.x,h=m.y,f=i(m.x)>i(m.y)?m.x:m.y,j=jb(k,l),a.lastInterval=b}else f=c.velocity,g=c.velocityX,h=c.velocityY,j=c.direction;b.velocity=f,b.velocityX=g,b.velocityY=h,b.direction=j}function gb(a){for(var b=[],c=0;c<a.pointers.length;)b[c]={clientX:h(a.pointers[c].clientX),clientY:h(a.pointers[c].clientY)},c++;return{timeStamp:j(),pointers:b,center:hb(b),deltaX:a.deltaX,deltaY:a.deltaY}}function hb(a){var b=a.length;if(1===b)return{x:h(a[0].clientX),y:h(a[0].clientY)};for(var c=0,d=0,e=0;b>e;)c+=a[e].clientX,d+=a[e].clientY,e++;return{x:h(c/b),y:h(d/b)}}function ib(a,b,c){return{x:b/a||0,y:c/a||0}}function jb(a,b){return a===b?S:i(a)>=i(b)?a>0?T:U:b>0?V:W}function kb(a,b,c){c||(c=$);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return Math.sqrt(d*d+e*e)}function lb(a,b,c){c||(c=$);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return 180*Math.atan2(e,d)/Math.PI}function mb(a,b){return lb(b[1],b[0],_)-lb(a[1],a[0],_)}function nb(a,b){return kb(b[0],b[1],_)/kb(a[0],a[1],_)}function rb(){this.evEl=pb,this.evWin=qb,this.allow=!0,this.pressed=!1,ab.apply(this,arguments)}function wb(){this.evEl=ub,this.evWin=vb,ab.apply(this,arguments),this.store=this.manager.session.pointerEvents=[]}function Ab(){this.evTarget=yb,this.evWin=zb,this.started=!1,ab.apply(this,arguments)}function Bb(a,b){var c=z(a.touches),d=z(a.changedTouches);return b&(Q|R)&&(c=A(c.concat(d),"identifier",!0)),[c,d]}function Eb(){this.evTarget=Db,this.targetIds={},ab.apply(this,arguments)}function Fb(a,b){var c=z(a.touches),d=this.targetIds;if(b&(O|P)&&1===c.length)return d[c[0].identifier]=!0,[c,c];var e,f,g=z(a.changedTouches),h=[],i=this.target;if(f=c.filter(function(a){return v(a.target,i)}),b===O)for(e=0;e<f.length;)d[f[e].identifier]=!0,e++;for(e=0;e<g.length;)d[g[e].identifier]&&h.push(g[e]),b&(Q|R)&&delete d[g[e].identifier],e++;return h.length?[A(f.concat(h),"identifier",!0),h]:void 0}function Gb(){ab.apply(this,arguments);var a=q(this.handler,this);this.touch=new Eb(this.manager,a),this.mouse=new rb(this.manager,a)}function Pb(a,b){this.manager=a,this.set(b)}function Qb(a){if(w(a,Mb))return Mb;var b=w(a,Nb),c=w(a,Ob);return b&&c?Nb+" "+Ob:b||c?b?Nb:Ob:w(a,Lb)?Lb:Kb}function Yb(a){this.id=D(),this.manager=null,this.options=o(a||{},this.defaults),this.options.enable=s(this.options.enable,!0),this.state=Rb,this.simultaneous={},this.requireFail=[]}function Zb(a){return a&Wb?"cancel":a&Ub?"end":a&Tb?"move":a&Sb?"start":""}function $b(a){return a==W?"down":a==V?"up":a==T?"left":a==U?"right":""}function _b(a,b){var c=b.manager;return c?c.get(a):a}function ac(){Yb.apply(this,arguments)}function bc(){ac.apply(this,arguments),this.pX=null,this.pY=null}function cc(){ac.apply(this,arguments)}function dc(){Yb.apply(this,arguments),this._timer=null,this._input=null}function ec(){ac.apply(this,arguments)}function fc(){ac.apply(this,arguments)}function gc(){Yb.apply(this,arguments),this.pTime=!1,this.pCenter=!1,this._timer=null,this._input=null,this.count=0}function hc(a,b){return b=b||{},b.recognizers=s(b.recognizers,hc.defaults.preset),new kc(a,b)}function kc(a,b){b=b||{},this.options=o(b,hc.defaults),this.options.inputTarget=this.options.inputTarget||a,this.handlers={},this.session={},this.recognizers=[],this.element=a,this.input=bb(this),this.touchAction=new Pb(this,this.options.touchAction),lc(this,!0),m(b.recognizers,function(a){var b=this.add(new a[0](a[1]));a[2]&&b.recognizeWith(a[2]),a[3]&&b.requireFailure(a[3])},this)}function lc(a,b){var c=a.element;m(a.options.cssProps,function(a,d){c.style[B(c.style,d)]=b?a:""})}function mc(a,c){var d=b.createEvent("Event");d.initEvent(a,!0,!0),d.gesture=c,c.target.dispatchEvent(d)}var e=["","webkit","moz","MS","ms","o"],f=b.createElement("div"),g="function",h=Math.round,i=Math.abs,j=Date.now,C=1,F=/mobile|tablet|ip(ad|hone|od)|android/i,G="ontouchstart"in a,H=B(a,"PointerEvent")!==d,I=G&&F.test(navigator.userAgent),J="touch",K="pen",L="mouse",M="kinect",N=25,O=1,P=2,Q=4,R=8,S=1,T=2,U=4,V=8,W=16,X=T|U,Y=V|W,Z=X|Y,$=["x","y"],_=["clientX","clientY"];ab.prototype={handler:function(){},init:function(){this.evEl&&t(this.element,this.evEl,this.domHandler),this.evTarget&&t(this.target,this.evTarget,this.domHandler),this.evWin&&t(E(this.element),this.evWin,this.domHandler)},destroy:function(){this.evEl&&u(this.element,this.evEl,this.domHandler),this.evTarget&&u(this.target,this.evTarget,this.domHandler),this.evWin&&u(E(this.element),this.evWin,this.domHandler)}};var ob={mousedown:O,mousemove:P,mouseup:Q},pb="mousedown",qb="mousemove mouseup";p(rb,ab,{handler:function(a){var b=ob[a.type];b&O&&0===a.button&&(this.pressed=!0),b&P&&1!==a.which&&(b=Q),this.pressed&&this.allow&&(b&Q&&(this.pressed=!1),this.callback(this.manager,b,{pointers:[a],changedPointers:[a],pointerType:L,srcEvent:a}))}});var sb={pointerdown:O,pointermove:P,pointerup:Q,pointercancel:R,pointerout:R},tb={2:J,3:K,4:L,5:M},ub="pointerdown",vb="pointermove pointerup pointercancel";a.MSPointerEvent&&(ub="MSPointerDown",vb="MSPointerMove MSPointerUp MSPointerCancel"),p(wb,ab,{handler:function(a){var b=this.store,c=!1,d=a.type.toLowerCase().replace("ms",""),e=sb[d],f=tb[a.pointerType]||a.pointerType,g=f==J,h=y(b,a.pointerId,"pointerId");e&O&&(0===a.button||g)?0>h&&(b.push(a),h=b.length-1):e&(Q|R)&&(c=!0),0>h||(b[h]=a,this.callback(this.manager,e,{pointers:b,changedPointers:[a],pointerType:f,srcEvent:a}),c&&b.splice(h,1))}});var xb={touchstart:O,touchmove:P,touchend:Q,touchcancel:R},yb="touchstart",zb="touchstart touchmove touchend touchcancel";p(Ab,ab,{handler:function(a){var b=xb[a.type];if(b===O&&(this.started=!0),this.started){var c=Bb.call(this,a,b);b&(Q|R)&&0===c[0].length-c[1].length&&(this.started=!1),this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:J,srcEvent:a})}}});var Cb={touchstart:O,touchmove:P,touchend:Q,touchcancel:R},Db="touchstart touchmove touchend touchcancel";p(Eb,ab,{handler:function(a){var b=Cb[a.type],c=Fb.call(this,a,b);c&&this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:J,srcEvent:a})}}),p(Gb,ab,{handler:function(a,b,c){var d=c.pointerType==J,e=c.pointerType==L;if(d)this.mouse.allow=!1;else if(e&&!this.mouse.allow)return;b&(Q|R)&&(this.mouse.allow=!0),this.callback(a,b,c)},destroy:function(){this.touch.destroy(),this.mouse.destroy()}});var Hb=B(f.style,"touchAction"),Ib=Hb!==d,Jb="compute",Kb="auto",Lb="manipulation",Mb="none",Nb="pan-x",Ob="pan-y";Pb.prototype={set:function(a){a==Jb&&(a=this.compute()),Ib&&(this.manager.element.style[Hb]=a),this.actions=a.toLowerCase().trim()},update:function(){this.set(this.manager.options.touchAction)},compute:function(){var a=[];return m(this.manager.recognizers,function(b){r(b.options.enable,[b])&&(a=a.concat(b.getTouchAction()))}),Qb(a.join(" "))},preventDefaults:function(a){if(!Ib){var b=a.srcEvent,c=a.offsetDirection;if(this.manager.session.prevented)return b.preventDefault(),void 0;var d=this.actions,e=w(d,Mb),f=w(d,Ob),g=w(d,Nb);return e||f&&c&X||g&&c&Y?this.preventSrc(b):void 0}},preventSrc:function(a){this.manager.session.prevented=!0,a.preventDefault()}};var Rb=1,Sb=2,Tb=4,Ub=8,Vb=Ub,Wb=16,Xb=32;Yb.prototype={defaults:{},set:function(a){return n(this.options,a),this.manager&&this.manager.touchAction.update(),this},recognizeWith:function(a){if(l(a,"recognizeWith",this))return this;var b=this.simultaneous;return a=_b(a,this),b[a.id]||(b[a.id]=a,a.recognizeWith(this)),this},dropRecognizeWith:function(a){return l(a,"dropRecognizeWith",this)?this:(a=_b(a,this),delete this.simultaneous[a.id],this)},requireFailure:function(a){if(l(a,"requireFailure",this))return this;var b=this.requireFail;return a=_b(a,this),-1===y(b,a)&&(b.push(a),a.requireFailure(this)),this},dropRequireFailure:function(a){if(l(a,"dropRequireFailure",this))return this;a=_b(a,this);var b=y(this.requireFail,a);return b>-1&&this.requireFail.splice(b,1),this},hasRequireFailures:function(){return this.requireFail.length>0},canRecognizeWith:function(a){return!!this.simultaneous[a.id]},emit:function(a){function d(d){b.manager.emit(b.options.event+(d?Zb(c):""),a)}var b=this,c=this.state;Ub>c&&d(!0),d(),c>=Ub&&d(!0)},tryEmit:function(a){return this.canEmit()?this.emit(a):(this.state=Xb,void 0)},canEmit:function(){for(var a=0;a<this.requireFail.length;){if(!(this.requireFail[a].state&(Xb|Rb)))return!1;a++}return!0},recognize:function(a){var b=n({},a);return r(this.options.enable,[this,b])?(this.state&(Vb|Wb|Xb)&&(this.state=Rb),this.state=this.process(b),this.state&(Sb|Tb|Ub|Wb)&&this.tryEmit(b),void 0):(this.reset(),this.state=Xb,void 0)},process:function(){},getTouchAction:function(){},reset:function(){}},p(ac,Yb,{defaults:{pointers:1},attrTest:function(a){var b=this.options.pointers;return 0===b||a.pointers.length===b},process:function(a){var b=this.state,c=a.eventType,d=b&(Sb|Tb),e=this.attrTest(a);return d&&(c&R||!e)?b|Wb:d||e?c&Q?b|Ub:b&Sb?b|Tb:Sb:Xb}}),p(bc,ac,{defaults:{event:"pan",threshold:10,pointers:1,direction:Z},getTouchAction:function(){var a=this.options.direction,b=[];return a&X&&b.push(Ob),a&Y&&b.push(Nb),b},directionTest:function(a){var b=this.options,c=!0,d=a.distance,e=a.direction,f=a.deltaX,g=a.deltaY;return e&b.direction||(b.direction&X?(e=0===f?S:0>f?T:U,c=f!=this.pX,d=Math.abs(a.deltaX)):(e=0===g?S:0>g?V:W,c=g!=this.pY,d=Math.abs(a.deltaY))),a.direction=e,c&&d>b.threshold&&e&b.direction},attrTest:function(a){return ac.prototype.attrTest.call(this,a)&&(this.state&Sb||!(this.state&Sb)&&this.directionTest(a))},emit:function(a){this.pX=a.deltaX,this.pY=a.deltaY;var b=$b(a.direction);b&&this.manager.emit(this.options.event+b,a),this._super.emit.call(this,a)}}),p(cc,ac,{defaults:{event:"pinch",threshold:0,pointers:2},getTouchAction:function(){return[Mb]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.scale-1)>this.options.threshold||this.state&Sb)},emit:function(a){if(this._super.emit.call(this,a),1!==a.scale){var b=a.scale<1?"in":"out";this.manager.emit(this.options.event+b,a)}}}),p(dc,Yb,{defaults:{event:"press",pointers:1,time:500,threshold:5},getTouchAction:function(){return[Kb]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distance<b.threshold,e=a.deltaTime>b.time;if(this._input=a,!d||!c||a.eventType&(Q|R)&&!e)this.reset();else if(a.eventType&O)this.reset(),this._timer=k(function(){this.state=Vb,this.tryEmit()},b.time,this);else if(a.eventType&Q)return Vb;return Xb},reset:function(){clearTimeout(this._timer)},emit:function(a){this.state===Vb&&(a&&a.eventType&Q?this.manager.emit(this.options.event+"up",a):(this._input.timeStamp=j(),this.manager.emit(this.options.event,this._input)))}}),p(ec,ac,{defaults:{event:"rotate",threshold:0,pointers:2},getTouchAction:function(){return[Mb]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.rotation)>this.options.threshold||this.state&Sb)}}),p(fc,ac,{defaults:{event:"swipe",threshold:10,velocity:.65,direction:X|Y,pointers:1},getTouchAction:function(){return bc.prototype.getTouchAction.call(this)},attrTest:function(a){var c,b=this.options.direction;return b&(X|Y)?c=a.velocity:b&X?c=a.velocityX:b&Y&&(c=a.velocityY),this._super.attrTest.call(this,a)&&b&a.direction&&a.distance>this.options.threshold&&i(c)>this.options.velocity&&a.eventType&Q},emit:function(a){var b=$b(a.direction);b&&this.manager.emit(this.options.event+b,a),this.manager.emit(this.options.event,a)}}),p(gc,Yb,{defaults:{event:"tap",pointers:1,taps:1,interval:300,time:250,threshold:2,posThreshold:10},getTouchAction:function(){return[Lb]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distance<b.threshold,e=a.deltaTime<b.time;if(this.reset(),a.eventType&O&&0===this.count)return this.failTimeout();if(d&&e&&c){if(a.eventType!=Q)return this.failTimeout();var f=this.pTime?a.timeStamp-this.pTime<b.interval:!0,g=!this.pCenter||kb(this.pCenter,a.center)<b.posThreshold;this.pTime=a.timeStamp,this.pCenter=a.center,g&&f?this.count+=1:this.count=1,this._input=a;var h=this.count%b.taps;if(0===h)return this.hasRequireFailures()?(this._timer=k(function(){this.state=Vb,this.tryEmit()},b.interval,this),Sb):Vb}return Xb},failTimeout:function(){return this._timer=k(function(){this.state=Xb},this.options.interval,this),Xb},reset:function(){clearTimeout(this._timer)},emit:function(){this.state==Vb&&(this._input.tapCount=this.count,this.manager.emit(this.options.event,this._input))}}),hc.VERSION="2.0.4",hc.defaults={domEvents:!1,touchAction:Jb,enable:!0,inputTarget:null,inputClass:null,preset:[[ec,{enable:!1}],[cc,{enable:!1},["rotate"]],[fc,{direction:X}],[bc,{direction:X},["swipe"]],[gc],[gc,{event:"doubletap",taps:2},["tap"]],[dc]],cssProps:{userSelect:"default",touchSelect:"none",touchCallout:"none",contentZooming:"none",userDrag:"none",tapHighlightColor:"rgba(0,0,0,0)"}};var ic=1,jc=2;kc.prototype={set:function(a){return n(this.options,a),a.touchAction&&this.touchAction.update(),a.inputTarget&&(this.input.destroy(),this.input.target=a.inputTarget,this.input.init()),this},stop:function(a){this.session.stopped=a?jc:ic},recognize:function(a){var b=this.session;if(!b.stopped){this.touchAction.preventDefaults(a);var c,d=this.recognizers,e=b.curRecognizer;(!e||e&&e.state&Vb)&&(e=b.curRecognizer=null);for(var f=0;f<d.length;)c=d[f],b.stopped===jc||e&&c!=e&&!c.canRecognizeWith(e)?c.reset():c.recognize(a),!e&&c.state&(Sb|Tb|Ub)&&(e=b.curRecognizer=c),f++}},get:function(a){if(a instanceof Yb)return a;for(var b=this.recognizers,c=0;c<b.length;c++)if(b[c].options.event==a)return b[c];return null},add:function(a){if(l(a,"add",this))return this;var b=this.get(a.options.event);return b&&this.remove(b),this.recognizers.push(a),a.manager=this,this.touchAction.update(),a},remove:function(a){if(l(a,"remove",this))return this;var b=this.recognizers;return a=this.get(a),b.splice(y(b,a),1),this.touchAction.update(),this},on:function(a,b){var c=this.handlers;return m(x(a),function(a){c[a]=c[a]||[],c[a].push(b)}),this},off:function(a,b){var c=this.handlers;return m(x(a),function(a){b?c[a].splice(y(c[a],b),1):delete c[a]}),this},emit:function(a,b){this.options.domEvents&&mc(a,b);var c=this.handlers[a]&&this.handlers[a].slice();if(c&&c.length){b.type=a,b.preventDefault=function(){b.srcEvent.preventDefault()};for(var d=0;d<c.length;)c[d](b),d++}},destroy:function(){this.element&&lc(this,!1),this.handlers={},this.session={},this.input.destroy(),this.element=null}},n(hc,{INPUT_START:O,INPUT_MOVE:P,INPUT_END:Q,INPUT_CANCEL:R,STATE_POSSIBLE:Rb,STATE_BEGAN:Sb,STATE_CHANGED:Tb,STATE_ENDED:Ub,STATE_RECOGNIZED:Vb,STATE_CANCELLED:Wb,STATE_FAILED:Xb,DIRECTION_NONE:S,DIRECTION_LEFT:T,DIRECTION_RIGHT:U,DIRECTION_UP:V,DIRECTION_DOWN:W,DIRECTION_HORIZONTAL:X,DIRECTION_VERTICAL:Y,DIRECTION_ALL:Z,Manager:kc,Input:ab,TouchAction:Pb,TouchInput:Eb,MouseInput:rb,PointerEventInput:wb,TouchMouseInput:Gb,SingleTouchInput:Ab,Recognizer:Yb,AttrRecognizer:ac,Tap:gc,Pan:bc,Swipe:fc,Pinch:cc,Rotate:ec,Press:dc,on:t,off:u,each:m,merge:o,extend:n,inherit:p,bindFn:q,prefixed:B}),typeof define==g&&define.amd?define(function(){return hc}):"undefined"!=typeof module&&module.exports?module.exports=hc:a[c]=hc}(window,document,"Hammer");;(function(factory) {
+    if (typeof define === 'function' && define.amd) {
+        define(['jquery', 'hammerjs'], factory);
+    } else if (typeof exports === 'object') {
+        factory(require('jquery'), require('hammerjs'));
+    } else {
+        factory(jQuery, Hammer);
+    }
+}(function($, Hammer) {
+    function hammerify(el, options) {
+        var $el = $(el);
+        if(!$el.data("hammer")) {
+            $el.data("hammer", new Hammer($el[0], options));
+        }
+    }
+
+    $.fn.hammer = function(options) {
+        return this.each(function() {
+            hammerify(this, options);
+        });
+    };
+
+    // extend the emit method to also trigger jQuery events
+    Hammer.Manager.prototype.emit = (function(originalEmit) {
+        return function(type, data) {
+            originalEmit.call(this, type, data);
+            $(this.element).trigger({
+                type: type,
+                gesture: data
+            });
+        };
+    })(Hammer.Manager.prototype.emit);
+}));
+;// Required for Meteor package, the use of window prevents export by Meteor
+(function(window){
+  if(window.Package){
+    Materialize = {};
+  } else {
+    window.Materialize = {};
+  }
+})(window);
+
+
+/*
+ * raf.js
+ * https://github.com/ngryman/raf.js
+ *
+ * original requestAnimationFrame polyfill by Erik Möller
+ * inspired from paul_irish gist and post
+ *
+ * Copyright (c) 2013 ngryman
+ * Licensed under the MIT license.
+ */
+(function(window) {
+  var lastTime = 0,
+    vendors = ['webkit', 'moz'],
+    requestAnimationFrame = window.requestAnimationFrame,
+    cancelAnimationFrame = window.cancelAnimationFrame,
+    i = vendors.length;
+
+  // try to un-prefix existing raf
+  while (--i >= 0 && !requestAnimationFrame) {
+    requestAnimationFrame = window[vendors[i] + 'RequestAnimationFrame'];
+    cancelAnimationFrame = window[vendors[i] + 'CancelRequestAnimationFrame'];
+  }
+
+  // polyfill with setTimeout fallback
+  // heavily inspired from @darius gist mod: https://gist.github.com/paulirish/1579671#comment-837945
+  if (!requestAnimationFrame || !cancelAnimationFrame) {
+    requestAnimationFrame = function(callback) {
+      var now = +Date.now(),
+        nextTime = Math.max(lastTime + 16, now);
+      return setTimeout(function() {
+        callback(lastTime = nextTime);
+      }, nextTime - now);
+    };
+
+    cancelAnimationFrame = clearTimeout;
+  }
+
+  // export to window
+  window.requestAnimationFrame = requestAnimationFrame;
+  window.cancelAnimationFrame = cancelAnimationFrame;
+}(window));
+
+
+// Unique ID
+Materialize.guid = (function() {
+  function s4() {
+    return Math.floor((1 + Math.random()) * 0x10000)
+      .toString(16)
+      .substring(1);
+  }
+  return function() {
+    return s4() + s4() + '-' + s4() + '-' + s4() + '-' +
+           s4() + '-' + s4() + s4() + s4();
+  };
+})();
+
+/**
+ * Escapes hash from special characters
+ * @param {string} hash  String returned from this.hash
+ * @returns {string}
+ */
+Materialize.escapeHash = function(hash) {
+  return hash.replace( /(:|\.|\[|\]|,|=)/g, "\\$1" );
+};
+
+Materialize.elementOrParentIsFixed = function(element) {
+    var $element = $(element);
+    var $checkElements = $element.add($element.parents());
+    var isFixed = false;
+    $checkElements.each(function(){
+        if ($(this).css("position") === "fixed") {
+            isFixed = true;
+            return false;
+        }
+    });
+    return isFixed;
+};
+
+
+/**
+ * Get time in ms
+ * @license https://raw.github.com/jashkenas/underscore/master/LICENSE
+ * @type {function}
+ * @return {number}
+ */
+var getTime = (Date.now || function () {
+  return new Date().getTime();
+});
+
+
+/**
+ * Returns a function, that, when invoked, will only be triggered at most once
+ * during a given window of time. Normally, the throttled function will run
+ * as much as it can, without ever going more than once per `wait` duration;
+ * but if you'd like to disable the execution on the leading edge, pass
+ * `{leading: false}`. To disable execution on the trailing edge, ditto.
+ * @license https://raw.github.com/jashkenas/underscore/master/LICENSE
+ * @param {function} func
+ * @param {number} wait
+ * @param {Object=} options
+ * @returns {Function}
+ */
+Materialize.throttle = function(func, wait, options) {
+  var context, args, result;
+  var timeout = null;
+  var previous = 0;
+  options || (options = {});
+  var later = function () {
+    previous = options.leading === false ? 0 : getTime();
+    timeout = null;
+    result = func.apply(context, args);
+    context = args = null;
+  };
+  return function () {
+    var now = getTime();
+    if (!previous && options.leading === false) previous = now;
+    var remaining = wait - (now - previous);
+    context = this;
+    args = arguments;
+    if (remaining <= 0) {
+      clearTimeout(timeout);
+      timeout = null;
+      previous = now;
+      result = func.apply(context, args);
+      context = args = null;
+    } else if (!timeout && options.trailing !== false) {
+      timeout = setTimeout(later, remaining);
+    }
+    return result;
+  };
+};
+
+
+// Velocity has conflicts when loaded with jQuery, this will check for it
+// First, check if in noConflict mode
+var Vel;
+if (jQuery) {
+  Vel = jQuery.Velocity;
+} else if ($) {
+  Vel = $.Velocity;
+} else {
+  Vel = Velocity;
+}
+;(function ($) {
+  $.fn.collapsible = function(options) {
+    var defaults = {
+      accordion: undefined,
+      onOpen: undefined,
+      onClose: undefined
+    };
+
+    options = $.extend(defaults, options);
+
+
+    return this.each(function() {
+
+      var $this = $(this);
+
+      var $panel_headers = $(this).find('> li > .collapsible-header');
+
+      var collapsible_type = $this.data("collapsible");
+
+      // Turn off any existing event handlers
+      $this.off('click.collapse', '> li > .collapsible-header');
+      $panel_headers.off('click.collapse');
+
+
+      /****************
+      Helper Functions
+      ****************/
+
+      // Accordion Open
+      function accordionOpen(object) {
+        $panel_headers = $this.find('> li > .collapsible-header');
+        if (object.hasClass('active')) {
+          object.parent().addClass('active');
+        }
+        else {
+          object.parent().removeClass('active');
+        }
+        if (object.parent().hasClass('active')){
+          object.siblings('.collapsible-body').stop(true,false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}});
+        }
+        else{
+          object.siblings('.collapsible-body').stop(true,false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}});
+        }
+
+        $panel_headers.not(object).removeClass('active').parent().removeClass('active');
+
+        // Close previously open accordion elements.
+        $panel_headers.not(object).parent().children('.collapsible-body').stop(true,false).each(function() {
+          if ($(this).is(':visible')) {
+            $(this).slideUp({
+              duration: 350,
+              easing: "easeOutQuart",
+              queue: false,
+              complete:
+                function() {
+                  $(this).css('height', '');
+                  execCallbacks($(this).siblings('.collapsible-header'));
+                }
+            });
+          }
+        });
+      }
+
+      // Expandable Open
+      function expandableOpen(object) {
+        if (object.hasClass('active')) {
+          object.parent().addClass('active');
+        }
+        else {
+          object.parent().removeClass('active');
+        }
+        if (object.parent().hasClass('active')){
+          object.siblings('.collapsible-body').stop(true,false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}});
+        }
+        else {
+          object.siblings('.collapsible-body').stop(true,false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}});
+        }
+      }
+
+      // Open collapsible. object: .collapsible-header
+      function collapsibleOpen(object) {
+        if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion
+          accordionOpen(object);
+        } else { // Handle Expandables
+          expandableOpen(object);
+        }
+
+        execCallbacks(object);
+      }
+
+      // Handle callbacks
+      function execCallbacks(object) {
+        if (object.hasClass('active')) {
+          if (typeof(options.onOpen) === "function") {
+            options.onOpen.call(this, object.parent());
+          }
+        } else {
+          if (typeof(options.onClose) === "function") {
+            options.onClose.call(this, object.parent());
+          }
+        }
+      }
+
+      /**
+       * Check if object is children of panel header
+       * @param  {Object}  object Jquery object
+       * @return {Boolean} true if it is children
+       */
+      function isChildrenOfPanelHeader(object) {
+
+        var panelHeader = getPanelHeader(object);
+
+        return panelHeader.length > 0;
+      }
+
+      /**
+       * Get panel header from a children element
+       * @param  {Object} object Jquery object
+       * @return {Object} panel header object
+       */
+      function getPanelHeader(object) {
+
+        return object.closest('li > .collapsible-header');
+      }
+
+      /*****  End Helper Functions  *****/
+
+
+
+      // Add click handler to only direct collapsible header children
+      $this.on('click.collapse', '> li > .collapsible-header', function(e) {
+        var element = $(e.target);
+
+        if (isChildrenOfPanelHeader(element)) {
+          element = getPanelHeader(element);
+        }
+
+        element.toggleClass('active');
+
+        collapsibleOpen(element);
+      });
+
+
+      // Open first active
+      if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion
+        collapsibleOpen($panel_headers.filter('.active').first());
+
+      } else { // Handle Expandables
+        $panel_headers.filter('.active').each(function() {
+          collapsibleOpen($(this));
+        });
+      }
+
+    });
+  };
+
+  $(document).ready(function(){
+    $('.collapsible').collapsible();
+  });
+}( jQuery ));;(function ($) {
+
+  // Add posibility to scroll to selected option
+  // usefull for select for example
+  $.fn.scrollTo = function(elem) {
+    $(this).scrollTop($(this).scrollTop() - $(this).offset().top + $(elem).offset().top);
+    return this;
+  };
+
+  $.fn.dropdown = function (options) {
+    var defaults = {
+      inDuration: 300,
+      outDuration: 225,
+      constrainWidth: true, // Constrains width of dropdown to the activator
+      hover: false,
+      gutter: 0, // Spacing from edge
+      belowOrigin: false,
+      alignment: 'left',
+      stopPropagation: false
+    };
+
+    // Open dropdown.
+    if (options === "open") {
+      this.each(function() {
+        $(this).trigger('open');
+      });
+      return false;
+    }
+
+    // Close dropdown.
+    if (options === "close") {
+      this.each(function() {
+        $(this).trigger('close');
+      });
+      return false;
+    }
+
+    this.each(function(){
+      var origin = $(this);
+      var curr_options = $.extend({}, defaults, options);
+      var isFocused = false;
+
+      // Dropdown menu
+      var activates = $("#"+ origin.attr('data-activates'));
+
+      function updateOptions() {
+        if (origin.data('induration') !== undefined)
+          curr_options.inDuration = origin.data('induration');
+        if (origin.data('outduration') !== undefined)
+          curr_options.outDuration = origin.data('outduration');
+        if (origin.data('constrainwidth') !== undefined)
+          curr_options.constrainWidth = origin.data('constrainwidth');
+        if (origin.data('hover') !== undefined)
+          curr_options.hover = origin.data('hover');
+        if (origin.data('gutter') !== undefined)
+          curr_options.gutter = origin.data('gutter');
+        if (origin.data('beloworigin') !== undefined)
+          curr_options.belowOrigin = origin.data('beloworigin');
+        if (origin.data('alignment') !== undefined)
+          curr_options.alignment = origin.data('alignment');
+        if (origin.data('stoppropagation') !== undefined)
+          curr_options.stopPropagation = origin.data('stoppropagation');
+      }
+
+      updateOptions();
+
+      // Attach dropdown to its activator
+      origin.after(activates);
+
+      /*
+        Helper function to position and resize dropdown.
+        Used in hover and click handler.
+      */
+      function placeDropdown(eventType) {
+        // Check for simultaneous focus and click events.
+        if (eventType === 'focus') {
+          isFocused = true;
+        }
+
+        // Check html data attributes
+        updateOptions();
+
+        // Set Dropdown state
+        activates.addClass('active');
+        origin.addClass('active');
+
+        // Constrain width
+        if (curr_options.constrainWidth === true) {
+          activates.css('width', origin.outerWidth());
+
+        } else {
+          activates.css('white-space', 'nowrap');
+        }
+
+        // Offscreen detection
+        var windowHeight = window.innerHeight;
+        var originHeight = origin.innerHeight();
+        var offsetLeft = origin.offset().left;
+        var offsetTop = origin.offset().top - $(window).scrollTop();
+        var currAlignment = curr_options.alignment;
+        var gutterSpacing = 0;
+        var leftPosition = 0;
+
+        // Below Origin
+        var verticalOffset = 0;
+        if (curr_options.belowOrigin === true) {
+          verticalOffset = originHeight;
+        }
+
+        // Check for scrolling positioned container.
+        var scrollYOffset = 0;
+        var scrollXOffset = 0;
+        var wrapper = origin.parent();
+        if (!wrapper.is('body')) {
+          if (wrapper[0].scrollHeight > wrapper[0].clientHeight) {
+            scrollYOffset = wrapper[0].scrollTop;
+          }
+          if (wrapper[0].scrollWidth > wrapper[0].clientWidth) {
+            scrollXOffset = wrapper[0].scrollLeft;
+          }
+        }
+
+
+        if (offsetLeft + activates.innerWidth() > $(window).width()) {
+          // Dropdown goes past screen on right, force right alignment
+          currAlignment = 'right';
+
+        } else if (offsetLeft - activates.innerWidth() + origin.innerWidth() < 0) {
+          // Dropdown goes past screen on left, force left alignment
+          currAlignment = 'left';
+        }
+        // Vertical bottom offscreen detection
+        if (offsetTop + activates.innerHeight() > windowHeight) {
+          // If going upwards still goes offscreen, just crop height of dropdown.
+          if (offsetTop + originHeight - activates.innerHeight() < 0) {
+            var adjustedHeight = windowHeight - offsetTop - verticalOffset;
+            activates.css('max-height', adjustedHeight);
+          } else {
+            // Flow upwards.
+            if (!verticalOffset) {
+              verticalOffset += originHeight;
+            }
+            verticalOffset -= activates.innerHeight();
+          }
+        }
+
+        // Handle edge alignment
+        if (currAlignment === 'left') {
+          gutterSpacing = curr_options.gutter;
+          leftPosition = origin.position().left + gutterSpacing;
+        }
+        else if (currAlignment === 'right') {
+          var offsetRight = origin.position().left + origin.outerWidth() - activates.outerWidth();
+          gutterSpacing = -curr_options.gutter;
+          leftPosition =  offsetRight + gutterSpacing;
+        }
+
+        // Position dropdown
+        activates.css({
+          position: 'absolute',
+          top: origin.position().top + verticalOffset + scrollYOffset,
+          left: leftPosition + scrollXOffset
+        });
+
+
+        // Show dropdown
+        activates.stop(true, true).css('opacity', 0)
+          .slideDown({
+            queue: false,
+            duration: curr_options.inDuration,
+            easing: 'easeOutCubic',
+            complete: function() {
+              $(this).css('height', '');
+            }
+          })
+          .animate( {opacity: 1}, {queue: false, duration: curr_options.inDuration, easing: 'easeOutSine'});
+
+        // Add click close handler to document
+        $(document).bind('click.'+ activates.attr('id') + ' touchstart.' + activates.attr('id'), function (e) {
+          if (!activates.is(e.target) && !origin.is(e.target) && (!origin.find(e.target).length) ) {
+            hideDropdown();
+            $(document).unbind('click.'+ activates.attr('id') + ' touchstart.' + activates.attr('id'));
+          }
+        });
+      }
+
+      function hideDropdown() {
+        // Check for simultaneous focus and click events.
+        isFocused = false;
+        activates.fadeOut(curr_options.outDuration);
+        activates.removeClass('active');
+        origin.removeClass('active');
+        $(document).unbind('click.'+ activates.attr('id') + ' touchstart.' + activates.attr('id'));
+        setTimeout(function() { activates.css('max-height', ''); }, curr_options.outDuration);
+      }
+
+      // Hover
+      if (curr_options.hover) {
+        var open = false;
+        origin.unbind('click.' + origin.attr('id'));
+        // Hover handler to show dropdown
+        origin.on('mouseenter', function(e){ // Mouse over
+          if (open === false) {
+            placeDropdown();
+            open = true;
+          }
+        });
+        origin.on('mouseleave', function(e){
+          // If hover on origin then to something other than dropdown content, then close
+          var toEl = e.toElement || e.relatedTarget; // added browser compatibility for target element
+          if(!$(toEl).closest('.dropdown-content').is(activates)) {
+            activates.stop(true, true);
+            hideDropdown();
+            open = false;
+          }
+        });
+
+        activates.on('mouseleave', function(e){ // Mouse out
+          var toEl = e.toElement || e.relatedTarget;
+          if(!$(toEl).closest('.dropdown-button').is(origin)) {
+            activates.stop(true, true);
+            hideDropdown();
+            open = false;
+          }
+        });
+
+        // Click
+      } else {
+        // Click handler to show dropdown
+        origin.unbind('click.' + origin.attr('id'));
+        origin.bind('click.'+origin.attr('id'), function(e){
+          if (!isFocused) {
+            if ( origin[0] == e.currentTarget &&
+                 !origin.hasClass('active') &&
+                 ($(e.target).closest('.dropdown-content').length === 0)) {
+              e.preventDefault(); // Prevents button click from moving window
+              if (curr_options.stopPropagation) {
+                e.stopPropagation();
+              }
+              placeDropdown('click');
+            }
+            // If origin is clicked and menu is open, close menu
+            else if (origin.hasClass('active')) {
+              hideDropdown();
+              $(document).unbind('click.'+ activates.attr('id') + ' touchstart.' + activates.attr('id'));
+            }
+          }
+        });
+
+      } // End else
+
+      // Listen to open and close event - useful for select component
+      origin.on('open', function(e, eventType) {
+        placeDropdown(eventType);
+      });
+      origin.on('close', hideDropdown);
+
+
+    });
+  }; // End dropdown plugin
+
+  $(document).ready(function(){
+    $('.dropdown-button').dropdown();
+  });
+}( jQuery ));
+;(function($) {
+  var _stack = 0,
+  _lastID = 0,
+  _generateID = function() {
+    _lastID++;
+    return 'materialize-modal-overlay-' + _lastID;
+  };
+
+  var methods = {
+    init : function(options) {
+      var defaults = {
+        opacity: 0.5,
+        inDuration: 350,
+        outDuration: 250,
+        ready: undefined,
+        complete: undefined,
+        dismissible: true,
+        startingTop: '4%',
+        endingTop: '10%'
+      };
+
+      // Override defaults
+      options = $.extend(defaults, options);
+
+      return this.each(function() {
+        var $modal = $(this);
+        var modal_id = $(this).attr("id") || '#' + $(this).data('target');
+
+        var closeModal = function() {
+          var overlayID = $modal.data('overlay-id');
+          var $overlay = $('#' + overlayID);
+          $modal.removeClass('open');
+
+          // Enable scrolling
+          $('body').css({
+            overflow: '',
+            width: ''
+          });
+
+          $modal.find('.modal-close').off('click.close');
+          $(document).off('keyup.modal' + overlayID);
+
+          $overlay.velocity( { opacity: 0}, {duration: options.outDuration, queue: false, ease: "easeOutQuart"});
+
+
+          // Define Bottom Sheet animation
+          var exitVelocityOptions = {
+            duration: options.outDuration,
+            queue: false,
+            ease: "easeOutCubic",
+            // Handle modal ready callback
+            complete: function() {
+              $(this).css({display:"none"});
+
+              // Call complete callback
+              if (typeof(options.complete) === "function") {
+                options.complete.call(this, $modal);
+              }
+              $overlay.remove();
+              _stack--;
+            }
+          };
+          if ($modal.hasClass('bottom-sheet')) {
+            $modal.velocity({bottom: "-100%", opacity: 0}, exitVelocityOptions);
+          }
+          else {
+            $modal.velocity(
+              { top: options.startingTop, opacity: 0, scaleX: 0.7},
+              exitVelocityOptions
+            );
+          }
+        };
+
+        var openModal = function($trigger) {
+          var $body = $('body');
+          var oldWidth = $body.innerWidth();
+          $body.css('overflow', 'hidden');
+          $body.width(oldWidth);
+
+          if ($modal.hasClass('open')) {
+            return;
+          }
+
+          var overlayID = _generateID();
+          var $overlay = $('<div class="modal-overlay"></div>');
+          lStack = (++_stack);
+
+          // Store a reference of the overlay
+          $overlay.attr('id', overlayID).css('z-index', 1000 + lStack * 2);
+          $modal.data('overlay-id', overlayID).css('z-index', 1000 + lStack * 2 + 1);
+          $modal.addClass('open');
+
+          $("body").append($overlay);
+
+          if (options.dismissible) {
+            $overlay.click(function() {
+              closeModal();
+            });
+            // Return on ESC
+            $(document).on('keyup.modal' + overlayID, function(e) {
+              if (e.keyCode === 27) {   // ESC key
+                closeModal();
+              }
+            });
+          }
+
+          $modal.find(".modal-close").on('click.close', function(e) {
+            closeModal();
+          });
+
+          $overlay.css({ display : "block", opacity : 0 });
+
+          $modal.css({
+            display : "block",
+            opacity: 0
+          });
+
+          $overlay.velocity({opacity: options.opacity}, {duration: options.inDuration, queue: false, ease: "easeOutCubic"});
+          $modal.data('associated-overlay', $overlay[0]);
+
+          // Define Bottom Sheet animation
+          var enterVelocityOptions = {
+            duration: options.inDuration,
+            queue: false,
+            ease: "easeOutCubic",
+            // Handle modal ready callback
+            complete: function() {
+              if (typeof(options.ready) === "function") {
+                options.ready.call(this, $modal, $trigger);
+              }
+            }
+          };
+          if ($modal.hasClass('bottom-sheet')) {
+            $modal.velocity({bottom: "0", opacity: 1}, enterVelocityOptions);
+          }
+          else {
+            $.Velocity.hook($modal, "scaleX", 0.7);
+            $modal.css({ top: options.startingTop });
+            $modal.velocity({top: options.endingTop, opacity: 1, scaleX: '1'}, enterVelocityOptions);
+          }
+
+        };
+
+        // Reset handlers
+        $(document).off('click.modalTrigger', 'a[href="#' + modal_id + '"], [data-target="' + modal_id + '"]');
+        $(this).off('openModal');
+        $(this).off('closeModal');
+
+        // Close Handlers
+        $(document).on('click.modalTrigger', 'a[href="#' + modal_id + '"], [data-target="' + modal_id + '"]', function(e) {
+          options.startingTop = ($(this).offset().top - $(window).scrollTop()) /1.15;
+          openModal($(this));
+          e.preventDefault();
+        }); // done set on click
+
+        $(this).on('openModal', function() {
+          var modal_id = $(this).attr("href") || '#' + $(this).data('target');
+          openModal();
+        });
+
+        $(this).on('closeModal', function() {
+          closeModal();
+        });
+      }); // done return
+    },
+    open : function() {
+      $(this).trigger('openModal');
+    },
+    close : function() {
+      $(this).trigger('closeModal');
+    }
+  };
+
+  $.fn.modal = function(methodOrOptions) {
+    if ( methods[methodOrOptions] ) {
+      return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 ));
+    } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) {
+      // Default to "init"
+      return methods.init.apply( this, arguments );
+    } else {
+      $.error( 'Method ' +  methodOrOptions + ' does not exist on jQuery.modal' );
+    }
+  };
+})(jQuery);
+;(function ($) {
+
+  $.fn.materialbox = function () {
+
+    return this.each(function() {
+
+      if ($(this).hasClass('initialized')) {
+        return;
+      }
+
+      $(this).addClass('initialized');
+
+      var overlayActive = false;
+      var doneAnimating = true;
+      var inDuration = 275;
+      var outDuration = 200;
+      var origin = $(this);
+      var placeholder = $('<div></div>').addClass('material-placeholder');
+      var originalWidth = 0;
+      var originalHeight = 0;
+      var ancestorsChanged;
+      var ancestor;
+      origin.wrap(placeholder);
+
+
+      origin.on('click', function(){
+        var placeholder = origin.parent('.material-placeholder');
+        var windowWidth = window.innerWidth;
+        var windowHeight = window.innerHeight;
+        var originalWidth = origin.width();
+        var originalHeight = origin.height();
+
+
+        // If already modal, return to original
+        if (doneAnimating === false) {
+          returnToOriginal();
+          return false;
+        }
+        else if (overlayActive && doneAnimating===true) {
+          returnToOriginal();
+          return false;
+        }
+
+
+        // Set states
+        doneAnimating = false;
+        origin.addClass('active');
+        overlayActive = true;
+
+        // Set positioning for placeholder
+        placeholder.css({
+          width: placeholder[0].getBoundingClientRect().width,
+          height: placeholder[0].getBoundingClientRect().height,
+          position: 'relative',
+          top: 0,
+          left: 0
+        });
+
+        // Find ancestor with overflow: hidden; and remove it
+        ancestorsChanged = undefined;
+        ancestor = placeholder[0].parentNode;
+        var count = 0;
+        while (ancestor !== null && !$(ancestor).is(document)) {
+          var curr = $(ancestor);
+          if (curr.css('overflow') !== 'visible') {
+            curr.css('overflow', 'visible');
+            if (ancestorsChanged === undefined) {
+              ancestorsChanged = curr;
+            }
+            else {
+              ancestorsChanged = ancestorsChanged.add(curr);
+            }
+          }
+          ancestor = ancestor.parentNode;
+        }
+
+        // Set css on origin
+        origin.css({
+          position: 'absolute',
+          'z-index': 1000,
+          'will-change': 'left, top, width, height'
+        })
+        .data('width', originalWidth)
+        .data('height', originalHeight);
+
+        // Add overlay
+        var overlay = $('<div id="materialbox-overlay"></div>')
+          .css({
+            opacity: 0
+          })
+          .click(function(){
+            if (doneAnimating === true)
+            returnToOriginal();
+          });
+
+        // Put before in origin image to preserve z-index layering.
+        origin.before(overlay);
+
+        // Set dimensions if needed
+        var overlayOffset = overlay[0].getBoundingClientRect();
+        overlay.css({
+          width: windowWidth,
+          height: windowHeight,
+          left: -1 * overlayOffset.left,
+          top: -1 * overlayOffset.top
+        })
+
+        // Animate Overlay
+        overlay.velocity({opacity: 1},
+                           {duration: inDuration, queue: false, easing: 'easeOutQuad'} );
+
+        // Add and animate caption if it exists
+        if (origin.data('caption') !== "") {
+          var $photo_caption = $('<div class="materialbox-caption"></div>');
+          $photo_caption.text(origin.data('caption'));
+          $('body').append($photo_caption);
+          $photo_caption.css({ "display": "inline" });
+          $photo_caption.velocity({opacity: 1}, {duration: inDuration, queue: false, easing: 'easeOutQuad'});
+        }
+
+        // Resize Image
+        var ratio = 0;
+        var widthPercent = originalWidth / windowWidth;
+        var heightPercent = originalHeight / windowHeight;
+        var newWidth = 0;
+        var newHeight = 0;
+
+        if (widthPercent > heightPercent) {
+          ratio = originalHeight / originalWidth;
+          newWidth = windowWidth * 0.9;
+          newHeight = windowWidth * 0.9 * ratio;
+        }
+        else {
+          ratio = originalWidth / originalHeight;
+          newWidth = (windowHeight * 0.9) * ratio;
+          newHeight = windowHeight * 0.9;
+        }
+
+        // Animate image + set z-index
+        if(origin.hasClass('responsive-img')) {
+          origin.velocity({'max-width': newWidth, 'width': originalWidth}, {duration: 0, queue: false,
+            complete: function(){
+              origin.css({left: 0, top: 0})
+              .velocity(
+                {
+                  height: newHeight,
+                  width: newWidth,
+                  left: $(document).scrollLeft() + windowWidth/2 - origin.parent('.material-placeholder').offset().left - newWidth/2,
+                  top: $(document).scrollTop() + windowHeight/2 - origin.parent('.material-placeholder').offset().top - newHeight/ 2
+                },
+                {
+                  duration: inDuration,
+                  queue: false,
+                  easing: 'easeOutQuad',
+                  complete: function(){doneAnimating = true;}
+                }
+              );
+            } // End Complete
+          }); // End Velocity
+        }
+        else {
+          origin.css('left', 0)
+          .css('top', 0)
+          .velocity(
+            {
+              height: newHeight,
+              width: newWidth,
+              left: $(document).scrollLeft() + windowWidth/2 - origin.parent('.material-placeholder').offset().left - newWidth/2,
+              top: $(document).scrollTop() + windowHeight/2 - origin.parent('.material-placeholder').offset().top - newHeight/ 2
+            },
+            {
+              duration: inDuration,
+              queue: false,
+              easing: 'easeOutQuad',
+              complete: function(){doneAnimating = true;}
+            }
+            ); // End Velocity
+        }
+
+      }); // End origin on click
+
+
+      // Return on scroll
+      $(window).scroll(function() {
+        if (overlayActive) {
+          returnToOriginal();
+        }
+      });
+
+      // Return on ESC
+      $(document).keyup(function(e) {
+
+        if (e.keyCode === 27 && doneAnimating === true) {   // ESC key
+          if (overlayActive) {
+            returnToOriginal();
+          }
+        }
+      });
+
+
+      // This function returns the modaled image to the original spot
+      function returnToOriginal() {
+
+        doneAnimating = false;
+
+        var placeholder = origin.parent('.material-placeholder');
+        var windowWidth = window.innerWidth;
+        var windowHeight = window.innerHeight;
+        var originalWidth = origin.data('width');
+        var originalHeight = origin.data('height');
+
+        origin.velocity("stop", true);
+        $('#materialbox-overlay').velocity("stop", true);
+        $('.materialbox-caption').velocity("stop", true);
+
+
+        $('#materialbox-overlay').velocity({opacity: 0}, {
+          duration: outDuration, // Delay prevents animation overlapping
+          queue: false, easing: 'easeOutQuad',
+          complete: function(){
+            // Remove Overlay
+            overlayActive = false;
+            $(this).remove();
+          }
+        });
+
+        // Resize Image
+        origin.velocity(
+          {
+            width: originalWidth,
+            height: originalHeight,
+            left: 0,
+            top: 0
+          },
+          {
+            duration: outDuration,
+            queue: false, easing: 'easeOutQuad'
+          }
+        );
+
+        // Remove Caption + reset css settings on image
+        $('.materialbox-caption').velocity({opacity: 0}, {
+          duration: outDuration, // Delay prevents animation overlapping
+          queue: false, easing: 'easeOutQuad',
+          complete: function(){
+            placeholder.css({
+              height: '',
+              width: '',
+              position: '',
+              top: '',
+              left: ''
+            });
+
+            origin.css({
+              height: '',
+              top: '',
+              left: '',
+              width: '',
+              'max-width': '',
+              position: '',
+              'z-index': '',
+              'will-change': ''
+            });
+
+            // Remove class
+            origin.removeClass('active');
+            doneAnimating = true;
+            $(this).remove();
+
+            // Remove overflow overrides on ancestors
+            if (ancestorsChanged) {
+              ancestorsChanged.css('overflow', '');
+            }
+          }
+        });
+
+      }
+    });
+  };
+
+  $(document).ready(function(){
+    $('.materialboxed').materialbox();
+  });
+
+}( jQuery ));
+;(function ($) {
+
+  $.fn.parallax = function () {
+    var window_width = $(window).width();
+    // Parallax Scripts
+    return this.each(function(i) {
+      var $this = $(this);
+      $this.addClass('parallax');
+
+      function updateParallax(initial) {
+        var container_height;
+        if (window_width < 601) {
+          container_height = ($this.height() > 0) ? $this.height() : $this.children("img").height();
+        }
+        else {
+          container_height = ($this.height() > 0) ? $this.height() : 500;
+        }
+        var $img = $this.children("img").first();
+        var img_height = $img.height();
+        var parallax_dist = img_height - container_height;
+        var bottom = $this.offset().top + container_height;
+        var top = $this.offset().top;
+        var scrollTop = $(window).scrollTop();
+        var windowHeight = window.innerHeight;
+        var windowBottom = scrollTop + windowHeight;
+        var percentScrolled = (windowBottom - top) / (container_height + windowHeight);
+        var parallax = Math.round((parallax_dist * percentScrolled));
+
+        if (initial) {
+          $img.css('display', 'block');
+        }
+        if ((bottom > scrollTop) && (top < (scrollTop + windowHeight))) {
+          $img.css('transform', "translate3D(-50%," + parallax + "px, 0)");
+        }
+
+      }
+
+      // Wait for image load
+      $this.children("img").one("load", function() {
+        updateParallax(true);
+      }).each(function() {
+        if (this.complete) $(this).trigger("load");
+      });
+
+      $(window).scroll(function() {
+        window_width = $(window).width();
+        updateParallax(false);
+      });
+
+      $(window).resize(function() {
+        window_width = $(window).width();
+        updateParallax(false);
+      });
+
+    });
+
+  };
+}( jQuery ));
+;(function ($) {
+
+  var methods = {
+    init : function(options) {
+      var defaults = {
+        onShow: null,
+        swipeable: false,
+        responsiveThreshold: Infinity, // breakpoint for swipeable
+      };
+      options = $.extend(defaults, options);
+
+      return this.each(function() {
+
+      // For each set of tabs, we want to keep track of
+      // which tab is active and its associated content
+      var $this = $(this),
+          window_width = $(window).width();
+
+      var $active, $content, $links = $this.find('li.tab a'),
+          $tabs_width = $this.width(),
+          $tabs_content = $(),
+          $tabs_wrapper,
+          $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length,
+          $indicator,
+          index = prev_index = 0,
+          clicked = false,
+          clickedTimeout,
+          transition = 300;
+
+
+      // Finds right attribute for indicator based on active tab.
+      // el: jQuery Object
+      var calcRightPos = function(el) {
+        return $tabs_width - el.position().left - el.outerWidth() - $this.scrollLeft();
+      };
+
+      // Finds left attribute for indicator based on active tab.
+      // el: jQuery Object
+      var calcLeftPos = function(el) {
+        return el.position().left + $this.scrollLeft();
+      };
+
+      // Animates Indicator to active tab.
+      // prev_index: Number
+      var animateIndicator = function(prev_index) {
+        if ((index - prev_index) >= 0) {
+          $indicator.velocity({"right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad'});
+          $indicator.velocity({"left": calcLeftPos($active) }, {duration: transition, queue: false, easing: 'easeOutQuad', delay: 90});
+
+        } else {
+          $indicator.velocity({"left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad'});
+          $indicator.velocity({"right": calcRightPos($active) }, {duration: transition, queue: false, easing: 'easeOutQuad', delay: 90});
+        }
+      };
+
+      // Change swipeable according to responsive threshold
+      if (options.swipeable) {
+        if (window_width > options.responsiveThreshold) {
+          options.swipeable = false;
+        }
+      }
+
+
+      // If the location.hash matches one of the links, use that as the active tab.
+      $active = $($links.filter('[href="'+location.hash+'"]'));
+
+      // If no match is found, use the first link or any with class 'active' as the initial active tab.
+      if ($active.length === 0) {
+        $active = $(this).find('li.tab a.active').first();
+      }
+      if ($active.length === 0) {
+        $active = $(this).find('li.tab a').first();
+      }
+
+      $active.addClass('active');
+      index = $links.index($active);
+      if (index < 0) {
+        index = 0;
+      }
+
+      if ($active[0] !== undefined) {
+        $content = $($active[0].hash);
+        $content.addClass('active');
+      }
+
+      // append indicator then set indicator width to tab width
+      if (!$this.find('.indicator').length) {
+        $this.append('<div class="indicator"></div>');
+      }
+      $indicator = $this.find('.indicator');
+
+      // we make sure that the indicator is at the end of the tabs
+      $this.append($indicator);
+
+      if ($this.is(":visible")) {
+        // $indicator.css({"right": $tabs_width - ((index + 1) * $tab_width)});
+        // $indicator.css({"left": index * $tab_width});
+        setTimeout(function() {
+          $indicator.css({"right": calcRightPos($active) });
+          $indicator.css({"left": calcLeftPos($active) });
+        }, 0);
+      }
+      $(window).resize(function () {
+        $tabs_width = $this.width();
+        $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
+        if (index < 0) {
+          index = 0;
+        }
+        if ($tab_width !== 0 && $tabs_width !== 0) {
+          $indicator.css({"right": calcRightPos($active) });
+          $indicator.css({"left": calcLeftPos($active) });
+        }
+      });
+
+      // Initialize Tabs Content.
+      if (options.swipeable) {
+        // TODO: Duplicate calls with swipeable? handle multiple div wrapping.
+        $links.each(function () {
+          var $curr_content = $(Materialize.escapeHash(this.hash));
+          $curr_content.addClass('carousel-item');
+          $tabs_content = $tabs_content.add($curr_content);
+        });
+        $tabs_wrapper = $tabs_content.wrapAll('<div class="tabs-content carousel"></div>');
+        $tabs_content.css('display', '');
+        $('.tabs-content.carousel').carousel({
+          fullWidth: true,
+          noWrap: true,
+          onCycleTo: function(item) {
+            if (!clicked) {
+              var prev_index = index;
+              index = $tabs_wrapper.index(item);
+              $active = $links.eq(index);
+              animateIndicator(prev_index);
+            }
+          },
+        });
+      } else {
+        // Hide the remaining content
+        $links.not($active).each(function () {
+          $(Materialize.escapeHash(this.hash)).hide();
+        });
+      }
+
+
+      // Bind the click event handler
+      $this.on('click', 'a', function(e) {
+        if ($(this).parent().hasClass('disabled')) {
+          e.preventDefault();
+          return;
+        }
+
+        // Act as regular link if target attribute is specified.
+        if (!!$(this).attr("target")) {
+          return;
+        }
+
+        clicked = true;
+        $tabs_width = $this.width();
+        $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
+
+        // Make the old tab inactive.
+        $active.removeClass('active');
+        var $oldContent = $content
+
+        // Update the variables with the new link and content
+        $active = $(this);
+        $content = $(Materialize.escapeHash(this.hash));
+        $links = $this.find('li.tab a');
+        var activeRect = $active.position();
+
+        // Make the tab active.
+        $active.addClass('active');
+        prev_index = index;
+        index = $links.index($(this));
+        if (index < 0) {
+          index = 0;
+        }
+        // Change url to current tab
+        // window.location.hash = $active.attr('href');
+
+        // Swap content
+        if (options.swipeable) {
+          if ($tabs_content.length) {
+            $tabs_content.carousel('set', index);
+          }
+        } else {
+          if ($content !== undefined) {
+            $content.show();
+            $content.addClass('active');
+            if (typeof(options.onShow) === "function") {
+              options.onShow.call(this, $content);
+            }
+          }
+
+          if ($oldContent !== undefined &&
+              !$oldContent.is($content)) {
+            $oldContent.hide();
+            $oldContent.removeClass('active');
+          }
+        }
+
+        // Reset clicked state
+        clickedTimeout = setTimeout(function(){ clicked = false; }, transition);
+
+        // Update indicator
+        animateIndicator(prev_index);
+
+        // Prevent the anchor's default click action
+        e.preventDefault();
+      });
+    });
+
+    },
+    select_tab : function( id ) {
+      this.find('a[href="#' + id + '"]').trigger('click');
+    }
+  };
+
+  $.fn.tabs = function(methodOrOptions) {
+    if ( methods[methodOrOptions] ) {
+      return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 ));
+    } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) {
+      // Default to "init"
+      return methods.init.apply( this, arguments );
+    } else {
+      $.error( 'Method ' +  methodOrOptions + ' does not exist on jQuery.tabs' );
+    }
+  };
+
+  $(document).ready(function(){
+    $('ul.tabs').tabs();
+  });
+}( jQuery ));
+;(function ($) {
+    $.fn.tooltip = function (options) {
+      var timeout = null,
+      margin = 5;
+
+      // Defaults
+      var defaults = {
+        delay: 350,
+        tooltip: '',
+        position: 'bottom',
+        html: false
+      };
+
+      // Remove tooltip from the activator
+      if (options === "remove") {
+        this.each(function() {
+          $('#' + $(this).attr('data-tooltip-id')).remove();
+          $(this).off('mouseenter.tooltip mouseleave.tooltip');
+        });
+        return false;
+      }
+
+      options = $.extend(defaults, options);
+
+      return this.each(function() {
+        var tooltipId = Materialize.guid();
+        var origin = $(this);
+
+        // Destroy old tooltip
+        if (origin.attr('data-tooltip-id')) {
+          $('#' + origin.attr('data-tooltip-id')).remove();
+        }
+
+        origin.attr('data-tooltip-id', tooltipId);
+
+        // Get attributes.
+        var allowHtml,
+            tooltipDelay,
+            tooltipPosition,
+            tooltipText,
+            tooltipEl,
+            backdrop;
+        var setAttributes = function() {
+          allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html;
+          tooltipDelay = origin.attr('data-delay');
+          tooltipDelay = (tooltipDelay === undefined || tooltipDelay === '') ?
+              options.delay : tooltipDelay;
+          tooltipPosition = origin.attr('data-position');
+          tooltipPosition = (tooltipPosition === undefined || tooltipPosition === '') ?
+              options.position : tooltipPosition;
+          tooltipText = origin.attr('data-tooltip');
+          tooltipText = (tooltipText === undefined || tooltipText === '') ?
+              options.tooltip : tooltipText;
+        };
+        setAttributes();
+
+        var renderTooltipEl = function() {
+          var tooltip = $('<div class="material-tooltip"></div>');
+
+          // Create Text span
+          if (allowHtml) {
+            tooltipText = $('<span></span>').html(tooltipText);
+          } else{
+            tooltipText = $('<span></span>').text(tooltipText);
+          }
+
+          // Create tooltip
+          tooltip.append(tooltipText)
+            .appendTo($('body'))
+            .attr('id', tooltipId);
+
+          // Create backdrop
+          backdrop = $('<div class="backdrop"></div>');
+          backdrop.appendTo(tooltip);
+          return tooltip;
+        };
+        tooltipEl = renderTooltipEl();
+
+        // Destroy previously binded events
+        origin.off('mouseenter.tooltip mouseleave.tooltip');
+        // Mouse In
+        var started = false, timeoutRef;
+        origin.on({'mouseenter.tooltip': function(e) {
+          var showTooltip = function() {
+            setAttributes();
+            started = true;
+            tooltipEl.velocity('stop');
+            backdrop.velocity('stop');
+            tooltipEl.css({ visibility: 'visible', left: '0px', top: '0px' });
+
+            // Tooltip positioning
+            var originWidth = origin.outerWidth();
+            var originHeight = origin.outerHeight();
+            var tooltipHeight = tooltipEl.outerHeight();
+            var tooltipWidth = tooltipEl.outerWidth();
+            var tooltipVerticalMovement = '0px';
+            var tooltipHorizontalMovement = '0px';
+            var backdropOffsetWidth = backdrop[0].offsetWidth;
+            var backdropOffsetHeight = backdrop[0].offsetHeight;
+            var scaleXFactor = 8;
+            var scaleYFactor = 8;
+            var scaleFactor = 0;
+            var targetTop, targetLeft, newCoordinates;
+
+            if (tooltipPosition === "top") {
+              // Top Position
+              targetTop = origin.offset().top - tooltipHeight - margin;
+              targetLeft = origin.offset().left + originWidth/2 - tooltipWidth/2;
+              newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
+              tooltipVerticalMovement = '-10px';
+              backdrop.css({
+                bottom: 0,
+                left: 0,
+                borderRadius: '14px 14px 0 0',
+                transformOrigin: '50% 100%',
+                marginTop: tooltipHeight,
+                marginLeft: (tooltipWidth/2) - (backdropOffsetWidth/2)
+              });
+            }
+            // Left Position
+            else if (tooltipPosition === "left") {
+              targetTop = origin.offset().top + originHeight/2 - tooltipHeight/2;
+              targetLeft =  origin.offset().left - tooltipWidth - margin;
+              newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
+
+              tooltipHorizontalMovement = '-10px';
+              backdrop.css({
+                top: '-7px',
+                right: 0,
+                width: '14px',
+                height: '14px',
+                borderRadius: '14px 0 0 14px',
+                transformOrigin: '95% 50%',
+                marginTop: tooltipHeight/2,
+                marginLeft: tooltipWidth
+              });
+            }
+            // Right Position
+            else if (tooltipPosition === "right") {
+              targetTop = origin.offset().top + originHeight/2 - tooltipHeight/2;
+              targetLeft = origin.offset().left + originWidth + margin;
+              newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
+
+              tooltipHorizontalMovement = '+10px';
+              backdrop.css({
+                top: '-7px',
+                left: 0,
+                width: '14px',
+                height: '14px',
+                borderRadius: '0 14px 14px 0',
+                transformOrigin: '5% 50%',
+                marginTop: tooltipHeight/2,
+                marginLeft: '0px'
+              });
+            }
+            else {
+              // Bottom Position
+              targetTop = origin.offset().top + origin.outerHeight() + margin;
+              targetLeft = origin.offset().left + originWidth/2 - tooltipWidth/2;
+              newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
+              tooltipVerticalMovement = '+10px';
+              backdrop.css({
+                top: 0,
+                left: 0,
+                marginLeft: (tooltipWidth/2) - (backdropOffsetWidth/2)
+              });
+            }
+
+            // Set tooptip css placement
+            tooltipEl.css({
+              top: newCoordinates.y,
+              left: newCoordinates.x
+            });
+
+            // Calculate Scale to fill
+            scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdropOffsetWidth);
+            scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdropOffsetHeight);
+            scaleFactor = Math.max(scaleXFactor, scaleYFactor);
+
+            tooltipEl.velocity({ translateY: tooltipVerticalMovement, translateX: tooltipHorizontalMovement}, { duration: 350, queue: false })
+              .velocity({opacity: 1}, {duration: 300, delay: 50, queue: false});
+            backdrop.css({ visibility: 'visible' })
+              .velocity({opacity:1},{duration: 55, delay: 0, queue: false})
+              .velocity({scaleX: scaleFactor, scaleY: scaleFactor}, {duration: 300, delay: 0, queue: false, easing: 'easeInOutQuad'});
+          };
+
+          timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval
+
+        // Mouse Out
+        },
+        'mouseleave.tooltip': function(){
+          // Reset State
+          started = false;
+          clearTimeout(timeoutRef);
+
+          // Animate back
+          setTimeout(function() {
+            if (started !== true) {
+              tooltipEl.velocity({
+                opacity: 0, translateY: 0, translateX: 0}, { duration: 225, queue: false});
+              backdrop.velocity({opacity: 0, scaleX: 1, scaleY: 1}, {
+                duration:225,
+                queue: false,
+                complete: function(){
+                  backdrop.css({ visibility: 'hidden' });
+                  tooltipEl.css({ visibility: 'hidden' });
+                  started = false;}
+              });
+            }
+          },225);
+        }
+        });
+    });
+  };
+
+  var repositionWithinScreen = function(x, y, width, height) {
+    var newX = x;
+    var newY = y;
+
+    if (newX < 0) {
+      newX = 4;
+    } else if (newX + width > window.innerWidth) {
+      newX -= newX + width - window.innerWidth;
+    }
+
+    if (newY < 0) {
+      newY = 4;
+    } else if (newY + height > window.innerHeight + $(window).scrollTop) {
+      newY -= newY + height - window.innerHeight;
+    }
+
+    return {x: newX, y: newY};
+  };
+
+  $(document).ready(function(){
+     $('.tooltipped').tooltip();
+   });
+}( jQuery ));
+;/*!
+ * Waves v0.6.4
+ * http://fian.my.id/Waves
+ *
+ * Copyright 2014 Alfiana E. Sibuea and other contributors
+ * Released under the MIT license
+ * https://github.com/fians/Waves/blob/master/LICENSE
+ */
+
+;(function(window) {
+    'use strict';
+
+    var Waves = Waves || {};
+    var $$ = document.querySelectorAll.bind(document);
+
+    // Find exact position of element
+    function isWindow(obj) {
+        return obj !== null && obj === obj.window;
+    }
+
+    function getWindow(elem) {
+        return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView;
+    }
+
+    function offset(elem) {
+        var docElem, win,
+            box = {top: 0, left: 0},
+            doc = elem && elem.ownerDocument;
+
+        docElem = doc.documentElement;
+
+        if (typeof elem.getBoundingClientRect !== typeof undefined) {
+            box = elem.getBoundingClientRect();
+        }
+        win = getWindow(doc);
+        return {
+            top: box.top + win.pageYOffset - docElem.clientTop,
+            left: box.left + win.pageXOffset - docElem.clientLeft
+        };
+    }
+
+    function convertStyle(obj) {
+        var style = '';
+
+        for (var a in obj) {
+            if (obj.hasOwnProperty(a)) {
+                style += (a + ':' + obj[a] + ';');
+            }
+        }
+
+        return style;
+    }
+
+    var Effect = {
+
+        // Effect delay
+        duration: 750,
+
+        show: function(e, element) {
+
+            // Disable right click
+            if (e.button === 2) {
+                return false;
+            }
+
+            var el = element || this;
+
+            // Create ripple
+            var ripple = document.createElement('div');
+            ripple.className = 'waves-ripple';
+            el.appendChild(ripple);
+
+            // Get click coordinate and element witdh
+            var pos         = offset(el);
+            var relativeY   = (e.pageY - pos.top);
+            var relativeX   = (e.pageX - pos.left);
+            var scale       = 'scale('+((el.clientWidth / 100) * 10)+')';
+
+            // Support for touch devices
+            if ('touches' in e) {
+              relativeY   = (e.touches[0].pageY - pos.top);
+              relativeX   = (e.touches[0].pageX - pos.left);
+            }
+
+            // Attach data to element
+            ripple.setAttribute('data-hold', Date.now());
+            ripple.setAttribute('data-scale', scale);
+            ripple.setAttribute('data-x', relativeX);
+            ripple.setAttribute('data-y', relativeY);
+
+            // Set ripple position
+            var rippleStyle = {
+                'top': relativeY+'px',
+                'left': relativeX+'px'
+            };
+
+            ripple.className = ripple.className + ' waves-notransition';
+            ripple.setAttribute('style', convertStyle(rippleStyle));
+            ripple.className = ripple.className.replace('waves-notransition', '');
+
+            // Scale the ripple
+            rippleStyle['-webkit-transform'] = scale;
+            rippleStyle['-moz-transform'] = scale;
+            rippleStyle['-ms-transform'] = scale;
+            rippleStyle['-o-transform'] = scale;
+            rippleStyle.transform = scale;
+            rippleStyle.opacity   = '1';
+
+            rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms';
+            rippleStyle['-moz-transition-duration']    = Effect.duration + 'ms';
+            rippleStyle['-o-transition-duration']      = Effect.duration + 'ms';
+            rippleStyle['transition-duration']         = Effect.duration + 'ms';
+
+            rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
+            rippleStyle['-moz-transition-timing-function']    = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
+            rippleStyle['-o-transition-timing-function']      = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
+            rippleStyle['transition-timing-function']         = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
+
+            ripple.setAttribute('style', convertStyle(rippleStyle));
+        },
+
+        hide: function(e) {
+            TouchHandler.touchup(e);
+
+            var el = this;
+            var width = el.clientWidth * 1.4;
+
+            // Get first ripple
+            var ripple = null;
+            var ripples = el.getElementsByClassName('waves-ripple');
+            if (ripples.length > 0) {
+                ripple = ripples[ripples.length - 1];
+            } else {
+                return false;
+            }
+
+            var relativeX   = ripple.getAttribute('data-x');
+            var relativeY   = ripple.getAttribute('data-y');
+            var scale       = ripple.getAttribute('data-scale');
+
+            // Get delay beetween mousedown and mouse leave
+            var diff = Date.now() - Number(ripple.getAttribute('data-hold'));
+            var delay = 350 - diff;
+
+            if (delay < 0) {
+                delay = 0;
+            }
+
+            // Fade out ripple after delay
+            setTimeout(function() {
+                var style = {
+                    'top': relativeY+'px',
+                    'left': relativeX+'px',
+                    'opacity': '0',
+
+                    // Duration
+                    '-webkit-transition-duration': Effect.duration + 'ms',
+                    '-moz-transition-duration': Effect.duration + 'ms',
+                    '-o-transition-duration': Effect.duration + 'ms',
+                    'transition-duration': Effect.duration + 'ms',
+                    '-webkit-transform': scale,
+                    '-moz-transform': scale,
+                    '-ms-transform': scale,
+                    '-o-transform': scale,
+                    'transform': scale,
+                };
+
+                ripple.setAttribute('style', convertStyle(style));
+
+                setTimeout(function() {
+                    try {
+                        el.removeChild(ripple);
+                    } catch(e) {
+                        return false;
+                    }
+                }, Effect.duration);
+            }, delay);
+        },
+
+        // Little hack to make <input> can perform waves effect
+        wrapInput: function(elements) {
+            for (var a = 0; a < elements.length; a++) {
+                var el = elements[a];
+
+                if (el.tagName.toLowerCase() === 'input') {
+                    var parent = el.parentNode;
+
+                    // If input already have parent just pass through
+                    if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) {
+                        continue;
+                    }
+
+                    // Put element class and style to the specified parent
+                    var wrapper = document.createElement('i');
+                    wrapper.className = el.className + ' waves-input-wrapper';
+
+                    var elementStyle = el.getAttribute('style');
+
+                    if (!elementStyle) {
+                        elementStyle = '';
+                    }
+
+                    wrapper.setAttribute('style', elementStyle);
+
+                    el.className = 'waves-button-input';
+                    el.removeAttribute('style');
+
+                    // Put element as child
+                    parent.replaceChild(wrapper, el);
+                    wrapper.appendChild(el);
+                }
+            }
+        }
+    };
+
+
+    /**
+     * Disable mousedown event for 500ms during and after touch
+     */
+    var TouchHandler = {
+        /* uses an integer rather than bool so there's no issues with
+         * needing to clear timeouts if another touch event occurred
+         * within the 500ms. Cannot mouseup between touchstart and
+         * touchend, nor in the 500ms after touchend. */
+        touches: 0,
+        allowEvent: function(e) {
+            var allow = true;
+
+            if (e.type === 'touchstart') {
+                TouchHandler.touches += 1; //push
+            } else if (e.type === 'touchend' || e.type === 'touchcancel') {
+                setTimeout(function() {
+                    if (TouchHandler.touches > 0) {
+                        TouchHandler.touches -= 1; //pop after 500ms
+                    }
+                }, 500);
+            } else if (e.type === 'mousedown' && TouchHandler.touches > 0) {
+                allow = false;
+            }
+
+            return allow;
+        },
+        touchup: function(e) {
+            TouchHandler.allowEvent(e);
+        }
+    };
+
+
+    /**
+     * Delegated click handler for .waves-effect element.
+     * returns null when .waves-effect element not in "click tree"
+     */
+    function getWavesEffectElement(e) {
+        if (TouchHandler.allowEvent(e) === false) {
+            return null;
+        }
+
+        var element = null;
+        var target = e.target || e.srcElement;
+
+        while (target.parentElement !== null) {
+            if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) {
+                element = target;
+                break;
+            } else if (target.classList.contains('waves-effect')) {
+                element = target;
+                break;
+            }
+            target = target.parentElement;
+        }
+
+        return element;
+    }
+
+    /**
+     * Bubble the click and show effect if .waves-effect elem was found
+     */
+    function showEffect(e) {
+        var element = getWavesEffectElement(e);
+
+        if (element !== null) {
+            Effect.show(e, element);
+
+            if ('ontouchstart' in window) {
+                element.addEventListener('touchend', Effect.hide, false);
+                element.addEventListener('touchcancel', Effect.hide, false);
+            }
+
+            element.addEventListener('mouseup', Effect.hide, false);
+            element.addEventListener('mouseleave', Effect.hide, false);
+        }
+    }
+
+    Waves.displayEffect = function(options) {
+        options = options || {};
+
+        if ('duration' in options) {
+            Effect.duration = options.duration;
+        }
+
+        //Wrap input inside <i> tag
+        Effect.wrapInput($$('.waves-effect'));
+
+        if ('ontouchstart' in window) {
+            document.body.addEventListener('touchstart', showEffect, false);
+        }
+
+        document.body.addEventListener('mousedown', showEffect, false);
+    };
+
+    /**
+     * Attach Waves to an input element (or any element which doesn't
+     * bubble mouseup/mousedown events).
+     *   Intended to be used with dynamically loaded forms/inputs, or
+     * where the user doesn't want a delegated click handler.
+     */
+    Waves.attach = function(element) {
+        //FUTURE: automatically add waves classes and allow users
+        // to specify them with an options param? Eg. light/classic/button
+        if (element.tagName.toLowerCase() === 'input') {
+            Effect.wrapInput([element]);
+            element = element.parentElement;
+        }
+
+        if ('ontouchstart' in window) {
+            element.addEventListener('touchstart', showEffect, false);
+        }
+
+        element.addEventListener('mousedown', showEffect, false);
+    };
+
+    window.Waves = Waves;
+
+    document.addEventListener('DOMContentLoaded', function() {
+        Waves.displayEffect();
+    }, false);
+
+})(window);
+;Materialize.toast = function (message, displayLength, className, completeCallback) {
+  className = className || "";
+
+  var container = document.getElementById('toast-container');
+
+  // Create toast container if it does not exist
+  if (container === null) {
+    // create notification container
+    container = document.createElement('div');
+    container.id = 'toast-container';
+    document.body.appendChild(container);
+  }
+
+  // Select and append toast
+  var newToast = createToast(message);
+
+  // only append toast if message is not undefined
+  if(message){
+    container.appendChild(newToast);
+  }
+
+  newToast.style.opacity = 0;
+
+  // Animate toast in
+  Vel(newToast, {translateY: '-35px',  opacity: 1 }, {duration: 300,
+    easing: 'easeOutCubic',
+    queue: false});
+
+  // Allows timer to be pause while being panned
+  var timeLeft = displayLength;
+  var counterInterval;
+  if (timeLeft != null)  {
+    counterInterval = setInterval (function(){
+      if (newToast.parentNode === null)
+        window.clearInterval(counterInterval);
+
+      // If toast is not being dragged, decrease its time remaining
+      if (!newToast.classList.contains('panning')) {
+        timeLeft -= 20;
+      }
+
+      if (timeLeft <= 0) {
+        // Animate toast out
+        Vel(newToast, {"opacity": 0, marginTop: '-40px'}, { duration: 375,
+            easing: 'easeOutExpo',
+            queue: false,
+            complete: function(){
+              // Call the optional callback
+              if(typeof(completeCallback) === "function")
+                completeCallback();
+              // Remove toast after it times out
+              this[0].parentNode.removeChild(this[0]);
+            }
+          });
+        window.clearInterval(counterInterval);
+      }
+    }, 20);
+  }
+
+
+
+  function createToast(html) {
+
+    // Create toast
+    var toast = document.createElement('div');
+    toast.classList.add('toast');
+    if (className) {
+      var classes = className.split(' ');
+
+      for (var i = 0, count = classes.length; i < count; i++) {
+        toast.classList.add(classes[i]);
+      }
+    }
+  // If type of parameter is HTML Element
+    if ( typeof HTMLElement === "object" ? html instanceof HTMLElement : html && typeof html === "object" && html !== null && html.nodeType === 1 && typeof html.nodeName==="string"
+) {
+      toast.appendChild(html);
+    }
+    else if (html instanceof jQuery) {
+      // Check if it is jQuery object
+      toast.appendChild(html[0]);
+    }
+    else {
+      // Insert as text;
+      toast.innerHTML = html;
+    }
+    // Bind hammer
+    var hammerHandler = new Hammer(toast, {prevent_default: false});
+    hammerHandler.on('pan', function(e) {
+      var deltaX = e.deltaX;
+      var activationDistance = 80;
+
+      // Change toast state
+      if (!toast.classList.contains('panning')){
+        toast.classList.add('panning');
+      }
+
+      var opacityPercent = 1-Math.abs(deltaX / activationDistance);
+      if (opacityPercent < 0)
+        opacityPercent = 0;
+
+      Vel(toast, {left: deltaX, opacity: opacityPercent }, {duration: 50, queue: false, easing: 'easeOutQuad'});
+
+    });
+
+    hammerHandler.on('panend', function(e) {
+      var deltaX = e.deltaX;
+      var activationDistance = 80;
+
+      // If toast dragged past activation point
+      if (Math.abs(deltaX) > activationDistance) {
+        Vel(toast, {marginTop: '-40px'}, { duration: 375,
+          easing: 'easeOutExpo',
+          queue: false,
+          complete: function(){
+            if(typeof(completeCallback) === "function") {
+              completeCallback();
+            }
+            toast.parentNode.removeChild(toast);
+          }
+        });
+
+      } else {
+        toast.classList.remove('panning');
+        // Put toast back into original position
+        Vel(toast, { left: 0, opacity: 1 }, { duration: 300,
+          easing: 'easeOutExpo',
+          queue: false
+        });
+
+      }
+    });
+
+    return toast;
+  }
+};
+;(function ($) {
+
+  var methods = {
+    init : function(options) {
+      var defaults = {
+        menuWidth: 300,
+        edge: 'left',
+        closeOnClick: false,
+        draggable: true
+      };
+      options = $.extend(defaults, options);
+
+      $(this).each(function(){
+        var $this = $(this);
+        var menuId = $this.attr('data-activates');
+        var menu = $("#"+ menuId);
+
+        // Set to width
+        if (options.menuWidth != 300) {
+          menu.css('width', options.menuWidth);
+        }
+
+        // Add Touch Area
+        var $dragTarget = $('.drag-target[data-sidenav="' + menuId + '"]');
+        if (options.draggable) {
+          // Regenerate dragTarget
+          if ($dragTarget.length) {
+            $dragTarget.remove();
+          }
+
+          $dragTarget = $('<div class="drag-target"></div>').attr('data-sidenav', menuId);
+          $('body').append($dragTarget);
+        } else {
+          $dragTarget = $();
+        }
+
+        if (options.edge == 'left') {
+          menu.css('transform', 'translateX(-100%)');
+          $dragTarget.css({'left': 0}); // Add Touch Area
+        }
+        else {
+          menu.addClass('right-aligned') // Change text-alignment to right
+            .css('transform', 'translateX(100%)');
+          $dragTarget.css({'right': 0}); // Add Touch Area
+        }
+
+        // If fixed sidenav, bring menu out
+        if (menu.hasClass('fixed')) {
+            if (window.innerWidth > 992) {
+              menu.css('transform', 'translateX(0)');
+            }
+          }
+
+        // Window resize to reset on large screens fixed
+        if (menu.hasClass('fixed')) {
+          $(window).resize( function() {
+            if (window.innerWidth > 992) {
+              // Close menu if window is resized bigger than 992 and user has fixed sidenav
+              if ($('#sidenav-overlay').length !== 0 && menuOut) {
+                removeMenu(true);
+              }
+              else {
+                // menu.removeAttr('style');
+                menu.css('transform', 'translateX(0%)');
+                // menu.css('width', options.menuWidth);
+              }
+            }
+            else if (menuOut === false){
+              if (options.edge === 'left') {
+                menu.css('transform', 'translateX(-100%)');
+              } else {
+                menu.css('transform', 'translateX(100%)');
+              }
+
+            }
+
+          });
+        }
+
+        // if closeOnClick, then add close event for all a tags in side sideNav
+        if (options.closeOnClick === true) {
+          menu.on("click.itemclick", "a:not(.collapsible-header)", function(){
+            removeMenu();
+          });
+        }
+
+        var removeMenu = function(restoreNav) {
+          panning = false;
+          menuOut = false;
+          // Reenable scrolling
+          $('body').css({
+            overflow: '',
+            width: ''
+          });
+
+          $('#sidenav-overlay').velocity({opacity: 0}, {duration: 200,
+              queue: false, easing: 'easeOutQuad',
+            complete: function() {
+              $(this).remove();
+            } });
+          if (options.edge === 'left') {
+            // Reset phantom div
+            $dragTarget.css({width: '', right: '', left: '0'});
+            menu.velocity(
+              {'translateX': '-100%'},
+              { duration: 200,
+                queue: false,
+                easing: 'easeOutCubic',
+                complete: function() {
+                  if (restoreNav === true) {
+                    // Restore Fixed sidenav
+                    menu.removeAttr('style');
+                    menu.css('width', options.menuWidth);
+                  }
+                }
+
+            });
+          }
+          else {
+            // Reset phantom div
+            $dragTarget.css({width: '', right: '0', left: ''});
+            menu.velocity(
+              {'translateX': '100%'},
+              { duration: 200,
+                queue: false,
+                easing: 'easeOutCubic',
+                complete: function() {
+                  if (restoreNav === true) {
+                    // Restore Fixed sidenav
+                    menu.removeAttr('style');
+                    menu.css('width', options.menuWidth);
+                  }
+                }
+              });
+          }
+        };
+
+
+
+        // Touch Event
+        var panning = false;
+        var menuOut = false;
+
+        if (options.draggable) {
+          $dragTarget.on('click', function(){
+            if (menuOut) {
+              removeMenu();
+            }
+          });
+
+          $dragTarget.hammer({
+            prevent_default: false
+          }).bind('pan', function(e) {
+
+            if (e.gesture.pointerType == "touch") {
+
+              var direction = e.gesture.direction;
+              var x = e.gesture.center.x;
+              var y = e.gesture.center.y;
+              var velocityX = e.gesture.velocityX;
+
+              // Disable Scrolling
+              var $body = $('body');
+              var $overlay = $('#sidenav-overlay');
+              var oldWidth = $body.innerWidth();
+              $body.css('overflow', 'hidden');
+              $body.width(oldWidth);
+
+              // If overlay does not exist, create one and if it is clicked, close menu
+              if ($overlay.length === 0) {
+                $overlay = $('<div id="sidenav-overlay"></div>');
+                $overlay.css('opacity', 0).click( function(){
+                  removeMenu();
+                });
+                $('body').append($overlay);
+              }
+
+              // Keep within boundaries
+              if (options.edge === 'left') {
+                if (x > options.menuWidth) { x = options.menuWidth; }
+                else if (x < 0) { x = 0; }
+              }
+
+              if (options.edge === 'left') {
+                // Left Direction
+                if (x < (options.menuWidth / 2)) { menuOut = false; }
+                // Right Direction
+                else if (x >= (options.menuWidth / 2)) { menuOut = true; }
+                menu.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)');
+              }
+              else {
+                // Left Direction
+                if (x < (window.innerWidth - options.menuWidth / 2)) {
+                  menuOut = true;
+                }
+                // Right Direction
+                else if (x >= (window.innerWidth - options.menuWidth / 2)) {
+                 menuOut = false;
+               }
+                var rightPos = (x - options.menuWidth / 2);
+                if (rightPos < 0) {
+                  rightPos = 0;
+                }
+
+                menu.css('transform', 'translateX(' + rightPos + 'px)');
+              }
+
+
+              // Percentage overlay
+              var overlayPerc;
+              if (options.edge === 'left') {
+                overlayPerc = x / options.menuWidth;
+                $overlay.velocity({opacity: overlayPerc }, {duration: 10, queue: false, easing: 'easeOutQuad'});
+              }
+              else {
+                overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth);
+                $overlay.velocity({opacity: overlayPerc }, {duration: 10, queue: false, easing: 'easeOutQuad'});
+              }
+            }
+
+          }).bind('panend', function(e) {
+
+            if (e.gesture.pointerType == "touch") {
+              var $overlay = $('<div id="sidenav-overlay"></div>');
+              var velocityX = e.gesture.velocityX;
+              var x = e.gesture.center.x;
+              var leftPos = x - options.menuWidth;
+              var rightPos = x - options.menuWidth / 2;
+              if (leftPos > 0 ) {
+                leftPos = 0;
+              }
+              if (rightPos < 0) {
+                rightPos = 0;
+              }
+              panning = false;
+
+              if (options.edge === 'left') {
+                // If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut
+                if ((menuOut && velocityX <= 0.3) || velocityX < -0.5) {
+                  // Return menu to open
+                  if (leftPos !== 0) {
+                    menu.velocity({'translateX': [0, leftPos]}, {duration: 300, queue: false, easing: 'easeOutQuad'});
+                  }
+
+                  $overlay.velocity({opacity: 1 }, {duration: 50, queue: false, easing: 'easeOutQuad'});
+                  $dragTarget.css({width: '50%', right: 0, left: ''});
+                  menuOut = true;
+                }
+                else if (!menuOut || velocityX > 0.3) {
+                  // Enable Scrolling
+                  $('body').css({
+                    overflow: '',
+                    width: ''
+                  });
+                  // Slide menu closed
+                  menu.velocity({'translateX': [-1 * options.menuWidth - 10, leftPos]}, {duration: 200, queue: false, easing: 'easeOutQuad'});
+                  $overlay.velocity({opacity: 0 }, {duration: 200, queue: false, easing: 'easeOutQuad',
+                    complete: function () {
+                      $(this).remove();
+                    }});
+                  $dragTarget.css({width: '10px', right: '', left: 0});
+                }
+              }
+              else {
+                if ((menuOut && velocityX >= -0.3) || velocityX > 0.5) {
+                  // Return menu to open
+                  if (rightPos !== 0) {
+                    menu.velocity({'translateX': [0, rightPos]}, {duration: 300, queue: false, easing: 'easeOutQuad'});
+                  }
+
+                  $overlay.velocity({opacity: 1 }, {duration: 50, queue: false, easing: 'easeOutQuad'});
+                  $dragTarget.css({width: '50%', right: '', left: 0});
+                  menuOut = true;
+                }
+                else if (!menuOut || velocityX < -0.3) {
+                  // Enable Scrolling
+                  $('body').css({
+                    overflow: '',
+                    width: ''
+                  });
+
+                  // Slide menu closed
+                  menu.velocity({'translateX': [options.menuWidth + 10, rightPos]}, {duration: 200, queue: false, easing: 'easeOutQuad'});
+                  $overlay.velocity({opacity: 0 }, {duration: 200, queue: false, easing: 'easeOutQuad',
+                    complete: function () {
+                      $(this).remove();
+                    }});
+                  $dragTarget.css({width: '10px', right: 0, left: ''});
+                }
+              }
+
+            }
+          });
+        }
+
+        $this.off('click.sidenav').on('click.sidenav', function() {
+          if (menuOut === true) {
+            menuOut = false;
+            panning = false;
+            removeMenu();
+          }
+          else {
+
+            // Disable Scrolling
+            var $body = $('body');
+            var $overlay = $('<div id="sidenav-overlay"></div>');
+            var oldWidth = $body.innerWidth();
+            $body.css('overflow', 'hidden');
+            $body.width(oldWidth);
+
+            // Push current drag target on top of DOM tree
+            $('body').append($dragTarget);
+
+            if (options.edge === 'left') {
+              $dragTarget.css({width: '50%', right: 0, left: ''});
+              menu.velocity({'translateX': [0, -1 * options.menuWidth]}, {duration: 300, queue: false, easing: 'easeOutQuad'});
+            }
+            else {
+              $dragTarget.css({width: '50%', right: '', left: 0});
+              menu.velocity({'translateX': [0, options.menuWidth]}, {duration: 300, queue: false, easing: 'easeOutQuad'});
+            }
+
+            $overlay.css('opacity', 0)
+            .click(function(){
+              menuOut = false;
+              panning = false;
+              removeMenu();
+              $overlay.velocity({opacity: 0}, {duration: 300, queue: false, easing: 'easeOutQuad',
+                complete: function() {
+                  $(this).remove();
+                } });
+
+            });
+            $('body').append($overlay);
+            $overlay.velocity({opacity: 1}, {duration: 300, queue: false, easing: 'easeOutQuad',
+              complete: function () {
+                menuOut = true;
+                panning = false;
+              }
+            });
+          }
+
+          return false;
+        });
+      });
+
+
+    },
+    destroy: function () {
+      var $overlay = $('#sidenav-overlay');
+      var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]');
+      $overlay.trigger('click');
+      $dragTarget.remove();
+      $(this).off('click');
+      $overlay.remove();
+    },
+    show : function() {
+      this.trigger('click');
+    },
+    hide : function() {
+      $('#sidenav-overlay').trigger('click');
+    }
+  };
+
+
+  $.fn.sideNav = function(methodOrOptions) {
+    if ( methods[methodOrOptions] ) {
+      return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 ));
+    } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) {
+      // Default to "init"
+      return methods.init.apply( this, arguments );
+    } else {
+      $.error( 'Method ' +  methodOrOptions + ' does not exist on jQuery.sideNav' );
+    }
+  }; // Plugin end
+}( jQuery ));
+;/**
+ * Extend jquery with a scrollspy plugin.
+ * This watches the window scroll and fires events when elements are scrolled into viewport.
+ *
+ * throttle() and getTime() taken from Underscore.js
+ * https://github.com/jashkenas/underscore
+ *
+ * @author Copyright 2013 John Smart
+ * @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE
+ * @see https://github.com/thesmart
+ * @version 0.1.2
+ */
+(function($) {
+
+       var jWindow = $(window);
+       var elements = [];
+       var elementsInView = [];
+       var isSpying = false;
+       var ticks = 0;
+       var unique_id = 1;
+       var offset = {
+               top : 0,
+               right : 0,
+               bottom : 0,
+               left : 0,
+       }
+
+       /**
+        * Find elements that are within the boundary
+        * @param {number} top
+        * @param {number} right
+        * @param {number} bottom
+        * @param {number} left
+        * @return {jQuery}             A collection of elements
+        */
+       function findElements(top, right, bottom, left) {
+               var hits = $();
+               $.each(elements, function(i, element) {
+                       if (element.height() > 0) {
+                               var elTop = element.offset().top,
+                                       elLeft = element.offset().left,
+                                       elRight = elLeft + element.width(),
+                                       elBottom = elTop + element.height();
+
+                               var isIntersect = !(elLeft > right ||
+                                       elRight < left ||
+                                       elTop > bottom ||
+                                       elBottom < top);
+
+                               if (isIntersect) {
+                                       hits.push(element);
+                               }
+                       }
+               });
+
+               return hits;
+       }
+
+
+       /**
+        * Called when the user scrolls the window
+        */
+       function onScroll(scrollOffset) {
+               // unique tick id
+               ++ticks;
+
+               // viewport rectangle
+               var top = jWindow.scrollTop(),
+                       left = jWindow.scrollLeft(),
+                       right = left + jWindow.width(),
+                       bottom = top + jWindow.height();
+
+               // determine which elements are in view
+               var intersections = findElements(top+offset.top + scrollOffset || 200, right+offset.right, bottom+offset.bottom, left+offset.left);
+               $.each(intersections, function(i, element) {
+
+                       var lastTick = element.data('scrollSpy:ticks');
+                       if (typeof lastTick != 'number') {
+                               // entered into view
+                               element.triggerHandler('scrollSpy:enter');
+                       }
+
+                       // update tick id
+                       element.data('scrollSpy:ticks', ticks);
+               });
+
+               // determine which elements are no longer in view
+               $.each(elementsInView, function(i, element) {
+                       var lastTick = element.data('scrollSpy:ticks');
+                       if (typeof lastTick == 'number' && lastTick !== ticks) {
+                               // exited from view
+                               element.triggerHandler('scrollSpy:exit');
+                               element.data('scrollSpy:ticks', null);
+                       }
+               });
+
+               // remember elements in view for next tick
+               elementsInView = intersections;
+       }
+
+       /**
+        * Called when window is resized
+       */
+       function onWinSize() {
+               jWindow.trigger('scrollSpy:winSize');
+       }
+
+
+       /**
+        * Enables ScrollSpy using a selector
+        * @param {jQuery|string} selector  The elements collection, or a selector
+        * @param {Object=} options     Optional.
+        throttle : number -> scrollspy throttling. Default: 100 ms
+        offsetTop : number -> offset from top. Default: 0
+        offsetRight : number -> offset from right. Default: 0
+        offsetBottom : number -> offset from bottom. Default: 0
+        offsetLeft : number -> offset from left. Default: 0
+        * @returns {jQuery}
+        */
+       $.scrollSpy = function(selector, options) {
+         var defaults = {
+                       throttle: 100,
+                       scrollOffset: 200 // offset - 200 allows elements near bottom of page to scroll
+    };
+    options = $.extend(defaults, options);
+
+               var visible = [];
+               selector = $(selector);
+               selector.each(function(i, element) {
+                       elements.push($(element));
+                       $(element).data("scrollSpy:id", i);
+                       // Smooth scroll to section
+                 $('a[href="#' + $(element).attr('id') + '"]').click(function(e) {
+                   e.preventDefault();
+                   var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1;
+               $('html, body').animate({ scrollTop: offset - options.scrollOffset }, {duration: 400, queue: false, easing: 'easeOutCubic'});
+                 });
+               });
+
+               offset.top = options.offsetTop || 0;
+               offset.right = options.offsetRight || 0;
+               offset.bottom = options.offsetBottom || 0;
+               offset.left = options.offsetLeft || 0;
+
+               var throttledScroll = Materialize.throttle(function() {
+                       onScroll(options.scrollOffset);
+               }, options.throttle || 100);
+               var readyScroll = function(){
+                       $(document).ready(throttledScroll);
+               };
+
+               if (!isSpying) {
+                       jWindow.on('scroll', readyScroll);
+                       jWindow.on('resize', readyScroll);
+                       isSpying = true;
+               }
+
+               // perform a scan once, after current execution context, and after dom is ready
+               setTimeout(readyScroll, 0);
+
+
+               selector.on('scrollSpy:enter', function() {
+                       visible = $.grep(visible, function(value) {
+             return value.height() != 0;
+           });
+
+                       var $this = $(this);
+
+                       if (visible[0]) {
+                               $('a[href="#' + visible[0].attr('id') + '"]').removeClass('active');
+                               if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) {
+                                       visible.unshift($(this));
+                               }
+                               else {
+                                       visible.push($(this));
+                               }
+                       }
+                       else {
+                               visible.push($(this));
+                       }
+
+
+                       $('a[href="#' + visible[0].attr('id') + '"]').addClass('active');
+               });
+               selector.on('scrollSpy:exit', function() {
+                       visible = $.grep(visible, function(value) {
+             return value.height() != 0;
+           });
+
+                       if (visible[0]) {
+                               $('a[href="#' + visible[0].attr('id') + '"]').removeClass('active');
+                               var $this = $(this);
+                               visible = $.grep(visible, function(value) {
+               return value.attr('id') != $this.attr('id');
+             });
+             if (visible[0]) { // Check if empty
+                                       $('a[href="#' + visible[0].attr('id') + '"]').addClass('active');
+             }
+                       }
+               });
+
+               return selector;
+       };
+
+       /**
+        * Listen for window resize events
+        * @param {Object=} options                                             Optional. Set { throttle: number } to change throttling. Default: 100 ms
+        * @returns {jQuery}            $(window)
+        */
+       $.winSizeSpy = function(options) {
+               $.winSizeSpy = function() { return jWindow; }; // lock from multiple calls
+               options = options || {
+                       throttle: 100
+               };
+               return jWindow.on('resize', Materialize.throttle(onWinSize, options.throttle || 100));
+       };
+
+       /**
+        * Enables ScrollSpy on a collection of elements
+        * e.g. $('.scrollSpy').scrollSpy()
+        * @param {Object=} options     Optional.
+                                                                                       throttle : number -> scrollspy throttling. Default: 100 ms
+                                                                                       offsetTop : number -> offset from top. Default: 0
+                                                                                       offsetRight : number -> offset from right. Default: 0
+                                                                                       offsetBottom : number -> offset from bottom. Default: 0
+                                                                                       offsetLeft : number -> offset from left. Default: 0
+        * @returns {jQuery}
+        */
+       $.fn.scrollSpy = function(options) {
+               return $.scrollSpy($(this), options);
+       };
+
+})(jQuery);
+;(function ($) {
+  $(document).ready(function() {
+
+    // Function to update labels of text fields
+    Materialize.updateTextFields = function() {
+      var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
+      $(input_selector).each(function(index, element) {
+        var $this = $(this);
+        if ($(element).val().length > 0 || element.autofocus || $this.attr('placeholder') !== undefined) {
+          $this.siblings('label').addClass('active');
+        } else if ($(element)[0].validity) {
+          $this.siblings('label').toggleClass('active', $(element)[0].validity.badInput === true);
+        } else {
+          $this.siblings('label').removeClass('active');
+        }
+      });
+    };
+
+    // Text based inputs
+    var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
+
+    // Add active if form auto complete
+    $(document).on('change', input_selector, function () {
+      if($(this).val().length !== 0 || $(this).attr('placeholder') !== undefined) {
+        $(this).siblings('label').addClass('active');
+      }
+      validate_field($(this));
+    });
+
+    // Add active if input element has been pre-populated on document ready
+    $(document).ready(function() {
+      Materialize.updateTextFields();
+    });
+
+    // HTML DOM FORM RESET handling
+    $(document).on('reset', function(e) {
+      var formReset = $(e.target);
+      if (formReset.is('form')) {
+        formReset.find(input_selector).removeClass('valid').removeClass('invalid');
+        formReset.find(input_selector).each(function () {
+          if ($(this).attr('value') === '') {
+            $(this).siblings('label').removeClass('active');
+          }
+        });
+
+        // Reset select
+        formReset.find('select.initialized').each(function () {
+          var reset_text = formReset.find('option[selected]').text();
+          formReset.siblings('input.select-dropdown').val(reset_text);
+        });
+      }
+    });
+
+    // Add active when element has focus
+    $(document).on('focus', input_selector, function () {
+      $(this).siblings('label, .prefix').addClass('active');
+    });
+
+    $(document).on('blur', input_selector, function () {
+      var $inputElement = $(this);
+      var selector = ".prefix";
+
+      if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) {
+        selector += ", label";
+      }
+
+      $inputElement.siblings(selector).removeClass('active');
+
+      validate_field($inputElement);
+    });
+
+    window.validate_field = function(object) {
+      var hasLength = object.attr('data-length') !== undefined;
+      var lenAttr = parseInt(object.attr('data-length'));
+      var len = object.val().length;
+
+      if (object.val().length === 0 && object[0].validity.badInput === false) {
+        if (object.hasClass('validate')) {
+          object.removeClass('valid');
+          object.removeClass('invalid');
+        }
+      }
+      else {
+        if (object.hasClass('validate')) {
+          // Check for character counter attributes
+          if ((object.is(':valid') && hasLength && (len <= lenAttr)) || (object.is(':valid') && !hasLength)) {
+            object.removeClass('invalid');
+            object.addClass('valid');
+          }
+          else {
+            object.removeClass('valid');
+            object.addClass('invalid');
+          }
+        }
+      }
+    };
+
+    // Radio and Checkbox focus class
+    var radio_checkbox = 'input[type=radio], input[type=checkbox]';
+    $(document).on('keyup.radio', radio_checkbox, function(e) {
+      // TAB, check if tabbing to radio or checkbox.
+      if (e.which === 9) {
+        $(this).addClass('tabbed');
+        var $this = $(this);
+        $this.one('blur', function(e) {
+
+          $(this).removeClass('tabbed');
+        });
+        return;
+      }
+    });
+
+    // Textarea Auto Resize
+    var hiddenDiv = $('.hiddendiv').first();
+    if (!hiddenDiv.length) {
+      hiddenDiv = $('<div class="hiddendiv common"></div>');
+      $('body').append(hiddenDiv);
+    }
+    var text_area_selector = '.materialize-textarea';
+
+    function textareaAutoResize($textarea) {
+      // Set font properties of hiddenDiv
+
+      var fontFamily = $textarea.css('font-family');
+      var fontSize = $textarea.css('font-size');
+      var lineHeight = $textarea.css('line-height');
+
+      if (fontSize) { hiddenDiv.css('font-size', fontSize); }
+      if (fontFamily) { hiddenDiv.css('font-family', fontFamily); }
+      if (lineHeight) { hiddenDiv.css('line-height', lineHeight); }
+
+      if ($textarea.attr('wrap') === "off") {
+        hiddenDiv.css('overflow-wrap', "normal")
+                 .css('white-space', "pre");
+      }
+
+      hiddenDiv.text($textarea.val() + '\n');
+      var content = hiddenDiv.html().replace(/\n/g, '<br>');
+      hiddenDiv.html(content);
+
+
+      // When textarea is hidden, width goes crazy.
+      // Approximate with half of window size
+
+      if ($textarea.is(':visible')) {
+        hiddenDiv.css('width', $textarea.width());
+      }
+      else {
+        hiddenDiv.css('width', $(window).width()/2);
+      }
+
+      $textarea.css('height', hiddenDiv.height());
+    }
+
+    $(text_area_selector).each(function () {
+      var $textarea = $(this);
+      if ($textarea.val().length) {
+        textareaAutoResize($textarea);
+      }
+    });
+
+    $('body').on('keyup keydown autoresize', text_area_selector, function () {
+      textareaAutoResize($(this));
+    });
+
+    // File Input Path
+    $(document).on('change', '.file-field input[type="file"]', function () {
+      var file_field = $(this).closest('.file-field');
+      var path_input = file_field.find('input.file-path');
+      var files      = $(this)[0].files;
+      var file_names = [];
+      for (var i = 0; i < files.length; i++) {
+        file_names.push(files[i].name);
+      }
+      path_input.val(file_names.join(", "));
+      path_input.trigger('change');
+    });
+
+    /****************
+    *  Range Input  *
+    ****************/
+
+    var range_type = 'input[type=range]';
+    var range_mousedown = false;
+    var left;
+
+    $(range_type).each(function () {
+      var thumb = $('<span class="thumb"><span class="value"></span></span>');
+      $(this).after(thumb);
+    });
+
+    var range_wrapper = '.range-field';
+    $(document).on('change', range_type, function(e) {
+      var thumb = $(this).siblings('.thumb');
+      thumb.find('.value').html($(this).val());
+    });
+
+    $(document).on('input mousedown touchstart', range_type, function(e) {
+      var thumb = $(this).siblings('.thumb');
+      var width = $(this).outerWidth();
+
+      // If thumb indicator does not exist yet, create it
+      if (thumb.length <= 0) {
+        thumb = $('<span class="thumb"><span class="value"></span></span>');
+        $(this).after(thumb);
+      }
+
+      // Set indicator value
+      thumb.find('.value').html($(this).val());
+
+      range_mousedown = true;
+      $(this).addClass('active');
+
+      if (!thumb.hasClass('active')) {
+        thumb.velocity({ height: "30px", width: "30px", top: "-20px", marginLeft: "-15px"}, { duration: 300, easing: 'easeOutExpo' });
+      }
+
+      if (e.type !== 'input') {
+        if(e.pageX === undefined || e.pageX === null){//mobile
+           left = e.originalEvent.touches[0].pageX - $(this).offset().left;
+        }
+        else{ // desktop
+           left = e.pageX - $(this).offset().left;
+        }
+        if (left < 0) {
+          left = 0;
+        }
+        else if (left > width) {
+          left = width;
+        }
+        thumb.addClass('active').css('left', left);
+      }
+
+      thumb.find('.value').html($(this).val());
+    });
+
+    $(document).on('mouseup touchend', range_wrapper, function() {
+      range_mousedown = false;
+      $(this).removeClass('active');
+    });
+
+    $(document).on('mousemove touchmove', range_wrapper, function(e) {
+      var thumb = $(this).children('.thumb');
+      var left;
+      if (range_mousedown) {
+        if (!thumb.hasClass('active')) {
+          thumb.velocity({ height: '30px', width: '30px', top: '-20px', marginLeft: '-15px'}, { duration: 300, easing: 'easeOutExpo' });
+        }
+        if (e.pageX === undefined || e.pageX === null) { //mobile
+          left = e.originalEvent.touches[0].pageX - $(this).offset().left;
+        }
+        else{ // desktop
+          left = e.pageX - $(this).offset().left;
+        }
+        var width = $(this).outerWidth();
+
+        if (left < 0) {
+          left = 0;
+        }
+        else if (left > width) {
+          left = width;
+        }
+        thumb.addClass('active').css('left', left);
+        thumb.find('.value').html(thumb.siblings(range_type).val());
+      }
+    });
+
+    $(document).on('mouseout touchleave', range_wrapper, function() {
+      if (!range_mousedown) {
+
+        var thumb = $(this).children('.thumb');
+
+        if (thumb.hasClass('active')) {
+          thumb.velocity({ height: '0', width: '0', top: '10px', marginLeft: '-6px'}, { duration: 100 });
+        }
+        thumb.removeClass('active');
+      }
+    });
+
+    /**************************
+     * Auto complete plugin  *
+     *************************/
+    $.fn.autocomplete = function (options) {
+      // Defaults
+      var defaults = {
+        data: {},
+        limit: Infinity,
+        onAutocomplete: null
+      };
+
+      options = $.extend(defaults, options);
+
+      return this.each(function() {
+        var $input = $(this);
+        var data = options.data,
+            count = 0,
+            activeIndex = 0,
+            oldVal,
+            $inputDiv = $input.closest('.input-field'); // Div to append on
+
+        // Check if data isn't empty
+        if (!$.isEmptyObject(data)) {
+          var $autocomplete = $('<ul class="autocomplete-content dropdown-content"></ul>');
+          var $oldAutocomplete;
+
+          // Append autocomplete element.
+          // Prevent double structure init.
+          if ($inputDiv.length) {
+            $oldAutocomplete = $inputDiv.children('.autocomplete-content.dropdown-content').first();
+            if (!$oldAutocomplete.length) {
+              $inputDiv.append($autocomplete); // Set ul in body
+            }
+          } else {
+            $oldAutocomplete = $input.next('.autocomplete-content.dropdown-content');
+            if (!$oldAutocomplete.length) {
+              $input.after($autocomplete);
+            }
+          }
+          if ($oldAutocomplete.length) {
+            $autocomplete = $oldAutocomplete;
+          }
+
+          // Highlight partial match.
+          var highlight = function(string, $el) {
+            var img = $el.find('img');
+            var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""),
+                matchEnd = matchStart + string.length - 1,
+                beforeMatch = $el.text().slice(0, matchStart),
+                matchText = $el.text().slice(matchStart, matchEnd + 1),
+                afterMatch = $el.text().slice(matchEnd + 1);
+            $el.html("<span>" + beforeMatch + "<span class='highlight'>" + matchText + "</span>" + afterMatch + "</span>");
+            if (img.length) {
+              $el.prepend(img);
+            }
+          };
+
+          // Reset current element position
+          var resetCurrentElement = function() {
+            activeIndex = 0;
+            $autocomplete.find('.active').removeClass('active');
+          }
+
+          // Perform search
+          $input.off('keyup.autocomplete').on('keyup.autocomplete', function (e) {
+            // Reset count.
+            count = 0;
+
+            // Don't capture enter or arrow key usage.
+            if (e.which === 13 ||
+                e.which === 38 ||
+                e.which === 40) {
+              return;
+            }
+
+            var val = $input.val().toLowerCase();
+
+            // Check if the input isn't empty
+            if (oldVal !== val) {
+              $autocomplete.empty();
+              resetCurrentElement();
+
+              if (val !== '') {
+                for(var key in data) {
+                  if (data.hasOwnProperty(key) &&
+                      key.toLowerCase().indexOf(val) !== -1 &&
+                      key.toLowerCase() !== val) {
+                    // Break if past limit
+                    if (count >= options.limit) {
+                      break;
+                    }
+
+                    var autocompleteOption = $('<li></li>');
+                    if (!!data[key]) {
+                      autocompleteOption.append('<img src="'+ data[key] +'" class="right circle"><span>'+ key +'</span>');
+                    } else {
+                      autocompleteOption.append('<span>'+ key +'</span>');
+                    }
+
+                    $autocomplete.append(autocompleteOption);
+                    highlight(val, autocompleteOption);
+                    count++;
+                  }
+                }
+              }
+            }
+
+            // Update oldVal
+            oldVal = val;
+          });
+
+          $input.off('keydown.autocomplete').on('keydown.autocomplete', function (e) {
+            // Arrow keys and enter key usage
+            var keyCode = e.which,
+                liElement,
+                numItems = $autocomplete.children('li').length,
+                $active = $autocomplete.children('.active').first();
+
+            // select element on Enter
+            if (keyCode === 13) {
+              liElement = $autocomplete.children('li').eq(activeIndex);
+              if (liElement.length) {
+                liElement.click();
+                e.preventDefault();
+              }
+              return;
+            }
+
+            // Capture up and down key
+            if ( keyCode === 38 || keyCode === 40 ) {
+              e.preventDefault();
+
+              if (keyCode === 38 &&
+                  activeIndex > 0) {
+                activeIndex--;
+              }
+
+              if (keyCode === 40 &&
+                  activeIndex < (numItems - 1) &&
+                  $active.length) {
+                activeIndex++;
+              }
+
+              $active.removeClass('active');
+              $autocomplete.children('li').eq(activeIndex).addClass('active');
+            }
+          });
+
+          // Set input value
+          $autocomplete.on('click', 'li', function () {
+            var text = $(this).text().trim();
+            $input.val(text);
+            $input.trigger('change');
+            $autocomplete.empty();
+            resetCurrentElement();
+
+            // Handle onAutocomplete callback.
+            if (typeof(options.onAutocomplete) === "function") {
+              options.onAutocomplete.call(this, text);
+            }
+          });
+        }
+      });
+    };
+
+  }); // End of $(document).ready
+
+  /*******************
+   *  Select Plugin  *
+   ******************/
+  $.fn.material_select = function (callback) {
+    $(this).each(function(){
+      var $select = $(this);
+
+      if ($select.hasClass('browser-default')) {
+        return; // Continue to next (return false breaks out of entire loop)
+      }
+
+      var multiple = $select.attr('multiple') ? true : false,
+          lastID = $select.data('select-id'); // Tear down structure if Select needs to be rebuilt
+
+      if (lastID) {
+        $select.parent().find('span.caret').remove();
+        $select.parent().find('input').remove();
+
+        $select.unwrap();
+        $('ul#select-options-'+lastID).remove();
+      }
+
+      // If destroying the select, remove the selelct-id and reset it to it's uninitialized state.
+      if(callback === 'destroy') {
+        $select.data('select-id', null).removeClass('initialized');
+        return;
+      }
+
+      var uniqueID = Materialize.guid();
+      $select.data('select-id', uniqueID);
+      var wrapper = $('<div class="select-wrapper"></div>');
+      wrapper.addClass($select.attr('class'));
+      var options = $('<ul id="select-options-' + uniqueID +'" class="dropdown-content select-dropdown ' + (multiple ? 'multiple-select-dropdown' : '') + '"></ul>'),
+          selectChildren = $select.children('option, optgroup'),
+          valuesSelected = [],
+          optionsHover = false;
+
+      var label = $select.find('option:selected').html() || $select.find('option:first').html() || "";
+
+      // Function that renders and appends the option taking into
+      // account type and possible image icon.
+      var appendOptionWithIcon = function(select, option, type) {
+        // Add disabled attr if disabled
+        var disabledClass = (option.is(':disabled')) ? 'disabled ' : '';
+        var optgroupClass = (type === 'optgroup-option') ? 'optgroup-option ' : '';
+
+        // add icons
+        var icon_url = option.data('icon');
+        var classes = option.attr('class');
+        if (!!icon_url) {
+          var classString = '';
+          if (!!classes) classString = ' class="' + classes + '"';
+
+          // Check for multiple type.
+          if (type === 'multiple') {
+            options.append($('<li class="' + disabledClass + '"><img alt="" src="' + icon_url + '"' + classString + '><span><input type="checkbox"' + disabledClass + '/><label></label>' + option.html() + '</span></li>'));
+          } else {
+            options.append($('<li class="' + disabledClass + optgroupClass + '"><img alt="" src="' + icon_url + '"' + classString + '><span>' + option.html() + '</span></li>'));
+          }
+          return true;
+        }
+
+        // Check for multiple type.
+        if (type === 'multiple') {
+          options.append($('<li class="' + disabledClass + '"><span><input type="checkbox"' + disabledClass + '/><label></label>' + option.html() + '</span></li>'));
+        } else {
+          options.append($('<li class="' + disabledClass + optgroupClass + '"><span>' + option.html() + '</span></li>'));
+        }
+      };
+
+      /* Create dropdown structure. */
+      if (selectChildren.length) {
+        selectChildren.each(function() {
+          if ($(this).is('option')) {
+            // Direct descendant option.
+            if (multiple) {
+              appendOptionWithIcon($select, $(this), 'multiple');
+
+            } else {
+              appendOptionWithIcon($select, $(this));
+            }
+          } else if ($(this).is('optgroup')) {
+            // Optgroup.
+            var selectOptions = $(this).children('option');
+            options.append($('<li class="optgroup"><span>' + $(this).attr('label') + '</span></li>'));
+
+            selectOptions.each(function() {
+              appendOptionWithIcon($select, $(this), 'optgroup-option');
+            });
+          }
+        });
+      }
+
+      options.find('li:not(.optgroup)').each(function (i) {
+        $(this).click(function (e) {
+          // Check if option element is disabled
+          if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) {
+            var selected = true;
+
+            if (multiple) {
+              $('input[type="checkbox"]', this).prop('checked', function(i, v) { return !v; });
+              selected = toggleEntryFromArray(valuesSelected, $(this).index(), $select);
+              $newSelect.trigger('focus');
+            } else {
+              options.find('li').removeClass('active');
+              $(this).toggleClass('active');
+              $newSelect.val($(this).text());
+            }
+
+            activateOption(options, $(this));
+            $select.find('option').eq(i).prop('selected', selected);
+            // Trigger onchange() event
+            $select.trigger('change');
+            if (typeof callback !== 'undefined') callback();
+          }
+
+          e.stopPropagation();
+        });
+      });
+
+      // Wrap Elements
+      $select.wrap(wrapper);
+      // Add Select Display Element
+      var dropdownIcon = $('<span class="caret">&#9660;</span>');
+      if ($select.is(':disabled'))
+        dropdownIcon.addClass('disabled');
+
+      // escape double quotes
+      var sanitizedLabelHtml = label.replace(/"/g, '&quot;');
+
+      var $newSelect = $('<input type="text" class="select-dropdown" readonly="true" ' + (($select.is(':disabled')) ? 'disabled' : '') + ' data-activates="select-options-' + uniqueID +'" value="'+ sanitizedLabelHtml +'"/>');
+      $select.before($newSelect);
+      $newSelect.before(dropdownIcon);
+
+      $newSelect.after(options);
+      // Check if section element is disabled
+      if (!$select.is(':disabled')) {
+        $newSelect.dropdown({'hover': false, 'closeOnClick': false});
+      }
+
+      // Copy tabindex
+      if ($select.attr('tabindex')) {
+        $($newSelect[0]).attr('tabindex', $select.attr('tabindex'));
+      }
+
+      $select.addClass('initialized');
+
+      $newSelect.on({
+        'focus': function (){
+          if ($('ul.select-dropdown').not(options[0]).is(':visible')) {
+            $('input.select-dropdown').trigger('close');
+          }
+          if (!options.is(':visible')) {
+            $(this).trigger('open', ['focus']);
+            var label = $(this).val();
+            if (multiple && label.indexOf(',') >= 0) {
+              label = label.split(',')[0];
+            }
+
+            var selectedOption = options.find('li').filter(function() {
+              return $(this).text().toLowerCase() === label.toLowerCase();
+            })[0];
+            activateOption(options, selectedOption, true);
+          }
+        },
+        'click': function (e){
+          e.stopPropagation();
+        }
+      });
+
+      $newSelect.on('blur', function() {
+        if (!multiple) {
+          $(this).trigger('close');
+        }
+        options.find('li.selected').removeClass('selected');
+      });
+
+      options.hover(function() {
+        optionsHover = true;
+      }, function () {
+        optionsHover = false;
+      });
+
+      $(window).on({
+        'click': function () {
+          multiple && (optionsHover || $newSelect.trigger('close'));
+        }
+      });
+
+      // Add initial multiple selections.
+      if (multiple) {
+        $select.find("option:selected:not(:disabled)").each(function () {
+          var index = $(this).index();
+
+          toggleEntryFromArray(valuesSelected, index, $select);
+          options.find("li").eq(index).find(":checkbox").prop("checked", true);
+        });
+      }
+
+      /**
+       * Make option as selected and scroll to selected position
+       * @param {jQuery} collection  Select options jQuery element
+       * @param {Element} newOption  element of the new option
+       * @param {Boolean} firstActivation  If on first activation of select
+       */
+      var activateOption = function(collection, newOption, firstActivation) {
+        if (newOption) {
+          collection.find('li.selected').removeClass('selected');
+          var option = $(newOption);
+          option.addClass('selected');
+          if (!multiple || !!firstActivation) {
+            options.scrollTo(option);
+          }
+        }
+      };
+
+      // Allow user to search by typing
+      // this array is cleared after 1 second
+      var filterQuery = [],
+          onKeyDown = function(e){
+            // TAB - switch to another input
+            if(e.which == 9){
+              $newSelect.trigger('close');
+              return;
+            }
+
+            // ARROW DOWN WHEN SELECT IS CLOSED - open select options
+            if(e.which == 40 && !options.is(':visible')){
+              $newSelect.trigger('open');
+              return;
+            }
+
+            // ENTER WHEN SELECT IS CLOSED - submit form
+            if(e.which == 13 && !options.is(':visible')){
+              return;
+            }
+
+            e.preventDefault();
+
+            // CASE WHEN USER TYPE LETTERS
+            var letter = String.fromCharCode(e.which).toLowerCase(),
+                nonLetters = [9,13,27,38,40];
+            if (letter && (nonLetters.indexOf(e.which) === -1)) {
+              filterQuery.push(letter);
+
+              var string = filterQuery.join(''),
+                  newOption = options.find('li').filter(function() {
+                    return $(this).text().toLowerCase().indexOf(string) === 0;
+                  })[0];
+
+              if (newOption) {
+                activateOption(options, newOption);
+              }
+            }
+
+            // ENTER - select option and close when select options are opened
+            if (e.which == 13) {
+              var activeOption = options.find('li.selected:not(.disabled)')[0];
+              if(activeOption){
+                $(activeOption).trigger('click');
+                if (!multiple) {
+                  $newSelect.trigger('close');
+                }
+              }
+            }
+
+            // ARROW DOWN - move to next not disabled option
+            if (e.which == 40) {
+              if (options.find('li.selected').length) {
+                newOption = options.find('li.selected').next('li:not(.disabled)')[0];
+              } else {
+                newOption = options.find('li:not(.disabled)')[0];
+              }
+              activateOption(options, newOption);
+            }
+
+            // ESC - close options
+            if (e.which == 27) {
+              $newSelect.trigger('close');
+            }
+
+            // ARROW UP - move to previous not disabled option
+            if (e.which == 38) {
+              newOption = options.find('li.selected').prev('li:not(.disabled)')[0];
+              if(newOption)
+                activateOption(options, newOption);
+            }
+
+            // Automaticaly clean filter query so user can search again by starting letters
+            setTimeout(function(){ filterQuery = []; }, 1000);
+          };
+
+      $newSelect.on('keydown', onKeyDown);
+    });
+
+    function toggleEntryFromArray(entriesArray, entryIndex, select) {
+      var index = entriesArray.indexOf(entryIndex),
+          notAdded = index === -1;
+
+      if (notAdded) {
+        entriesArray.push(entryIndex);
+      } else {
+        entriesArray.splice(index, 1);
+      }
+
+      select.siblings('ul.dropdown-content').find('li').eq(entryIndex).toggleClass('active');
+
+      // use notAdded instead of true (to detect if the option is selected or not)
+      select.find('option').eq(entryIndex).prop('selected', notAdded);
+      setValueToInput(entriesArray, select);
+
+      return notAdded;
+    }
+
+    function setValueToInput(entriesArray, select) {
+      var value = '';
+
+      for (var i = 0, count = entriesArray.length; i < count; i++) {
+        var text = select.find('option').eq(entriesArray[i]).text();
+
+        i === 0 ? value += text : value += ', ' + text;
+      }
+
+      if (value === '') {
+        value = select.find('option:disabled').eq(0).text();
+      }
+
+      select.siblings('input.select-dropdown').val(value);
+    }
+  };
+
+}( jQuery ));
+;(function ($) {
+
+  var methods = {
+
+    init : function(options) {
+      var defaults = {
+        indicators: true,
+        height: 400,
+        transition: 500,
+        interval: 6000
+      };
+      options = $.extend(defaults, options);
+
+      return this.each(function() {
+
+        // For each slider, we want to keep track of
+        // which slide is active and its associated content
+        var $this = $(this);
+        var $slider = $this.find('ul.slides').first();
+        var $slides = $slider.find('> li');
+        var $active_index = $slider.find('.active').index();
+        var $active, $indicators, $interval;
+        if ($active_index != -1) { $active = $slides.eq($active_index); }
+
+        // Transitions the caption depending on alignment
+        function captionTransition(caption, duration) {
+          if (caption.hasClass("center-align")) {
+            caption.velocity({opacity: 0, translateY: -100}, {duration: duration, queue: false});
+          }
+          else if (caption.hasClass("right-align")) {
+            caption.velocity({opacity: 0, translateX: 100}, {duration: duration, queue: false});
+          }
+          else if (caption.hasClass("left-align")) {
+            caption.velocity({opacity: 0, translateX: -100}, {duration: duration, queue: false});
+          }
+        }
+
+        // This function will transition the slide to any index of the next slide
+        function moveToSlide(index) {
+          // Wrap around indices.
+          if (index >= $slides.length) index = 0;
+          else if (index < 0) index = $slides.length -1;
+
+          $active_index = $slider.find('.active').index();
+
+          // Only do if index changes
+          if ($active_index != index) {
+            $active = $slides.eq($active_index);
+            $caption = $active.find('.caption');
+
+            $active.removeClass('active');
+            $active.velocity({opacity: 0}, {duration: options.transition, queue: false, easing: 'easeOutQuad',
+                              complete: function() {
+                                $slides.not('.active').velocity({opacity: 0, translateX: 0, translateY: 0}, {duration: 0, queue: false});
+                              } });
+            captionTransition($caption, options.transition);
+
+
+            // Update indicators
+            if (options.indicators) {
+              $indicators.eq($active_index).removeClass('active');
+            }
+
+            $slides.eq(index).velocity({opacity: 1}, {duration: options.transition, queue: false, easing: 'easeOutQuad'});
+            $slides.eq(index).find('.caption').velocity({opacity: 1, translateX: 0, translateY: 0}, {duration: options.transition, delay: options.transition, queue: false, easing: 'easeOutQuad'});
+            $slides.eq(index).addClass('active');
+
+
+            // Update indicators
+            if (options.indicators) {
+              $indicators.eq(index).addClass('active');
+            }
+          }
+        }
+
+        // Set height of slider
+        // If fullscreen, do nothing
+        if (!$this.hasClass('fullscreen')) {
+          if (options.indicators) {
+            // Add height if indicators are present
+            $this.height(options.height + 40);
+          }
+          else {
+            $this.height(options.height);
+          }
+          $slider.height(options.height);
+        }
+
+
+        // Set initial positions of captions
+        $slides.find('.caption').each(function () {
+          captionTransition($(this), 0);
+        });
+
+        // Move img src into background-image
+        $slides.find('img').each(function () {
+          var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==';
+          if ($(this).attr('src') !== placeholderBase64) {
+            $(this).css('background-image', 'url(' + $(this).attr('src') + ')' );
+            $(this).attr('src', placeholderBase64);
+          }
+        });
+
+        // dynamically add indicators
+        if (options.indicators) {
+          $indicators = $('<ul class="indicators"></ul>');
+          $slides.each(function( index ) {
+            var $indicator = $('<li class="indicator-item"></li>');
+
+            // Handle clicks on indicators
+            $indicator.click(function () {
+              var $parent = $slider.parent();
+              var curr_index = $parent.find($(this)).index();
+              moveToSlide(curr_index);
+
+              // reset interval
+              clearInterval($interval);
+              $interval = setInterval(
+                function(){
+                  $active_index = $slider.find('.active').index();
+                  if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
+                  else $active_index += 1;
+
+                  moveToSlide($active_index);
+
+                }, options.transition + options.interval
+              );
+            });
+            $indicators.append($indicator);
+          });
+          $this.append($indicators);
+          $indicators = $this.find('ul.indicators').find('li.indicator-item');
+        }
+
+        if ($active) {
+          $active.show();
+        }
+        else {
+          $slides.first().addClass('active').velocity({opacity: 1}, {duration: options.transition, queue: false, easing: 'easeOutQuad'});
+
+          $active_index = 0;
+          $active = $slides.eq($active_index);
+
+          // Update indicators
+          if (options.indicators) {
+            $indicators.eq($active_index).addClass('active');
+          }
+        }
+
+        // Adjust height to current slide
+        $active.find('img').each(function() {
+          $active.find('.caption').velocity({opacity: 1, translateX: 0, translateY: 0}, {duration: options.transition, queue: false, easing: 'easeOutQuad'});
+        });
+
+        // auto scroll
+        $interval = setInterval(
+          function(){
+            $active_index = $slider.find('.active').index();
+            moveToSlide($active_index + 1);
+
+          }, options.transition + options.interval
+        );
+
+
+        // HammerJS, Swipe navigation
+
+        // Touch Event
+        var panning = false;
+        var swipeLeft = false;
+        var swipeRight = false;
+
+        $this.hammer({
+            prevent_default: false
+        }).bind('pan', function(e) {
+          if (e.gesture.pointerType === "touch") {
+
+            // reset interval
+            clearInterval($interval);
+
+            var direction = e.gesture.direction;
+            var x = e.gesture.deltaX;
+            var velocityX = e.gesture.velocityX;
+            var velocityY = e.gesture.velocityY;
+
+            $curr_slide = $slider.find('.active');
+            if (Math.abs(velocityX) > Math.abs(velocityY)) {
+              $curr_slide.velocity({ translateX: x
+                  }, {duration: 50, queue: false, easing: 'easeOutQuad'});
+            }
+
+            // Swipe Left
+            if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.65)) {
+              swipeRight = true;
+            }
+            // Swipe Right
+            else if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.65)) {
+              swipeLeft = true;
+            }
+
+            // Make Slide Behind active slide visible
+            var next_slide;
+            if (swipeLeft) {
+              next_slide = $curr_slide.next();
+              if (next_slide.length === 0) {
+                next_slide = $slides.first();
+              }
+              next_slide.velocity({ opacity: 1
+                  }, {duration: 300, queue: false, easing: 'easeOutQuad'});
+            }
+            if (swipeRight) {
+              next_slide = $curr_slide.prev();
+              if (next_slide.length === 0) {
+                next_slide = $slides.last();
+              }
+              next_slide.velocity({ opacity: 1
+                  }, {duration: 300, queue: false, easing: 'easeOutQuad'});
+            }
+
+
+          }
+
+        }).bind('panend', function(e) {
+          if (e.gesture.pointerType === "touch") {
+
+            $curr_slide = $slider.find('.active');
+            panning = false;
+            curr_index = $slider.find('.active').index();
+
+            if (!swipeRight && !swipeLeft || $slides.length <=1) {
+              // Return to original spot
+              $curr_slide.velocity({ translateX: 0
+                  }, {duration: 300, queue: false, easing: 'easeOutQuad'});
+            }
+            else if (swipeLeft) {
+              moveToSlide(curr_index + 1);
+              $curr_slide.velocity({translateX: -1 * $this.innerWidth() }, {duration: 300, queue: false, easing: 'easeOutQuad',
+                                    complete: function() {
+                                      $curr_slide.velocity({opacity: 0, translateX: 0}, {duration: 0, queue: false});
+                                    } });
+            }
+            else if (swipeRight) {
+              moveToSlide(curr_index - 1);
+              $curr_slide.velocity({translateX: $this.innerWidth() }, {duration: 300, queue: false, easing: 'easeOutQuad',
+                                    complete: function() {
+                                      $curr_slide.velocity({opacity: 0, translateX: 0}, {duration: 0, queue: false});
+                                    } });
+            }
+            swipeLeft = false;
+            swipeRight = false;
+
+            // Restart interval
+            clearInterval($interval);
+            $interval = setInterval(
+              function(){
+                $active_index = $slider.find('.active').index();
+                if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
+                else $active_index += 1;
+
+                moveToSlide($active_index);
+
+              }, options.transition + options.interval
+            );
+          }
+        });
+
+        $this.on('sliderPause', function() {
+          clearInterval($interval);
+        });
+
+        $this.on('sliderStart', function() {
+          clearInterval($interval);
+          $interval = setInterval(
+            function(){
+              $active_index = $slider.find('.active').index();
+              if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
+              else $active_index += 1;
+
+              moveToSlide($active_index);
+
+            }, options.transition + options.interval
+          );
+        });
+
+        $this.on('sliderNext', function() {
+          $active_index = $slider.find('.active').index();
+          moveToSlide($active_index + 1);
+        });
+
+        $this.on('sliderPrev', function() {
+          $active_index = $slider.find('.active').index();
+          moveToSlide($active_index - 1);
+        });
+
+      });
+
+
+
+    },
+    pause : function() {
+      $(this).trigger('sliderPause');
+    },
+    start : function() {
+      $(this).trigger('sliderStart');
+    },
+    next : function() {
+      $(this).trigger('sliderNext');
+    },
+    prev : function() {
+      $(this).trigger('sliderPrev');
+    }
+  };
+
+
+  $.fn.slider = function(methodOrOptions) {
+    if ( methods[methodOrOptions] ) {
+      return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 ));
+    } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) {
+      // Default to "init"
+      return methods.init.apply( this, arguments );
+    } else {
+      $.error( 'Method ' +  methodOrOptions + ' does not exist on jQuery.tooltip' );
+    }
+  }; // Plugin end
+}( jQuery ));
+;(function ($) {
+  $(document).ready(function() {
+
+    $(document).on('click.card', '.card', function (e) {
+      if ($(this).find('> .card-reveal').length) {
+        if ($(e.target).is($('.card-reveal .card-title')) || $(e.target).is($('.card-reveal .card-title i'))) {
+          // Make Reveal animate down and display none
+          $(this).find('.card-reveal').velocity(
+            {translateY: 0}, {
+              duration: 225,
+              queue: false,
+              easing: 'easeInOutQuad',
+              complete: function() { $(this).css({ display: 'none'}); }
+            }
+          );
+        }
+        else if ($(e.target).is($('.card .activator')) ||
+                 $(e.target).is($('.card .activator i')) ) {
+          $(e.target).closest('.card').css('overflow', 'hidden');
+          $(this).find('.card-reveal').css({ display: 'block'}).velocity("stop", false).velocity({translateY: '-100%'}, {duration: 300, queue: false, easing: 'easeInOutQuad'});
+        }
+      }
+    });
+
+  });
+}( jQuery ));;(function ($) {
+  var materialChipsDefaults = {
+    data: [],
+    placeholder: '',
+    secondaryPlaceholder: '',
+    autocompleteData: {},
+    autocompleteLimit: Infinity,
+  };
+
+  $(document).ready(function() {
+    // Handle removal of static chips.
+    $(document).on('click', '.chip .close', function(e){
+      var $chips = $(this).closest('.chips');
+      if ($chips.attr('data-initialized')) {
+        return;
+      }
+      $(this).closest('.chip').remove();
+    });
+  });
+
+  $.fn.material_chip = function (options) {
+    var self = this;
+    this.$el = $(this);
+    this.$document = $(document);
+    this.SELS = {
+      CHIPS: '.chips',
+      CHIP: '.chip',
+      INPUT: 'input',
+      DELETE: '.material-icons',
+      SELECTED_CHIP: '.selected',
+    };
+
+    if ('data' === options) {
+      return this.$el.data('chips');
+    }
+
+    var curr_options = $.extend({}, materialChipsDefaults, options);
+    self.hasAutocomplete = !$.isEmptyObject(curr_options.autocompleteData);
+
+    // Initialize
+    this.init = function() {
+      var i = 0;
+      var chips;
+      self.$el.each(function(){
+        var $chips = $(this);
+        var chipId = Materialize.guid();
+        self.chipId = chipId;
+
+        if (!curr_options.data || !(curr_options.data instanceof Array)) {
+          curr_options.data = [];
+        }
+        $chips.data('chips', curr_options.data);
+        $chips.attr('data-index', i);
+        $chips.attr('data-initialized', true);
+
+        if (!$chips.hasClass(self.SELS.CHIPS)) {
+          $chips.addClass('chips');
+        }
+
+        self.chips($chips, chipId);
+        i++;
+      });
+    };
+
+    this.handleEvents = function() {
+      var SELS = self.SELS;
+
+      self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function(e){
+        $(e.target).find(SELS.INPUT).focus();
+      });
+
+      self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function(e){
+        var $chip = $(e.target);
+        if ($chip.length) {
+          var wasSelected = $chip.hasClass('selected');
+          var $chips = $chip.closest(SELS.CHIPS);
+          $(SELS.CHIP).removeClass('selected');
+
+          if (!wasSelected) {
+            self.selectChip($chip.index(), $chips);
+          }
+        }
+      });
+
+      self.$document.off('keydown.chips').on('keydown.chips', function(e){
+        if ($(e.target).is('input, textarea')) {
+          return;
+        }
+
+        // delete
+        var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP);
+        var $chips = $chip.closest(SELS.CHIPS);
+        var length = $chip.siblings(SELS.CHIP).length;
+        var index;
+
+        if (!$chip.length) {
+          return;
+        }
+
+        if (e.which === 8 || e.which === 46) {
+          e.preventDefault();
+
+          index = $chip.index();
+          self.deleteChip(index, $chips);
+
+          var selectIndex = null;
+          if ((index + 1) < length) {
+            selectIndex = index;
+          } else if (index === length || (index + 1) === length) {
+            selectIndex = length - 1;
+          }
+
+          if (selectIndex < 0) selectIndex = null;
+
+          if (null !== selectIndex) {
+            self.selectChip(selectIndex, $chips);
+          }
+          if (!length) $chips.find('input').focus();
+
+        // left
+        } else if (e.which === 37) {
+          index = $chip.index() - 1;
+          if (index < 0) {
+            return;
+          }
+          $(SELS.CHIP).removeClass('selected');
+          self.selectChip(index, $chips);
+
+        // right
+        } else if (e.which === 39) {
+          index = $chip.index() + 1;
+          $(SELS.CHIP).removeClass('selected');
+          if (index > length) {
+            $chips.find('input').focus();
+            return;
+          }
+          self.selectChip(index, $chips);
+        }
+      });
+
+      self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function(e){
+        var $currChips = $(e.target).closest(SELS.CHIPS);
+        $currChips.addClass('focus');
+        $currChips.siblings('label, .prefix').addClass('active');
+        $(SELS.CHIP).removeClass('selected');
+      });
+
+      self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function(e){
+        var $currChips = $(e.target).closest(SELS.CHIPS);
+        $currChips.removeClass('focus');
+
+        // Remove active if empty
+        if (!$currChips.data('chips').length) {
+          $currChips.siblings('label').removeClass('active');
+        }
+        $currChips.siblings('.prefix').removeClass('active');
+      });
+
+      self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function(e){
+        var $target = $(e.target);
+        var $chips = $target.closest(SELS.CHIPS);
+        var chipsLength = $chips.children(SELS.CHIP).length;
+
+        // enter
+        if (13 === e.which) {
+          // Override enter if autocompleting.
+          if (self.hasAutocomplete &&
+              $chips.find('.autocomplete-content.dropdown-content').length &&
+              $chips.find('.autocomplete-content.dropdown-content').children().length) {
+            return;
+          }
+
+          e.preventDefault();
+          self.addChip({tag: $target.val()}, $chips);
+          $target.val('');
+          return;
+        }
+
+        // delete or left
+        if ((8 === e.keyCode || 37 === e.keyCode) && '' === $target.val() && chipsLength) {
+          e.preventDefault();
+          self.selectChip(chipsLength - 1, $chips);
+          $target.blur();
+          return;
+        }
+      });
+
+      // Click on delete icon in chip.
+      self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function(e) {
+        var $target = $(e.target);
+        var $chips = $target.closest(SELS.CHIPS);
+        var $chip = $target.closest(SELS.CHIP);
+        e.stopPropagation();
+        self.deleteChip($chip.index(), $chips);
+        $chips.find('input').focus();
+      });
+    };
+
+    this.chips = function($chips, chipId) {
+      var html = '';
+      $chips.data('chips').forEach(function(elem){
+        html += self.renderChip(elem);
+      });
+      html += '<input id="' + chipId +'" class="input" placeholder="">';
+      $chips.html(html);
+      self.setPlaceholder($chips);
+
+      // Set for attribute for label
+      var label = $chips.next('label');
+      if (label.length) {
+        label.attr('for', chipId);
+
+        if ($chips.data('chips').length) {
+          label.addClass('active');
+        }
+      }
+
+      // Setup autocomplete if needed.
+      var input = $('#' + chipId);
+      if (self.hasAutocomplete) {
+        input.autocomplete({
+          data: curr_options.autocompleteData,
+          limit: curr_options.autocompleteLimit,
+          onAutocomplete: function(val) {
+            self.addChip({tag: val}, $chips);
+            input.val('');
+            input.focus();
+          },
+        })
+      }
+    };
+
+    this.renderChip = function(elem) {
+      if (!elem.tag) return;
+
+      var html = '<div class="chip">' + elem.tag;
+      if (elem.image) {
+        html += ' <img src="' + elem.image + '"> ';
+      }
+      html += '<i class="material-icons close">close</i>';
+      html += '</div>';
+      return html;
+    };
+
+    this.setPlaceholder = function($chips) {
+      if ($chips.data('chips').length && curr_options.placeholder) {
+        $chips.find('input').prop('placeholder', curr_options.placeholder);
+
+      } else if (!$chips.data('chips').length && curr_options.secondaryPlaceholder) {
+        $chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder);
+      }
+    };
+
+    this.isValid = function($chips, elem) {
+      var chips = $chips.data('chips');
+      var exists = false;
+      for (var i=0; i < chips.length; i++) {
+        if (chips[i].tag === elem.tag) {
+            exists = true;
+            return;
+        }
+      }
+      return '' !== elem.tag && !exists;
+    };
+
+    this.addChip = function(elem, $chips) {
+      if (!self.isValid($chips, elem)) {
+        return;
+      }
+      var chipHtml = self.renderChip(elem);
+      var newData = [];
+      var oldData = $chips.data('chips');
+      for (var i = 0; i < oldData.length; i++) {
+        newData.push(oldData[i]);
+      }
+      newData.push(elem);
+
+      $chips.data('chips', newData);
+      $(chipHtml).insertBefore($chips.find('input'));
+      $chips.trigger('chip.add', elem);
+      self.setPlaceholder($chips);
+    };
+
+    this.deleteChip = function(chipIndex, $chips) {
+      var chip = $chips.data('chips')[chipIndex];
+      $chips.find('.chip').eq(chipIndex).remove();
+
+      var newData = [];
+      var oldData = $chips.data('chips');
+      for (var i = 0; i < oldData.length; i++) {
+        if (i !== chipIndex) {
+          newData.push(oldData[i]);
+        }
+      }
+
+      $chips.data('chips', newData);
+      $chips.trigger('chip.delete', chip);
+      self.setPlaceholder($chips);
+    };
+
+    this.selectChip = function(chipIndex, $chips) {
+      var $chip = $chips.find('.chip').eq(chipIndex);
+      if ($chip && false === $chip.hasClass('selected')) {
+        $chip.addClass('selected');
+        $chips.trigger('chip.select', $chips.data('chips')[chipIndex]);
+      }
+    };
+
+    this.getChipsElement = function(index, $chips) {
+      return $chips.eq(index);
+    };
+
+    // init
+    this.init();
+
+    this.handleEvents();
+  };
+}( jQuery ));
+;(function ($) {
+  $.fn.pushpin = function (options) {
+    // Defaults
+    var defaults = {
+      top: 0,
+      bottom: Infinity,
+      offset: 0
+    };
+
+    // Remove pushpin event and classes
+    if (options === "remove") {
+      this.each(function () {
+        if (id = $(this).data('pushpin-id')) {
+          $(window).off('scroll.' + id);
+          $(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style');
+        }
+      });
+      return false;
+    }
+
+    options = $.extend(defaults, options);
+
+
+    $index = 0;
+    return this.each(function() {
+      var $uniqueId = Materialize.guid(),
+          $this = $(this),
+          $original_offset = $(this).offset().top;
+
+      function removePinClasses(object) {
+        object.removeClass('pin-top');
+        object.removeClass('pinned');
+        object.removeClass('pin-bottom');
+      }
+
+      function updateElements(objects, scrolled) {
+        objects.each(function () {
+          // Add position fixed (because its between top and bottom)
+          if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) {
+            removePinClasses($(this));
+            $(this).css('top', options.offset);
+            $(this).addClass('pinned');
+          }
+
+          // Add pin-top (when scrolled position is above top)
+          if (scrolled < options.top && !$(this).hasClass('pin-top')) {
+            removePinClasses($(this));
+            $(this).css('top', 0);
+            $(this).addClass('pin-top');
+          }
+
+          // Add pin-bottom (when scrolled position is below bottom)
+          if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) {
+            removePinClasses($(this));
+            $(this).addClass('pin-bottom');
+            $(this).css('top', options.bottom - $original_offset);
+          }
+        });
+      }
+
+      $(this).data('pushpin-id', $uniqueId);
+      updateElements($this, $(window).scrollTop());
+      $(window).on('scroll.' + $uniqueId, function () {
+        var $scrolled = $(window).scrollTop() + options.offset;
+        updateElements($this, $scrolled);
+      });
+
+    });
+
+  };
+}( jQuery ));;(function ($) {
+  $(document).ready(function() {
+
+    // jQuery reverse
+    $.fn.reverse = [].reverse;
+
+    // Hover behaviour: make sure this doesn't work on .click-to-toggle FABs!
+    $(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function(e) {
+      var $this = $(this);
+      openFABMenu($this);
+    });
+    $(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function(e) {
+      var $this = $(this);
+      closeFABMenu($this);
+    });
+
+    // Toggle-on-click behaviour.
+    $(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function(e) {
+      var $this = $(this);
+      var $menu = $this.parent();
+      if ($menu.hasClass('active')) {
+        closeFABMenu($menu);
+      } else {
+        openFABMenu($menu);
+      }
+    });
+
+    // Toolbar transition behaviour.
+    $(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function(e) {
+      var $this = $(this);
+      var $menu = $this.parent();
+      FABtoToolbar($menu);
+    });
+
+  });
+
+  $.fn.extend({
+    openFAB: function() {
+      openFABMenu($(this));
+    },
+    closeFAB: function() {
+      closeFABMenu($(this));
+    },
+    openToolbar: function() {
+      FABtoToolbar($(this));
+    },
+    closeToolbar: function() {
+      toolbarToFAB($(this));
+    }
+  });
+
+
+  var openFABMenu = function (btn) {
+    var $this = btn;
+    if ($this.hasClass('active') === false) {
+
+      // Get direction option
+      var horizontal = $this.hasClass('horizontal');
+      var offsetY, offsetX;
+
+      if (horizontal === true) {
+        offsetX = 40;
+      } else {
+        offsetY = 40;
+      }
+
+      $this.addClass('active');
+      $this.find('ul .btn-floating').velocity(
+        { scaleY: ".4", scaleX: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px'},
+        { duration: 0 });
+
+      var time = 0;
+      $this.find('ul .btn-floating').reverse().each( function () {
+        $(this).velocity(
+          { opacity: "1", scaleX: "1", scaleY: "1", translateY: "0", translateX: '0'},
+          { duration: 80, delay: time });
+        time += 40;
+      });
+    }
+  };
+
+  var closeFABMenu = function (btn) {
+    var $this = btn;
+    // Get direction option
+    var horizontal = $this.hasClass('horizontal');
+    var offsetY, offsetX;
+
+    if (horizontal === true) {
+      offsetX = 40;
+    } else {
+      offsetY = 40;
+    }
+
+    $this.removeClass('active');
+    var time = 0;
+    $this.find('ul .btn-floating').velocity("stop", true);
+    $this.find('ul .btn-floating').velocity(
+      { opacity: "0", scaleX: ".4", scaleY: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px'},
+      { duration: 80 }
+    );
+  };
+
+
+  /**
+   * Transform FAB into toolbar
+   * @param  {Object}  object jQuery object
+   */
+  var FABtoToolbar = function(btn) {
+    if (btn.attr('data-open') === "true") {
+      return;
+    }
+
+    var offsetX, offsetY, scaleFactor;
+    var windowWidth = window.innerWidth;
+    var windowHeight = window.innerHeight;
+    var btnRect = btn[0].getBoundingClientRect();
+    var anchor = btn.find('> a').first();
+    var menu = btn.find('> ul').first();
+    var backdrop = $('<div class="fab-backdrop"></div>');
+    var fabColor = anchor.css('background-color');
+    anchor.append(backdrop);
+
+    offsetX = btnRect.left - (windowWidth / 2) + (btnRect.width / 2);
+    offsetY = windowHeight - btnRect.bottom;
+    scaleFactor = windowWidth / backdrop.width();
+    btn.attr('data-origin-bottom', btnRect.bottom);
+    btn.attr('data-origin-left', btnRect.left);
+    btn.attr('data-origin-width', btnRect.width);
+
+    // Set initial state
+    btn.addClass('active');
+    btn.attr('data-open', true);
+    btn.css({
+      'text-align': 'center',
+      width: '100%',
+      bottom: 0,
+      left: 0,
+      transform: 'translateX(' + offsetX + 'px)',
+      transition: 'none'
+    });
+    anchor.css({
+      transform: 'translateY(' + -offsetY + 'px)',
+      transition: 'none'
+    });
+    backdrop.css({
+      'background-color': fabColor
+    });
+
+
+    setTimeout(function() {
+      btn.css({
+        transform: '',
+        transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s'
+      });
+      anchor.css({
+        overflow: 'visible',
+        transform: '',
+        transition: 'transform .2s'
+      });
+
+      setTimeout(function() {
+        btn.css({
+          overflow: 'hidden',
+          'background-color': fabColor
+        });
+        backdrop.css({
+          transform: 'scale(' + scaleFactor + ')',
+          transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
+        });
+        menu.find('> li > a').css({
+          opacity: 1
+        });
+
+        // Scroll to close.
+        $(window).on('scroll.fabToolbarClose', function() {
+          toolbarToFAB(btn);
+          $(window).off('scroll.fabToolbarClose');
+          $(document).off('click.fabToolbarClose');
+        });
+
+        $(document).on('click.fabToolbarClose', function(e) {
+          if (!$(e.target).closest(menu).length) {
+            toolbarToFAB(btn);
+            $(window).off('scroll.fabToolbarClose');
+            $(document).off('click.fabToolbarClose');
+          }
+        });
+      }, 100);
+    }, 0);
+  };
+
+  /**
+   * Transform toolbar back into FAB
+   * @param  {Object}  object jQuery object
+   */
+  var toolbarToFAB = function(btn) {
+    if (btn.attr('data-open') !== "true") {
+      return;
+    }
+
+    var offsetX, offsetY, scaleFactor;
+    var windowWidth = window.innerWidth;
+    var windowHeight = window.innerHeight;
+    var btnWidth = btn.attr('data-origin-width');
+    var btnBottom = btn.attr('data-origin-bottom');
+    var btnLeft = btn.attr('data-origin-left');
+    var anchor = btn.find('> .btn-floating').first();
+    var menu = btn.find('> ul').first();
+    var backdrop = btn.find('.fab-backdrop');
+    var fabColor = anchor.css('background-color');
+
+    offsetX = btnLeft - (windowWidth / 2) + (btnWidth / 2);
+    offsetY = windowHeight - btnBottom;
+    scaleFactor = windowWidth / backdrop.width();
+
+
+    // Hide backdrop
+    btn.removeClass('active');
+    btn.attr('data-open', false);
+    btn.css({
+      'background-color': 'transparent',
+      transition: 'none'
+    });
+    anchor.css({
+      transition: 'none'
+    });
+    backdrop.css({
+      transform: 'scale(0)',
+      'background-color': fabColor
+    });
+    menu.find('> li > a').css({
+      opacity: ''
+    });
+
+    setTimeout(function() {
+      backdrop.remove();
+
+      // Set initial state.
+      btn.css({
+        'text-align': '',
+        width: '',
+        bottom: '',
+        left: '',
+        overflow: '',
+        'background-color': '',
+        transform: 'translate3d(' + -offsetX + 'px,0,0)'
+      });
+      anchor.css({
+        overflow: '',
+        transform: 'translate3d(0,' + offsetY + 'px,0)'
+      });
+
+      setTimeout(function() {
+        btn.css({
+          transform: 'translate3d(0,0,0)',
+          transition: 'transform .2s'
+        });
+        anchor.css({
+          transform: 'translate3d(0,0,0)',
+          transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
+        });
+      }, 20);
+    }, 200);
+  };
+
+
+}( jQuery ));
+;(function ($) {
+  // Image transition function
+  Materialize.fadeInImage = function(selectorOrEl) {
+    var element;
+    if (typeof(selectorOrEl) === 'string') {
+      element = $(selectorOrEl);
+    } else if (typeof(selectorOrEl) === 'object') {
+      element = selectorOrEl;
+    } else {
+      return;
+    }
+    element.css({opacity: 0});
+    $(element).velocity({opacity: 1}, {
+      duration: 650,
+      queue: false,
+      easing: 'easeOutSine'
+    });
+    $(element).velocity({opacity: 1}, {
+      duration: 1300,
+      queue: false,
+      easing: 'swing',
+      step: function(now, fx) {
+        fx.start = 100;
+        var grayscale_setting = now/100;
+        var brightness_setting = 150 - (100 - now)/1.75;
+
+        if (brightness_setting < 100) {
+          brightness_setting = 100;
+        }
+        if (now >= 0) {
+          $(this).css({
+              "-webkit-filter": "grayscale("+grayscale_setting+")" + "brightness("+brightness_setting+"%)",
+              "filter": "grayscale("+grayscale_setting+")" + "brightness("+brightness_setting+"%)"
+          });
+        }
+      }
+    });
+  };
+
+  // Horizontal staggered list
+  Materialize.showStaggeredList = function(selectorOrEl) {
+    var element;
+    if (typeof(selectorOrEl) === 'string') {
+      element = $(selectorOrEl);
+    } else if (typeof(selectorOrEl) === 'object') {
+      element = selectorOrEl;
+    } else {
+      return;
+    }
+    var time = 0;
+    element.find('li').velocity(
+        { translateX: "-100px"},
+        { duration: 0 });
+
+    element.find('li').each(function() {
+      $(this).velocity(
+        { opacity: "1", translateX: "0"},
+        { duration: 800, delay: time, easing: [60, 10] });
+      time += 120;
+    });
+  };
+
+
+  $(document).ready(function() {
+    // Hardcoded .staggered-list scrollFire
+    // var staggeredListOptions = [];
+    // $('ul.staggered-list').each(function (i) {
+
+    //   var label = 'scrollFire-' + i;
+    //   $(this).addClass(label);
+    //   staggeredListOptions.push(
+    //     {selector: 'ul.staggered-list.' + label,
+    //      offset: 200,
+    //      callback: 'showStaggeredList("ul.staggered-list.' + label + '")'});
+    // });
+    // scrollFire(staggeredListOptions);
+
+    // HammerJS, Swipe navigation
+
+    // Touch Event
+    var swipeLeft = false;
+    var swipeRight = false;
+
+
+    // Dismissible Collections
+    $('.dismissable').each(function() {
+      $(this).hammer({
+        prevent_default: false
+      }).bind('pan', function(e) {
+        if (e.gesture.pointerType === "touch") {
+          var $this = $(this);
+          var direction = e.gesture.direction;
+          var x = e.gesture.deltaX;
+          var velocityX = e.gesture.velocityX;
+
+          $this.velocity({ translateX: x
+              }, {duration: 50, queue: false, easing: 'easeOutQuad'});
+
+          // Swipe Left
+          if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.75)) {
+            swipeLeft = true;
+          }
+
+          // Swipe Right
+          if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.75)) {
+            swipeRight = true;
+          }
+        }
+      }).bind('panend', function(e) {
+        // Reset if collection is moved back into original position
+        if (Math.abs(e.gesture.deltaX) < ($(this).innerWidth() / 2)) {
+          swipeRight = false;
+          swipeLeft = false;
+        }
+
+        if (e.gesture.pointerType === "touch") {
+          var $this = $(this);
+          if (swipeLeft || swipeRight) {
+            var fullWidth;
+            if (swipeLeft) { fullWidth = $this.innerWidth(); }
+            else { fullWidth = -1 * $this.innerWidth(); }
+
+            $this.velocity({ translateX: fullWidth,
+              }, {duration: 100, queue: false, easing: 'easeOutQuad', complete:
+              function() {
+                $this.css('border', 'none');
+                $this.velocity({ height: 0, padding: 0,
+                  }, {duration: 200, queue: false, easing: 'easeOutQuad', complete:
+                    function() { $this.remove(); }
+                  });
+              }
+            });
+          }
+          else {
+            $this.velocity({ translateX: 0,
+              }, {duration: 100, queue: false, easing: 'easeOutQuad'});
+          }
+          swipeLeft = false;
+          swipeRight = false;
+        }
+      });
+
+    });
+
+
+    // time = 0
+    // // Vertical Staggered list
+    // $('ul.staggered-list.vertical li').velocity(
+    //     { translateY: "100px"},
+    //     { duration: 0 });
+
+    // $('ul.staggered-list.vertical li').each(function() {
+    //   $(this).velocity(
+    //     { opacity: "1", translateY: "0"},
+    //     { duration: 800, delay: time, easing: [60, 25] });
+    //   time += 120;
+    // });
+
+    // // Fade in and Scale
+    // $('.fade-in.scale').velocity(
+    //     { scaleX: .4, scaleY: .4, translateX: -600},
+    //     { duration: 0});
+    // $('.fade-in').each(function() {
+    //   $(this).velocity(
+    //     { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0},
+    //     { duration: 800, easing: [60, 10] });
+    // });
+  });
+}( jQuery ));
+;(function($) {
+
+  var scrollFireEventsHandled = false;
+
+  // Input: Array of JSON objects {selector, offset, callback}
+  Materialize.scrollFire = function(options) {
+    var onScroll = function() {
+      var windowScroll = window.pageYOffset + window.innerHeight;
+
+      for (var i = 0 ; i < options.length; i++) {
+        // Get options from each line
+        var value = options[i];
+        var selector = value.selector,
+            offset = value.offset,
+            callback = value.callback;
+
+        var currentElement = document.querySelector(selector);
+        if ( currentElement !== null) {
+          var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset;
+
+          if (windowScroll > (elementOffset + offset)) {
+            if (value.done !== true) {
+              if (typeof(callback) === 'function') {
+                callback.call(this, currentElement);
+              } else if (typeof(callback) === 'string') {
+                var callbackFunc = new Function(callback);
+                callbackFunc(currentElement);
+              }
+              value.done = true;
+            }
+          }
+        }
+      }
+    };
+
+
+    var throttledScroll = Materialize.throttle(function() {
+      onScroll();
+    }, options.throttle || 100);
+
+    if (!scrollFireEventsHandled) {
+      window.addEventListener("scroll", throttledScroll);
+      window.addEventListener("resize", throttledScroll);
+      scrollFireEventsHandled = true;
+    }
+
+    // perform a scan once, after current execution context, and after dom is ready
+    setTimeout(throttledScroll, 0);
+  };
+
+})(jQuery);
+;/*!
+ * pickadate.js v3.5.0, 2014/04/13
+ * By Amsul, http://amsul.ca
+ * Hosted on http://amsul.github.io/pickadate.js
+ * Licensed under MIT
+ */
+
+(function ( factory ) {
+
+    // AMD.
+    if ( typeof define == 'function' && define.amd )
+        define( 'picker', ['jquery'], factory )
+
+    // Node.js/browserify.
+    else if ( typeof exports == 'object' )
+        module.exports = factory( require('jquery') )
+
+    // Browser globals.
+    else this.Picker = factory( jQuery )
+
+}(function( $ ) {
+
+var $window = $( window )
+var $document = $( document )
+var $html = $( document.documentElement )
+
+
+/**
+ * The picker constructor that creates a blank picker.
+ */
+function PickerConstructor( ELEMENT, NAME, COMPONENT, OPTIONS ) {
+
+    // If there’s no element, return the picker constructor.
+    if ( !ELEMENT ) return PickerConstructor
+
+
+    var
+        IS_DEFAULT_THEME = false,
+
+
+        // The state of the picker.
+        STATE = {
+            id: ELEMENT.id || 'P' + Math.abs( ~~(Math.random() * new Date()) )
+        },
+
+
+        // Merge the defaults and options passed.
+        SETTINGS = COMPONENT ? $.extend( true, {}, COMPONENT.defaults, OPTIONS ) : OPTIONS || {},
+
+
+        // Merge the default classes with the settings classes.
+        CLASSES = $.extend( {}, PickerConstructor.klasses(), SETTINGS.klass ),
+
+
+        // The element node wrapper into a jQuery object.
+        $ELEMENT = $( ELEMENT ),
+
+
+        // Pseudo picker constructor.
+        PickerInstance = function() {
+            return this.start()
+        },
+
+
+        // The picker prototype.
+        P = PickerInstance.prototype = {
+
+            constructor: PickerInstance,
+
+            $node: $ELEMENT,
+
+
+            /**
+             * Initialize everything
+             */
+            start: function() {
+
+                // If it’s already started, do nothing.
+                if ( STATE && STATE.start ) return P
+
+
+                // Update the picker states.
+                STATE.methods = {}
+                STATE.start = true
+                STATE.open = false
+                STATE.type = ELEMENT.type
+
+
+                // Confirm focus state, convert into text input to remove UA stylings,
+                // and set as readonly to prevent keyboard popup.
+                ELEMENT.autofocus = ELEMENT == getActiveElement()
+                ELEMENT.readOnly = !SETTINGS.editable
+                ELEMENT.id = ELEMENT.id || STATE.id
+                if ( ELEMENT.type != 'text' ) {
+                    ELEMENT.type = 'text'
+                }
+
+
+                // Create a new picker component with the settings.
+                P.component = new COMPONENT(P, SETTINGS)
+
+
+                // Create the picker root with a holder and then prepare it.
+                P.$root = $( PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"') )
+                prepareElementRoot()
+
+
+                // If there’s a format for the hidden input element, create the element.
+                if ( SETTINGS.formatSubmit ) {
+                    prepareElementHidden()
+                }
+
+
+                // Prepare the input element.
+                prepareElement()
+
+
+                // Insert the root as specified in the settings.
+                if ( SETTINGS.container ) $( SETTINGS.container ).append( P.$root )
+                else $ELEMENT.after( P.$root )
+
+
+                // Bind the default component and settings events.
+                P.on({
+                    start: P.component.onStart,
+                    render: P.component.onRender,
+                    stop: P.component.onStop,
+                    open: P.component.onOpen,
+                    close: P.component.onClose,
+                    set: P.component.onSet
+                }).on({
+                    start: SETTINGS.onStart,
+                    render: SETTINGS.onRender,
+                    stop: SETTINGS.onStop,
+                    open: SETTINGS.onOpen,
+                    close: SETTINGS.onClose,
+                    set: SETTINGS.onSet
+                })
+
+
+                // Once we’re all set, check the theme in use.
+                IS_DEFAULT_THEME = isUsingDefaultTheme( P.$root.children()[ 0 ] )
+
+
+                // If the element has autofocus, open the picker.
+                if ( ELEMENT.autofocus ) {
+                    P.open()
+                }
+
+
+                // Trigger queued the “start” and “render” events.
+                return P.trigger( 'start' ).trigger( 'render' )
+            }, //start
+
+
+            /**
+             * Render a new picker
+             */
+            render: function( entireComponent ) {
+
+                // Insert a new component holder in the root or box.
+                if ( entireComponent ) P.$root.html( createWrappedComponent() )
+                else P.$root.find( '.' + CLASSES.box ).html( P.component.nodes( STATE.open ) )
+
+                // Trigger the queued “render” events.
+                return P.trigger( 'render' )
+            }, //render
+
+
+            /**
+             * Destroy everything
+             */
+            stop: function() {
+
+                // If it’s already stopped, do nothing.
+                if ( !STATE.start ) return P
+
+                // Then close the picker.
+                P.close()
+
+                // Remove the hidden field.
+                if ( P._hidden ) {
+                    P._hidden.parentNode.removeChild( P._hidden )
+                }
+
+                // Remove the root.
+                P.$root.remove()
+
+                // Remove the input class, remove the stored data, and unbind
+                // the events (after a tick for IE - see `P.close`).
+                $ELEMENT.removeClass( CLASSES.input ).removeData( NAME )
+                setTimeout( function() {
+                    $ELEMENT.off( '.' + STATE.id )
+                }, 0)
+
+                // Restore the element state
+                ELEMENT.type = STATE.type
+                ELEMENT.readOnly = false
+
+                // Trigger the queued “stop” events.
+                P.trigger( 'stop' )
+
+                // Reset the picker states.
+                STATE.methods = {}
+                STATE.start = false
+
+                return P
+            }, //stop
+
+
+            /**
+             * Open up the picker
+             */
+            open: function( dontGiveFocus ) {
+
+                // If it’s already open, do nothing.
+                if ( STATE.open ) return P
+
+                // Add the “active” class.
+                $ELEMENT.addClass( CLASSES.active )
+                aria( ELEMENT, 'expanded', true )
+
+                // * A Firefox bug, when `html` has `overflow:hidden`, results in
+                //   killing transitions :(. So add the “opened” state on the next tick.
+                //   Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
+                setTimeout( function() {
+
+                    // Add the “opened” class to the picker root.
+                    P.$root.addClass( CLASSES.opened )
+                    aria( P.$root[0], 'hidden', false )
+
+                }, 0 )
+
+                // If we have to give focus, bind the element and doc events.
+                if ( dontGiveFocus !== false ) {
+
+                    // Set it as open.
+                    STATE.open = true
+
+                    // Prevent the page from scrolling.
+                    if ( IS_DEFAULT_THEME ) {
+                        $html.
+                            css( 'overflow', 'hidden' ).
+                            css( 'padding-right', '+=' + getScrollbarWidth() )
+                    }
+
+                    // Pass focus to the root element’s jQuery object.
+                    // * Workaround for iOS8 to bring the picker’s root into view.
+                    P.$root.eq(0).focus()
+
+                    // Bind the document events.
+                    $document.on( 'click.' + STATE.id + ' focusin.' + STATE.id, function( event ) {
+
+                        var target = event.target
+
+                        // If the target of the event is not the element, close the picker picker.
+                        // * Don’t worry about clicks or focusins on the root because those don’t bubble up.
+                        //   Also, for Firefox, a click on an `option` element bubbles up directly
+                        //   to the doc. So make sure the target wasn't the doc.
+                        // * In Firefox stopPropagation() doesn’t prevent right-click events from bubbling,
+                        //   which causes the picker to unexpectedly close when right-clicking it. So make
+                        //   sure the event wasn’t a right-click.
+                        if ( target != ELEMENT && target != document && event.which != 3 ) {
+
+                            // If the target was the holder that covers the screen,
+                            // keep the element focused to maintain tabindex.
+                            P.close( target === P.$root.children()[0] )
+                        }
+
+                    }).on( 'keydown.' + STATE.id, function( event ) {
+
+                        var
+                            // Get the keycode.
+                            keycode = event.keyCode,
+
+                            // Translate that to a selection change.
+                            keycodeToMove = P.component.key[ keycode ],
+
+                            // Grab the target.
+                            target = event.target
+
+
+                        // On escape, close the picker and give focus.
+                        if ( keycode == 27 ) {
+                            P.close( true )
+                        }
+
+
+                        // Check if there is a key movement or “enter” keypress on the element.
+                        else if ( target == P.$root[0] && ( keycodeToMove || keycode == 13 ) ) {
+
+                            // Prevent the default action to stop page movement.
+                            event.preventDefault()
+
+                            // Trigger the key movement action.
+                            if ( keycodeToMove ) {
+                                PickerConstructor._.trigger( P.component.key.go, P, [ PickerConstructor._.trigger( keycodeToMove ) ] )
+                            }
+
+                            // On “enter”, if the highlighted item isn’t disabled, set the value and close.
+                            else if ( !P.$root.find( '.' + CLASSES.highlighted ).hasClass( CLASSES.disabled ) ) {
+                                P.set( 'select', P.component.item.highlight ).close()
+                            }
+                        }
+
+
+                        // If the target is within the root and “enter” is pressed,
+                        // prevent the default action and trigger a click on the target instead.
+                        else if ( $.contains( P.$root[0], target ) && keycode == 13 ) {
+                            event.preventDefault()
+                            target.click()
+                        }
+                    })
+                }
+
+                // Trigger the queued “open” events.
+                return P.trigger( 'open' )
+            }, //open
+
+
+            /**
+             * Close the picker
+             */
+            close: function( giveFocus ) {
+
+                // If we need to give focus, do it before changing states.
+                if ( giveFocus ) {
+                    // ....ah yes! It would’ve been incomplete without a crazy workaround for IE :|
+                    // The focus is triggered *after* the close has completed - causing it
+                    // to open again. So unbind and rebind the event at the next tick.
+                    P.$root.off( 'focus.toOpen' ).eq(0).focus()
+                    setTimeout( function() {
+                        P.$root.on( 'focus.toOpen', handleFocusToOpenEvent )
+                    }, 0 )
+                }
+
+                // Remove the “active” class.
+                $ELEMENT.removeClass( CLASSES.active )
+                aria( ELEMENT, 'expanded', false )
+
+                // * A Firefox bug, when `html` has `overflow:hidden`, results in
+                //   killing transitions :(. So remove the “opened” state on the next tick.
+                //   Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
+                setTimeout( function() {
+
+                    // Remove the “opened” and “focused” class from the picker root.
+                    P.$root.removeClass( CLASSES.opened + ' ' + CLASSES.focused )
+                    aria( P.$root[0], 'hidden', true )
+
+                }, 0 )
+
+                // If it’s already closed, do nothing more.
+                if ( !STATE.open ) return P
+
+                // Set it as closed.
+                STATE.open = false
+
+                // Allow the page to scroll.
+                if ( IS_DEFAULT_THEME ) {
+                    $html.
+                        css( 'overflow', '' ).
+                        css( 'padding-right', '-=' + getScrollbarWidth() )
+                }
+
+                // Unbind the document events.
+                $document.off( '.' + STATE.id )
+
+                // Trigger the queued “close” events.
+                return P.trigger( 'close' )
+            }, //close
+
+
+            /**
+             * Clear the values
+             */
+            clear: function( options ) {
+                return P.set( 'clear', null, options )
+            }, //clear
+
+
+            /**
+             * Set something
+             */
+            set: function( thing, value, options ) {
+
+                var thingItem, thingValue,
+                    thingIsObject = $.isPlainObject( thing ),
+                    thingObject = thingIsObject ? thing : {}
+
+                // Make sure we have usable options.
+                options = thingIsObject && $.isPlainObject( value ) ? value : options || {}
+
+                if ( thing ) {
+
+                    // If the thing isn’t an object, make it one.
+                    if ( !thingIsObject ) {
+                        thingObject[ thing ] = value
+                    }
+
+                    // Go through the things of items to set.
+                    for ( thingItem in thingObject ) {
+
+                        // Grab the value of the thing.
+                        thingValue = thingObject[ thingItem ]
+
+                        // First, if the item exists and there’s a value, set it.
+                        if ( thingItem in P.component.item ) {
+                            if ( thingValue === undefined ) thingValue = null
+                            P.component.set( thingItem, thingValue, options )
+                        }
+
+                        // Then, check to update the element value and broadcast a change.
+                        if ( thingItem == 'select' || thingItem == 'clear' ) {
+                            $ELEMENT.
+                                val( thingItem == 'clear' ? '' : P.get( thingItem, SETTINGS.format ) ).
+                                trigger( 'change' )
+                        }
+                    }
+
+                    // Render a new picker.
+                    P.render()
+                }
+
+                // When the method isn’t muted, trigger queued “set” events and pass the `thingObject`.
+                return options.muted ? P : P.trigger( 'set', thingObject )
+            }, //set
+
+
+            /**
+             * Get something
+             */
+            get: function( thing, format ) {
+
+                // Make sure there’s something to get.
+                thing = thing || 'value'
+
+                // If a picker state exists, return that.
+                if ( STATE[ thing ] != null ) {
+                    return STATE[ thing ]
+                }
+
+                // Return the submission value, if that.
+                if ( thing == 'valueSubmit' ) {
+                    if ( P._hidden ) {
+                        return P._hidden.value
+                    }
+                    thing = 'value'
+                }
+
+                // Return the value, if that.
+                if ( thing == 'value' ) {
+                    return ELEMENT.value
+                }
+
+                // Check if a component item exists, return that.
+                if ( thing in P.component.item ) {
+                    if ( typeof format == 'string' ) {
+                        var thingValue = P.component.get( thing )
+                        return thingValue ?
+                            PickerConstructor._.trigger(
+                                P.component.formats.toString,
+                                P.component,
+                                [ format, thingValue ]
+                            ) : ''
+                    }
+                    return P.component.get( thing )
+                }
+            }, //get
+
+
+
+            /**
+             * Bind events on the things.
+             */
+            on: function( thing, method, internal ) {
+
+                var thingName, thingMethod,
+                    thingIsObject = $.isPlainObject( thing ),
+                    thingObject = thingIsObject ? thing : {}
+
+                if ( thing ) {
+
+                    // If the thing isn’t an object, make it one.
+                    if ( !thingIsObject ) {
+                        thingObject[ thing ] = method
+                    }
+
+                    // Go through the things to bind to.
+                    for ( thingName in thingObject ) {
+
+                        // Grab the method of the thing.
+                        thingMethod = thingObject[ thingName ]
+
+                        // If it was an internal binding, prefix it.
+                        if ( internal ) {
+                            thingName = '_' + thingName
+                        }
+
+                        // Make sure the thing methods collection exists.
+                        STATE.methods[ thingName ] = STATE.methods[ thingName ] || []
+
+                        // Add the method to the relative method collection.
+                        STATE.methods[ thingName ].push( thingMethod )
+                    }
+                }
+
+                return P
+            }, //on
+
+
+
+            /**
+             * Unbind events on the things.
+             */
+            off: function() {
+                var i, thingName,
+                    names = arguments;
+                for ( i = 0, namesCount = names.length; i < namesCount; i += 1 ) {
+                    thingName = names[i]
+                    if ( thingName in STATE.methods ) {
+                        delete STATE.methods[thingName]
+                    }
+                }
+                return P
+            },
+
+
+            /**
+             * Fire off method events.
+             */
+            trigger: function( name, data ) {
+                var _trigger = function( name ) {
+                    var methodList = STATE.methods[ name ]
+                    if ( methodList ) {
+                        methodList.map( function( method ) {
+                            PickerConstructor._.trigger( method, P, [ data ] )
+                        })
+                    }
+                }
+                _trigger( '_' + name )
+                _trigger( name )
+                return P
+            } //trigger
+        } //PickerInstance.prototype
+
+
+    /**
+     * Wrap the picker holder components together.
+     */
+    function createWrappedComponent() {
+
+        // Create a picker wrapper holder
+        return PickerConstructor._.node( 'div',
+
+            // Create a picker wrapper node
+            PickerConstructor._.node( 'div',
+
+                // Create a picker frame
+                PickerConstructor._.node( 'div',
+
+                    // Create a picker box node
+                    PickerConstructor._.node( 'div',
+
+                        // Create the components nodes.
+                        P.component.nodes( STATE.open ),
+
+                        // The picker box class
+                        CLASSES.box
+                    ),
+
+                    // Picker wrap class
+                    CLASSES.wrap
+                ),
+
+                // Picker frame class
+                CLASSES.frame
+            ),
+
+            // Picker holder class
+            CLASSES.holder
+        ) //endreturn
+    } //createWrappedComponent
+
+
+
+    /**
+     * Prepare the input element with all bindings.
+     */
+    function prepareElement() {
+
+        $ELEMENT.
+
+            // Store the picker data by component name.
+            data(NAME, P).
+
+            // Add the “input” class name.
+            addClass(CLASSES.input).
+
+            // Remove the tabindex.
+            attr('tabindex', -1).
+
+            // If there’s a `data-value`, update the value of the element.
+            val( $ELEMENT.data('value') ?
+                P.get('select', SETTINGS.format) :
+                ELEMENT.value
+            )
+
+
+        // Only bind keydown events if the element isn’t editable.
+        if ( !SETTINGS.editable ) {
+
+            $ELEMENT.
+
+                // On focus/click, focus onto the root to open it up.
+                on( 'focus.' + STATE.id + ' click.' + STATE.id, function( event ) {
+                    event.preventDefault()
+                    P.$root.eq(0).focus()
+                }).
+
+                // Handle keyboard event based on the picker being opened or not.
+                on( 'keydown.' + STATE.id, handleKeydownEvent )
+        }
+
+
+        // Update the aria attributes.
+        aria(ELEMENT, {
+            haspopup: true,
+            expanded: false,
+            readonly: false,
+            owns: ELEMENT.id + '_root'
+        })
+    }
+
+
+    /**
+     * Prepare the root picker element with all bindings.
+     */
+    function prepareElementRoot() {
+
+        P.$root.
+
+            on({
+
+                // For iOS8.
+                keydown: handleKeydownEvent,
+
+                // When something within the root is focused, stop from bubbling
+                // to the doc and remove the “focused” state from the root.
+                focusin: function( event ) {
+                    P.$root.removeClass( CLASSES.focused )
+                    event.stopPropagation()
+                },
+
+                // When something within the root holder is clicked, stop it
+                // from bubbling to the doc.
+                'mousedown click': function( event ) {
+
+                    var target = event.target
+
+                    // Make sure the target isn’t the root holder so it can bubble up.
+                    if ( target != P.$root.children()[ 0 ] ) {
+
+                        event.stopPropagation()
+
+                        // * For mousedown events, cancel the default action in order to
+                        //   prevent cases where focus is shifted onto external elements
+                        //   when using things like jQuery mobile or MagnificPopup (ref: #249 & #120).
+                        //   Also, for Firefox, don’t prevent action on the `option` element.
+                        if ( event.type == 'mousedown' && !$( target ).is( 'input, select, textarea, button, option' )) {
+
+                            event.preventDefault()
+
+                            // Re-focus onto the root so that users can click away
+                            // from elements focused within the picker.
+                            P.$root.eq(0).focus()
+                        }
+                    }
+                }
+            }).
+
+            // Add/remove the “target” class on focus and blur.
+            on({
+                focus: function() {
+                    $ELEMENT.addClass( CLASSES.target )
+                },
+                blur: function() {
+                    $ELEMENT.removeClass( CLASSES.target )
+                }
+            }).
+
+            // Open the picker and adjust the root “focused” state
+            on( 'focus.toOpen', handleFocusToOpenEvent ).
+
+            // If there’s a click on an actionable element, carry out the actions.
+            on( 'click', '[data-pick], [data-nav], [data-clear], [data-close]', function() {
+
+                var $target = $( this ),
+                    targetData = $target.data(),
+                    targetDisabled = $target.hasClass( CLASSES.navDisabled ) || $target.hasClass( CLASSES.disabled ),
+
+                    // * For IE, non-focusable elements can be active elements as well
+                    //   (http://stackoverflow.com/a/2684561).
+                    activeElement = getActiveElement()
+                    activeElement = activeElement && ( activeElement.type || activeElement.href )
+
+                // If it’s disabled or nothing inside is actively focused, re-focus the element.
+                if ( targetDisabled || activeElement && !$.contains( P.$root[0], activeElement ) ) {
+                    P.$root.eq(0).focus()
+                }
+
+                // If something is superficially changed, update the `highlight` based on the `nav`.
+                if ( !targetDisabled && targetData.nav ) {
+                    P.set( 'highlight', P.component.item.highlight, { nav: targetData.nav } )
+                }
+
+                // If something is picked, set `select` then close with focus.
+                else if ( !targetDisabled && 'pick' in targetData ) {
+                    P.set( 'select', targetData.pick )
+                }
+
+                // If a “clear” button is pressed, empty the values and close with focus.
+                else if ( targetData.clear ) {
+                    P.clear().close( true )
+                }
+
+                else if ( targetData.close ) {
+                    P.close( true )
+                }
+
+            }) //P.$root
+
+        aria( P.$root[0], 'hidden', true )
+    }
+
+
+     /**
+      * Prepare the hidden input element along with all bindings.
+      */
+    function prepareElementHidden() {
+
+        var name
+
+        if ( SETTINGS.hiddenName === true ) {
+            name = ELEMENT.name
+            ELEMENT.name = ''
+        }
+        else {
+            name = [
+                typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : '',
+                typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit'
+            ]
+            name = name[0] + ELEMENT.name + name[1]
+        }
+
+        P._hidden = $(
+            '<input ' +
+            'type=hidden ' +
+
+            // Create the name using the original input’s with a prefix and suffix.
+            'name="' + name + '"' +
+
+            // If the element has a value, set the hidden value as well.
+            (
+                $ELEMENT.data('value') || ELEMENT.value ?
+                    ' value="' + P.get('select', SETTINGS.formatSubmit) + '"' :
+                    ''
+            ) +
+            '>'
+        )[0]
+
+        $ELEMENT.
+
+            // If the value changes, update the hidden input with the correct format.
+            on('change.' + STATE.id, function() {
+                P._hidden.value = ELEMENT.value ?
+                    P.get('select', SETTINGS.formatSubmit) :
+                    ''
+            })
+
+
+        // Insert the hidden input as specified in the settings.
+        if ( SETTINGS.container ) $( SETTINGS.container ).append( P._hidden )
+        else $ELEMENT.after( P._hidden )
+    }
+
+
+    // For iOS8.
+    function handleKeydownEvent( event ) {
+
+        var keycode = event.keyCode,
+
+            // Check if one of the delete keys was pressed.
+            isKeycodeDelete = /^(8|46)$/.test(keycode)
+
+        // For some reason IE clears the input value on “escape”.
+        if ( keycode == 27 ) {
+            P.close()
+            return false
+        }
+
+        // Check if `space` or `delete` was pressed or the picker is closed with a key movement.
+        if ( keycode == 32 || isKeycodeDelete || !STATE.open && P.component.key[keycode] ) {
+
+            // Prevent it from moving the page and bubbling to doc.
+            event.preventDefault()
+            event.stopPropagation()
+
+            // If `delete` was pressed, clear the values and close the picker.
+            // Otherwise open the picker.
+            if ( isKeycodeDelete ) { P.clear().close() }
+            else { P.open() }
+        }
+    }
+
+
+    // Separated for IE
+    function handleFocusToOpenEvent( event ) {
+
+        // Stop the event from propagating to the doc.
+        event.stopPropagation()
+
+        // If it’s a focus event, add the “focused” class to the root.
+        if ( event.type == 'focus' ) {
+            P.$root.addClass( CLASSES.focused )
+        }
+
+        // And then finally open the picker.
+        P.open()
+    }
+
+
+    // Return a new picker instance.
+    return new PickerInstance()
+} //PickerConstructor
+
+
+
+/**
+ * The default classes and prefix to use for the HTML classes.
+ */
+PickerConstructor.klasses = function( prefix ) {
+    prefix = prefix || 'picker'
+    return {
+
+        picker: prefix,
+        opened: prefix + '--opened',
+        focused: prefix + '--focused',
+
+        input: prefix + '__input',
+        active: prefix + '__input--active',
+        target: prefix + '__input--target',
+
+        holder: prefix + '__holder',
+
+        frame: prefix + '__frame',
+        wrap: prefix + '__wrap',
+
+        box: prefix + '__box'
+    }
+} //PickerConstructor.klasses
+
+
+
+/**
+ * Check if the default theme is being used.
+ */
+function isUsingDefaultTheme( element ) {
+
+    var theme,
+        prop = 'position'
+
+    // For IE.
+    if ( element.currentStyle ) {
+        theme = element.currentStyle[prop]
+    }
+
+    // For normal browsers.
+    else if ( window.getComputedStyle ) {
+        theme = getComputedStyle( element )[prop]
+    }
+
+    return theme == 'fixed'
+}
+
+
+
+/**
+ * Get the width of the browser’s scrollbar.
+ * Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js
+ */
+function getScrollbarWidth() {
+
+    if ( $html.height() <= $window.height() ) {
+        return 0
+    }
+
+    var $outer = $( '<div style="visibility:hidden;width:100px" />' ).
+        appendTo( 'body' )
+
+    // Get the width without scrollbars.
+    var widthWithoutScroll = $outer[0].offsetWidth
+
+    // Force adding scrollbars.
+    $outer.css( 'overflow', 'scroll' )
+
+    // Add the inner div.
+    var $inner = $( '<div style="width:100%" />' ).appendTo( $outer )
+
+    // Get the width with scrollbars.
+    var widthWithScroll = $inner[0].offsetWidth
+
+    // Remove the divs.
+    $outer.remove()
+
+    // Return the difference between the widths.
+    return widthWithoutScroll - widthWithScroll
+}
+
+
+
+/**
+ * PickerConstructor helper methods.
+ */
+PickerConstructor._ = {
+
+    /**
+     * Create a group of nodes. Expects:
+     * `
+        {
+            min:    {Integer},
+            max:    {Integer},
+            i:      {Integer},
+            node:   {String},
+            item:   {Function}
+        }
+     * `
+     */
+    group: function( groupObject ) {
+
+        var
+            // Scope for the looped object
+            loopObjectScope,
+
+            // Create the nodes list
+            nodesList = '',
+
+            // The counter starts from the `min`
+            counter = PickerConstructor._.trigger( groupObject.min, groupObject )
+
+
+        // Loop from the `min` to `max`, incrementing by `i`
+        for ( ; counter <= PickerConstructor._.trigger( groupObject.max, groupObject, [ counter ] ); counter += groupObject.i ) {
+
+            // Trigger the `item` function within scope of the object
+            loopObjectScope = PickerConstructor._.trigger( groupObject.item, groupObject, [ counter ] )
+
+            // Splice the subgroup and create nodes out of the sub nodes
+            nodesList += PickerConstructor._.node(
+                groupObject.node,
+                loopObjectScope[ 0 ],   // the node
+                loopObjectScope[ 1 ],   // the classes
+                loopObjectScope[ 2 ]    // the attributes
+            )
+        }
+
+        // Return the list of nodes
+        return nodesList
+    }, //group
+
+
+    /**
+     * Create a dom node string
+     */
+    node: function( wrapper, item, klass, attribute ) {
+
+        // If the item is false-y, just return an empty string
+        if ( !item ) return ''
+
+        // If the item is an array, do a join
+        item = $.isArray( item ) ? item.join( '' ) : item
+
+        // Check for the class
+        klass = klass ? ' class="' + klass + '"' : ''
+
+        // Check for any attributes
+        attribute = attribute ? ' ' + attribute : ''
+
+        // Return the wrapped item
+        return '<' + wrapper + klass + attribute + '>' + item + '</' + wrapper + '>'
+    }, //node
+
+
+    /**
+     * Lead numbers below 10 with a zero.
+     */
+    lead: function( number ) {
+        return ( number < 10 ? '0': '' ) + number
+    },
+
+
+    /**
+     * Trigger a function otherwise return the value.
+     */
+    trigger: function( callback, scope, args ) {
+        return typeof callback == 'function' ? callback.apply( scope, args || [] ) : callback
+    },
+
+
+    /**
+     * If the second character is a digit, length is 2 otherwise 1.
+     */
+    digits: function( string ) {
+        return ( /\d/ ).test( string[ 1 ] ) ? 2 : 1
+    },
+
+
+    /**
+     * Tell if something is a date object.
+     */
+    isDate: function( value ) {
+        return {}.toString.call( value ).indexOf( 'Date' ) > -1 && this.isInteger( value.getDate() )
+    },
+
+
+    /**
+     * Tell if something is an integer.
+     */
+    isInteger: function( value ) {
+        return {}.toString.call( value ).indexOf( 'Number' ) > -1 && value % 1 === 0
+    },
+
+
+    /**
+     * Create ARIA attribute strings.
+     */
+    ariaAttr: ariaAttr
+} //PickerConstructor._
+
+
+
+/**
+ * Extend the picker with a component and defaults.
+ */
+PickerConstructor.extend = function( name, Component ) {
+
+    // Extend jQuery.
+    $.fn[ name ] = function( options, action ) {
+
+        // Grab the component data.
+        var componentData = this.data( name )
+
+        // If the picker is requested, return the data object.
+        if ( options == 'picker' ) {
+            return componentData
+        }
+
+        // If the component data exists and `options` is a string, carry out the action.
+        if ( componentData && typeof options == 'string' ) {
+            return PickerConstructor._.trigger( componentData[ options ], componentData, [ action ] )
+        }
+
+        // Otherwise go through each matched element and if the component
+        // doesn’t exist, create a new picker using `this` element
+        // and merging the defaults and options with a deep copy.
+        return this.each( function() {
+            var $this = $( this )
+            if ( !$this.data( name ) ) {
+                new PickerConstructor( this, name, Component, options )
+            }
+        })
+    }
+
+    // Set the defaults.
+    $.fn[ name ].defaults = Component.defaults
+} //PickerConstructor.extend
+
+
+
+function aria(element, attribute, value) {
+    if ( $.isPlainObject(attribute) ) {
+        for ( var key in attribute ) {
+            ariaSet(element, key, attribute[key])
+        }
+    }
+    else {
+        ariaSet(element, attribute, value)
+    }
+}
+function ariaSet(element, attribute, value) {
+    element.setAttribute(
+        (attribute == 'role' ? '' : 'aria-') + attribute,
+        value
+    )
+}
+function ariaAttr(attribute, data) {
+    if ( !$.isPlainObject(attribute) ) {
+        attribute = { attribute: data }
+    }
+    data = ''
+    for ( var key in attribute ) {
+        var attr = (key == 'role' ? '' : 'aria-') + key,
+            attrVal = attribute[key]
+        data += attrVal == null ? '' : attr + '="' + attribute[key] + '"'
+    }
+    return data
+}
+
+// IE8 bug throws an error for activeElements within iframes.
+function getActiveElement() {
+    try {
+        return document.activeElement
+    } catch ( err ) { }
+}
+
+
+
+// Expose the picker constructor.
+return PickerConstructor
+
+
+}));
+
+
+;/*!
+ * Date picker for pickadate.js v3.5.0
+ * http://amsul.github.io/pickadate.js/date.htm
+ */
+
+(function ( factory ) {
+
+    // AMD.
+    if ( typeof define == 'function' && define.amd )
+        define( ['picker', 'jquery'], factory )
+
+    // Node.js/browserify.
+    else if ( typeof exports == 'object' )
+        module.exports = factory( require('./picker.js'), require('jquery') )
+
+    // Browser globals.
+    else factory( Picker, jQuery )
+
+}(function( Picker, $ ) {
+
+
+/**
+ * Globals and constants
+ */
+var DAYS_IN_WEEK = 7,
+    WEEKS_IN_CALENDAR = 6,
+    _ = Picker._
+
+
+
+/**
+ * The date picker constructor
+ */
+function DatePicker( picker, settings ) {
+
+    var calendar = this,
+        element = picker.$node[ 0 ],
+        elementValue = element.value,
+        elementDataValue = picker.$node.data( 'value' ),
+        valueString = elementDataValue || elementValue,
+        formatString = elementDataValue ? settings.formatSubmit : settings.format,
+        isRTL = function() {
+
+            return element.currentStyle ?
+
+                // For IE.
+                element.currentStyle.direction == 'rtl' :
+
+                // For normal browsers.
+                getComputedStyle( picker.$root[0] ).direction == 'rtl'
+        }
+
+    calendar.settings = settings
+    calendar.$node = picker.$node
+
+    // The queue of methods that will be used to build item objects.
+    calendar.queue = {
+        min: 'measure create',
+        max: 'measure create',
+        now: 'now create',
+        select: 'parse create validate',
+        highlight: 'parse navigate create validate',
+        view: 'parse create validate viewset',
+        disable: 'deactivate',
+        enable: 'activate'
+    }
+
+    // The component's item object.
+    calendar.item = {}
+
+    calendar.item.clear = null
+    calendar.item.disable = ( settings.disable || [] ).slice( 0 )
+    calendar.item.enable = -(function( collectionDisabled ) {
+        return collectionDisabled[ 0 ] === true ? collectionDisabled.shift() : -1
+    })( calendar.item.disable )
+
+    calendar.
+        set( 'min', settings.min ).
+        set( 'max', settings.max ).
+        set( 'now' )
+
+    // When there’s a value, set the `select`, which in turn
+    // also sets the `highlight` and `view`.
+    if ( valueString ) {
+        calendar.set( 'select', valueString, { format: formatString })
+    }
+
+    // If there’s no value, default to highlighting “today”.
+    else {
+        calendar.
+            set( 'select', null ).
+            set( 'highlight', calendar.item.now )
+    }
+
+
+    // The keycode to movement mapping.
+    calendar.key = {
+        40: 7, // Down
+        38: -7, // Up
+        39: function() { return isRTL() ? -1 : 1 }, // Right
+        37: function() { return isRTL() ? 1 : -1 }, // Left
+        go: function( timeChange ) {
+            var highlightedObject = calendar.item.highlight,
+                targetDate = new Date( highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange )
+            calendar.set(
+                'highlight',
+                targetDate,
+                { interval: timeChange }
+            )
+            this.render()
+        }
+    }
+
+
+    // Bind some picker events.
+    picker.
+        on( 'render', function() {
+            picker.$root.find( '.' + settings.klass.selectMonth ).on( 'change', function() {
+                var value = this.value
+                if ( value ) {
+                    picker.set( 'highlight', [ picker.get( 'view' ).year, value, picker.get( 'highlight' ).date ] )
+                    picker.$root.find( '.' + settings.klass.selectMonth ).trigger( 'focus' )
+                }
+            })
+            picker.$root.find( '.' + settings.klass.selectYear ).on( 'change', function() {
+                var value = this.value
+                if ( value ) {
+                    picker.set( 'highlight', [ value, picker.get( 'view' ).month, picker.get( 'highlight' ).date ] )
+                    picker.$root.find( '.' + settings.klass.selectYear ).trigger( 'focus' )
+                }
+            })
+        }, 1 ).
+        on( 'open', function() {
+            var includeToday = ''
+            if ( calendar.disabled( calendar.get('now') ) ) {
+                includeToday = ':not(.' + settings.klass.buttonToday + ')'
+            }
+            picker.$root.find( 'button' + includeToday + ', select' ).attr( 'disabled', false )
+        }, 1 ).
+        on( 'close', function() {
+            picker.$root.find( 'button, select' ).attr( 'disabled', true )
+        }, 1 )
+
+} //DatePicker
+
+
+/**
+ * Set a datepicker item object.
+ */
+DatePicker.prototype.set = function( type, value, options ) {
+
+    var calendar = this,
+        calendarItem = calendar.item
+
+    // If the value is `null` just set it immediately.
+    if ( value === null ) {
+        if ( type == 'clear' ) type = 'select'
+        calendarItem[ type ] = value
+        return calendar
+    }
+
+    // Otherwise go through the queue of methods, and invoke the functions.
+    // Update this as the time unit, and set the final value as this item.
+    // * In the case of `enable`, keep the queue but set `disable` instead.
+    //   And in the case of `flip`, keep the queue but set `enable` instead.
+    calendarItem[ ( type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type ) ] = calendar.queue[ type ].split( ' ' ).map( function( method ) {
+        value = calendar[ method ]( type, value, options )
+        return value
+    }).pop()
+
+    // Check if we need to cascade through more updates.
+    if ( type == 'select' ) {
+        calendar.set( 'highlight', calendarItem.select, options )
+    }
+    else if ( type == 'highlight' ) {
+        calendar.set( 'view', calendarItem.highlight, options )
+    }
+    else if ( type.match( /^(flip|min|max|disable|enable)$/ ) ) {
+        if ( calendarItem.select && calendar.disabled( calendarItem.select ) ) {
+            calendar.set( 'select', calendarItem.select, options )
+        }
+        if ( calendarItem.highlight && calendar.disabled( calendarItem.highlight ) ) {
+            calendar.set( 'highlight', calendarItem.highlight, options )
+        }
+    }
+
+    return calendar
+} //DatePicker.prototype.set
+
+
+/**
+ * Get a datepicker item object.
+ */
+DatePicker.prototype.get = function( type ) {
+    return this.item[ type ]
+} //DatePicker.prototype.get
+
+
+/**
+ * Create a picker date object.
+ */
+DatePicker.prototype.create = function( type, value, options ) {
+
+    var isInfiniteValue,
+        calendar = this
+
+    // If there’s no value, use the type as the value.
+    value = value === undefined ? type : value
+
+
+    // If it’s infinity, update the value.
+    if ( value == -Infinity || value == Infinity ) {
+        isInfiniteValue = value
+    }
+
+    // If it’s an object, use the native date object.
+    else if ( $.isPlainObject( value ) && _.isInteger( value.pick ) ) {
+        value = value.obj
+    }
+
+    // If it’s an array, convert it into a date and make sure
+    // that it’s a valid date – otherwise default to today.
+    else if ( $.isArray( value ) ) {
+        value = new Date( value[ 0 ], value[ 1 ], value[ 2 ] )
+        value = _.isDate( value ) ? value : calendar.create().obj
+    }
+
+    // If it’s a number or date object, make a normalized date.
+    else if ( _.isInteger( value ) || _.isDate( value ) ) {
+        value = calendar.normalize( new Date( value ), options )
+    }
+
+    // If it’s a literal true or any other case, set it to now.
+    else /*if ( value === true )*/ {
+        value = calendar.now( type, value, options )
+    }
+
+    // Return the compiled object.
+    return {
+        year: isInfiniteValue || value.getFullYear(),
+        month: isInfiniteValue || value.getMonth(),
+        date: isInfiniteValue || value.getDate(),
+        day: isInfiniteValue || value.getDay(),
+        obj: isInfiniteValue || value,
+        pick: isInfiniteValue || value.getTime()
+    }
+} //DatePicker.prototype.create
+
+
+/**
+ * Create a range limit object using an array, date object,
+ * literal “true”, or integer relative to another time.
+ */
+DatePicker.prototype.createRange = function( from, to ) {
+
+    var calendar = this,
+        createDate = function( date ) {
+            if ( date === true || $.isArray( date ) || _.isDate( date ) ) {
+                return calendar.create( date )
+            }
+            return date
+        }
+
+    // Create objects if possible.
+    if ( !_.isInteger( from ) ) {
+        from = createDate( from )
+    }
+    if ( !_.isInteger( to ) ) {
+        to = createDate( to )
+    }
+
+    // Create relative dates.
+    if ( _.isInteger( from ) && $.isPlainObject( to ) ) {
+        from = [ to.year, to.month, to.date + from ];
+    }
+    else if ( _.isInteger( to ) && $.isPlainObject( from ) ) {
+        to = [ from.year, from.month, from.date + to ];
+    }
+
+    return {
+        from: createDate( from ),
+        to: createDate( to )
+    }
+} //DatePicker.prototype.createRange
+
+
+/**
+ * Check if a date unit falls within a date range object.
+ */
+DatePicker.prototype.withinRange = function( range, dateUnit ) {
+    range = this.createRange(range.from, range.to)
+    return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick
+}
+
+
+/**
+ * Check if two date range objects overlap.
+ */
+DatePicker.prototype.overlapRanges = function( one, two ) {
+
+    var calendar = this
+
+    // Convert the ranges into comparable dates.
+    one = calendar.createRange( one.from, one.to )
+    two = calendar.createRange( two.from, two.to )
+
+    return calendar.withinRange( one, two.from ) || calendar.withinRange( one, two.to ) ||
+        calendar.withinRange( two, one.from ) || calendar.withinRange( two, one.to )
+}
+
+
+/**
+ * Get the date today.
+ */
+DatePicker.prototype.now = function( type, value, options ) {
+    value = new Date()
+    if ( options && options.rel ) {
+        value.setDate( value.getDate() + options.rel )
+    }
+    return this.normalize( value, options )
+}
+
+
+/**
+ * Navigate to next/prev month.
+ */
+DatePicker.prototype.navigate = function( type, value, options ) {
+
+    var targetDateObject,
+        targetYear,
+        targetMonth,
+        targetDate,
+        isTargetArray = $.isArray( value ),
+        isTargetObject = $.isPlainObject( value ),
+        viewsetObject = this.item.view/*,
+        safety = 100*/
+
+
+    if ( isTargetArray || isTargetObject ) {
+
+        if ( isTargetObject ) {
+            targetYear = value.year
+            targetMonth = value.month
+            targetDate = value.date
+        }
+        else {
+            targetYear = +value[0]
+            targetMonth = +value[1]
+            targetDate = +value[2]
+        }
+
+        // If we’re navigating months but the view is in a different
+        // month, navigate to the view’s year and month.
+        if ( options && options.nav && viewsetObject && viewsetObject.month !== targetMonth ) {
+            targetYear = viewsetObject.year
+            targetMonth = viewsetObject.month
+        }
+
+        // Figure out the expected target year and month.
+        targetDateObject = new Date( targetYear, targetMonth + ( options && options.nav ? options.nav : 0 ), 1 )
+        targetYear = targetDateObject.getFullYear()
+        targetMonth = targetDateObject.getMonth()
+
+        // If the month we’re going to doesn’t have enough days,
+        // keep decreasing the date until we reach the month’s last date.
+        while ( /*safety &&*/ new Date( targetYear, targetMonth, targetDate ).getMonth() !== targetMonth ) {
+            targetDate -= 1
+            /*safety -= 1
+            if ( !safety ) {
+                throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.'
+            }*/
+        }
+
+        value = [ targetYear, targetMonth, targetDate ]
+    }
+
+    return value
+} //DatePicker.prototype.navigate
+
+
+/**
+ * Normalize a date by setting the hours to midnight.
+ */
+DatePicker.prototype.normalize = function( value/*, options*/ ) {
+    value.setHours( 0, 0, 0, 0 )
+    return value
+}
+
+
+/**
+ * Measure the range of dates.
+ */
+DatePicker.prototype.measure = function( type, value/*, options*/ ) {
+
+    var calendar = this
+
+    // If it’s anything false-y, remove the limits.
+    if ( !value ) {
+        value = type == 'min' ? -Infinity : Infinity
+    }
+
+    // If it’s a string, parse it.
+    else if ( typeof value == 'string' ) {
+        value = calendar.parse( type, value )
+    }
+
+    // If it's an integer, get a date relative to today.
+    else if ( _.isInteger( value ) ) {
+        value = calendar.now( type, value, { rel: value } )
+    }
+
+    return value
+} ///DatePicker.prototype.measure
+
+
+/**
+ * Create a viewset object based on navigation.
+ */
+DatePicker.prototype.viewset = function( type, dateObject/*, options*/ ) {
+    return this.create([ dateObject.year, dateObject.month, 1 ])
+}
+
+
+/**
+ * Validate a date as enabled and shift if needed.
+ */
+DatePicker.prototype.validate = function( type, dateObject, options ) {
+
+    var calendar = this,
+
+        // Keep a reference to the original date.
+        originalDateObject = dateObject,
+
+        // Make sure we have an interval.
+        interval = options && options.interval ? options.interval : 1,
+
+        // Check if the calendar enabled dates are inverted.
+        isFlippedBase = calendar.item.enable === -1,
+
+        // Check if we have any enabled dates after/before now.
+        hasEnabledBeforeTarget, hasEnabledAfterTarget,
+
+        // The min & max limits.
+        minLimitObject = calendar.item.min,
+        maxLimitObject = calendar.item.max,
+
+        // Check if we’ve reached the limit during shifting.
+        reachedMin, reachedMax,
+
+        // Check if the calendar is inverted and at least one weekday is enabled.
+        hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter( function( value ) {
+
+            // If there’s a date, check where it is relative to the target.
+            if ( $.isArray( value ) ) {
+                var dateTime = calendar.create( value ).pick
+                if ( dateTime < dateObject.pick ) hasEnabledBeforeTarget = true
+                else if ( dateTime > dateObject.pick ) hasEnabledAfterTarget = true
+            }
+
+            // Return only integers for enabled weekdays.
+            return _.isInteger( value )
+        }).length/*,
+
+        safety = 100*/
+
+
+
+    // Cases to validate for:
+    // [1] Not inverted and date disabled.
+    // [2] Inverted and some dates enabled.
+    // [3] Not inverted and out of range.
+    //
+    // Cases to **not** validate for:
+    // • Navigating months.
+    // • Not inverted and date enabled.
+    // • Inverted and all dates disabled.
+    // • ..and anything else.
+    if ( !options || !options.nav ) if (
+        /* 1 */ ( !isFlippedBase && calendar.disabled( dateObject ) ) ||
+        /* 2 */ ( isFlippedBase && calendar.disabled( dateObject ) && ( hasEnabledWeekdays || hasEnabledBeforeTarget || hasEnabledAfterTarget ) ) ||
+        /* 3 */ ( !isFlippedBase && (dateObject.pick <= minLimitObject.pick || dateObject.pick >= maxLimitObject.pick) )
+    ) {
+
+
+        // When inverted, flip the direction if there aren’t any enabled weekdays
+        // and there are no enabled dates in the direction of the interval.
+        if ( isFlippedBase && !hasEnabledWeekdays && ( ( !hasEnabledAfterTarget && interval > 0 ) || ( !hasEnabledBeforeTarget && interval < 0 ) ) ) {
+            interval *= -1
+        }
+
+
+        // Keep looping until we reach an enabled date.
+        while ( /*safety &&*/ calendar.disabled( dateObject ) ) {
+
+            /*safety -= 1
+            if ( !safety ) {
+                throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.'
+            }*/
+
+
+            // If we’ve looped into the next/prev month with a large interval, return to the original date and flatten the interval.
+            if ( Math.abs( interval ) > 1 && ( dateObject.month < originalDateObject.month || dateObject.month > originalDateObject.month ) ) {
+                dateObject = originalDateObject
+                interval = interval > 0 ? 1 : -1
+            }
+
+
+            // If we’ve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit.
+            if ( dateObject.pick <= minLimitObject.pick ) {
+                reachedMin = true
+                interval = 1
+                dateObject = calendar.create([
+                    minLimitObject.year,
+                    minLimitObject.month,
+                    minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1)
+                ])
+            }
+            else if ( dateObject.pick >= maxLimitObject.pick ) {
+                reachedMax = true
+                interval = -1
+                dateObject = calendar.create([
+                    maxLimitObject.year,
+                    maxLimitObject.month,
+                    maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1)
+                ])
+            }
+
+
+            // If we’ve reached both limits, just break out of the loop.
+            if ( reachedMin && reachedMax ) {
+                break
+            }
+
+
+            // Finally, create the shifted date using the interval and keep looping.
+            dateObject = calendar.create([ dateObject.year, dateObject.month, dateObject.date + interval ])
+        }
+
+    } //endif
+
+
+    // Return the date object settled on.
+    return dateObject
+} //DatePicker.prototype.validate
+
+
+/**
+ * Check if a date is disabled.
+ */
+DatePicker.prototype.disabled = function( dateToVerify ) {
+
+    var
+        calendar = this,
+
+        // Filter through the disabled dates to check if this is one.
+        isDisabledMatch = calendar.item.disable.filter( function( dateToDisable ) {
+
+            // If the date is a number, match the weekday with 0index and `firstDay` check.
+            if ( _.isInteger( dateToDisable ) ) {
+                return dateToVerify.day === ( calendar.settings.firstDay ? dateToDisable : dateToDisable - 1 ) % 7
+            }
+
+            // If it’s an array or a native JS date, create and match the exact date.
+            if ( $.isArray( dateToDisable ) || _.isDate( dateToDisable ) ) {
+                return dateToVerify.pick === calendar.create( dateToDisable ).pick
+            }
+
+            // If it’s an object, match a date within the “from” and “to” range.
+            if ( $.isPlainObject( dateToDisable ) ) {
+                return calendar.withinRange( dateToDisable, dateToVerify )
+            }
+        })
+
+    // If this date matches a disabled date, confirm it’s not inverted.
+    isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function( dateToDisable ) {
+        return $.isArray( dateToDisable ) && dateToDisable[3] == 'inverted' ||
+            $.isPlainObject( dateToDisable ) && dateToDisable.inverted
+    }).length
+
+    // Check the calendar “enabled” flag and respectively flip the
+    // disabled state. Then also check if it’s beyond the min/max limits.
+    return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch ||
+        dateToVerify.pick < calendar.item.min.pick ||
+        dateToVerify.pick > calendar.item.max.pick
+
+} //DatePicker.prototype.disabled
+
+
+/**
+ * Parse a string into a usable type.
+ */
+DatePicker.prototype.parse = function( type, value, options ) {
+
+    var calendar = this,
+        parsingObject = {}
+
+    // If it’s already parsed, we’re good.
+    if ( !value || typeof value != 'string' ) {
+        return value
+    }
+
+    // We need a `.format` to parse the value with.
+    if ( !( options && options.format ) ) {
+        options = options || {}
+        options.format = calendar.settings.format
+    }
+
+    // Convert the format into an array and then map through it.
+    calendar.formats.toArray( options.format ).map( function( label ) {
+
+        var
+            // Grab the formatting label.
+            formattingLabel = calendar.formats[ label ],
+
+            // The format length is from the formatting label function or the
+            // label length without the escaping exclamation (!) mark.
+            formatLength = formattingLabel ? _.trigger( formattingLabel, calendar, [ value, parsingObject ] ) : label.replace( /^!/, '' ).length
+
+        // If there's a format label, split the value up to the format length.
+        // Then add it to the parsing object with appropriate label.
+        if ( formattingLabel ) {
+            parsingObject[ label ] = value.substr( 0, formatLength )
+        }
+
+        // Update the value as the substring from format length to end.
+        value = value.substr( formatLength )
+    })
+
+    // Compensate for month 0index.
+    return [
+        parsingObject.yyyy || parsingObject.yy,
+        +( parsingObject.mm || parsingObject.m ) - 1,
+        parsingObject.dd || parsingObject.d
+    ]
+} //DatePicker.prototype.parse
+
+
+/**
+ * Various formats to display the object in.
+ */
+DatePicker.prototype.formats = (function() {
+
+    // Return the length of the first word in a collection.
+    function getWordLengthFromCollection( string, collection, dateObject ) {
+
+        // Grab the first word from the string.
+        var word = string.match( /\w+/ )[ 0 ]
+
+        // If there's no month index, add it to the date object
+        if ( !dateObject.mm && !dateObject.m ) {
+            dateObject.m = collection.indexOf( word ) + 1
+        }
+
+        // Return the length of the word.
+        return word.length
+    }
+
+    // Get the length of the first word in a string.
+    function getFirstWordLength( string ) {
+        return string.match( /\w+/ )[ 0 ].length
+    }
+
+    return {
+
+        d: function( string, dateObject ) {
+
+            // If there's string, then get the digits length.
+            // Otherwise return the selected date.
+            return string ? _.digits( string ) : dateObject.date
+        },
+        dd: function( string, dateObject ) {
+
+            // If there's a string, then the length is always 2.
+            // Otherwise return the selected date with a leading zero.
+            return string ? 2 : _.lead( dateObject.date )
+        },
+        ddd: function( string, dateObject ) {
+
+            // If there's a string, then get the length of the first word.
+            // Otherwise return the short selected weekday.
+            return string ? getFirstWordLength( string ) : this.settings.weekdaysShort[ dateObject.day ]
+        },
+        dddd: function( string, dateObject ) {
+
+            // If there's a string, then get the length of the first word.
+            // Otherwise return the full selected weekday.
+            return string ? getFirstWordLength( string ) : this.settings.weekdaysFull[ dateObject.day ]
+        },
+        m: function( string, dateObject ) {
+
+            // If there's a string, then get the length of the digits
+            // Otherwise return the selected month with 0index compensation.
+            return string ? _.digits( string ) : dateObject.month + 1
+        },
+        mm: function( string, dateObject ) {
+
+            // If there's a string, then the length is always 2.
+            // Otherwise return the selected month with 0index and leading zero.
+            return string ? 2 : _.lead( dateObject.month + 1 )
+        },
+        mmm: function( string, dateObject ) {
+
+            var collection = this.settings.monthsShort
+
+            // If there's a string, get length of the relevant month from the short
+            // months collection. Otherwise return the selected month from that collection.
+            return string ? getWordLengthFromCollection( string, collection, dateObject ) : collection[ dateObject.month ]
+        },
+        mmmm: function( string, dateObject ) {
+
+            var collection = this.settings.monthsFull
+
+            // If there's a string, get length of the relevant month from the full
+            // months collection. Otherwise return the selected month from that collection.
+            return string ? getWordLengthFromCollection( string, collection, dateObject ) : collection[ dateObject.month ]
+        },
+        yy: function( string, dateObject ) {
+
+            // If there's a string, then the length is always 2.
+            // Otherwise return the selected year by slicing out the first 2 digits.
+            return string ? 2 : ( '' + dateObject.year ).slice( 2 )
+        },
+        yyyy: function( string, dateObject ) {
+
+            // If there's a string, then the length is always 4.
+            // Otherwise return the selected year.
+            return string ? 4 : dateObject.year
+        },
+
+        // Create an array by splitting the formatting string passed.
+        toArray: function( formatString ) { return formatString.split( /(d{1,4}|m{1,4}|y{4}|yy|!.)/g ) },
+
+        // Format an object into a string using the formatting options.
+        toString: function ( formatString, itemObject ) {
+            var calendar = this
+            return calendar.formats.toArray( formatString ).map( function( label ) {
+                return _.trigger( calendar.formats[ label ], calendar, [ 0, itemObject ] ) || label.replace( /^!/, '' )
+            }).join( '' )
+        }
+    }
+})() //DatePicker.prototype.formats
+
+
+
+
+/**
+ * Check if two date units are the exact.
+ */
+DatePicker.prototype.isDateExact = function( one, two ) {
+
+    var calendar = this
+
+    // When we’re working with weekdays, do a direct comparison.
+    if (
+        ( _.isInteger( one ) && _.isInteger( two ) ) ||
+        ( typeof one == 'boolean' && typeof two == 'boolean' )
+     ) {
+        return one === two
+    }
+
+    // When we’re working with date representations, compare the “pick” value.
+    if (
+        ( _.isDate( one ) || $.isArray( one ) ) &&
+        ( _.isDate( two ) || $.isArray( two ) )
+    ) {
+        return calendar.create( one ).pick === calendar.create( two ).pick
+    }
+
+    // When we’re working with range objects, compare the “from” and “to”.
+    if ( $.isPlainObject( one ) && $.isPlainObject( two ) ) {
+        return calendar.isDateExact( one.from, two.from ) && calendar.isDateExact( one.to, two.to )
+    }
+
+    return false
+}
+
+
+/**
+ * Check if two date units overlap.
+ */
+DatePicker.prototype.isDateOverlap = function( one, two ) {
+
+    var calendar = this,
+        firstDay = calendar.settings.firstDay ? 1 : 0
+
+    // When we’re working with a weekday index, compare the days.
+    if ( _.isInteger( one ) && ( _.isDate( two ) || $.isArray( two ) ) ) {
+        one = one % 7 + firstDay
+        return one === calendar.create( two ).day + 1
+    }
+    if ( _.isInteger( two ) && ( _.isDate( one ) || $.isArray( one ) ) ) {
+        two = two % 7 + firstDay
+        return two === calendar.create( one ).day + 1
+    }
+
+    // When we’re working with range objects, check if the ranges overlap.
+    if ( $.isPlainObject( one ) && $.isPlainObject( two ) ) {
+        return calendar.overlapRanges( one, two )
+    }
+
+    return false
+}
+
+
+/**
+ * Flip the “enabled” state.
+ */
+DatePicker.prototype.flipEnable = function(val) {
+    var itemObject = this.item
+    itemObject.enable = val || (itemObject.enable == -1 ? 1 : -1)
+}
+
+
+/**
+ * Mark a collection of dates as “disabled”.
+ */
+DatePicker.prototype.deactivate = function( type, datesToDisable ) {
+
+    var calendar = this,
+        disabledItems = calendar.item.disable.slice(0)
+
+
+    // If we’re flipping, that’s all we need to do.
+    if ( datesToDisable == 'flip' ) {
+        calendar.flipEnable()
+    }
+
+    else if ( datesToDisable === false ) {
+        calendar.flipEnable(1)
+        disabledItems = []
+    }
+
+    else if ( datesToDisable === true ) {
+        calendar.flipEnable(-1)
+        disabledItems = []
+    }
+
+    // Otherwise go through the dates to disable.
+    else {
+
+        datesToDisable.map(function( unitToDisable ) {
+
+            var matchFound
+
+            // When we have disabled items, check for matches.
+            // If something is matched, immediately break out.
+            for ( var index = 0; index < disabledItems.length; index += 1 ) {
+                if ( calendar.isDateExact( unitToDisable, disabledItems[index] ) ) {
+                    matchFound = true
+                    break
+                }
+            }
+
+            // If nothing was found, add the validated unit to the collection.
+            if ( !matchFound ) {
+                if (
+                    _.isInteger( unitToDisable ) ||
+                    _.isDate( unitToDisable ) ||
+                    $.isArray( unitToDisable ) ||
+                    ( $.isPlainObject( unitToDisable ) && unitToDisable.from && unitToDisable.to )
+                ) {
+                    disabledItems.push( unitToDisable )
+                }
+            }
+        })
+    }
+
+    // Return the updated collection.
+    return disabledItems
+} //DatePicker.prototype.deactivate
+
+
+/**
+ * Mark a collection of dates as “enabled”.
+ */
+DatePicker.prototype.activate = function( type, datesToEnable ) {
+
+    var calendar = this,
+        disabledItems = calendar.item.disable,
+        disabledItemsCount = disabledItems.length
+
+    // If we’re flipping, that’s all we need to do.
+    if ( datesToEnable == 'flip' ) {
+        calendar.flipEnable()
+    }
+
+    else if ( datesToEnable === true ) {
+        calendar.flipEnable(1)
+        disabledItems = []
+    }
+
+    else if ( datesToEnable === false ) {
+        calendar.flipEnable(-1)
+        disabledItems = []
+    }
+
+    // Otherwise go through the disabled dates.
+    else {
+
+        datesToEnable.map(function( unitToEnable ) {
+
+            var matchFound,
+                disabledUnit,
+                index,
+                isExactRange
+
+            // Go through the disabled items and try to find a match.
+            for ( index = 0; index < disabledItemsCount; index += 1 ) {
+
+                disabledUnit = disabledItems[index]
+
+                // When an exact match is found, remove it from the collection.
+                if ( calendar.isDateExact( disabledUnit, unitToEnable ) ) {
+                    matchFound = disabledItems[index] = null
+                    isExactRange = true
+                    break
+                }
+
+                // When an overlapped match is found, add the “inverted” state to it.
+                else if ( calendar.isDateOverlap( disabledUnit, unitToEnable ) ) {
+                    if ( $.isPlainObject( unitToEnable ) ) {
+                        unitToEnable.inverted = true
+                        matchFound = unitToEnable
+                    }
+                    else if ( $.isArray( unitToEnable ) ) {
+                        matchFound = unitToEnable
+                        if ( !matchFound[3] ) matchFound.push( 'inverted' )
+                    }
+                    else if ( _.isDate( unitToEnable ) ) {
+                        matchFound = [ unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted' ]
+                    }
+                    break
+                }
+            }
+
+            // If a match was found, remove a previous duplicate entry.
+            if ( matchFound ) for ( index = 0; index < disabledItemsCount; index += 1 ) {
+                if ( calendar.isDateExact( disabledItems[index], unitToEnable ) ) {
+                    disabledItems[index] = null
+                    break
+                }
+            }
+
+            // In the event that we’re dealing with an exact range of dates,
+            // make sure there are no “inverted” dates because of it.
+            if ( isExactRange ) for ( index = 0; index < disabledItemsCount; index += 1 ) {
+                if ( calendar.isDateOverlap( disabledItems[index], unitToEnable ) ) {
+                    disabledItems[index] = null
+                    break
+                }
+            }
+
+            // If something is still matched, add it into the collection.
+            if ( matchFound ) {
+                disabledItems.push( matchFound )
+            }
+        })
+    }
+
+    // Return the updated collection.
+    return disabledItems.filter(function( val ) { return val != null })
+} //DatePicker.prototype.activate
+
+
+/**
+ * Create a string for the nodes in the picker.
+ */
+DatePicker.prototype.nodes = function( isOpen ) {
+
+    var
+        calendar = this,
+        settings = calendar.settings,
+        calendarItem = calendar.item,
+        nowObject = calendarItem.now,
+        selectedObject = calendarItem.select,
+        highlightedObject = calendarItem.highlight,
+        viewsetObject = calendarItem.view,
+        disabledCollection = calendarItem.disable,
+        minLimitObject = calendarItem.min,
+        maxLimitObject = calendarItem.max,
+
+
+        // Create the calendar table head using a copy of weekday labels collection.
+        // * We do a copy so we don't mutate the original array.
+        tableHead = (function( collection, fullCollection ) {
+
+            // If the first day should be Monday, move Sunday to the end.
+            if ( settings.firstDay ) {
+                collection.push( collection.shift() )
+                fullCollection.push( fullCollection.shift() )
+            }
+
+            // Create and return the table head group.
+            return _.node(
+                'thead',
+                _.node(
+                    'tr',
+                    _.group({
+                        min: 0,
+                        max: DAYS_IN_WEEK - 1,
+                        i: 1,
+                        node: 'th',
+                        item: function( counter ) {
+                            return [
+                                collection[ counter ],
+                                settings.klass.weekdays,
+                                'scope=col title="' + fullCollection[ counter ] + '"'
+                            ]
+                        }
+                    })
+                )
+            ) //endreturn
+
+        // Materialize modified
+        })( ( settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter ).slice( 0 ), settings.weekdaysFull.slice( 0 ) ), //tableHead
+
+
+        // Create the nav for next/prev month.
+        createMonthNav = function( next ) {
+
+            // Otherwise, return the created month tag.
+            return _.node(
+                'div',
+                ' ',
+                settings.klass[ 'nav' + ( next ? 'Next' : 'Prev' ) ] + (
+
+                    // If the focused month is outside the range, disabled the button.
+                    ( next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month ) ||
+                    ( !next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month ) ?
+                    ' ' + settings.klass.navDisabled : ''
+                ),
+                'data-nav=' + ( next || -1 ) + ' ' +
+                _.ariaAttr({
+                    role: 'button',
+                    controls: calendar.$node[0].id + '_table'
+                }) + ' ' +
+                'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev ) + '"'
+            ) //endreturn
+        }, //createMonthNav
+
+
+        // Create the month label.
+        //Materialize modified
+        createMonthLabel = function(override) {
+
+            var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull
+
+             // Materialize modified
+            if (override == "short_months") {
+              monthsCollection = settings.monthsShort;
+            }
+
+            // If there are months to select, add a dropdown menu.
+            if ( settings.selectMonths  && override == undefined) {
+
+                return _.node( 'select',
+                    _.group({
+                        min: 0,
+                        max: 11,
+                        i: 1,
+                        node: 'option',
+                        item: function( loopedMonth ) {
+
+                            return [
+
+                                // The looped month and no classes.
+                                monthsCollection[ loopedMonth ], 0,
+
+                                // Set the value and selected index.
+                                'value=' + loopedMonth +
+                                ( viewsetObject.month == loopedMonth ? ' selected' : '' ) +
+                                (
+                                    (
+                                        ( viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month ) ||
+                                        ( viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month )
+                                    ) ?
+                                    ' disabled' : ''
+                                )
+                            ]
+                        }
+                    }),
+                    settings.klass.selectMonth + ' browser-default',
+                    ( isOpen ? '' : 'disabled' ) + ' ' +
+                    _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' +
+                    'title="' + settings.labelMonthSelect + '"'
+                )
+            }
+
+            // Materialize modified
+            if (override == "short_months")
+                if (selectedObject != null)
+                return _.node( 'div', monthsCollection[ selectedObject.month ] );
+                else return _.node( 'div', monthsCollection[ viewsetObject.month ] );
+
+            // If there's a need for a month selector
+            return _.node( 'div', monthsCollection[ viewsetObject.month ], settings.klass.month )
+        }, //createMonthLabel
+
+
+        // Create the year label.
+        // Materialize modified
+        createYearLabel = function(override) {
+
+            var focusedYear = viewsetObject.year,
+
+            // If years selector is set to a literal "true", set it to 5. Otherwise
+            // divide in half to get half before and half after focused year.
+            numberYears = settings.selectYears === true ? 5 : ~~( settings.selectYears / 2 )
+
+            // If there are years to select, add a dropdown menu.
+            if ( numberYears ) {
+
+                var
+                    minYear = minLimitObject.year,
+                    maxYear = maxLimitObject.year,
+                    lowestYear = focusedYear - numberYears,
+                    highestYear = focusedYear + numberYears
+
+                // If the min year is greater than the lowest year, increase the highest year
+                // by the difference and set the lowest year to the min year.
+                if ( minYear > lowestYear ) {
+                    highestYear += minYear - lowestYear
+                    lowestYear = minYear
+                }
+
+                // If the max year is less than the highest year, decrease the lowest year
+                // by the lower of the two: available and needed years. Then set the
+                // highest year to the max year.
+                if ( maxYear < highestYear ) {
+
+                    var availableYears = lowestYear - minYear,
+                        neededYears = highestYear - maxYear
+
+                    lowestYear -= availableYears > neededYears ? neededYears : availableYears
+                    highestYear = maxYear
+                }
+
+                if ( settings.selectYears  && override == undefined ) {
+                    return _.node( 'select',
+                        _.group({
+                            min: lowestYear,
+                            max: highestYear,
+                            i: 1,
+                            node: 'option',
+                            item: function( loopedYear ) {
+                                return [
+
+                                    // The looped year and no classes.
+                                    loopedYear, 0,
+
+                                    // Set the value and selected index.
+                                    'value=' + loopedYear + ( focusedYear == loopedYear ? ' selected' : '' )
+                                ]
+                            }
+                        }),
+                        settings.klass.selectYear + ' browser-default',
+                        ( isOpen ? '' : 'disabled' ) + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' +
+                        'title="' + settings.labelYearSelect + '"'
+                    )
+                }
+            }
+
+            // Materialize modified
+            if (override == "raw")
+                return _.node( 'div', focusedYear )
+
+            // Otherwise just return the year focused
+            return _.node( 'div', focusedYear, settings.klass.year )
+        } //createYearLabel
+
+
+        // Materialize modified
+        createDayLabel = function() {
+                if (selectedObject != null)
+                    return _.node( 'div', selectedObject.date)
+                else return _.node( 'div', nowObject.date)
+            }
+        createWeekdayLabel = function() {
+            var display_day;
+
+            if (selectedObject != null)
+                display_day = selectedObject.day;
+            else
+                display_day = nowObject.day;
+            var weekday = settings.weekdaysFull[ display_day ]
+            return weekday
+        }
+
+
+    // Create and return the entire calendar.
+return _.node(
+        // Date presentation View
+        'div',
+            _.node(
+                'div',
+                createWeekdayLabel(),
+                "picker__weekday-display"
+            )+
+            _.node(
+                // Div for short Month
+                'div',
+                createMonthLabel("short_months"),
+                settings.klass.month_display
+            )+
+            _.node(
+                // Div for Day
+                'div',
+                createDayLabel() ,
+                settings.klass.day_display
+            )+
+            _.node(
+                // Div for Year
+                'div',
+                createYearLabel("raw") ,
+                settings.klass.year_display
+            ),
+        settings.klass.date_display
+    )+
+    // Calendar container
+    _.node('div',
+        _.node('div',
+        ( settings.selectYears ?  createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel() ) +
+        createMonthNav() + createMonthNav( 1 ),
+        settings.klass.header
+    ) + _.node(
+        'table',
+        tableHead +
+        _.node(
+            'tbody',
+            _.group({
+                min: 0,
+                max: WEEKS_IN_CALENDAR - 1,
+                i: 1,
+                node: 'tr',
+                item: function( rowCounter ) {
+
+                    // If Monday is the first day and the month starts on Sunday, shift the date back a week.
+                    var shiftDateBy = settings.firstDay && calendar.create([ viewsetObject.year, viewsetObject.month, 1 ]).day === 0 ? -7 : 0
+
+                    return [
+                        _.group({
+                            min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index
+                            max: function() {
+                                return this.min + DAYS_IN_WEEK - 1
+                            },
+                            i: 1,
+                            node: 'td',
+                            item: function( targetDate ) {
+
+                                // Convert the time date from a relative date to a target date.
+                                targetDate = calendar.create([ viewsetObject.year, viewsetObject.month, targetDate + ( settings.firstDay ? 1 : 0 ) ])
+
+                                var isSelected = selectedObject && selectedObject.pick == targetDate.pick,
+                                    isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick,
+                                    isDisabled = disabledCollection && calendar.disabled( targetDate ) || targetDate.pick < minLimitObject.pick || targetDate.pick > maxLimitObject.pick,
+                                    formattedDate = _.trigger( calendar.formats.toString, calendar, [ settings.format, targetDate ] )
+
+                                return [
+                                    _.node(
+                                        'div',
+                                        targetDate.date,
+                                        (function( klasses ) {
+
+                                            // Add the `infocus` or `outfocus` classes based on month in view.
+                                            klasses.push( viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus )
+
+                                            // Add the `today` class if needed.
+                                            if ( nowObject.pick == targetDate.pick ) {
+                                                klasses.push( settings.klass.now )
+                                            }
+
+                                            // Add the `selected` class if something's selected and the time matches.
+                                            if ( isSelected ) {
+                                                klasses.push( settings.klass.selected )
+                                            }
+
+                                            // Add the `highlighted` class if something's highlighted and the time matches.
+                                            if ( isHighlighted ) {
+                                                klasses.push( settings.klass.highlighted )
+                                            }
+
+                                            // Add the `disabled` class if something's disabled and the object matches.
+                                            if ( isDisabled ) {
+                                                klasses.push( settings.klass.disabled )
+                                            }
+
+                                            return klasses.join( ' ' )
+                                        })([ settings.klass.day ]),
+                                        'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({
+                                            role: 'gridcell',
+                                            label: formattedDate,
+                                            selected: isSelected && calendar.$node.val() === formattedDate ? true : null,
+                                            activedescendant: isHighlighted ? true : null,
+                                            disabled: isDisabled ? true : null
+                                        })
+                                    ),
+                                    '',
+                                    _.ariaAttr({ role: 'presentation' })
+                                ] //endreturn
+                            }
+                        })
+                    ] //endreturn
+                }
+            })
+        ),
+        settings.klass.table,
+        'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({
+            role: 'grid',
+            controls: calendar.$node[0].id,
+            readonly: true
+        })
+    )
+    , settings.klass.calendar_container) // end calendar
+
+     +
+
+    // * For Firefox forms to submit, make sure to set the buttons’ `type` attributes as “button”.
+    _.node(
+        'div',
+        _.node( 'button', settings.today, "btn-flat picker__today",
+            'type=button data-pick=' + nowObject.pick +
+            ( isOpen && !calendar.disabled(nowObject) ? '' : ' disabled' ) + ' ' +
+            _.ariaAttr({ controls: calendar.$node[0].id }) ) +
+        _.node( 'button', settings.clear, "btn-flat picker__clear",
+            'type=button data-clear=1' +
+            ( isOpen ? '' : ' disabled' ) + ' ' +
+            _.ariaAttr({ controls: calendar.$node[0].id }) ) +
+        _.node('button', settings.close, "btn-flat picker__close",
+            'type=button data-close=true ' +
+            ( isOpen ? '' : ' disabled' ) + ' ' +
+            _.ariaAttr({ controls: calendar.$node[0].id }) ),
+        settings.klass.footer
+    ) //endreturn
+} //DatePicker.prototype.nodes
+
+
+
+
+/**
+ * The date picker defaults.
+ */
+DatePicker.defaults = (function( prefix ) {
+
+    return {
+
+        // The title label to use for the month nav buttons
+        labelMonthNext: 'Next month',
+        labelMonthPrev: 'Previous month',
+
+        // The title label to use for the dropdown selectors
+        labelMonthSelect: 'Select a month',
+        labelYearSelect: 'Select a year',
+
+        // Months and weekdays
+        monthsFull: [ 'January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December' ],
+        monthsShort: [ 'Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec' ],
+        weekdaysFull: [ 'Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday' ],
+        weekdaysShort: [ 'Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat' ],
+
+        // Materialize modified
+        weekdaysLetter: [ 'S', 'M', 'T', 'W', 'T', 'F', 'S' ],
+
+        // Today and clear
+        today: 'Today',
+        clear: 'Clear',
+        close: 'Close',
+
+        // The format to show on the `input` element
+        format: 'd mmmm, yyyy',
+
+        // Classes
+        klass: {
+
+            table: prefix + 'table',
+
+            header: prefix + 'header',
+
+
+            // Materialize Added klasses
+            date_display: prefix + 'date-display',
+            day_display: prefix + 'day-display',
+            month_display: prefix + 'month-display',
+            year_display: prefix + 'year-display',
+            calendar_container: prefix + 'calendar-container',
+            // end
+
+
+
+            navPrev: prefix + 'nav--prev',
+            navNext: prefix + 'nav--next',
+            navDisabled: prefix + 'nav--disabled',
+
+            month: prefix + 'month',
+            year: prefix + 'year',
+
+            selectMonth: prefix + 'select--month',
+            selectYear: prefix + 'select--year',
+
+            weekdays: prefix + 'weekday',
+
+            day: prefix + 'day',
+            disabled: prefix + 'day--disabled',
+            selected: prefix + 'day--selected',
+            highlighted: prefix + 'day--highlighted',
+            now: prefix + 'day--today',
+            infocus: prefix + 'day--infocus',
+            outfocus: prefix + 'day--outfocus',
+
+            footer: prefix + 'footer',
+
+            buttonClear: prefix + 'button--clear',
+            buttonToday: prefix + 'button--today',
+            buttonClose: prefix + 'button--close'
+        }
+    }
+})( Picker.klasses().picker + '__' )
+
+
+
+
+
+/**
+ * Extend the picker to add the date picker.
+ */
+Picker.extend( 'pickadate', DatePicker )
+
+
+}));
+
+
+;(function ($) {
+
+  $.fn.characterCounter = function(){
+    return this.each(function(){
+      var $input = $(this);
+      var $counterElement = $input.parent().find('span[class="character-counter"]');
+
+      // character counter has already been added appended to the parent container
+      if ($counterElement.length) {
+        return;
+      }
+
+      var itHasLengthAttribute = $input.attr('data-length') !== undefined;
+
+      if(itHasLengthAttribute){
+        $input.on('input', updateCounter);
+        $input.on('focus', updateCounter);
+        $input.on('blur', removeCounterElement);
+
+        addCounterElement($input);
+      }
+
+    });
+  };
+
+  function updateCounter(){
+    var maxLength     = +$(this).attr('data-length'),
+    actualLength      = +$(this).val().length,
+    isValidLength     = actualLength <= maxLength;
+
+    $(this).parent().find('span[class="character-counter"]')
+                    .html( actualLength + '/' + maxLength);
+
+    addInputStyle(isValidLength, $(this));
+  }
+
+  function addCounterElement($input) {
+    var $counterElement = $input.parent().find('span[class="character-counter"]');
+
+    if ($counterElement.length) {
+      return;
+    }
+
+    $counterElement = $('<span/>')
+                        .addClass('character-counter')
+                        .css('float','right')
+                        .css('font-size','12px')
+                        .css('height', 1);
+
+    $input.parent().append($counterElement);
+  }
+
+  function removeCounterElement(){
+    $(this).parent().find('span[class="character-counter"]').html('');
+  }
+
+  function addInputStyle(isValidLength, $input){
+    var inputHasInvalidClass = $input.hasClass('invalid');
+    if (isValidLength && inputHasInvalidClass) {
+      $input.removeClass('invalid');
+    }
+    else if(!isValidLength && !inputHasInvalidClass){
+      $input.removeClass('valid');
+      $input.addClass('invalid');
+    }
+  }
+
+  $(document).ready(function(){
+    $('input, textarea').characterCounter();
+  });
+
+}( jQuery ));
+;(function ($) {
+
+  var methods = {
+
+    init : function(options) {
+      var defaults = {
+        duration: 200, // ms
+        dist: -100, // zoom scale TODO: make this more intuitive as an option
+        shift: 0, // spacing for center image
+        padding: 0, // Padding between non center items
+        fullWidth: false, // Change to full width styles
+        indicators: false, // Toggle indicators
+        noWrap: false, // Don't wrap around and cycle through items.
+        onCycleTo: null // Callback for when a new slide is cycled to.
+      };
+      options = $.extend(defaults, options);
+
+      return this.each(function() {
+
+        var images, item_width, item_height, offset, center, pressed, dim, count,
+            reference, referenceY, amplitude, target, velocity,
+            xform, frame, timestamp, ticker, dragged, vertical_dragged;
+        var $indicators = $('<ul class="indicators"></ul>');
+
+
+        // Initialize
+        var view = $(this);
+        var showIndicators = view.attr('data-indicators') || options.indicators;
+
+        // Don't double initialize.
+        if (view.hasClass('initialized')) {
+          // Redraw carousel.
+          $(this).trigger('carouselNext', [0.000001]);
+          return true;
+        }
+
+
+        // Options
+        if (options.fullWidth) {
+          options.dist = 0;
+          var firstImage = view.find('.carousel-item img').first();
+          if (firstImage.length) {
+            imageHeight = firstImage.on('load', function(){
+              view.css('height', $(this).height());
+            });
+          } else {
+            imageHeight = view.find('.carousel-item').first().height();
+            view.css('height', imageHeight);
+          }
+
+          // Offset fixed items when indicators.
+          if (showIndicators) {
+            view.find('.carousel-fixed-item').addClass('with-indicators');
+          }
+        }
+
+
+        view.addClass('initialized');
+        pressed = false;
+        offset = target = 0;
+        images = [];
+        item_width = view.find('.carousel-item').first().innerWidth();
+        item_height = view.find('.carousel-item').first().innerHeight();
+        dim = item_width * 2 + options.padding;
+
+        view.find('.carousel-item').each(function (i) {
+          images.push($(this)[0]);
+          if (showIndicators) {
+            var $indicator = $('<li class="indicator-item"></li>');
+
+            // Add active to first by default.
+            if (i === 0) {
+              $indicator.addClass('active');
+            }
+
+            // Handle clicks on indicators.
+            $indicator.click(function (e) {
+              e.stopPropagation();
+
+              var index = $(this).index();
+              cycleTo(index);
+            });
+            $indicators.append($indicator);
+          }
+        });
+
+        if (showIndicators) {
+          view.append($indicators);
+        }
+        count = images.length;
+
+
+        function setupEvents() {
+          if (typeof window.ontouchstart !== 'undefined') {
+            view[0].addEventListener('touchstart', tap);
+            view[0].addEventListener('touchmove', drag);
+            view[0].addEventListener('touchend', release);
+          }
+          view[0].addEventListener('mousedown', tap);
+          view[0].addEventListener('mousemove', drag);
+          view[0].addEventListener('mouseup', release);
+          view[0].addEventListener('mouseleave', release);
+          view[0].addEventListener('click', click);
+        }
+
+        function xpos(e) {
+          // touch event
+          if (e.targetTouches && (e.targetTouches.length >= 1)) {
+            return e.targetTouches[0].clientX;
+          }
+
+          // mouse event
+          return e.clientX;
+        }
+
+        function ypos(e) {
+          // touch event
+          if (e.targetTouches && (e.targetTouches.length >= 1)) {
+            return e.targetTouches[0].clientY;
+          }
+
+          // mouse event
+          return e.clientY;
+        }
+
+        function wrap(x) {
+          return (x >= count) ? (x % count) : (x < 0) ? wrap(count + (x % count)) : x;
+        }
+
+        function scroll(x) {
+          var i, half, delta, dir, tween, el, alignment, xTranslation;
+          var lastCenter = center;
+
+          offset = (typeof x === 'number') ? x : offset;
+          center = Math.floor((offset + dim / 2) / dim);
+          delta = offset - center * dim;
+          dir = (delta < 0) ? 1 : -1;
+          tween = -dir * delta * 2 / dim;
+          half = count >> 1;
+
+          if (!options.fullWidth) {
+            alignment = 'translateX(' + (view[0].clientWidth - item_width) / 2 + 'px) ';
+            alignment += 'translateY(' + (view[0].clientHeight - item_height) / 2 + 'px)';
+          } else {
+            alignment = 'translateX(0)';
+          }
+
+          // Set indicator active
+          if (showIndicators) {
+            var diff = (center % count);
+            var activeIndicator = $indicators.find('.indicator-item.active');
+            if (activeIndicator.index() !== diff) {
+              activeIndicator.removeClass('active');
+              $indicators.find('.indicator-item').eq(diff).addClass('active');
+            }
+          }
+
+          // center
+          // Don't show wrapped items.
+          if (!options.noWrap || (center >= 0 && center < count)) {
+            el = images[wrap(center)];
+
+            // Add active class to center item.
+            if (!$(el).hasClass('active')) {
+              view.find('.carousel-item').removeClass('active');
+              $(el).addClass('active');
+            }
+            el.style[xform] = alignment +
+              ' translateX(' + (-delta / 2) + 'px)' +
+              ' translateX(' + (dir * options.shift * tween * i) + 'px)' +
+              ' translateZ(' + (options.dist * tween) + 'px)';
+            el.style.zIndex = 0;
+            if (options.fullWidth) { tweenedOpacity = 1; }
+            else { tweenedOpacity = 1 - 0.2 * tween; }
+            el.style.opacity = tweenedOpacity;
+            el.style.display = 'block';
+          }
+
+          for (i = 1; i <= half; ++i) {
+            // right side
+            if (options.fullWidth) {
+              zTranslation = options.dist;
+              tweenedOpacity = (i === half && delta < 0) ? 1 - tween : 1;
+            } else {
+              zTranslation = options.dist * (i * 2 + tween * dir);
+              tweenedOpacity = 1 - 0.2 * (i * 2 + tween * dir);
+            }
+            // Don't show wrapped items.
+            if (!options.noWrap || center + i < count) {
+              el = images[wrap(center + i)];
+              el.style[xform] = alignment +
+                ' translateX(' + (options.shift + (dim * i - delta) / 2) + 'px)' +
+                ' translateZ(' + zTranslation + 'px)';
+              el.style.zIndex = -i;
+              el.style.opacity = tweenedOpacity;
+              el.style.display = 'block';
+            }
+
+
+            // left side
+            if (options.fullWidth) {
+              zTranslation = options.dist;
+              tweenedOpacity = (i === half && delta > 0) ? 1 - tween : 1;
+            } else {
+              zTranslation = options.dist * (i * 2 - tween * dir);
+              tweenedOpacity = 1 - 0.2 * (i * 2 - tween * dir);
+            }
+            // Don't show wrapped items.
+            if (!options.noWrap || center - i >= 0) {
+              el = images[wrap(center - i)];
+              el.style[xform] = alignment +
+                ' translateX(' + (-options.shift + (-dim * i - delta) / 2) + 'px)' +
+                ' translateZ(' + zTranslation + 'px)';
+              el.style.zIndex = -i;
+              el.style.opacity = tweenedOpacity;
+              el.style.display = 'block';
+            }
+          }
+
+          // center
+          // Don't show wrapped items.
+          if (!options.noWrap || (center >= 0 && center < count)) {
+            el = images[wrap(center)];
+            el.style[xform] = alignment +
+              ' translateX(' + (-delta / 2) + 'px)' +
+              ' translateX(' + (dir * options.shift * tween) + 'px)' +
+              ' translateZ(' + (options.dist * tween) + 'px)';
+            el.style.zIndex = 0;
+            if (options.fullWidth) { tweenedOpacity = 1; }
+            else { tweenedOpacity = 1 - 0.2 * tween; }
+            el.style.opacity = tweenedOpacity;
+            el.style.display = 'block';
+          }
+
+          // onCycleTo callback
+          if (lastCenter !== center &&
+              typeof(options.onCycleTo) === "function") {
+            var $curr_item = view.find('.carousel-item').eq(wrap(center));
+            options.onCycleTo.call(this, $curr_item, dragged);
+          }
+        }
+
+        function track() {
+          var now, elapsed, delta, v;
+
+          now = Date.now();
+          elapsed = now - timestamp;
+          timestamp = now;
+          delta = offset - frame;
+          frame = offset;
+
+          v = 1000 * delta / (1 + elapsed);
+          velocity = 0.8 * v + 0.2 * velocity;
+        }
+
+        function autoScroll() {
+          var elapsed, delta;
+
+          if (amplitude) {
+            elapsed = Date.now() - timestamp;
+            delta = amplitude * Math.exp(-elapsed / options.duration);
+            if (delta > 2 || delta < -2) {
+                scroll(target - delta);
+                requestAnimationFrame(autoScroll);
+            } else {
+                scroll(target);
+            }
+          }
+        }
+
+        function click(e) {
+          // Disable clicks if carousel was dragged.
+          if (dragged) {
+            e.preventDefault();
+            e.stopPropagation();
+            return false;
+
+          } else if (!options.fullWidth) {
+            var clickedIndex = $(e.target).closest('.carousel-item').index();
+            var diff = (center % count) - clickedIndex;
+
+            // Disable clicks if carousel was shifted by click
+            if (diff !== 0) {
+              e.preventDefault();
+              e.stopPropagation();
+            }
+            cycleTo(clickedIndex);
+          }
+        }
+
+        function cycleTo(n) {
+          var diff = (center % count) - n;
+
+          // Account for wraparound.
+          if (!options.noWrap) {
+            if (diff < 0) {
+              if (Math.abs(diff + count) < Math.abs(diff)) { diff += count; }
+
+            } else if (diff > 0) {
+              if (Math.abs(diff - count) < diff) { diff -= count; }
+            }
+          }
+
+          // Call prev or next accordingly.
+          if (diff < 0) {
+            view.trigger('carouselNext', [Math.abs(diff)]);
+
+          } else if (diff > 0) {
+            view.trigger('carouselPrev', [diff]);
+          }
+        }
+
+        function tap(e) {
+          pressed = true;
+          dragged = false;
+          vertical_dragged = false;
+          reference = xpos(e);
+          referenceY = ypos(e);
+
+          velocity = amplitude = 0;
+          frame = offset;
+          timestamp = Date.now();
+          clearInterval(ticker);
+          ticker = setInterval(track, 100);
+
+        }
+
+        function drag(e) {
+          var x, delta, deltaY;
+          if (pressed) {
+            x = xpos(e);
+            y = ypos(e);
+            delta = reference - x;
+            deltaY = Math.abs(referenceY - y);
+            if (deltaY < 30 && !vertical_dragged) {
+              // If vertical scrolling don't allow dragging.
+              if (delta > 2 || delta < -2) {
+                dragged = true;
+                reference = x;
+                scroll(offset + delta);
+              }
+
+            } else if (dragged) {
+              // If dragging don't allow vertical scroll.
+              e.preventDefault();
+              e.stopPropagation();
+              return false;
+
+            } else {
+              // Vertical scrolling.
+              vertical_dragged = true;
+            }
+          }
+
+          if (dragged) {
+            // If dragging don't allow vertical scroll.
+            e.preventDefault();
+            e.stopPropagation();
+            return false;
+          }
+        }
+
+        function release(e) {
+          if (pressed) {
+            pressed = false;
+          } else {
+            return;
+          }
+
+          clearInterval(ticker);
+          target = offset;
+          if (velocity > 10 || velocity < -10) {
+            amplitude = 0.9 * velocity;
+            target = offset + amplitude;
+          }
+          target = Math.round(target / dim) * dim;
+
+          // No wrap of items.
+          if (options.noWrap) {
+            if (target >= dim * (count - 1)) {
+              target = dim * (count - 1);
+            } else if (target < 0) {
+              target = 0;
+            }
+          }
+          amplitude = target - offset;
+          timestamp = Date.now();
+          requestAnimationFrame(autoScroll);
+
+          if (dragged) {
+            e.preventDefault();
+            e.stopPropagation();
+          }
+          return false;
+        }
+
+        xform = 'transform';
+        ['webkit', 'Moz', 'O', 'ms'].every(function (prefix) {
+          var e = prefix + 'Transform';
+          if (typeof document.body.style[e] !== 'undefined') {
+            xform = e;
+            return false;
+          }
+          return true;
+        });
+
+
+        $(window).on('resize.carousel', function() {
+          if (options.fullWidth) {
+            item_width = view.find('.carousel-item').first().innerWidth();
+            item_height = view.find('.carousel-item').first().innerHeight();
+            dim = item_width * 2 + options.padding;
+            offset = center * 2 * item_width;
+            target = offset;
+          } else {
+            scroll();
+          }
+        });
+
+        setupEvents();
+        scroll(offset);
+
+        $(this).on('carouselNext', function(e, n) {
+          if (n === undefined) {
+            n = 1;
+          }
+          target = (dim * Math.round(offset / dim)) + (dim * n);
+          if (offset !== target) {
+            amplitude = target - offset;
+            timestamp = Date.now();
+            requestAnimationFrame(autoScroll);
+          }
+        });
+
+        $(this).on('carouselPrev', function(e, n) {
+          if (n === undefined) {
+            n = 1;
+          }
+          target = (dim * Math.round(offset / dim)) - (dim * n);
+          if (offset !== target) {
+            amplitude = target - offset;
+            timestamp = Date.now();
+            requestAnimationFrame(autoScroll);
+          }
+        });
+
+        $(this).on('carouselSet', function(e, n) {
+          if (n === undefined) {
+            n = 0;
+          }
+          cycleTo(n);
+        });
+
+      });
+
+
+
+    },
+    next : function(n) {
+      $(this).trigger('carouselNext', [n]);
+    },
+    prev : function(n) {
+      $(this).trigger('carouselPrev', [n]);
+    },
+    set : function(n) {
+      $(this).trigger('carouselSet', [n]);
+    }
+  };
+
+
+    $.fn.carousel = function(methodOrOptions) {
+      if ( methods[methodOrOptions] ) {
+        return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 ));
+      } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) {
+        // Default to "init"
+        return methods.init.apply( this, arguments );
+      } else {
+        $.error( 'Method ' +  methodOrOptions + ' does not exist on jQuery.carousel' );
+      }
+    }; // Plugin end
+}( jQuery ));
\ No newline at end of file
diff --git a/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/js/materialize.min.js b/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/js/materialize.min.js
new file mode 100644 (file)
index 0000000..00c0d5f
--- /dev/null
@@ -0,0 +1,10 @@
+/*!
+ * Materialize v0.98.0 (http://materializecss.com)
+ * Copyright 2014-2015 Materialize
+ * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
+ */
+if("undefined"==typeof jQuery){var jQuery;jQuery="function"==typeof require?$=require("jquery"):$}jQuery.easing.jswing=jQuery.easing.swing,jQuery.extend(jQuery.easing,{def:"easeOutQuad",swing:function(a,b,c,d,e){return jQuery.easing[jQuery.easing.def](a,b,c,d,e)},easeInQuad:function(a,b,c,d,e){return d*(b/=e)*b+c},easeOutQuad:function(a,b,c,d,e){return-d*(b/=e)*(b-2)+c},easeInOutQuad:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b+c:-d/2*(--b*(b-2)-1)+c},easeInCubic:function(a,b,c,d,e){return d*(b/=e)*b*b+c},easeOutCubic:function(a,b,c,d,e){return d*((b=b/e-1)*b*b+1)+c},easeInOutCubic:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b+c:d/2*((b-=2)*b*b+2)+c},easeInQuart:function(a,b,c,d,e){return d*(b/=e)*b*b*b+c},easeOutQuart:function(a,b,c,d,e){return-d*((b=b/e-1)*b*b*b-1)+c},easeInOutQuart:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b*b+c:-d/2*((b-=2)*b*b*b-2)+c},easeInQuint:function(a,b,c,d,e){return d*(b/=e)*b*b*b*b+c},easeOutQuint:function(a,b,c,d,e){return d*((b=b/e-1)*b*b*b*b+1)+c},easeInOutQuint:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b*b*b+c:d/2*((b-=2)*b*b*b*b+2)+c},easeInSine:function(a,b,c,d,e){return-d*Math.cos(b/e*(Math.PI/2))+d+c},easeOutSine:function(a,b,c,d,e){return d*Math.sin(b/e*(Math.PI/2))+c},easeInOutSine:function(a,b,c,d,e){return-d/2*(Math.cos(Math.PI*b/e)-1)+c},easeInExpo:function(a,b,c,d,e){return 0==b?c:d*Math.pow(2,10*(b/e-1))+c},easeOutExpo:function(a,b,c,d,e){return b==e?c+d:d*(-Math.pow(2,-10*b/e)+1)+c},easeInOutExpo:function(a,b,c,d,e){return 0==b?c:b==e?c+d:(b/=e/2)<1?d/2*Math.pow(2,10*(b-1))+c:d/2*(-Math.pow(2,-10*--b)+2)+c},easeInCirc:function(a,b,c,d,e){return-d*(Math.sqrt(1-(b/=e)*b)-1)+c},easeOutCirc:function(a,b,c,d,e){return d*Math.sqrt(1-(b=b/e-1)*b)+c},easeInOutCirc:function(a,b,c,d,e){return(b/=e/2)<1?-d/2*(Math.sqrt(1-b*b)-1)+c:d/2*(Math.sqrt(1-(b-=2)*b)+1)+c},easeInElastic:function(a,b,c,d,e){var f=1.70158,g=0,h=d;if(0==b)return c;if(1==(b/=e))return c+d;if(g||(g=.3*e),h<Math.abs(d)){h=d;var f=g/4}else var f=g/(2*Math.PI)*Math.asin(d/h);return-(h*Math.pow(2,10*(b-=1))*Math.sin((b*e-f)*(2*Math.PI)/g))+c},easeOutElastic:function(a,b,c,d,e){var f=1.70158,g=0,h=d;if(0==b)return c;if(1==(b/=e))return c+d;if(g||(g=.3*e),h<Math.abs(d)){h=d;var f=g/4}else var f=g/(2*Math.PI)*Math.asin(d/h);return h*Math.pow(2,-10*b)*Math.sin((b*e-f)*(2*Math.PI)/g)+d+c},easeInOutElastic:function(a,b,c,d,e){var f=1.70158,g=0,h=d;if(0==b)return c;if(2==(b/=e/2))return c+d;if(g||(g=e*(.3*1.5)),h<Math.abs(d)){h=d;var f=g/4}else var f=g/(2*Math.PI)*Math.asin(d/h);return b<1?-.5*(h*Math.pow(2,10*(b-=1))*Math.sin((b*e-f)*(2*Math.PI)/g))+c:h*Math.pow(2,-10*(b-=1))*Math.sin((b*e-f)*(2*Math.PI)/g)*.5+d+c},easeInBack:function(a,b,c,d,e,f){return void 0==f&&(f=1.70158),d*(b/=e)*b*((f+1)*b-f)+c},easeOutBack:function(a,b,c,d,e,f){return void 0==f&&(f=1.70158),d*((b=b/e-1)*b*((f+1)*b+f)+1)+c},easeInOutBack:function(a,b,c,d,e,f){return void 0==f&&(f=1.70158),(b/=e/2)<1?d/2*(b*b*(((f*=1.525)+1)*b-f))+c:d/2*((b-=2)*b*(((f*=1.525)+1)*b+f)+2)+c},easeInBounce:function(a,b,c,d,e){return d-jQuery.easing.easeOutBounce(a,e-b,0,d,e)+c},easeOutBounce:function(a,b,c,d,e){return(b/=e)<1/2.75?d*(7.5625*b*b)+c:b<2/2.75?d*(7.5625*(b-=1.5/2.75)*b+.75)+c:b<2.5/2.75?d*(7.5625*(b-=2.25/2.75)*b+.9375)+c:d*(7.5625*(b-=2.625/2.75)*b+.984375)+c},easeInOutBounce:function(a,b,c,d,e){return b<e/2?.5*jQuery.easing.easeInBounce(a,2*b,0,d,e)+c:.5*jQuery.easing.easeOutBounce(a,2*b-e,0,d,e)+.5*d+c}}),jQuery.extend(jQuery.easing,{easeInOutMaterial:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b+c:d/4*((b-=2)*b*b+2)+c}}),jQuery.Velocity?console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity."):(!function(a){function b(a){var b=a.length,d=c.type(a);return"function"!==d&&!c.isWindow(a)&&(!(1!==a.nodeType||!b)||("array"===d||0===b||"number"==typeof b&&b>0&&b-1 in a))}if(!a.jQuery){var c=function(a,b){return new c.fn.init(a,b)};c.isWindow=function(a){return null!=a&&a==a.window},c.type=function(a){return null==a?a+"":"object"==typeof a||"function"==typeof a?e[g.call(a)]||"object":typeof a},c.isArray=Array.isArray||function(a){return"array"===c.type(a)},c.isPlainObject=function(a){var b;if(!a||"object"!==c.type(a)||a.nodeType||c.isWindow(a))return!1;try{if(a.constructor&&!f.call(a,"constructor")&&!f.call(a.constructor.prototype,"isPrototypeOf"))return!1}catch(d){return!1}for(b in a);return void 0===b||f.call(a,b)},c.each=function(a,c,d){var e,f=0,g=a.length,h=b(a);if(d){if(h)for(;g>f&&(e=c.apply(a[f],d),e!==!1);f++);else for(f in a)if(e=c.apply(a[f],d),e===!1)break}else if(h)for(;g>f&&(e=c.call(a[f],f,a[f]),e!==!1);f++);else for(f in a)if(e=c.call(a[f],f,a[f]),e===!1)break;return a},c.data=function(a,b,e){if(void 0===e){var f=a[c.expando],g=f&&d[f];if(void 0===b)return g;if(g&&b in g)return g[b]}else if(void 0!==b){var f=a[c.expando]||(a[c.expando]=++c.uuid);return d[f]=d[f]||{},d[f][b]=e,e}},c.removeData=function(a,b){var e=a[c.expando],f=e&&d[e];f&&c.each(b,function(a,b){delete f[b]})},c.extend=function(){var a,b,d,e,f,g,h=arguments[0]||{},i=1,j=arguments.length,k=!1;for("boolean"==typeof h&&(k=h,h=arguments[i]||{},i++),"object"!=typeof h&&"function"!==c.type(h)&&(h={}),i===j&&(h=this,i--);j>i;i++)if(null!=(f=arguments[i]))for(e in f)a=h[e],d=f[e],h!==d&&(k&&d&&(c.isPlainObject(d)||(b=c.isArray(d)))?(b?(b=!1,g=a&&c.isArray(a)?a:[]):g=a&&c.isPlainObject(a)?a:{},h[e]=c.extend(k,g,d)):void 0!==d&&(h[e]=d));return h},c.queue=function(a,d,e){function f(a,c){var d=c||[];return null!=a&&(b(Object(a))?!function(a,b){for(var c=+b.length,d=0,e=a.length;c>d;)a[e++]=b[d++];if(c!==c)for(;void 0!==b[d];)a[e++]=b[d++];return a.length=e,a}(d,"string"==typeof a?[a]:a):[].push.call(d,a)),d}if(a){d=(d||"fx")+"queue";var g=c.data(a,d);return e?(!g||c.isArray(e)?g=c.data(a,d,f(e)):g.push(e),g):g||[]}},c.dequeue=function(a,b){c.each(a.nodeType?[a]:a,function(a,d){b=b||"fx";var e=c.queue(d,b),f=e.shift();"inprogress"===f&&(f=e.shift()),f&&("fx"===b&&e.unshift("inprogress"),f.call(d,function(){c.dequeue(d,b)}))})},c.fn=c.prototype={init:function(a){if(a.nodeType)return this[0]=a,this;throw new Error("Not a DOM node.")},offset:function(){var b=this[0].getBoundingClientRect?this[0].getBoundingClientRect():{top:0,left:0};return{top:b.top+(a.pageYOffset||document.scrollTop||0)-(document.clientTop||0),left:b.left+(a.pageXOffset||document.scrollLeft||0)-(document.clientLeft||0)}},position:function(){function a(){for(var a=this.offsetParent||document;a&&"html"===!a.nodeType.toLowerCase&&"static"===a.style.position;)a=a.offsetParent;return a||document}var b=this[0],a=a.apply(b),d=this.offset(),e=/^(?:body|html)$/i.test(a.nodeName)?{top:0,left:0}:c(a).offset();return d.top-=parseFloat(b.style.marginTop)||0,d.left-=parseFloat(b.style.marginLeft)||0,a.style&&(e.top+=parseFloat(a.style.borderTopWidth)||0,e.left+=parseFloat(a.style.borderLeftWidth)||0),{top:d.top-e.top,left:d.left-e.left}}};var d={};c.expando="velocity"+(new Date).getTime(),c.uuid=0;for(var e={},f=e.hasOwnProperty,g=e.toString,h="Boolean Number String Function Array Date RegExp Object Error".split(" "),i=0;i<h.length;i++)e["[object "+h[i]+"]"]=h[i].toLowerCase();c.fn.init.prototype=c.fn,a.Velocity={Utilities:c}}}(window),function(a){"object"==typeof module&&"object"==typeof module.exports?module.exports=a():"function"==typeof define&&define.amd?define(a):a()}(function(){return function(a,b,c,d){function e(a){for(var b=-1,c=a?a.length:0,d=[];++b<c;){var e=a[b];e&&d.push(e)}return d}function f(a){return p.isWrapped(a)?a=[].slice.call(a):p.isNode(a)&&(a=[a]),a}function g(a){var b=m.data(a,"velocity");return null===b?d:b}function h(a){return function(b){return Math.round(b*a)*(1/a)}}function i(a,c,d,e){function f(a,b){return 1-3*b+3*a}function g(a,b){return 3*b-6*a}function h(a){return 3*a}function i(a,b,c){return((f(b,c)*a+g(b,c))*a+h(b))*a}function j(a,b,c){return 3*f(b,c)*a*a+2*g(b,c)*a+h(b)}function k(b,c){for(var e=0;p>e;++e){var f=j(c,a,d);if(0===f)return c;var g=i(c,a,d)-b;c-=g/f}return c}function l(){for(var b=0;t>b;++b)x[b]=i(b*u,a,d)}function m(b,c,e){var f,g,h=0;do g=c+(e-c)/2,f=i(g,a,d)-b,f>0?e=g:c=g;while(Math.abs(f)>r&&++h<s);return g}function n(b){for(var c=0,e=1,f=t-1;e!=f&&x[e]<=b;++e)c+=u;--e;var g=(b-x[e])/(x[e+1]-x[e]),h=c+g*u,i=j(h,a,d);return i>=q?k(b,h):0==i?h:m(b,c,c+u)}function o(){y=!0,(a!=c||d!=e)&&l()}var p=4,q=.001,r=1e-7,s=10,t=11,u=1/(t-1),v="Float32Array"in b;if(4!==arguments.length)return!1;for(var w=0;4>w;++w)if("number"!=typeof arguments[w]||isNaN(arguments[w])||!isFinite(arguments[w]))return!1;a=Math.min(a,1),d=Math.min(d,1),a=Math.max(a,0),d=Math.max(d,0);var x=v?new Float32Array(t):new Array(t),y=!1,z=function(b){return y||o(),a===c&&d===e?b:0===b?0:1===b?1:i(n(b),c,e)};z.getControlPoints=function(){return[{x:a,y:c},{x:d,y:e}]};var A="generateBezier("+[a,c,d,e]+")";return z.toString=function(){return A},z}function j(a,b){var c=a;return p.isString(a)?t.Easings[a]||(c=!1):c=p.isArray(a)&&1===a.length?h.apply(null,a):p.isArray(a)&&2===a.length?u.apply(null,a.concat([b])):!(!p.isArray(a)||4!==a.length)&&i.apply(null,a),c===!1&&(c=t.Easings[t.defaults.easing]?t.defaults.easing:s),c}function k(a){if(a){var b=(new Date).getTime(),c=t.State.calls.length;c>1e4&&(t.State.calls=e(t.State.calls));for(var f=0;c>f;f++)if(t.State.calls[f]){var h=t.State.calls[f],i=h[0],j=h[2],n=h[3],o=!!n,q=null;n||(n=t.State.calls[f][3]=b-16);for(var r=Math.min((b-n)/j.duration,1),s=0,u=i.length;u>s;s++){var w=i[s],y=w.element;if(g(y)){var z=!1;if(j.display!==d&&null!==j.display&&"none"!==j.display){if("flex"===j.display){var A=["-webkit-box","-moz-box","-ms-flexbox","-webkit-flex"];m.each(A,function(a,b){v.setPropertyValue(y,"display",b)})}v.setPropertyValue(y,"display",j.display)}j.visibility!==d&&"hidden"!==j.visibility&&v.setPropertyValue(y,"visibility",j.visibility);for(var B in w)if("element"!==B){var C,D=w[B],E=p.isString(D.easing)?t.Easings[D.easing]:D.easing;if(1===r)C=D.endValue;else{var F=D.endValue-D.startValue;if(C=D.startValue+F*E(r,j,F),!o&&C===D.currentValue)continue}if(D.currentValue=C,"tween"===B)q=C;else{if(v.Hooks.registered[B]){var G=v.Hooks.getRoot(B),H=g(y).rootPropertyValueCache[G];H&&(D.rootPropertyValue=H)}var I=v.setPropertyValue(y,B,D.currentValue+(0===parseFloat(C)?"":D.unitType),D.rootPropertyValue,D.scrollData);v.Hooks.registered[B]&&(g(y).rootPropertyValueCache[G]=v.Normalizations.registered[G]?v.Normalizations.registered[G]("extract",null,I[1]):I[1]),"transform"===I[0]&&(z=!0)}}j.mobileHA&&g(y).transformCache.translate3d===d&&(g(y).transformCache.translate3d="(0px, 0px, 0px)",z=!0),z&&v.flushTransformCache(y)}}j.display!==d&&"none"!==j.display&&(t.State.calls[f][2].display=!1),j.visibility!==d&&"hidden"!==j.visibility&&(t.State.calls[f][2].visibility=!1),j.progress&&j.progress.call(h[1],h[1],r,Math.max(0,n+j.duration-b),n,q),1===r&&l(f)}}t.State.isTicking&&x(k)}function l(a,b){if(!t.State.calls[a])return!1;for(var c=t.State.calls[a][0],e=t.State.calls[a][1],f=t.State.calls[a][2],h=t.State.calls[a][4],i=!1,j=0,k=c.length;k>j;j++){var l=c[j].element;if(b||f.loop||("none"===f.display&&v.setPropertyValue(l,"display",f.display),"hidden"===f.visibility&&v.setPropertyValue(l,"visibility",f.visibility)),f.loop!==!0&&(m.queue(l)[1]===d||!/\.velocityQueueEntryFlag/i.test(m.queue(l)[1]))&&g(l)){g(l).isAnimating=!1,g(l).rootPropertyValueCache={};var n=!1;m.each(v.Lists.transforms3D,function(a,b){var c=/^scale/.test(b)?1:0,e=g(l).transformCache[b];g(l).transformCache[b]!==d&&new RegExp("^\\("+c+"[^.]").test(e)&&(n=!0,delete g(l).transformCache[b])}),f.mobileHA&&(n=!0,delete g(l).transformCache.translate3d),n&&v.flushTransformCache(l),v.Values.removeClass(l,"velocity-animating")}if(!b&&f.complete&&!f.loop&&j===k-1)try{f.complete.call(e,e)}catch(o){setTimeout(function(){throw o},1)}h&&f.loop!==!0&&h(e),g(l)&&f.loop===!0&&!b&&(m.each(g(l).tweensContainer,function(a,b){/^rotate/.test(a)&&360===parseFloat(b.endValue)&&(b.endValue=0,b.startValue=360),/^backgroundPosition/.test(a)&&100===parseFloat(b.endValue)&&"%"===b.unitType&&(b.endValue=0,b.startValue=100)}),t(l,"reverse",{loop:!0,delay:f.delay})),f.queue!==!1&&m.dequeue(l,f.queue)}t.State.calls[a]=!1;for(var p=0,q=t.State.calls.length;q>p;p++)if(t.State.calls[p]!==!1){i=!0;break}i===!1&&(t.State.isTicking=!1,delete t.State.calls,t.State.calls=[])}var m,n=function(){if(c.documentMode)return c.documentMode;for(var a=7;a>4;a--){var b=c.createElement("div");if(b.innerHTML="<!--[if IE "+a+"]><span></span><![endif]-->",b.getElementsByTagName("span").length)return b=null,a}return d}(),o=function(){var a=0;return b.webkitRequestAnimationFrame||b.mozRequestAnimationFrame||function(b){var c,d=(new Date).getTime();return c=Math.max(0,16-(d-a)),a=d+c,setTimeout(function(){b(d+c)},c)}}(),p={isString:function(a){return"string"==typeof a},isArray:Array.isArray||function(a){return"[object Array]"===Object.prototype.toString.call(a)},isFunction:function(a){return"[object Function]"===Object.prototype.toString.call(a)},isNode:function(a){return a&&a.nodeType},isNodeList:function(a){return"object"==typeof a&&/^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(a))&&a.length!==d&&(0===a.length||"object"==typeof a[0]&&a[0].nodeType>0)},isWrapped:function(a){return a&&(a.jquery||b.Zepto&&b.Zepto.zepto.isZ(a))},isSVG:function(a){return b.SVGElement&&a instanceof b.SVGElement},isEmptyObject:function(a){for(var b in a)return!1;return!0}},q=!1;if(a.fn&&a.fn.jquery?(m=a,q=!0):m=b.Velocity.Utilities,8>=n&&!q)throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");if(7>=n)return void(jQuery.fn.velocity=jQuery.fn.animate);var r=400,s="swing",t={State:{isMobile:/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),isAndroid:/Android/i.test(navigator.userAgent),isGingerbread:/Android 2\.3\.[3-7]/i.test(navigator.userAgent),isChrome:b.chrome,isFirefox:/Firefox/i.test(navigator.userAgent),prefixElement:c.createElement("div"),prefixMatches:{},scrollAnchor:null,scrollPropertyLeft:null,scrollPropertyTop:null,isTicking:!1,calls:[]},CSS:{},Utilities:m,Redirects:{},Easings:{},Promise:b.Promise,defaults:{queue:"",duration:r,easing:s,begin:d,complete:d,progress:d,display:d,visibility:d,loop:!1,delay:!1,mobileHA:!0,_cacheValues:!0},init:function(a){m.data(a,"velocity",{isSVG:p.isSVG(a),isAnimating:!1,computedStyle:null,tweensContainer:null,rootPropertyValueCache:{},transformCache:{}})},hook:null,mock:!1,version:{major:1,minor:2,patch:2},debug:!1};b.pageYOffset!==d?(t.State.scrollAnchor=b,t.State.scrollPropertyLeft="pageXOffset",t.State.scrollPropertyTop="pageYOffset"):(t.State.scrollAnchor=c.documentElement||c.body.parentNode||c.body,t.State.scrollPropertyLeft="scrollLeft",t.State.scrollPropertyTop="scrollTop");var u=function(){function a(a){return-a.tension*a.x-a.friction*a.v}function b(b,c,d){var e={x:b.x+d.dx*c,v:b.v+d.dv*c,tension:b.tension,friction:b.friction};return{dx:e.v,dv:a(e)}}function c(c,d){var e={dx:c.v,dv:a(c)},f=b(c,.5*d,e),g=b(c,.5*d,f),h=b(c,d,g),i=1/6*(e.dx+2*(f.dx+g.dx)+h.dx),j=1/6*(e.dv+2*(f.dv+g.dv)+h.dv);return c.x=c.x+i*d,c.v=c.v+j*d,c}return function d(a,b,e){var f,g,h,i={x:-1,v:0,tension:null,friction:null},j=[0],k=0,l=1e-4,m=.016;for(a=parseFloat(a)||500,b=parseFloat(b)||20,e=e||null,i.tension=a,i.friction=b,f=null!==e,f?(k=d(a,b),g=k/e*m):g=m;h=c(h||i,g),j.push(1+h.x),k+=16,Math.abs(h.x)>l&&Math.abs(h.v)>l;);return f?function(a){return j[a*(j.length-1)|0]}:k}}();t.Easings={linear:function(a){return a},swing:function(a){return.5-Math.cos(a*Math.PI)/2},spring:function(a){return 1-Math.cos(4.5*a*Math.PI)*Math.exp(6*-a)}},m.each([["ease",[.25,.1,.25,1]],["ease-in",[.42,0,1,1]],["ease-out",[0,0,.58,1]],["ease-in-out",[.42,0,.58,1]],["easeInSine",[.47,0,.745,.715]],["easeOutSine",[.39,.575,.565,1]],["easeInOutSine",[.445,.05,.55,.95]],["easeInQuad",[.55,.085,.68,.53]],["easeOutQuad",[.25,.46,.45,.94]],["easeInOutQuad",[.455,.03,.515,.955]],["easeInCubic",[.55,.055,.675,.19]],["easeOutCubic",[.215,.61,.355,1]],["easeInOutCubic",[.645,.045,.355,1]],["easeInQuart",[.895,.03,.685,.22]],["easeOutQuart",[.165,.84,.44,1]],["easeInOutQuart",[.77,0,.175,1]],["easeInQuint",[.755,.05,.855,.06]],["easeOutQuint",[.23,1,.32,1]],["easeInOutQuint",[.86,0,.07,1]],["easeInExpo",[.95,.05,.795,.035]],["easeOutExpo",[.19,1,.22,1]],["easeInOutExpo",[1,0,0,1]],["easeInCirc",[.6,.04,.98,.335]],["easeOutCirc",[.075,.82,.165,1]],["easeInOutCirc",[.785,.135,.15,.86]]],function(a,b){t.Easings[b[0]]=i.apply(null,b[1])});var v=t.CSS={RegEx:{isHex:/^#([A-f\d]{3}){1,2}$/i,valueUnwrap:/^[A-z]+\((.*)\)$/i,wrappedValueAlreadyExtracted:/[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/,valueSplit:/([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi},Lists:{colors:["fill","stroke","stopColor","color","backgroundColor","borderColor","borderTopColor","borderRightColor","borderBottomColor","borderLeftColor","outlineColor"],transformsBase:["translateX","translateY","scale","scaleX","scaleY","skewX","skewY","rotateZ"],transforms3D:["transformPerspective","translateZ","scaleZ","rotateX","rotateY"]},Hooks:{templates:{textShadow:["Color X Y Blur","black 0px 0px 0px"],boxShadow:["Color X Y Blur Spread","black 0px 0px 0px 0px"],clip:["Top Right Bottom Left","0px 0px 0px 0px"],backgroundPosition:["X Y","0% 0%"],transformOrigin:["X Y Z","50% 50% 0px"],perspectiveOrigin:["X Y","50% 50%"]},registered:{},register:function(){for(var a=0;a<v.Lists.colors.length;a++){var b="color"===v.Lists.colors[a]?"0 0 0 1":"255 255 255 1";v.Hooks.templates[v.Lists.colors[a]]=["Red Green Blue Alpha",b]}var c,d,e;if(n)for(c in v.Hooks.templates){d=v.Hooks.templates[c],e=d[0].split(" ");var f=d[1].match(v.RegEx.valueSplit);"Color"===e[0]&&(e.push(e.shift()),f.push(f.shift()),v.Hooks.templates[c]=[e.join(" "),f.join(" ")])}for(c in v.Hooks.templates){d=v.Hooks.templates[c],e=d[0].split(" ");for(var a in e){var g=c+e[a],h=a;v.Hooks.registered[g]=[c,h]}}},getRoot:function(a){var b=v.Hooks.registered[a];return b?b[0]:a},cleanRootPropertyValue:function(a,b){return v.RegEx.valueUnwrap.test(b)&&(b=b.match(v.RegEx.valueUnwrap)[1]),v.Values.isCSSNullValue(b)&&(b=v.Hooks.templates[a][1]),b},extractValue:function(a,b){var c=v.Hooks.registered[a];if(c){var d=c[0],e=c[1];return b=v.Hooks.cleanRootPropertyValue(d,b),b.toString().match(v.RegEx.valueSplit)[e]}return b},injectValue:function(a,b,c){var d=v.Hooks.registered[a];if(d){var e,f,g=d[0],h=d[1];return c=v.Hooks.cleanRootPropertyValue(g,c),e=c.toString().match(v.RegEx.valueSplit),e[h]=b,f=e.join(" ")}return c}},Normalizations:{registered:{clip:function(a,b,c){switch(a){case"name":return"clip";case"extract":var d;return v.RegEx.wrappedValueAlreadyExtracted.test(c)?d=c:(d=c.toString().match(v.RegEx.valueUnwrap),d=d?d[1].replace(/,(\s+)?/g," "):c),d;case"inject":return"rect("+c+")"}},blur:function(a,b,c){switch(a){case"name":return t.State.isFirefox?"filter":"-webkit-filter";case"extract":var d=parseFloat(c);if(!d&&0!==d){var e=c.toString().match(/blur\(([0-9]+[A-z]+)\)/i);d=e?e[1]:0}return d;case"inject":return parseFloat(c)?"blur("+c+")":"none"}},opacity:function(a,b,c){if(8>=n)switch(a){case"name":return"filter";case"extract":var d=c.toString().match(/alpha\(opacity=(.*)\)/i);return c=d?d[1]/100:1;case"inject":return b.style.zoom=1,parseFloat(c)>=1?"":"alpha(opacity="+parseInt(100*parseFloat(c),10)+")"}else switch(a){case"name":return"opacity";case"extract":return c;case"inject":return c}}},register:function(){9>=n||t.State.isGingerbread||(v.Lists.transformsBase=v.Lists.transformsBase.concat(v.Lists.transforms3D));for(var a=0;a<v.Lists.transformsBase.length;a++)!function(){var b=v.Lists.transformsBase[a];v.Normalizations.registered[b]=function(a,c,e){switch(a){case"name":return"transform";case"extract":return g(c)===d||g(c).transformCache[b]===d?/^scale/i.test(b)?1:0:g(c).transformCache[b].replace(/[()]/g,"");case"inject":var f=!1;switch(b.substr(0,b.length-1)){case"translate":f=!/(%|px|em|rem|vw|vh|\d)$/i.test(e);break;case"scal":case"scale":t.State.isAndroid&&g(c).transformCache[b]===d&&1>e&&(e=1),f=!/(\d)$/i.test(e);break;case"skew":f=!/(deg|\d)$/i.test(e);break;case"rotate":f=!/(deg|\d)$/i.test(e)}return f||(g(c).transformCache[b]="("+e+")"),g(c).transformCache[b]}}}();for(var a=0;a<v.Lists.colors.length;a++)!function(){var b=v.Lists.colors[a];v.Normalizations.registered[b]=function(a,c,e){switch(a){case"name":return b;case"extract":var f;if(v.RegEx.wrappedValueAlreadyExtracted.test(e))f=e;else{var g,h={black:"rgb(0, 0, 0)",blue:"rgb(0, 0, 255)",gray:"rgb(128, 128, 128)",green:"rgb(0, 128, 0)",red:"rgb(255, 0, 0)",white:"rgb(255, 255, 255)"};/^[A-z]+$/i.test(e)?g=h[e]!==d?h[e]:h.black:v.RegEx.isHex.test(e)?g="rgb("+v.Values.hexToRgb(e).join(" ")+")":/^rgba?\(/i.test(e)||(g=h.black),f=(g||e).toString().match(v.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g," ")}return 8>=n||3!==f.split(" ").length||(f+=" 1"),f;case"inject":return 8>=n?4===e.split(" ").length&&(e=e.split(/\s+/).slice(0,3).join(" ")):3===e.split(" ").length&&(e+=" 1"),(8>=n?"rgb":"rgba")+"("+e.replace(/\s+/g,",").replace(/\.(\d)+(?=,)/g,"")+")"}}}()}},Names:{camelCase:function(a){return a.replace(/-(\w)/g,function(a,b){return b.toUpperCase()})},SVGAttribute:function(a){var b="width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return(n||t.State.isAndroid&&!t.State.isChrome)&&(b+="|transform"),new RegExp("^("+b+")$","i").test(a)},prefixCheck:function(a){if(t.State.prefixMatches[a])return[t.State.prefixMatches[a],!0];for(var b=["","Webkit","Moz","ms","O"],c=0,d=b.length;d>c;c++){var e;if(e=0===c?a:b[c]+a.replace(/^\w/,function(a){return a.toUpperCase()}),p.isString(t.State.prefixElement.style[e]))return t.State.prefixMatches[a]=e,[e,!0]}return[a,!1]}},Values:{hexToRgb:function(a){var b,c=/^#?([a-f\d])([a-f\d])([a-f\d])$/i,d=/^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return a=a.replace(c,function(a,b,c,d){return b+b+c+c+d+d}),b=d.exec(a),b?[parseInt(b[1],16),parseInt(b[2],16),parseInt(b[3],16)]:[0,0,0]},isCSSNullValue:function(a){return 0==a||/^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(a)},getUnitType:function(a){return/^(rotate|skew)/i.test(a)?"deg":/(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(a)?"":"px"},getDisplayType:function(a){var b=a&&a.tagName.toString().toLowerCase();return/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(b)?"inline":/^(li)$/i.test(b)?"list-item":/^(tr)$/i.test(b)?"table-row":/^(table)$/i.test(b)?"table":/^(tbody)$/i.test(b)?"table-row-group":"block"},addClass:function(a,b){a.classList?a.classList.add(b):a.className+=(a.className.length?" ":"")+b},removeClass:function(a,b){a.classList?a.classList.remove(b):a.className=a.className.toString().replace(new RegExp("(^|\\s)"+b.split(" ").join("|")+"(\\s|$)","gi")," ")}},getPropertyValue:function(a,c,e,f){function h(a,c){function e(){j&&v.setPropertyValue(a,"display","none")}var i=0;if(8>=n)i=m.css(a,c);else{var j=!1;if(/^(width|height)$/.test(c)&&0===v.getPropertyValue(a,"display")&&(j=!0,v.setPropertyValue(a,"display",v.Values.getDisplayType(a))),!f){if("height"===c&&"border-box"!==v.getPropertyValue(a,"boxSizing").toString().toLowerCase()){var k=a.offsetHeight-(parseFloat(v.getPropertyValue(a,"borderTopWidth"))||0)-(parseFloat(v.getPropertyValue(a,"borderBottomWidth"))||0)-(parseFloat(v.getPropertyValue(a,"paddingTop"))||0)-(parseFloat(v.getPropertyValue(a,"paddingBottom"))||0);return e(),k}if("width"===c&&"border-box"!==v.getPropertyValue(a,"boxSizing").toString().toLowerCase()){var l=a.offsetWidth-(parseFloat(v.getPropertyValue(a,"borderLeftWidth"))||0)-(parseFloat(v.getPropertyValue(a,"borderRightWidth"))||0)-(parseFloat(v.getPropertyValue(a,"paddingLeft"))||0)-(parseFloat(v.getPropertyValue(a,"paddingRight"))||0);return e(),l}}var o;o=g(a)===d?b.getComputedStyle(a,null):g(a).computedStyle?g(a).computedStyle:g(a).computedStyle=b.getComputedStyle(a,null),"borderColor"===c&&(c="borderTopColor"),i=9===n&&"filter"===c?o.getPropertyValue(c):o[c],(""===i||null===i)&&(i=a.style[c]),e()}if("auto"===i&&/^(top|right|bottom|left)$/i.test(c)){var p=h(a,"position");("fixed"===p||"absolute"===p&&/top|left/i.test(c))&&(i=m(a).position()[c]+"px")}return i}var i;if(v.Hooks.registered[c]){var j=c,k=v.Hooks.getRoot(j);e===d&&(e=v.getPropertyValue(a,v.Names.prefixCheck(k)[0])),v.Normalizations.registered[k]&&(e=v.Normalizations.registered[k]("extract",a,e)),i=v.Hooks.extractValue(j,e)}else if(v.Normalizations.registered[c]){var l,o;l=v.Normalizations.registered[c]("name",a),"transform"!==l&&(o=h(a,v.Names.prefixCheck(l)[0]),v.Values.isCSSNullValue(o)&&v.Hooks.templates[c]&&(o=v.Hooks.templates[c][1])),i=v.Normalizations.registered[c]("extract",a,o)}if(!/^[\d-]/.test(i))if(g(a)&&g(a).isSVG&&v.Names.SVGAttribute(c))if(/^(height|width)$/i.test(c))try{i=a.getBBox()[c]}catch(p){i=0}else i=a.getAttribute(c);else i=h(a,v.Names.prefixCheck(c)[0]);return v.Values.isCSSNullValue(i)&&(i=0),t.debug>=2&&console.log("Get "+c+": "+i),i},setPropertyValue:function(a,c,d,e,f){var h=c;if("scroll"===c)f.container?f.container["scroll"+f.direction]=d:"Left"===f.direction?b.scrollTo(d,f.alternateValue):b.scrollTo(f.alternateValue,d);else if(v.Normalizations.registered[c]&&"transform"===v.Normalizations.registered[c]("name",a))v.Normalizations.registered[c]("inject",a,d),h="transform",d=g(a).transformCache[c];else{if(v.Hooks.registered[c]){var i=c,j=v.Hooks.getRoot(c);e=e||v.getPropertyValue(a,j),d=v.Hooks.injectValue(i,d,e),c=j}if(v.Normalizations.registered[c]&&(d=v.Normalizations.registered[c]("inject",a,d),c=v.Normalizations.registered[c]("name",a)),h=v.Names.prefixCheck(c)[0],8>=n)try{a.style[h]=d}catch(k){t.debug&&console.log("Browser does not support ["+d+"] for ["+h+"]")}else g(a)&&g(a).isSVG&&v.Names.SVGAttribute(c)?a.setAttribute(c,d):a.style[h]=d;t.debug>=2&&console.log("Set "+c+" ("+h+"): "+d)}return[h,d]},flushTransformCache:function(a){function b(b){return parseFloat(v.getPropertyValue(a,b))}var c="";if((n||t.State.isAndroid&&!t.State.isChrome)&&g(a).isSVG){var d={translate:[b("translateX"),b("translateY")],skewX:[b("skewX")],skewY:[b("skewY")],scale:1!==b("scale")?[b("scale"),b("scale")]:[b("scaleX"),b("scaleY")],rotate:[b("rotateZ"),0,0]};m.each(g(a).transformCache,function(a){/^translate/i.test(a)?a="translate":/^scale/i.test(a)?a="scale":/^rotate/i.test(a)&&(a="rotate"),d[a]&&(c+=a+"("+d[a].join(" ")+") ",delete d[a])})}else{var e,f;m.each(g(a).transformCache,function(b){return e=g(a).transformCache[b],"transformPerspective"===b?(f=e,!0):(9===n&&"rotateZ"===b&&(b="rotate"),void(c+=b+e+" "))}),f&&(c="perspective"+f+" "+c)}v.setPropertyValue(a,"transform",c)}};v.Hooks.register(),v.Normalizations.register(),t.hook=function(a,b,c){var e=d;return a=f(a),m.each(a,function(a,f){if(g(f)===d&&t.init(f),c===d)e===d&&(e=t.CSS.getPropertyValue(f,b));else{var h=t.CSS.setPropertyValue(f,b,c);"transform"===h[0]&&t.CSS.flushTransformCache(f),e=h}}),e};var w=function(){function a(){return h?B.promise||null:i}function e(){function a(a){function l(a,b){var c=d,e=d,g=d;return p.isArray(a)?(c=a[0],!p.isArray(a[1])&&/^[\d-]/.test(a[1])||p.isFunction(a[1])||v.RegEx.isHex.test(a[1])?g=a[1]:(p.isString(a[1])&&!v.RegEx.isHex.test(a[1])||p.isArray(a[1]))&&(e=b?a[1]:j(a[1],h.duration),a[2]!==d&&(g=a[2]))):c=a,b||(e=e||h.easing),p.isFunction(c)&&(c=c.call(f,y,x)),p.isFunction(g)&&(g=g.call(f,y,x)),[c||0,e,g]}function n(a,b){var c,d;return d=(b||"0").toString().toLowerCase().replace(/[%A-z]+$/,function(a){return c=a,""}),c||(c=v.Values.getUnitType(a)),[d,c]}function r(){var a={myParent:f.parentNode||c.body,position:v.getPropertyValue(f,"position"),fontSize:v.getPropertyValue(f,"fontSize")},d=a.position===I.lastPosition&&a.myParent===I.lastParent,e=a.fontSize===I.lastFontSize;I.lastParent=a.myParent,I.lastPosition=a.position,I.lastFontSize=a.fontSize;var h=100,i={};if(e&&d)i.emToPx=I.lastEmToPx,i.percentToPxWidth=I.lastPercentToPxWidth,i.percentToPxHeight=I.lastPercentToPxHeight;else{var j=g(f).isSVG?c.createElementNS("http://www.w3.org/2000/svg","rect"):c.createElement("div");t.init(j),a.myParent.appendChild(j),m.each(["overflow","overflowX","overflowY"],function(a,b){t.CSS.setPropertyValue(j,b,"hidden")}),t.CSS.setPropertyValue(j,"position",a.position),t.CSS.setPropertyValue(j,"fontSize",a.fontSize),t.CSS.setPropertyValue(j,"boxSizing","content-box"),m.each(["minWidth","maxWidth","width","minHeight","maxHeight","height"],function(a,b){t.CSS.setPropertyValue(j,b,h+"%")}),t.CSS.setPropertyValue(j,"paddingLeft",h+"em"),i.percentToPxWidth=I.lastPercentToPxWidth=(parseFloat(v.getPropertyValue(j,"width",null,!0))||1)/h,i.percentToPxHeight=I.lastPercentToPxHeight=(parseFloat(v.getPropertyValue(j,"height",null,!0))||1)/h,i.emToPx=I.lastEmToPx=(parseFloat(v.getPropertyValue(j,"paddingLeft"))||1)/h,a.myParent.removeChild(j)}return null===I.remToPx&&(I.remToPx=parseFloat(v.getPropertyValue(c.body,"fontSize"))||16),null===I.vwToPx&&(I.vwToPx=parseFloat(b.innerWidth)/100,I.vhToPx=parseFloat(b.innerHeight)/100),i.remToPx=I.remToPx,i.vwToPx=I.vwToPx,i.vhToPx=I.vhToPx,t.debug>=1&&console.log("Unit ratios: "+JSON.stringify(i),f),i}if(h.begin&&0===y)try{h.begin.call(o,o)}catch(u){setTimeout(function(){throw u},1)}if("scroll"===C){var w,z,A,D=/^x$/i.test(h.axis)?"Left":"Top",E=parseFloat(h.offset)||0;h.container?p.isWrapped(h.container)||p.isNode(h.container)?(h.container=h.container[0]||h.container,w=h.container["scroll"+D],A=w+m(f).position()[D.toLowerCase()]+E):h.container=null:(w=t.State.scrollAnchor[t.State["scrollProperty"+D]],z=t.State.scrollAnchor[t.State["scrollProperty"+("Left"===D?"Top":"Left")]],A=m(f).offset()[D.toLowerCase()]+E),i={scroll:{rootPropertyValue:!1,startValue:w,currentValue:w,endValue:A,unitType:"",easing:h.easing,scrollData:{container:h.container,direction:D,alternateValue:z}},element:f},t.debug&&console.log("tweensContainer (scroll): ",i.scroll,f)}else if("reverse"===C){if(!g(f).tweensContainer)return void m.dequeue(f,h.queue);"none"===g(f).opts.display&&(g(f).opts.display="auto"),"hidden"===g(f).opts.visibility&&(g(f).opts.visibility="visible"),g(f).opts.loop=!1,g(f).opts.begin=null,g(f).opts.complete=null,s.easing||delete h.easing,s.duration||delete h.duration,h=m.extend({},g(f).opts,h);var F=m.extend(!0,{},g(f).tweensContainer);for(var G in F)if("element"!==G){var H=F[G].startValue;F[G].startValue=F[G].currentValue=F[G].endValue,F[G].endValue=H,p.isEmptyObject(s)||(F[G].easing=h.easing),t.debug&&console.log("reverse tweensContainer ("+G+"): "+JSON.stringify(F[G]),f)}i=F}else if("start"===C){var F;g(f).tweensContainer&&g(f).isAnimating===!0&&(F=g(f).tweensContainer),m.each(q,function(a,b){if(RegExp("^"+v.Lists.colors.join("$|^")+"$").test(a)){var c=l(b,!0),e=c[0],f=c[1],g=c[2];if(v.RegEx.isHex.test(e)){for(var h=["Red","Green","Blue"],i=v.Values.hexToRgb(e),j=g?v.Values.hexToRgb(g):d,k=0;k<h.length;k++){var m=[i[k]];f&&m.push(f),j!==d&&m.push(j[k]),q[a+h[k]]=m}delete q[a]}}});for(var K in q){var L=l(q[K]),M=L[0],N=L[1],O=L[2];K=v.Names.camelCase(K);var P=v.Hooks.getRoot(K),Q=!1;if(g(f).isSVG||"tween"===P||v.Names.prefixCheck(P)[1]!==!1||v.Normalizations.registered[P]!==d){(h.display!==d&&null!==h.display&&"none"!==h.display||h.visibility!==d&&"hidden"!==h.visibility)&&/opacity|filter/.test(K)&&!O&&0!==M&&(O=0),h._cacheValues&&F&&F[K]?(O===d&&(O=F[K].endValue+F[K].unitType),Q=g(f).rootPropertyValueCache[P]):v.Hooks.registered[K]?O===d?(Q=v.getPropertyValue(f,P),O=v.getPropertyValue(f,K,Q)):Q=v.Hooks.templates[P][1]:O===d&&(O=v.getPropertyValue(f,K));var R,S,T,U=!1;if(R=n(K,O),O=R[0],T=R[1],R=n(K,M),M=R[0].replace(/^([+-\/*])=/,function(a,b){return U=b,""}),S=R[1],O=parseFloat(O)||0,M=parseFloat(M)||0,"%"===S&&(/^(fontSize|lineHeight)$/.test(K)?(M/=100,S="em"):/^scale/.test(K)?(M/=100,S=""):/(Red|Green|Blue)$/i.test(K)&&(M=M/100*255,S="")),/[\/*]/.test(U))S=T;else if(T!==S&&0!==O)if(0===M)S=T;else{e=e||r();var V=/margin|padding|left|right|width|text|word|letter/i.test(K)||/X$/.test(K)||"x"===K?"x":"y";
+switch(T){case"%":O*="x"===V?e.percentToPxWidth:e.percentToPxHeight;break;case"px":break;default:O*=e[T+"ToPx"]}switch(S){case"%":O*=1/("x"===V?e.percentToPxWidth:e.percentToPxHeight);break;case"px":break;default:O*=1/e[S+"ToPx"]}}switch(U){case"+":M=O+M;break;case"-":M=O-M;break;case"*":M=O*M;break;case"/":M=O/M}i[K]={rootPropertyValue:Q,startValue:O,currentValue:O,endValue:M,unitType:S,easing:N},t.debug&&console.log("tweensContainer ("+K+"): "+JSON.stringify(i[K]),f)}else t.debug&&console.log("Skipping ["+P+"] due to a lack of browser support.")}i.element=f}i.element&&(v.Values.addClass(f,"velocity-animating"),J.push(i),""===h.queue&&(g(f).tweensContainer=i,g(f).opts=h),g(f).isAnimating=!0,y===x-1?(t.State.calls.push([J,o,h,null,B.resolver]),t.State.isTicking===!1&&(t.State.isTicking=!0,k())):y++)}var e,f=this,h=m.extend({},t.defaults,s),i={};switch(g(f)===d&&t.init(f),parseFloat(h.delay)&&h.queue!==!1&&m.queue(f,h.queue,function(a){t.velocityQueueEntryFlag=!0,g(f).delayTimer={setTimeout:setTimeout(a,parseFloat(h.delay)),next:a}}),h.duration.toString().toLowerCase()){case"fast":h.duration=200;break;case"normal":h.duration=r;break;case"slow":h.duration=600;break;default:h.duration=parseFloat(h.duration)||1}t.mock!==!1&&(t.mock===!0?h.duration=h.delay=1:(h.duration*=parseFloat(t.mock)||1,h.delay*=parseFloat(t.mock)||1)),h.easing=j(h.easing,h.duration),h.begin&&!p.isFunction(h.begin)&&(h.begin=null),h.progress&&!p.isFunction(h.progress)&&(h.progress=null),h.complete&&!p.isFunction(h.complete)&&(h.complete=null),h.display!==d&&null!==h.display&&(h.display=h.display.toString().toLowerCase(),"auto"===h.display&&(h.display=t.CSS.Values.getDisplayType(f))),h.visibility!==d&&null!==h.visibility&&(h.visibility=h.visibility.toString().toLowerCase()),h.mobileHA=h.mobileHA&&t.State.isMobile&&!t.State.isGingerbread,h.queue===!1?h.delay?setTimeout(a,h.delay):a():m.queue(f,h.queue,function(b,c){return c===!0?(B.promise&&B.resolver(o),!0):(t.velocityQueueEntryFlag=!0,void a(b))}),""!==h.queue&&"fx"!==h.queue||"inprogress"===m.queue(f)[0]||m.dequeue(f)}var h,i,n,o,q,s,u=arguments[0]&&(arguments[0].p||m.isPlainObject(arguments[0].properties)&&!arguments[0].properties.names||p.isString(arguments[0].properties));if(p.isWrapped(this)?(h=!1,n=0,o=this,i=this):(h=!0,n=1,o=u?arguments[0].elements||arguments[0].e:arguments[0]),o=f(o)){u?(q=arguments[0].properties||arguments[0].p,s=arguments[0].options||arguments[0].o):(q=arguments[n],s=arguments[n+1]);var x=o.length,y=0;if(!/^(stop|finish)$/i.test(q)&&!m.isPlainObject(s)){var z=n+1;s={};for(var A=z;A<arguments.length;A++)p.isArray(arguments[A])||!/^(fast|normal|slow)$/i.test(arguments[A])&&!/^\d/.test(arguments[A])?p.isString(arguments[A])||p.isArray(arguments[A])?s.easing=arguments[A]:p.isFunction(arguments[A])&&(s.complete=arguments[A]):s.duration=arguments[A]}var B={promise:null,resolver:null,rejecter:null};h&&t.Promise&&(B.promise=new t.Promise(function(a,b){B.resolver=a,B.rejecter=b}));var C;switch(q){case"scroll":C="scroll";break;case"reverse":C="reverse";break;case"finish":case"stop":m.each(o,function(a,b){g(b)&&g(b).delayTimer&&(clearTimeout(g(b).delayTimer.setTimeout),g(b).delayTimer.next&&g(b).delayTimer.next(),delete g(b).delayTimer)});var D=[];return m.each(t.State.calls,function(a,b){b&&m.each(b[1],function(c,e){var f=s===d?"":s;return f!==!0&&b[2].queue!==f&&(s!==d||b[2].queue!==!1)||void m.each(o,function(c,d){d===e&&((s===!0||p.isString(s))&&(m.each(m.queue(d,p.isString(s)?s:""),function(a,b){p.isFunction(b)&&b(null,!0)}),m.queue(d,p.isString(s)?s:"",[])),"stop"===q?(g(d)&&g(d).tweensContainer&&f!==!1&&m.each(g(d).tweensContainer,function(a,b){b.endValue=b.currentValue}),D.push(a)):"finish"===q&&(b[2].duration=1))})})}),"stop"===q&&(m.each(D,function(a,b){l(b,!0)}),B.promise&&B.resolver(o)),a();default:if(!m.isPlainObject(q)||p.isEmptyObject(q)){if(p.isString(q)&&t.Redirects[q]){var E=m.extend({},s),F=E.duration,G=E.delay||0;return E.backwards===!0&&(o=m.extend(!0,[],o).reverse()),m.each(o,function(a,b){parseFloat(E.stagger)?E.delay=G+parseFloat(E.stagger)*a:p.isFunction(E.stagger)&&(E.delay=G+E.stagger.call(b,a,x)),E.drag&&(E.duration=parseFloat(F)||(/^(callout|transition)/.test(q)?1e3:r),E.duration=Math.max(E.duration*(E.backwards?1-a/x:(a+1)/x),.75*E.duration,200)),t.Redirects[q].call(b,b,E||{},a,x,o,B.promise?B:d)}),a()}var H="Velocity: First argument ("+q+") was not a property map, a known action, or a registered redirect. Aborting.";return B.promise?B.rejecter(new Error(H)):console.log(H),a()}C="start"}var I={lastParent:null,lastPosition:null,lastFontSize:null,lastPercentToPxWidth:null,lastPercentToPxHeight:null,lastEmToPx:null,remToPx:null,vwToPx:null,vhToPx:null},J=[];m.each(o,function(a,b){p.isNode(b)&&e.call(b)});var K,E=m.extend({},t.defaults,s);if(E.loop=parseInt(E.loop),K=2*E.loop-1,E.loop)for(var L=0;K>L;L++){var M={delay:E.delay,progress:E.progress};L===K-1&&(M.display=E.display,M.visibility=E.visibility,M.complete=E.complete),w(o,"reverse",M)}return a()}};t=m.extend(w,t),t.animate=w;var x=b.requestAnimationFrame||o;return t.State.isMobile||c.hidden===d||c.addEventListener("visibilitychange",function(){c.hidden?(x=function(a){return setTimeout(function(){a(!0)},16)},k()):x=b.requestAnimationFrame||o}),a.Velocity=t,a!==b&&(a.fn.velocity=w,a.fn.velocity.defaults=t.defaults),m.each(["Down","Up"],function(a,b){t.Redirects["slide"+b]=function(a,c,e,f,g,h){var i=m.extend({},c),j=i.begin,k=i.complete,l={height:"",marginTop:"",marginBottom:"",paddingTop:"",paddingBottom:""},n={};i.display===d&&(i.display="Down"===b?"inline"===t.CSS.Values.getDisplayType(a)?"inline-block":"block":"none"),i.begin=function(){j&&j.call(g,g);for(var c in l){n[c]=a.style[c];var d=t.CSS.getPropertyValue(a,c);l[c]="Down"===b?[d,0]:[0,d]}n.overflow=a.style.overflow,a.style.overflow="hidden"},i.complete=function(){for(var b in n)a.style[b]=n[b];k&&k.call(g,g),h&&h.resolver(g)},t(a,l,i)}}),m.each(["In","Out"],function(a,b){t.Redirects["fade"+b]=function(a,c,e,f,g,h){var i=m.extend({},c),j={opacity:"In"===b?1:0},k=i.complete;i.complete=e!==f-1?i.begin=null:function(){k&&k.call(g,g),h&&h.resolver(g)},i.display===d&&(i.display="In"===b?"auto":"none"),t(this,j,i)}}),t}(window.jQuery||window.Zepto||window,window,document)})),!function(a,b,c,d){"use strict";function e(a,b,c){return setTimeout(k(a,c),b)}function f(a,b,c){return!!Array.isArray(a)&&(g(a,c[b],c),!0)}function g(a,b,c){var e;if(a)if(a.forEach)a.forEach(b,c);else if(a.length!==d)for(e=0;e<a.length;)b.call(c,a[e],e,a),e++;else for(e in a)a.hasOwnProperty(e)&&b.call(c,a[e],e,a)}function h(a,b,c){for(var e=Object.keys(b),f=0;f<e.length;)(!c||c&&a[e[f]]===d)&&(a[e[f]]=b[e[f]]),f++;return a}function i(a,b){return h(a,b,!0)}function j(a,b,c){var d,e=b.prototype;d=a.prototype=Object.create(e),d.constructor=a,d._super=e,c&&h(d,c)}function k(a,b){return function(){return a.apply(b,arguments)}}function l(a,b){return typeof a==ka?a.apply(b?b[0]||d:d,b):a}function m(a,b){return a===d?b:a}function n(a,b,c){g(r(b),function(b){a.addEventListener(b,c,!1)})}function o(a,b,c){g(r(b),function(b){a.removeEventListener(b,c,!1)})}function p(a,b){for(;a;){if(a==b)return!0;a=a.parentNode}return!1}function q(a,b){return a.indexOf(b)>-1}function r(a){return a.trim().split(/\s+/g)}function s(a,b,c){if(a.indexOf&&!c)return a.indexOf(b);for(var d=0;d<a.length;){if(c&&a[d][c]==b||!c&&a[d]===b)return d;d++}return-1}function t(a){return Array.prototype.slice.call(a,0)}function u(a,b,c){for(var d=[],e=[],f=0;f<a.length;){var g=b?a[f][b]:a[f];s(e,g)<0&&d.push(a[f]),e[f]=g,f++}return c&&(d=b?d.sort(function(a,c){return a[b]>c[b]}):d.sort()),d}function v(a,b){for(var c,e,f=b[0].toUpperCase()+b.slice(1),g=0;g<ia.length;){if(c=ia[g],e=c?c+f:b,e in a)return e;g++}return d}function w(){return oa++}function x(a){var b=a.ownerDocument;return b.defaultView||b.parentWindow}function y(a,b){var c=this;this.manager=a,this.callback=b,this.element=a.element,this.target=a.options.inputTarget,this.domHandler=function(b){l(a.options.enable,[a])&&c.handler(b)},this.init()}function z(a){var b,c=a.options.inputClass;return new(b=c?c:ra?N:sa?Q:qa?S:M)(a,A)}function A(a,b,c){var d=c.pointers.length,e=c.changedPointers.length,f=b&ya&&0===d-e,g=b&(Aa|Ba)&&0===d-e;c.isFirst=!!f,c.isFinal=!!g,f&&(a.session={}),c.eventType=b,B(a,c),a.emit("hammer.input",c),a.recognize(c),a.session.prevInput=c}function B(a,b){var c=a.session,d=b.pointers,e=d.length;c.firstInput||(c.firstInput=E(b)),e>1&&!c.firstMultiple?c.firstMultiple=E(b):1===e&&(c.firstMultiple=!1);var f=c.firstInput,g=c.firstMultiple,h=g?g.center:f.center,i=b.center=F(d);b.timeStamp=na(),b.deltaTime=b.timeStamp-f.timeStamp,b.angle=J(h,i),b.distance=I(h,i),C(c,b),b.offsetDirection=H(b.deltaX,b.deltaY),b.scale=g?L(g.pointers,d):1,b.rotation=g?K(g.pointers,d):0,D(c,b);var j=a.element;p(b.srcEvent.target,j)&&(j=b.srcEvent.target),b.target=j}function C(a,b){var c=b.center,d=a.offsetDelta||{},e=a.prevDelta||{},f=a.prevInput||{};(b.eventType===ya||f.eventType===Aa)&&(e=a.prevDelta={x:f.deltaX||0,y:f.deltaY||0},d=a.offsetDelta={x:c.x,y:c.y}),b.deltaX=e.x+(c.x-d.x),b.deltaY=e.y+(c.y-d.y)}function D(a,b){var c,e,f,g,h=a.lastInterval||b,i=b.timeStamp-h.timeStamp;if(b.eventType!=Ba&&(i>xa||h.velocity===d)){var j=h.deltaX-b.deltaX,k=h.deltaY-b.deltaY,l=G(i,j,k);e=l.x,f=l.y,c=ma(l.x)>ma(l.y)?l.x:l.y,g=H(j,k),a.lastInterval=b}else c=h.velocity,e=h.velocityX,f=h.velocityY,g=h.direction;b.velocity=c,b.velocityX=e,b.velocityY=f,b.direction=g}function E(a){for(var b=[],c=0;c<a.pointers.length;)b[c]={clientX:la(a.pointers[c].clientX),clientY:la(a.pointers[c].clientY)},c++;return{timeStamp:na(),pointers:b,center:F(b),deltaX:a.deltaX,deltaY:a.deltaY}}function F(a){var b=a.length;if(1===b)return{x:la(a[0].clientX),y:la(a[0].clientY)};for(var c=0,d=0,e=0;b>e;)c+=a[e].clientX,d+=a[e].clientY,e++;return{x:la(c/b),y:la(d/b)}}function G(a,b,c){return{x:b/a||0,y:c/a||0}}function H(a,b){return a===b?Ca:ma(a)>=ma(b)?a>0?Da:Ea:b>0?Fa:Ga}function I(a,b,c){c||(c=Ka);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return Math.sqrt(d*d+e*e)}function J(a,b,c){c||(c=Ka);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return 180*Math.atan2(e,d)/Math.PI}function K(a,b){return J(b[1],b[0],La)-J(a[1],a[0],La)}function L(a,b){return I(b[0],b[1],La)/I(a[0],a[1],La)}function M(){this.evEl=Na,this.evWin=Oa,this.allow=!0,this.pressed=!1,y.apply(this,arguments)}function N(){this.evEl=Ra,this.evWin=Sa,y.apply(this,arguments),this.store=this.manager.session.pointerEvents=[]}function O(){this.evTarget=Ua,this.evWin=Va,this.started=!1,y.apply(this,arguments)}function P(a,b){var c=t(a.touches),d=t(a.changedTouches);return b&(Aa|Ba)&&(c=u(c.concat(d),"identifier",!0)),[c,d]}function Q(){this.evTarget=Xa,this.targetIds={},y.apply(this,arguments)}function R(a,b){var c=t(a.touches),d=this.targetIds;if(b&(ya|za)&&1===c.length)return d[c[0].identifier]=!0,[c,c];var e,f,g=t(a.changedTouches),h=[],i=this.target;if(f=c.filter(function(a){return p(a.target,i)}),b===ya)for(e=0;e<f.length;)d[f[e].identifier]=!0,e++;for(e=0;e<g.length;)d[g[e].identifier]&&h.push(g[e]),b&(Aa|Ba)&&delete d[g[e].identifier],e++;return h.length?[u(f.concat(h),"identifier",!0),h]:void 0}function S(){y.apply(this,arguments);var a=k(this.handler,this);this.touch=new Q(this.manager,a),this.mouse=new M(this.manager,a)}function T(a,b){this.manager=a,this.set(b)}function U(a){if(q(a,bb))return bb;var b=q(a,cb),c=q(a,db);return b&&c?cb+" "+db:b||c?b?cb:db:q(a,ab)?ab:_a}function V(a){this.id=w(),this.manager=null,this.options=i(a||{},this.defaults),this.options.enable=m(this.options.enable,!0),this.state=eb,this.simultaneous={},this.requireFail=[]}function W(a){return a&jb?"cancel":a&hb?"end":a&gb?"move":a&fb?"start":""}function X(a){return a==Ga?"down":a==Fa?"up":a==Da?"left":a==Ea?"right":""}function Y(a,b){var c=b.manager;return c?c.get(a):a}function Z(){V.apply(this,arguments)}function $(){Z.apply(this,arguments),this.pX=null,this.pY=null}function _(){Z.apply(this,arguments)}function aa(){V.apply(this,arguments),this._timer=null,this._input=null}function ba(){Z.apply(this,arguments)}function ca(){Z.apply(this,arguments)}function da(){V.apply(this,arguments),this.pTime=!1,this.pCenter=!1,this._timer=null,this._input=null,this.count=0}function ea(a,b){return b=b||{},b.recognizers=m(b.recognizers,ea.defaults.preset),new fa(a,b)}function fa(a,b){b=b||{},this.options=i(b,ea.defaults),this.options.inputTarget=this.options.inputTarget||a,this.handlers={},this.session={},this.recognizers=[],this.element=a,this.input=z(this),this.touchAction=new T(this,this.options.touchAction),ga(this,!0),g(b.recognizers,function(a){var b=this.add(new a[0](a[1]));a[2]&&b.recognizeWith(a[2]),a[3]&&b.requireFailure(a[3])},this)}function ga(a,b){var c=a.element;g(a.options.cssProps,function(a,d){c.style[v(c.style,d)]=b?a:""})}function ha(a,c){var d=b.createEvent("Event");d.initEvent(a,!0,!0),d.gesture=c,c.target.dispatchEvent(d)}var ia=["","webkit","moz","MS","ms","o"],ja=b.createElement("div"),ka="function",la=Math.round,ma=Math.abs,na=Date.now,oa=1,pa=/mobile|tablet|ip(ad|hone|od)|android/i,qa="ontouchstart"in a,ra=v(a,"PointerEvent")!==d,sa=qa&&pa.test(navigator.userAgent),ta="touch",ua="pen",va="mouse",wa="kinect",xa=25,ya=1,za=2,Aa=4,Ba=8,Ca=1,Da=2,Ea=4,Fa=8,Ga=16,Ha=Da|Ea,Ia=Fa|Ga,Ja=Ha|Ia,Ka=["x","y"],La=["clientX","clientY"];y.prototype={handler:function(){},init:function(){this.evEl&&n(this.element,this.evEl,this.domHandler),this.evTarget&&n(this.target,this.evTarget,this.domHandler),this.evWin&&n(x(this.element),this.evWin,this.domHandler)},destroy:function(){this.evEl&&o(this.element,this.evEl,this.domHandler),this.evTarget&&o(this.target,this.evTarget,this.domHandler),this.evWin&&o(x(this.element),this.evWin,this.domHandler)}};var Ma={mousedown:ya,mousemove:za,mouseup:Aa},Na="mousedown",Oa="mousemove mouseup";j(M,y,{handler:function(a){var b=Ma[a.type];b&ya&&0===a.button&&(this.pressed=!0),b&za&&1!==a.which&&(b=Aa),this.pressed&&this.allow&&(b&Aa&&(this.pressed=!1),this.callback(this.manager,b,{pointers:[a],changedPointers:[a],pointerType:va,srcEvent:a}))}});var Pa={pointerdown:ya,pointermove:za,pointerup:Aa,pointercancel:Ba,pointerout:Ba},Qa={2:ta,3:ua,4:va,5:wa},Ra="pointerdown",Sa="pointermove pointerup pointercancel";a.MSPointerEvent&&(Ra="MSPointerDown",Sa="MSPointerMove MSPointerUp MSPointerCancel"),j(N,y,{handler:function(a){var b=this.store,c=!1,d=a.type.toLowerCase().replace("ms",""),e=Pa[d],f=Qa[a.pointerType]||a.pointerType,g=f==ta,h=s(b,a.pointerId,"pointerId");e&ya&&(0===a.button||g)?0>h&&(b.push(a),h=b.length-1):e&(Aa|Ba)&&(c=!0),0>h||(b[h]=a,this.callback(this.manager,e,{pointers:b,changedPointers:[a],pointerType:f,srcEvent:a}),c&&b.splice(h,1))}});var Ta={touchstart:ya,touchmove:za,touchend:Aa,touchcancel:Ba},Ua="touchstart",Va="touchstart touchmove touchend touchcancel";j(O,y,{handler:function(a){var b=Ta[a.type];if(b===ya&&(this.started=!0),this.started){var c=P.call(this,a,b);b&(Aa|Ba)&&0===c[0].length-c[1].length&&(this.started=!1),this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:ta,srcEvent:a})}}});var Wa={touchstart:ya,touchmove:za,touchend:Aa,touchcancel:Ba},Xa="touchstart touchmove touchend touchcancel";j(Q,y,{handler:function(a){var b=Wa[a.type],c=R.call(this,a,b);c&&this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:ta,srcEvent:a})}}),j(S,y,{handler:function(a,b,c){var d=c.pointerType==ta,e=c.pointerType==va;if(d)this.mouse.allow=!1;else if(e&&!this.mouse.allow)return;b&(Aa|Ba)&&(this.mouse.allow=!0),this.callback(a,b,c)},destroy:function(){this.touch.destroy(),this.mouse.destroy()}});var Ya=v(ja.style,"touchAction"),Za=Ya!==d,$a="compute",_a="auto",ab="manipulation",bb="none",cb="pan-x",db="pan-y";T.prototype={set:function(a){a==$a&&(a=this.compute()),Za&&(this.manager.element.style[Ya]=a),this.actions=a.toLowerCase().trim()},update:function(){this.set(this.manager.options.touchAction)},compute:function(){var a=[];return g(this.manager.recognizers,function(b){l(b.options.enable,[b])&&(a=a.concat(b.getTouchAction()))}),U(a.join(" "))},preventDefaults:function(a){if(!Za){var b=a.srcEvent,c=a.offsetDirection;if(this.manager.session.prevented)return void b.preventDefault();var d=this.actions,e=q(d,bb),f=q(d,db),g=q(d,cb);return e||f&&c&Ha||g&&c&Ia?this.preventSrc(b):void 0}},preventSrc:function(a){this.manager.session.prevented=!0,a.preventDefault()}};var eb=1,fb=2,gb=4,hb=8,ib=hb,jb=16,kb=32;V.prototype={defaults:{},set:function(a){return h(this.options,a),this.manager&&this.manager.touchAction.update(),this},recognizeWith:function(a){if(f(a,"recognizeWith",this))return this;var b=this.simultaneous;return a=Y(a,this),b[a.id]||(b[a.id]=a,a.recognizeWith(this)),this},dropRecognizeWith:function(a){return f(a,"dropRecognizeWith",this)?this:(a=Y(a,this),delete this.simultaneous[a.id],this)},requireFailure:function(a){if(f(a,"requireFailure",this))return this;var b=this.requireFail;return a=Y(a,this),-1===s(b,a)&&(b.push(a),a.requireFailure(this)),this},dropRequireFailure:function(a){if(f(a,"dropRequireFailure",this))return this;a=Y(a,this);var b=s(this.requireFail,a);return b>-1&&this.requireFail.splice(b,1),this},hasRequireFailures:function(){return this.requireFail.length>0},canRecognizeWith:function(a){return!!this.simultaneous[a.id]},emit:function(a){function b(b){c.manager.emit(c.options.event+(b?W(d):""),a)}var c=this,d=this.state;hb>d&&b(!0),b(),d>=hb&&b(!0)},tryEmit:function(a){return this.canEmit()?this.emit(a):void(this.state=kb)},canEmit:function(){for(var a=0;a<this.requireFail.length;){if(!(this.requireFail[a].state&(kb|eb)))return!1;a++}return!0},recognize:function(a){var b=h({},a);return l(this.options.enable,[this,b])?(this.state&(ib|jb|kb)&&(this.state=eb),this.state=this.process(b),void(this.state&(fb|gb|hb|jb)&&this.tryEmit(b))):(this.reset(),void(this.state=kb))},process:function(){},getTouchAction:function(){},reset:function(){}},j(Z,V,{defaults:{pointers:1},attrTest:function(a){var b=this.options.pointers;return 0===b||a.pointers.length===b},process:function(a){var b=this.state,c=a.eventType,d=b&(fb|gb),e=this.attrTest(a);return d&&(c&Ba||!e)?b|jb:d||e?c&Aa?b|hb:b&fb?b|gb:fb:kb}}),j($,Z,{defaults:{event:"pan",threshold:10,pointers:1,direction:Ja},getTouchAction:function(){var a=this.options.direction,b=[];return a&Ha&&b.push(db),a&Ia&&b.push(cb),b},directionTest:function(a){var b=this.options,c=!0,d=a.distance,e=a.direction,f=a.deltaX,g=a.deltaY;return e&b.direction||(b.direction&Ha?(e=0===f?Ca:0>f?Da:Ea,c=f!=this.pX,d=Math.abs(a.deltaX)):(e=0===g?Ca:0>g?Fa:Ga,c=g!=this.pY,d=Math.abs(a.deltaY))),a.direction=e,c&&d>b.threshold&&e&b.direction},attrTest:function(a){return Z.prototype.attrTest.call(this,a)&&(this.state&fb||!(this.state&fb)&&this.directionTest(a))},emit:function(a){this.pX=a.deltaX,this.pY=a.deltaY;var b=X(a.direction);b&&this.manager.emit(this.options.event+b,a),this._super.emit.call(this,a)}}),j(_,Z,{defaults:{event:"pinch",threshold:0,pointers:2},getTouchAction:function(){return[bb]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.scale-1)>this.options.threshold||this.state&fb)},emit:function(a){if(this._super.emit.call(this,a),1!==a.scale){var b=a.scale<1?"in":"out";this.manager.emit(this.options.event+b,a)}}}),j(aa,V,{defaults:{event:"press",pointers:1,time:500,threshold:5},getTouchAction:function(){return[_a]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distance<b.threshold,f=a.deltaTime>b.time;if(this._input=a,!d||!c||a.eventType&(Aa|Ba)&&!f)this.reset();else if(a.eventType&ya)this.reset(),this._timer=e(function(){this.state=ib,this.tryEmit()},b.time,this);else if(a.eventType&Aa)return ib;return kb},reset:function(){clearTimeout(this._timer)},emit:function(a){this.state===ib&&(a&&a.eventType&Aa?this.manager.emit(this.options.event+"up",a):(this._input.timeStamp=na(),this.manager.emit(this.options.event,this._input)))}}),j(ba,Z,{defaults:{event:"rotate",threshold:0,pointers:2},getTouchAction:function(){return[bb]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.rotation)>this.options.threshold||this.state&fb)}}),j(ca,Z,{defaults:{event:"swipe",threshold:10,velocity:.65,direction:Ha|Ia,pointers:1},getTouchAction:function(){return $.prototype.getTouchAction.call(this)},attrTest:function(a){var b,c=this.options.direction;return c&(Ha|Ia)?b=a.velocity:c&Ha?b=a.velocityX:c&Ia&&(b=a.velocityY),this._super.attrTest.call(this,a)&&c&a.direction&&a.distance>this.options.threshold&&ma(b)>this.options.velocity&&a.eventType&Aa},emit:function(a){var b=X(a.direction);b&&this.manager.emit(this.options.event+b,a),this.manager.emit(this.options.event,a)}}),j(da,V,{defaults:{event:"tap",pointers:1,taps:1,interval:300,time:250,threshold:2,posThreshold:10},getTouchAction:function(){return[ab]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distance<b.threshold,f=a.deltaTime<b.time;if(this.reset(),a.eventType&ya&&0===this.count)return this.failTimeout();if(d&&f&&c){if(a.eventType!=Aa)return this.failTimeout();var g=!this.pTime||a.timeStamp-this.pTime<b.interval,h=!this.pCenter||I(this.pCenter,a.center)<b.posThreshold;this.pTime=a.timeStamp,this.pCenter=a.center,h&&g?this.count+=1:this.count=1,this._input=a;var i=this.count%b.taps;if(0===i)return this.hasRequireFailures()?(this._timer=e(function(){this.state=ib,this.tryEmit()},b.interval,this),fb):ib}return kb},failTimeout:function(){return this._timer=e(function(){this.state=kb},this.options.interval,this),kb},reset:function(){clearTimeout(this._timer)},emit:function(){this.state==ib&&(this._input.tapCount=this.count,this.manager.emit(this.options.event,this._input))}}),ea.VERSION="2.0.4",ea.defaults={domEvents:!1,touchAction:$a,enable:!0,inputTarget:null,inputClass:null,preset:[[ba,{enable:!1}],[_,{enable:!1},["rotate"]],[ca,{direction:Ha}],[$,{direction:Ha},["swipe"]],[da],[da,{event:"doubletap",taps:2},["tap"]],[aa]],cssProps:{userSelect:"default",touchSelect:"none",touchCallout:"none",contentZooming:"none",userDrag:"none",tapHighlightColor:"rgba(0,0,0,0)"}};var lb=1,mb=2;fa.prototype={set:function(a){return h(this.options,a),a.touchAction&&this.touchAction.update(),a.inputTarget&&(this.input.destroy(),this.input.target=a.inputTarget,this.input.init()),this},stop:function(a){this.session.stopped=a?mb:lb},recognize:function(a){var b=this.session;if(!b.stopped){this.touchAction.preventDefaults(a);var c,d=this.recognizers,e=b.curRecognizer;(!e||e&&e.state&ib)&&(e=b.curRecognizer=null);for(var f=0;f<d.length;)c=d[f],b.stopped===mb||e&&c!=e&&!c.canRecognizeWith(e)?c.reset():c.recognize(a),!e&&c.state&(fb|gb|hb)&&(e=b.curRecognizer=c),f++}},get:function(a){if(a instanceof V)return a;for(var b=this.recognizers,c=0;c<b.length;c++)if(b[c].options.event==a)return b[c];return null},add:function(a){if(f(a,"add",this))return this;var b=this.get(a.options.event);return b&&this.remove(b),this.recognizers.push(a),a.manager=this,this.touchAction.update(),a},remove:function(a){if(f(a,"remove",this))return this;var b=this.recognizers;return a=this.get(a),b.splice(s(b,a),1),this.touchAction.update(),this},on:function(a,b){var c=this.handlers;return g(r(a),function(a){c[a]=c[a]||[],c[a].push(b)}),this},off:function(a,b){var c=this.handlers;return g(r(a),function(a){b?c[a].splice(s(c[a],b),1):delete c[a]}),this},emit:function(a,b){this.options.domEvents&&ha(a,b);var c=this.handlers[a]&&this.handlers[a].slice();if(c&&c.length){b.type=a,b.preventDefault=function(){b.srcEvent.preventDefault()};for(var d=0;d<c.length;)c[d](b),d++}},destroy:function(){this.element&&ga(this,!1),this.handlers={},this.session={},this.input.destroy(),this.element=null}},h(ea,{INPUT_START:ya,INPUT_MOVE:za,INPUT_END:Aa,INPUT_CANCEL:Ba,STATE_POSSIBLE:eb,STATE_BEGAN:fb,STATE_CHANGED:gb,STATE_ENDED:hb,STATE_RECOGNIZED:ib,STATE_CANCELLED:jb,STATE_FAILED:kb,DIRECTION_NONE:Ca,DIRECTION_LEFT:Da,DIRECTION_RIGHT:Ea,DIRECTION_UP:Fa,DIRECTION_DOWN:Ga,DIRECTION_HORIZONTAL:Ha,DIRECTION_VERTICAL:Ia,DIRECTION_ALL:Ja,Manager:fa,Input:y,TouchAction:T,TouchInput:Q,MouseInput:M,PointerEventInput:N,TouchMouseInput:S,SingleTouchInput:O,Recognizer:V,AttrRecognizer:Z,Tap:da,Pan:$,Swipe:ca,Pinch:_,Rotate:ba,Press:aa,on:n,off:o,each:g,merge:i,extend:h,inherit:j,bindFn:k,prefixed:v}),typeof define==ka&&define.amd?define(function(){return ea}):"undefined"!=typeof module&&module.exports?module.exports=ea:a[c]=ea}(window,document,"Hammer"),function(a){"function"==typeof define&&define.amd?define(["jquery","hammerjs"],a):"object"==typeof exports?a(require("jquery"),require("hammerjs")):a(jQuery,Hammer)}(function(a,b){function c(c,d){var e=a(c);e.data("hammer")||e.data("hammer",new b(e[0],d))}a.fn.hammer=function(a){return this.each(function(){c(this,a)})},b.Manager.prototype.emit=function(b){return function(c,d){b.call(this,c,d),a(this.element).trigger({type:c,gesture:d})}}(b.Manager.prototype.emit)}),function(a){a.Package?Materialize={}:a.Materialize={}}(window),function(a){for(var b=0,c=["webkit","moz"],d=a.requestAnimationFrame,e=a.cancelAnimationFrame,f=c.length;--f>=0&&!d;)d=a[c[f]+"RequestAnimationFrame"],e=a[c[f]+"CancelRequestAnimationFrame"];d&&e||(d=function(a){var c=+Date.now(),d=Math.max(b+16,c);return setTimeout(function(){a(b=d)},d-c)},e=clearTimeout),a.requestAnimationFrame=d,a.cancelAnimationFrame=e}(window),Materialize.guid=function(){function a(){return Math.floor(65536*(1+Math.random())).toString(16).substring(1)}return function(){return a()+a()+"-"+a()+"-"+a()+"-"+a()+"-"+a()+a()+a()}}(),Materialize.escapeHash=function(a){return a.replace(/(:|\.|\[|\]|,|=)/g,"\\$1")},Materialize.elementOrParentIsFixed=function(a){var b=$(a),c=b.add(b.parents()),d=!1;return c.each(function(){if("fixed"===$(this).css("position"))return d=!0,!1}),d};var getTime=Date.now||function(){return(new Date).getTime()};Materialize.throttle=function(a,b,c){var d,e,f,g=null,h=0;c||(c={});var i=function(){h=c.leading===!1?0:getTime(),g=null,f=a.apply(d,e),d=e=null};return function(){var j=getTime();h||c.leading!==!1||(h=j);var k=b-(j-h);return d=this,e=arguments,k<=0?(clearTimeout(g),g=null,h=j,f=a.apply(d,e),d=e=null):g||c.trailing===!1||(g=setTimeout(i,k)),f}};var Vel;Vel=jQuery?jQuery.Velocity:$?$.Velocity:Velocity,function(a){a.fn.collapsible=function(b){var c={accordion:void 0,onOpen:void 0,onClose:void 0};return b=a.extend(c,b),this.each(function(){function c(b){j=i.find("> li > .collapsible-header"),b.hasClass("active")?b.parent().addClass("active"):b.parent().removeClass("active"),b.parent().hasClass("active")?b.siblings(".collapsible-body").stop(!0,!1).slideDown({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){a(this).css("height","")}}):b.siblings(".collapsible-body").stop(!0,!1).slideUp({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){a(this).css("height","")}}),j.not(b).removeClass("active").parent().removeClass("active"),j.not(b).parent().children(".collapsible-body").stop(!0,!1).each(function(){a(this).is(":visible")&&a(this).slideUp({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){a(this).css("height",""),f(a(this).siblings(".collapsible-header"))}})})}function d(b){b.hasClass("active")?b.parent().addClass("active"):b.parent().removeClass("active"),b.parent().hasClass("active")?b.siblings(".collapsible-body").stop(!0,!1).slideDown({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){a(this).css("height","")}}):b.siblings(".collapsible-body").stop(!0,!1).slideUp({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){a(this).css("height","")}})}function e(a){b.accordion||"accordion"===k||void 0===k?c(a):d(a),f(a)}function f(a){a.hasClass("active")?"function"==typeof b.onOpen&&b.onOpen.call(this,a.parent()):"function"==typeof b.onClose&&b.onClose.call(this,a.parent())}function g(a){var b=h(a);return b.length>0}function h(a){return a.closest("li > .collapsible-header")}var i=a(this),j=a(this).find("> li > .collapsible-header"),k=i.data("collapsible");i.off("click.collapse","> li > .collapsible-header"),j.off("click.collapse"),i.on("click.collapse","> li > .collapsible-header",function(b){var c=a(b.target);g(c)&&(c=h(c)),c.toggleClass("active"),e(c)}),b.accordion||"accordion"===k||void 0===k?e(j.filter(".active").first()):j.filter(".active").each(function(){e(a(this))})})},a(document).ready(function(){a(".collapsible").collapsible()})}(jQuery),function(a){a.fn.scrollTo=function(b){return a(this).scrollTop(a(this).scrollTop()-a(this).offset().top+a(b).offset().top),this},a.fn.dropdown=function(b){var c={inDuration:300,outDuration:225,constrainWidth:!0,hover:!1,gutter:0,belowOrigin:!1,alignment:"left",stopPropagation:!1};return"open"===b?(this.each(function(){a(this).trigger("open")}),!1):"close"===b?(this.each(function(){a(this).trigger("close")}),!1):void this.each(function(){function d(){void 0!==g.data("induration")&&(h.inDuration=g.data("induration")),void 0!==g.data("outduration")&&(h.outDuration=g.data("outduration")),void 0!==g.data("constrainwidth")&&(h.constrainWidth=g.data("constrainwidth")),void 0!==g.data("hover")&&(h.hover=g.data("hover")),void 0!==g.data("gutter")&&(h.gutter=g.data("gutter")),void 0!==g.data("beloworigin")&&(h.belowOrigin=g.data("beloworigin")),void 0!==g.data("alignment")&&(h.alignment=g.data("alignment")),void 0!==g.data("stoppropagation")&&(h.stopPropagation=g.data("stoppropagation"))}function e(b){"focus"===b&&(i=!0),d(),j.addClass("active"),g.addClass("active"),h.constrainWidth===!0?j.css("width",g.outerWidth()):j.css("white-space","nowrap");var c=window.innerHeight,e=g.innerHeight(),k=g.offset().left,l=g.offset().top-a(window).scrollTop(),m=h.alignment,n=0,o=0,p=0;h.belowOrigin===!0&&(p=e);var q=0,r=0,s=g.parent();if(s.is("body")||(s[0].scrollHeight>s[0].clientHeight&&(q=s[0].scrollTop),s[0].scrollWidth>s[0].clientWidth&&(r=s[0].scrollLeft)),k+j.innerWidth()>a(window).width()?m="right":k-j.innerWidth()+g.innerWidth()<0&&(m="left"),l+j.innerHeight()>c)if(l+e-j.innerHeight()<0){var t=c-l-p;j.css("max-height",t)}else p||(p+=e),p-=j.innerHeight();if("left"===m)n=h.gutter,o=g.position().left+n;else if("right"===m){var u=g.position().left+g.outerWidth()-j.outerWidth();n=-h.gutter,o=u+n}j.css({position:"absolute",top:g.position().top+p+q,left:o+r}),j.stop(!0,!0).css("opacity",0).slideDown({queue:!1,duration:h.inDuration,easing:"easeOutCubic",complete:function(){a(this).css("height","")}}).animate({opacity:1},{queue:!1,duration:h.inDuration,easing:"easeOutSine"}),a(document).bind("click."+j.attr("id")+" touchstart."+j.attr("id"),function(b){j.is(b.target)||g.is(b.target)||g.find(b.target).length||(f(),a(document).unbind("click."+j.attr("id")+" touchstart."+j.attr("id")))})}function f(){i=!1,j.fadeOut(h.outDuration),j.removeClass("active"),g.removeClass("active"),a(document).unbind("click."+j.attr("id")+" touchstart."+j.attr("id")),setTimeout(function(){j.css("max-height","")},h.outDuration)}var g=a(this),h=a.extend({},c,b),i=!1,j=a("#"+g.attr("data-activates"));if(d(),g.after(j),h.hover){var k=!1;g.unbind("click."+g.attr("id")),g.on("mouseenter",function(a){k===!1&&(e(),k=!0)}),g.on("mouseleave",function(b){var c=b.toElement||b.relatedTarget;a(c).closest(".dropdown-content").is(j)||(j.stop(!0,!0),f(),k=!1)}),j.on("mouseleave",function(b){var c=b.toElement||b.relatedTarget;a(c).closest(".dropdown-button").is(g)||(j.stop(!0,!0),f(),k=!1)})}else g.unbind("click."+g.attr("id")),g.bind("click."+g.attr("id"),function(b){i||(g[0]!=b.currentTarget||g.hasClass("active")||0!==a(b.target).closest(".dropdown-content").length?g.hasClass("active")&&(f(),a(document).unbind("click."+j.attr("id")+" touchstart."+j.attr("id"))):(b.preventDefault(),h.stopPropagation&&b.stopPropagation(),e("click")))});g.on("open",function(a,b){e(b)}),g.on("close",f)})},a(document).ready(function(){a(".dropdown-button").dropdown()})}(jQuery),function(a){var b=0,c=0,d=function(){return c++,"materialize-modal-overlay-"+c},e={init:function(c){var e={opacity:.5,inDuration:350,outDuration:250,ready:void 0,
+complete:void 0,dismissible:!0,startingTop:"4%",endingTop:"10%"};return c=a.extend(e,c),this.each(function(){var e=a(this),f=a(this).attr("id")||"#"+a(this).data("target"),g=function(){var d=e.data("overlay-id"),f=a("#"+d);e.removeClass("open"),a("body").css({overflow:"",width:""}),e.find(".modal-close").off("click.close"),a(document).off("keyup.modal"+d),f.velocity({opacity:0},{duration:c.outDuration,queue:!1,ease:"easeOutQuart"});var g={duration:c.outDuration,queue:!1,ease:"easeOutCubic",complete:function(){a(this).css({display:"none"}),"function"==typeof c.complete&&c.complete.call(this,e),f.remove(),b--}};e.hasClass("bottom-sheet")?e.velocity({bottom:"-100%",opacity:0},g):e.velocity({top:c.startingTop,opacity:0,scaleX:.7},g)},h=function(f){var h=a("body"),i=h.innerWidth();if(h.css("overflow","hidden"),h.width(i),!e.hasClass("open")){var j=d(),k=a('<div class="modal-overlay"></div>');lStack=++b,k.attr("id",j).css("z-index",1e3+2*lStack),e.data("overlay-id",j).css("z-index",1e3+2*lStack+1),e.addClass("open"),a("body").append(k),c.dismissible&&(k.click(function(){g()}),a(document).on("keyup.modal"+j,function(a){27===a.keyCode&&g()})),e.find(".modal-close").on("click.close",function(a){g()}),k.css({display:"block",opacity:0}),e.css({display:"block",opacity:0}),k.velocity({opacity:c.opacity},{duration:c.inDuration,queue:!1,ease:"easeOutCubic"}),e.data("associated-overlay",k[0]);var l={duration:c.inDuration,queue:!1,ease:"easeOutCubic",complete:function(){"function"==typeof c.ready&&c.ready.call(this,e,f)}};e.hasClass("bottom-sheet")?e.velocity({bottom:"0",opacity:1},l):(a.Velocity.hook(e,"scaleX",.7),e.css({top:c.startingTop}),e.velocity({top:c.endingTop,opacity:1,scaleX:"1"},l))}};a(document).off("click.modalTrigger",'a[href="#'+f+'"], [data-target="'+f+'"]'),a(this).off("openModal"),a(this).off("closeModal"),a(document).on("click.modalTrigger",'a[href="#'+f+'"], [data-target="'+f+'"]',function(b){c.startingTop=(a(this).offset().top-a(window).scrollTop())/1.15,h(a(this)),b.preventDefault()}),a(this).on("openModal",function(){a(this).attr("href")||"#"+a(this).data("target");h()}),a(this).on("closeModal",function(){g()})})},open:function(){a(this).trigger("openModal")},close:function(){a(this).trigger("closeModal")}};a.fn.modal=function(b){return e[b]?e[b].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof b&&b?void a.error("Method "+b+" does not exist on jQuery.modal"):e.init.apply(this,arguments)}}(jQuery),function(a){a.fn.materialbox=function(){return this.each(function(){function b(){f=!1;var b=i.parent(".material-placeholder"),d=(window.innerWidth,window.innerHeight,i.data("width")),g=i.data("height");i.velocity("stop",!0),a("#materialbox-overlay").velocity("stop",!0),a(".materialbox-caption").velocity("stop",!0),a("#materialbox-overlay").velocity({opacity:0},{duration:h,queue:!1,easing:"easeOutQuad",complete:function(){e=!1,a(this).remove()}}),i.velocity({width:d,height:g,left:0,top:0},{duration:h,queue:!1,easing:"easeOutQuad"}),a(".materialbox-caption").velocity({opacity:0},{duration:h,queue:!1,easing:"easeOutQuad",complete:function(){b.css({height:"",width:"",position:"",top:"",left:""}),i.css({height:"",top:"",left:"",width:"","max-width":"",position:"","z-index":"","will-change":""}),i.removeClass("active"),f=!0,a(this).remove(),c&&c.css("overflow","")}})}if(!a(this).hasClass("initialized")){a(this).addClass("initialized");var c,d,e=!1,f=!0,g=275,h=200,i=a(this),j=a("<div></div>").addClass("material-placeholder");i.wrap(j),i.on("click",function(){var h=i.parent(".material-placeholder"),j=window.innerWidth,k=window.innerHeight,l=i.width(),m=i.height();if(f===!1)return b(),!1;if(e&&f===!0)return b(),!1;f=!1,i.addClass("active"),e=!0,h.css({width:h[0].getBoundingClientRect().width,height:h[0].getBoundingClientRect().height,position:"relative",top:0,left:0}),c=void 0,d=h[0].parentNode;for(;null!==d&&!a(d).is(document);){var n=a(d);"visible"!==n.css("overflow")&&(n.css("overflow","visible"),c=void 0===c?n:c.add(n)),d=d.parentNode}i.css({position:"absolute","z-index":1e3,"will-change":"left, top, width, height"}).data("width",l).data("height",m);var o=a('<div id="materialbox-overlay"></div>').css({opacity:0}).click(function(){f===!0&&b()});i.before(o);var p=o[0].getBoundingClientRect();if(o.css({width:j,height:k,left:-1*p.left,top:-1*p.top}),o.velocity({opacity:1},{duration:g,queue:!1,easing:"easeOutQuad"}),""!==i.data("caption")){var q=a('<div class="materialbox-caption"></div>');q.text(i.data("caption")),a("body").append(q),q.css({display:"inline"}),q.velocity({opacity:1},{duration:g,queue:!1,easing:"easeOutQuad"})}var r=0,s=l/j,t=m/k,u=0,v=0;s>t?(r=m/l,u=.9*j,v=.9*j*r):(r=l/m,u=.9*k*r,v=.9*k),i.hasClass("responsive-img")?i.velocity({"max-width":u,width:l},{duration:0,queue:!1,complete:function(){i.css({left:0,top:0}).velocity({height:v,width:u,left:a(document).scrollLeft()+j/2-i.parent(".material-placeholder").offset().left-u/2,top:a(document).scrollTop()+k/2-i.parent(".material-placeholder").offset().top-v/2},{duration:g,queue:!1,easing:"easeOutQuad",complete:function(){f=!0}})}}):i.css("left",0).css("top",0).velocity({height:v,width:u,left:a(document).scrollLeft()+j/2-i.parent(".material-placeholder").offset().left-u/2,top:a(document).scrollTop()+k/2-i.parent(".material-placeholder").offset().top-v/2},{duration:g,queue:!1,easing:"easeOutQuad",complete:function(){f=!0}})}),a(window).scroll(function(){e&&b()}),a(document).keyup(function(a){27===a.keyCode&&f===!0&&e&&b()})}})},a(document).ready(function(){a(".materialboxed").materialbox()})}(jQuery),function(a){a.fn.parallax=function(){var b=a(window).width();return this.each(function(c){function d(c){var d;d=b<601?e.height()>0?e.height():e.children("img").height():e.height()>0?e.height():500;var f=e.children("img").first(),g=f.height(),h=g-d,i=e.offset().top+d,j=e.offset().top,k=a(window).scrollTop(),l=window.innerHeight,m=k+l,n=(m-j)/(d+l),o=Math.round(h*n);c&&f.css("display","block"),i>k&&j<k+l&&f.css("transform","translate3D(-50%,"+o+"px, 0)")}var e=a(this);e.addClass("parallax"),e.children("img").one("load",function(){d(!0)}).each(function(){this.complete&&a(this).trigger("load")}),a(window).scroll(function(){b=a(window).width(),d(!1)}),a(window).resize(function(){b=a(window).width(),d(!1)})})}}(jQuery),function(a){var b={init:function(b){var c={onShow:null,swipeable:!1,responsiveThreshold:1/0};return b=a.extend(c,b),this.each(function(){var c,d,e,f,g,h=a(this),i=a(window).width(),j=h.find("li.tab a"),k=h.width(),l=a(),m=Math.max(k,h[0].scrollWidth)/j.length,n=prev_index=0,o=!1,p=300,q=function(a){return k-a.position().left-a.outerWidth()-h.scrollLeft()},r=function(a){return a.position().left+h.scrollLeft()},s=function(a){n-a>=0?(f.velocity({right:q(c)},{duration:p,queue:!1,easing:"easeOutQuad"}),f.velocity({left:r(c)},{duration:p,queue:!1,easing:"easeOutQuad",delay:90})):(f.velocity({left:r(c)},{duration:p,queue:!1,easing:"easeOutQuad"}),f.velocity({right:q(c)},{duration:p,queue:!1,easing:"easeOutQuad",delay:90}))};b.swipeable&&i>b.responsiveThreshold&&(b.swipeable=!1),c=a(j.filter('[href="'+location.hash+'"]')),0===c.length&&(c=a(this).find("li.tab a.active").first()),0===c.length&&(c=a(this).find("li.tab a").first()),c.addClass("active"),n=j.index(c),n<0&&(n=0),void 0!==c[0]&&(d=a(c[0].hash),d.addClass("active")),h.find(".indicator").length||h.append('<div class="indicator"></div>'),f=h.find(".indicator"),h.append(f),h.is(":visible")&&setTimeout(function(){f.css({right:q(c)}),f.css({left:r(c)})},0),a(window).resize(function(){k=h.width(),m=Math.max(k,h[0].scrollWidth)/j.length,n<0&&(n=0),0!==m&&0!==k&&(f.css({right:q(c)}),f.css({left:r(c)}))}),b.swipeable?(j.each(function(){var b=a(Materialize.escapeHash(this.hash));b.addClass("carousel-item"),l=l.add(b)}),e=l.wrapAll('<div class="tabs-content carousel"></div>'),l.css("display",""),a(".tabs-content.carousel").carousel({fullWidth:!0,noWrap:!0,onCycleTo:function(a){if(!o){var b=n;n=e.index(a),c=j.eq(n),s(b)}}})):j.not(c).each(function(){a(Materialize.escapeHash(this.hash)).hide()}),h.on("click","a",function(e){if(a(this).parent().hasClass("disabled"))return void e.preventDefault();if(!a(this).attr("target")){o=!0,k=h.width(),m=Math.max(k,h[0].scrollWidth)/j.length,c.removeClass("active");var f=d;c=a(this),d=a(Materialize.escapeHash(this.hash)),j=h.find("li.tab a");c.position();c.addClass("active"),prev_index=n,n=j.index(a(this)),n<0&&(n=0),b.swipeable?l.length&&l.carousel("set",n):(void 0!==d&&(d.show(),d.addClass("active"),"function"==typeof b.onShow&&b.onShow.call(this,d)),void 0===f||f.is(d)||(f.hide(),f.removeClass("active"))),g=setTimeout(function(){o=!1},p),s(prev_index),e.preventDefault()}})})},select_tab:function(a){this.find('a[href="#'+a+'"]').trigger("click")}};a.fn.tabs=function(c){return b[c]?b[c].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof c&&c?void a.error("Method "+c+" does not exist on jQuery.tabs"):b.init.apply(this,arguments)},a(document).ready(function(){a("ul.tabs").tabs()})}(jQuery),function(a){a.fn.tooltip=function(c){var d=5,e={delay:350,tooltip:"",position:"bottom",html:!1};return"remove"===c?(this.each(function(){a("#"+a(this).attr("data-tooltip-id")).remove(),a(this).off("mouseenter.tooltip mouseleave.tooltip")}),!1):(c=a.extend(e,c),this.each(function(){var e=Materialize.guid(),f=a(this);f.attr("data-tooltip-id")&&a("#"+f.attr("data-tooltip-id")).remove(),f.attr("data-tooltip-id",e);var g,h,i,j,k,l,m=function(){g=f.attr("data-html")?"true"===f.attr("data-html"):c.html,h=f.attr("data-delay"),h=void 0===h||""===h?c.delay:h,i=f.attr("data-position"),i=void 0===i||""===i?c.position:i,j=f.attr("data-tooltip"),j=void 0===j||""===j?c.tooltip:j};m();var n=function(){var b=a('<div class="material-tooltip"></div>');return j=g?a("<span></span>").html(j):a("<span></span>").text(j),b.append(j).appendTo(a("body")).attr("id",e),l=a('<div class="backdrop"></div>'),l.appendTo(b),b};k=n(),f.off("mouseenter.tooltip mouseleave.tooltip");var o,p=!1;f.on({"mouseenter.tooltip":function(a){var c=function(){m(),p=!0,k.velocity("stop"),l.velocity("stop"),k.css({visibility:"visible",left:"0px",top:"0px"});var a,c,e,g=f.outerWidth(),h=f.outerHeight(),j=k.outerHeight(),n=k.outerWidth(),o="0px",q="0px",r=l[0].offsetWidth,s=l[0].offsetHeight,t=8,u=8,v=0;"top"===i?(a=f.offset().top-j-d,c=f.offset().left+g/2-n/2,e=b(c,a,n,j),o="-10px",l.css({bottom:0,left:0,borderRadius:"14px 14px 0 0",transformOrigin:"50% 100%",marginTop:j,marginLeft:n/2-r/2})):"left"===i?(a=f.offset().top+h/2-j/2,c=f.offset().left-n-d,e=b(c,a,n,j),q="-10px",l.css({top:"-7px",right:0,width:"14px",height:"14px",borderRadius:"14px 0 0 14px",transformOrigin:"95% 50%",marginTop:j/2,marginLeft:n})):"right"===i?(a=f.offset().top+h/2-j/2,c=f.offset().left+g+d,e=b(c,a,n,j),q="+10px",l.css({top:"-7px",left:0,width:"14px",height:"14px",borderRadius:"0 14px 14px 0",transformOrigin:"5% 50%",marginTop:j/2,marginLeft:"0px"})):(a=f.offset().top+f.outerHeight()+d,c=f.offset().left+g/2-n/2,e=b(c,a,n,j),o="+10px",l.css({top:0,left:0,marginLeft:n/2-r/2})),k.css({top:e.y,left:e.x}),t=Math.SQRT2*n/parseInt(r),u=Math.SQRT2*j/parseInt(s),v=Math.max(t,u),k.velocity({translateY:o,translateX:q},{duration:350,queue:!1}).velocity({opacity:1},{duration:300,delay:50,queue:!1}),l.css({visibility:"visible"}).velocity({opacity:1},{duration:55,delay:0,queue:!1}).velocity({scaleX:v,scaleY:v},{duration:300,delay:0,queue:!1,easing:"easeInOutQuad"})};o=setTimeout(c,h)},"mouseleave.tooltip":function(){p=!1,clearTimeout(o),setTimeout(function(){p!==!0&&(k.velocity({opacity:0,translateY:0,translateX:0},{duration:225,queue:!1}),l.velocity({opacity:0,scaleX:1,scaleY:1},{duration:225,queue:!1,complete:function(){l.css({visibility:"hidden"}),k.css({visibility:"hidden"}),p=!1}}))},225)}})}))};var b=function(b,c,d,e){var f=b,g=c;return f<0?f=4:f+d>window.innerWidth&&(f-=f+d-window.innerWidth),g<0?g=4:g+e>window.innerHeight+a(window).scrollTop&&(g-=g+e-window.innerHeight),{x:f,y:g}};a(document).ready(function(){a(".tooltipped").tooltip()})}(jQuery),function(a){"use strict";function b(a){return null!==a&&a===a.window}function c(a){return b(a)?a:9===a.nodeType&&a.defaultView}function d(a){var b,d,e={top:0,left:0},f=a&&a.ownerDocument;return b=f.documentElement,"undefined"!=typeof a.getBoundingClientRect&&(e=a.getBoundingClientRect()),d=c(f),{top:e.top+d.pageYOffset-b.clientTop,left:e.left+d.pageXOffset-b.clientLeft}}function e(a){var b="";for(var c in a)a.hasOwnProperty(c)&&(b+=c+":"+a[c]+";");return b}function f(a){if(k.allowEvent(a)===!1)return null;for(var b=null,c=a.target||a.srcElement;null!==c.parentElement;){if(!(c instanceof SVGElement||c.className.indexOf("waves-effect")===-1)){b=c;break}if(c.classList.contains("waves-effect")){b=c;break}c=c.parentElement}return b}function g(b){var c=f(b);null!==c&&(j.show(b,c),"ontouchstart"in a&&(c.addEventListener("touchend",j.hide,!1),c.addEventListener("touchcancel",j.hide,!1)),c.addEventListener("mouseup",j.hide,!1),c.addEventListener("mouseleave",j.hide,!1))}var h=h||{},i=document.querySelectorAll.bind(document),j={duration:750,show:function(a,b){if(2===a.button)return!1;var c=b||this,f=document.createElement("div");f.className="waves-ripple",c.appendChild(f);var g=d(c),h=a.pageY-g.top,i=a.pageX-g.left,k="scale("+c.clientWidth/100*10+")";"touches"in a&&(h=a.touches[0].pageY-g.top,i=a.touches[0].pageX-g.left),f.setAttribute("data-hold",Date.now()),f.setAttribute("data-scale",k),f.setAttribute("data-x",i),f.setAttribute("data-y",h);var l={top:h+"px",left:i+"px"};f.className=f.className+" waves-notransition",f.setAttribute("style",e(l)),f.className=f.className.replace("waves-notransition",""),l["-webkit-transform"]=k,l["-moz-transform"]=k,l["-ms-transform"]=k,l["-o-transform"]=k,l.transform=k,l.opacity="1",l["-webkit-transition-duration"]=j.duration+"ms",l["-moz-transition-duration"]=j.duration+"ms",l["-o-transition-duration"]=j.duration+"ms",l["transition-duration"]=j.duration+"ms",l["-webkit-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",l["-moz-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",l["-o-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",l["transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",f.setAttribute("style",e(l))},hide:function(a){k.touchup(a);var b=this,c=(1.4*b.clientWidth,null),d=b.getElementsByClassName("waves-ripple");if(!(d.length>0))return!1;c=d[d.length-1];var f=c.getAttribute("data-x"),g=c.getAttribute("data-y"),h=c.getAttribute("data-scale"),i=Date.now()-Number(c.getAttribute("data-hold")),l=350-i;l<0&&(l=0),setTimeout(function(){var a={top:g+"px",left:f+"px",opacity:"0","-webkit-transition-duration":j.duration+"ms","-moz-transition-duration":j.duration+"ms","-o-transition-duration":j.duration+"ms","transition-duration":j.duration+"ms","-webkit-transform":h,"-moz-transform":h,"-ms-transform":h,"-o-transform":h,transform:h};c.setAttribute("style",e(a)),setTimeout(function(){try{b.removeChild(c)}catch(a){return!1}},j.duration)},l)},wrapInput:function(a){for(var b=0;b<a.length;b++){var c=a[b];if("input"===c.tagName.toLowerCase()){var d=c.parentNode;if("i"===d.tagName.toLowerCase()&&d.className.indexOf("waves-effect")!==-1)continue;var e=document.createElement("i");e.className=c.className+" waves-input-wrapper";var f=c.getAttribute("style");f||(f=""),e.setAttribute("style",f),c.className="waves-button-input",c.removeAttribute("style"),d.replaceChild(e,c),e.appendChild(c)}}}},k={touches:0,allowEvent:function(a){var b=!0;return"touchstart"===a.type?k.touches+=1:"touchend"===a.type||"touchcancel"===a.type?setTimeout(function(){k.touches>0&&(k.touches-=1)},500):"mousedown"===a.type&&k.touches>0&&(b=!1),b},touchup:function(a){k.allowEvent(a)}};h.displayEffect=function(b){b=b||{},"duration"in b&&(j.duration=b.duration),j.wrapInput(i(".waves-effect")),"ontouchstart"in a&&document.body.addEventListener("touchstart",g,!1),document.body.addEventListener("mousedown",g,!1)},h.attach=function(b){"input"===b.tagName.toLowerCase()&&(j.wrapInput([b]),b=b.parentElement),"ontouchstart"in a&&b.addEventListener("touchstart",g,!1),b.addEventListener("mousedown",g,!1)},a.Waves=h,document.addEventListener("DOMContentLoaded",function(){h.displayEffect()},!1)}(window),Materialize.toast=function(a,b,c,d){function e(a){var b=document.createElement("div");if(b.classList.add("toast"),c)for(var e=c.split(" "),f=0,g=e.length;f<g;f++)b.classList.add(e[f]);("object"==typeof HTMLElement?a instanceof HTMLElement:a&&"object"==typeof a&&null!==a&&1===a.nodeType&&"string"==typeof a.nodeName)?b.appendChild(a):a instanceof jQuery?b.appendChild(a[0]):b.innerHTML=a;var h=new Hammer(b,{prevent_default:!1});return h.on("pan",function(a){var c=a.deltaX,d=80;b.classList.contains("panning")||b.classList.add("panning");var e=1-Math.abs(c/d);e<0&&(e=0),Vel(b,{left:c,opacity:e},{duration:50,queue:!1,easing:"easeOutQuad"})}),h.on("panend",function(a){var c=a.deltaX,e=80;Math.abs(c)>e?Vel(b,{marginTop:"-40px"},{duration:375,easing:"easeOutExpo",queue:!1,complete:function(){"function"==typeof d&&d(),b.parentNode.removeChild(b)}}):(b.classList.remove("panning"),Vel(b,{left:0,opacity:1},{duration:300,easing:"easeOutExpo",queue:!1}))}),b}c=c||"";var f=document.getElementById("toast-container");null===f&&(f=document.createElement("div"),f.id="toast-container",document.body.appendChild(f));var g=e(a);a&&f.appendChild(g),g.style.opacity=0,Vel(g,{translateY:"-35px",opacity:1},{duration:300,easing:"easeOutCubic",queue:!1});var h,i=b;null!=i&&(h=setInterval(function(){null===g.parentNode&&window.clearInterval(h),g.classList.contains("panning")||(i-=20),i<=0&&(Vel(g,{opacity:0,marginTop:"-40px"},{duration:375,easing:"easeOutExpo",queue:!1,complete:function(){"function"==typeof d&&d(),this[0].parentNode.removeChild(this[0])}}),window.clearInterval(h))},20))},function(a){var b={init:function(b){var c={menuWidth:300,edge:"left",closeOnClick:!1,draggable:!0};b=a.extend(c,b),a(this).each(function(){var c=a(this),d=c.attr("data-activates"),e=a("#"+d);300!=b.menuWidth&&e.css("width",b.menuWidth);var f=a('.drag-target[data-sidenav="'+d+'"]');b.draggable?(f.length&&f.remove(),f=a('<div class="drag-target"></div>').attr("data-sidenav",d),a("body").append(f)):f=a(),"left"==b.edge?(e.css("transform","translateX(-100%)"),f.css({left:0})):(e.addClass("right-aligned").css("transform","translateX(100%)"),f.css({right:0})),e.hasClass("fixed")&&window.innerWidth>992&&e.css("transform","translateX(0)"),e.hasClass("fixed")&&a(window).resize(function(){window.innerWidth>992?0!==a("#sidenav-overlay").length&&i?g(!0):e.css("transform","translateX(0%)"):i===!1&&("left"===b.edge?e.css("transform","translateX(-100%)"):e.css("transform","translateX(100%)"))}),b.closeOnClick===!0&&e.on("click.itemclick","a:not(.collapsible-header)",function(){g()});var g=function(c){h=!1,i=!1,a("body").css({overflow:"",width:""}),a("#sidenav-overlay").velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){a(this).remove()}}),"left"===b.edge?(f.css({width:"",right:"",left:"0"}),e.velocity({translateX:"-100%"},{duration:200,queue:!1,easing:"easeOutCubic",complete:function(){c===!0&&(e.removeAttr("style"),e.css("width",b.menuWidth))}})):(f.css({width:"",right:"0",left:""}),e.velocity({translateX:"100%"},{duration:200,queue:!1,easing:"easeOutCubic",complete:function(){c===!0&&(e.removeAttr("style"),e.css("width",b.menuWidth))}}))},h=!1,i=!1;b.draggable&&(f.on("click",function(){i&&g()}),f.hammer({prevent_default:!1}).bind("pan",function(c){if("touch"==c.gesture.pointerType){var d=(c.gesture.direction,c.gesture.center.x),f=(c.gesture.center.y,c.gesture.velocityX,a("body")),h=a("#sidenav-overlay"),j=f.innerWidth();if(f.css("overflow","hidden"),f.width(j),0===h.length&&(h=a('<div id="sidenav-overlay"></div>'),h.css("opacity",0).click(function(){g()}),a("body").append(h)),"left"===b.edge&&(d>b.menuWidth?d=b.menuWidth:d<0&&(d=0)),"left"===b.edge)d<b.menuWidth/2?i=!1:d>=b.menuWidth/2&&(i=!0),e.css("transform","translateX("+(d-b.menuWidth)+"px)");else{d<window.innerWidth-b.menuWidth/2?i=!0:d>=window.innerWidth-b.menuWidth/2&&(i=!1);var k=d-b.menuWidth/2;k<0&&(k=0),e.css("transform","translateX("+k+"px)")}var l;"left"===b.edge?(l=d/b.menuWidth,h.velocity({opacity:l},{duration:10,queue:!1,easing:"easeOutQuad"})):(l=Math.abs((d-window.innerWidth)/b.menuWidth),h.velocity({opacity:l},{duration:10,queue:!1,easing:"easeOutQuad"}))}}).bind("panend",function(c){if("touch"==c.gesture.pointerType){var d=a('<div id="sidenav-overlay"></div>'),g=c.gesture.velocityX,j=c.gesture.center.x,k=j-b.menuWidth,l=j-b.menuWidth/2;k>0&&(k=0),l<0&&(l=0),h=!1,"left"===b.edge?i&&g<=.3||g<-.5?(0!==k&&e.velocity({translateX:[0,k]},{duration:300,queue:!1,easing:"easeOutQuad"}),d.velocity({opacity:1},{duration:50,queue:!1,easing:"easeOutQuad"}),f.css({width:"50%",right:0,left:""}),i=!0):(!i||g>.3)&&(a("body").css({overflow:"",width:""}),e.velocity({translateX:[-1*b.menuWidth-10,k]},{duration:200,queue:!1,easing:"easeOutQuad"}),d.velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){a(this).remove()}}),f.css({width:"10px",right:"",left:0})):i&&g>=-.3||g>.5?(0!==l&&e.velocity({translateX:[0,l]},{duration:300,queue:!1,easing:"easeOutQuad"}),d.velocity({opacity:1},{duration:50,queue:!1,easing:"easeOutQuad"}),f.css({width:"50%",right:"",left:0}),i=!0):(!i||g<-.3)&&(a("body").css({overflow:"",width:""}),e.velocity({translateX:[b.menuWidth+10,l]},{duration:200,queue:!1,easing:"easeOutQuad"}),d.velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){a(this).remove()}}),f.css({width:"10px",right:0,left:""}))}})),c.off("click.sidenav").on("click.sidenav",function(){if(i===!0)i=!1,h=!1,g();else{var c=a("body"),d=a('<div id="sidenav-overlay"></div>'),j=c.innerWidth();c.css("overflow","hidden"),c.width(j),a("body").append(f),"left"===b.edge?(f.css({width:"50%",right:0,left:""}),e.velocity({translateX:[0,-1*b.menuWidth]},{duration:300,queue:!1,easing:"easeOutQuad"})):(f.css({width:"50%",right:"",left:0}),e.velocity({translateX:[0,b.menuWidth]},{duration:300,queue:!1,easing:"easeOutQuad"})),d.css("opacity",0).click(function(){i=!1,h=!1,g(),d.velocity({opacity:0},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){a(this).remove()}})}),a("body").append(d),d.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){i=!0,h=!1}})}return!1})})},destroy:function(){var b=a("#sidenav-overlay"),c=a('.drag-target[data-sidenav="'+a(this).attr("data-activates")+'"]');b.trigger("click"),c.remove(),a(this).off("click"),b.remove()},show:function(){this.trigger("click")},hide:function(){a("#sidenav-overlay").trigger("click")}};a.fn.sideNav=function(c){return b[c]?b[c].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof c&&c?void a.error("Method "+c+" does not exist on jQuery.sideNav"):b.init.apply(this,arguments)}}(jQuery),function(a){function b(b,c,d,e){var g=a();return a.each(f,function(a,f){if(f.height()>0){var h=f.offset().top,i=f.offset().left,j=i+f.width(),k=h+f.height(),l=!(i>c||j<e||h>d||k<b);l&&g.push(f)}}),g}function c(c){++i;var d=e.scrollTop(),f=e.scrollLeft(),h=f+e.width(),k=d+e.height(),l=b(d+j.top+c||200,h+j.right,k+j.bottom,f+j.left);a.each(l,function(a,b){var c=b.data("scrollSpy:ticks");"number"!=typeof c&&b.triggerHandler("scrollSpy:enter"),b.data("scrollSpy:ticks",i)}),a.each(g,function(a,b){var c=b.data("scrollSpy:ticks");"number"==typeof c&&c!==i&&(b.triggerHandler("scrollSpy:exit"),b.data("scrollSpy:ticks",null))}),g=l}function d(){e.trigger("scrollSpy:winSize")}var e=a(window),f=[],g=[],h=!1,i=0,j={top:0,right:0,bottom:0,left:0};a.scrollSpy=function(b,d){var g={throttle:100,scrollOffset:200};d=a.extend(g,d);var i=[];b=a(b),b.each(function(b,c){f.push(a(c)),a(c).data("scrollSpy:id",b),a('a[href="#'+a(c).attr("id")+'"]').click(function(b){b.preventDefault();var c=a(Materialize.escapeHash(this.hash)).offset().top+1;a("html, body").animate({scrollTop:c-d.scrollOffset},{duration:400,queue:!1,easing:"easeOutCubic"})})}),j.top=d.offsetTop||0,j.right=d.offsetRight||0,j.bottom=d.offsetBottom||0,j.left=d.offsetLeft||0;var k=Materialize.throttle(function(){c(d.scrollOffset)},d.throttle||100),l=function(){a(document).ready(k)};return h||(e.on("scroll",l),e.on("resize",l),h=!0),setTimeout(l,0),b.on("scrollSpy:enter",function(){i=a.grep(i,function(a){return 0!=a.height()});var b=a(this);i[0]?(a('a[href="#'+i[0].attr("id")+'"]').removeClass("active"),b.data("scrollSpy:id")<i[0].data("scrollSpy:id")?i.unshift(a(this)):i.push(a(this))):i.push(a(this)),a('a[href="#'+i[0].attr("id")+'"]').addClass("active")}),b.on("scrollSpy:exit",function(){if(i=a.grep(i,function(a){return 0!=a.height()}),i[0]){a('a[href="#'+i[0].attr("id")+'"]').removeClass("active");var b=a(this);i=a.grep(i,function(a){return a.attr("id")!=b.attr("id")}),i[0]&&a('a[href="#'+i[0].attr("id")+'"]').addClass("active")}}),b},a.winSizeSpy=function(b){return a.winSizeSpy=function(){return e},b=b||{throttle:100},e.on("resize",Materialize.throttle(d,b.throttle||100))},a.fn.scrollSpy=function(b){return a.scrollSpy(a(this),b)}}(jQuery),function(a){a(document).ready(function(){function b(b){var c=b.css("font-family"),d=b.css("font-size"),f=b.css("line-height");d&&e.css("font-size",d),c&&e.css("font-family",c),f&&e.css("line-height",f),"off"===b.attr("wrap")&&e.css("overflow-wrap","normal").css("white-space","pre"),e.text(b.val()+"\n");var g=e.html().replace(/\n/g,"<br>");e.html(g),b.is(":visible")?e.css("width",b.width()):e.css("width",a(window).width()/2),b.css("height",e.height())}Materialize.updateTextFields=function(){var b="input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea";a(b).each(function(b,c){var d=a(this);a(c).val().length>0||c.autofocus||void 0!==d.attr("placeholder")?d.siblings("label").addClass("active"):a(c)[0].validity?d.siblings("label").toggleClass("active",a(c)[0].validity.badInput===!0):d.siblings("label").removeClass("active")})};var c="input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea";a(document).on("change",c,function(){0===a(this).val().length&&void 0===a(this).attr("placeholder")||a(this).siblings("label").addClass("active"),validate_field(a(this))}),a(document).ready(function(){Materialize.updateTextFields()}),a(document).on("reset",function(b){var d=a(b.target);d.is("form")&&(d.find(c).removeClass("valid").removeClass("invalid"),d.find(c).each(function(){""===a(this).attr("value")&&a(this).siblings("label").removeClass("active")}),d.find("select.initialized").each(function(){var a=d.find("option[selected]").text();d.siblings("input.select-dropdown").val(a)}))}),a(document).on("focus",c,function(){a(this).siblings("label, .prefix").addClass("active")}),a(document).on("blur",c,function(){var b=a(this),c=".prefix";0===b.val().length&&b[0].validity.badInput!==!0&&void 0===b.attr("placeholder")&&(c+=", label"),b.siblings(c).removeClass("active"),validate_field(b)}),window.validate_field=function(a){var b=void 0!==a.attr("data-length"),c=parseInt(a.attr("data-length")),d=a.val().length;0===a.val().length&&a[0].validity.badInput===!1?a.hasClass("validate")&&(a.removeClass("valid"),a.removeClass("invalid")):a.hasClass("validate")&&(a.is(":valid")&&b&&d<=c||a.is(":valid")&&!b?(a.removeClass("invalid"),a.addClass("valid")):(a.removeClass("valid"),a.addClass("invalid")))};var d="input[type=radio], input[type=checkbox]";a(document).on("keyup.radio",d,function(b){if(9===b.which){a(this).addClass("tabbed");var c=a(this);return void c.one("blur",function(b){a(this).removeClass("tabbed")})}});var e=a(".hiddendiv").first();e.length||(e=a('<div class="hiddendiv common"></div>'),a("body").append(e));var f=".materialize-textarea";a(f).each(function(){var c=a(this);c.val().length&&b(c)}),a("body").on("keyup keydown autoresize",f,function(){b(a(this))}),a(document).on("change",'.file-field input[type="file"]',function(){for(var b=a(this).closest(".file-field"),c=b.find("input.file-path"),d=a(this)[0].files,e=[],f=0;f<d.length;f++)e.push(d[f].name);c.val(e.join(", ")),c.trigger("change")});var g,h="input[type=range]",i=!1;a(h).each(function(){var b=a('<span class="thumb"><span class="value"></span></span>');a(this).after(b)});var j=".range-field";a(document).on("change",h,function(b){var c=a(this).siblings(".thumb");c.find(".value").html(a(this).val())}),a(document).on("input mousedown touchstart",h,function(b){var c=a(this).siblings(".thumb"),d=a(this).outerWidth();c.length<=0&&(c=a('<span class="thumb"><span class="value"></span></span>'),a(this).after(c)),c.find(".value").html(a(this).val()),i=!0,a(this).addClass("active"),c.hasClass("active")||c.velocity({height:"30px",width:"30px",top:"-20px",marginLeft:"-15px"},{duration:300,easing:"easeOutExpo"}),"input"!==b.type&&(g=void 0===b.pageX||null===b.pageX?b.originalEvent.touches[0].pageX-a(this).offset().left:b.pageX-a(this).offset().left,g<0?g=0:g>d&&(g=d),c.addClass("active").css("left",g)),c.find(".value").html(a(this).val())}),a(document).on("mouseup touchend",j,function(){i=!1,a(this).removeClass("active")}),a(document).on("mousemove touchmove",j,function(b){var c,d=a(this).children(".thumb");if(i){d.hasClass("active")||d.velocity({height:"30px",width:"30px",top:"-20px",marginLeft:"-15px"},{duration:300,easing:"easeOutExpo"}),c=void 0===b.pageX||null===b.pageX?b.originalEvent.touches[0].pageX-a(this).offset().left:b.pageX-a(this).offset().left;var e=a(this).outerWidth();c<0?c=0:c>e&&(c=e),d.addClass("active").css("left",c),d.find(".value").html(d.siblings(h).val())}}),a(document).on("mouseout touchleave",j,function(){if(!i){var b=a(this).children(".thumb");b.hasClass("active")&&b.velocity({height:"0",width:"0",top:"10px",marginLeft:"-6px"},{duration:100}),b.removeClass("active")}}),a.fn.autocomplete=function(b){var c={data:{},limit:1/0,onAutocomplete:null};return b=a.extend(c,b),this.each(function(){var c,d=a(this),e=b.data,f=0,g=0,h=d.closest(".input-field");if(!a.isEmptyObject(e)){var i,j=a('<ul class="autocomplete-content dropdown-content"></ul>');h.length?(i=h.children(".autocomplete-content.dropdown-content").first(),i.length||h.append(j)):(i=d.next(".autocomplete-content.dropdown-content"),i.length||d.after(j)),i.length&&(j=i);var k=function(a,b){var c=b.find("img"),d=b.text().toLowerCase().indexOf(""+a.toLowerCase()),e=d+a.length-1,f=b.text().slice(0,d),g=b.text().slice(d,e+1),h=b.text().slice(e+1);b.html("<span>"+f+"<span class='highlight'>"+g+"</span>"+h+"</span>"),c.length&&b.prepend(c)},l=function(){g=0,j.find(".active").removeClass("active")};d.off("keyup.autocomplete").on("keyup.autocomplete",function(g){if(f=0,13!==g.which&&38!==g.which&&40!==g.which){var h=d.val().toLowerCase();if(c!==h&&(j.empty(),l(),""!==h))for(var i in e)if(e.hasOwnProperty(i)&&i.toLowerCase().indexOf(h)!==-1&&i.toLowerCase()!==h){if(f>=b.limit)break;var m=a("<li></li>");e[i]?m.append('<img src="'+e[i]+'" class="right circle"><span>'+i+"</span>"):m.append("<span>"+i+"</span>"),j.append(m),k(h,m),f++}c=h}}),d.off("keydown.autocomplete").on("keydown.autocomplete",function(a){var b,c=a.which,d=j.children("li").length,e=j.children(".active").first();return 13===c?(b=j.children("li").eq(g),void(b.length&&(b.click(),a.preventDefault()))):void(38!==c&&40!==c||(a.preventDefault(),38===c&&g>0&&g--,40===c&&g<d-1&&e.length&&g++,e.removeClass("active"),j.children("li").eq(g).addClass("active")))}),j.on("click","li",function(){var c=a(this).text().trim();d.val(c),d.trigger("change"),j.empty(),l(),"function"==typeof b.onAutocomplete&&b.onAutocomplete.call(this,c)})}})}}),a.fn.material_select=function(b){function c(a,b,c){var e=a.indexOf(b),f=e===-1;return f?a.push(b):a.splice(e,1),c.siblings("ul.dropdown-content").find("li").eq(b).toggleClass("active"),c.find("option").eq(b).prop("selected",f),d(a,c),f}function d(a,b){
+for(var c="",d=0,e=a.length;d<e;d++){var f=b.find("option").eq(a[d]).text();c+=0===d?f:", "+f}""===c&&(c=b.find("option:disabled").eq(0).text()),b.siblings("input.select-dropdown").val(c)}a(this).each(function(){var d=a(this);if(!d.hasClass("browser-default")){var e=!!d.attr("multiple"),f=d.data("select-id");if(f&&(d.parent().find("span.caret").remove(),d.parent().find("input").remove(),d.unwrap(),a("ul#select-options-"+f).remove()),"destroy"===b)return void d.data("select-id",null).removeClass("initialized");var g=Materialize.guid();d.data("select-id",g);var h=a('<div class="select-wrapper"></div>');h.addClass(d.attr("class"));var i=a('<ul id="select-options-'+g+'" class="dropdown-content select-dropdown '+(e?"multiple-select-dropdown":"")+'"></ul>'),j=d.children("option, optgroup"),k=[],l=!1,m=d.find("option:selected").html()||d.find("option:first").html()||"",n=function(b,c,d){var e=c.is(":disabled")?"disabled ":"",f="optgroup-option"===d?"optgroup-option ":"",g=c.data("icon"),h=c.attr("class");if(g){var j="";return h&&(j=' class="'+h+'"'),"multiple"===d?i.append(a('<li class="'+e+'"><img alt="" src="'+g+'"'+j+'><span><input type="checkbox"'+e+"/><label></label>"+c.html()+"</span></li>")):i.append(a('<li class="'+e+f+'"><img alt="" src="'+g+'"'+j+"><span>"+c.html()+"</span></li>")),!0}"multiple"===d?i.append(a('<li class="'+e+'"><span><input type="checkbox"'+e+"/><label></label>"+c.html()+"</span></li>")):i.append(a('<li class="'+e+f+'"><span>'+c.html()+"</span></li>"))};j.length&&j.each(function(){if(a(this).is("option"))e?n(d,a(this),"multiple"):n(d,a(this));else if(a(this).is("optgroup")){var b=a(this).children("option");i.append(a('<li class="optgroup"><span>'+a(this).attr("label")+"</span></li>")),b.each(function(){n(d,a(this),"optgroup-option")})}}),i.find("li:not(.optgroup)").each(function(f){a(this).click(function(g){if(!a(this).hasClass("disabled")&&!a(this).hasClass("optgroup")){var h=!0;e?(a('input[type="checkbox"]',this).prop("checked",function(a,b){return!b}),h=c(k,a(this).index(),d),q.trigger("focus")):(i.find("li").removeClass("active"),a(this).toggleClass("active"),q.val(a(this).text())),r(i,a(this)),d.find("option").eq(f).prop("selected",h),d.trigger("change"),"undefined"!=typeof b&&b()}g.stopPropagation()})}),d.wrap(h);var o=a('<span class="caret">&#9660;</span>');d.is(":disabled")&&o.addClass("disabled");var p=m.replace(/"/g,"&quot;"),q=a('<input type="text" class="select-dropdown" readonly="true" '+(d.is(":disabled")?"disabled":"")+' data-activates="select-options-'+g+'" value="'+p+'"/>');d.before(q),q.before(o),q.after(i),d.is(":disabled")||q.dropdown({hover:!1,closeOnClick:!1}),d.attr("tabindex")&&a(q[0]).attr("tabindex",d.attr("tabindex")),d.addClass("initialized"),q.on({focus:function(){if(a("ul.select-dropdown").not(i[0]).is(":visible")&&a("input.select-dropdown").trigger("close"),!i.is(":visible")){a(this).trigger("open",["focus"]);var b=a(this).val();e&&b.indexOf(",")>=0&&(b=b.split(",")[0]);var c=i.find("li").filter(function(){return a(this).text().toLowerCase()===b.toLowerCase()})[0];r(i,c,!0)}},click:function(a){a.stopPropagation()}}),q.on("blur",function(){e||a(this).trigger("close"),i.find("li.selected").removeClass("selected")}),i.hover(function(){l=!0},function(){l=!1}),a(window).on({click:function(){e&&(l||q.trigger("close"))}}),e&&d.find("option:selected:not(:disabled)").each(function(){var b=a(this).index();c(k,b,d),i.find("li").eq(b).find(":checkbox").prop("checked",!0)});var r=function(b,c,d){if(c){b.find("li.selected").removeClass("selected");var f=a(c);f.addClass("selected"),e&&!d||i.scrollTo(f)}},s=[],t=function(b){if(9==b.which)return void q.trigger("close");if(40==b.which&&!i.is(":visible"))return void q.trigger("open");if(13!=b.which||i.is(":visible")){b.preventDefault();var c=String.fromCharCode(b.which).toLowerCase(),d=[9,13,27,38,40];if(c&&d.indexOf(b.which)===-1){s.push(c);var f=s.join(""),g=i.find("li").filter(function(){return 0===a(this).text().toLowerCase().indexOf(f)})[0];g&&r(i,g)}if(13==b.which){var h=i.find("li.selected:not(.disabled)")[0];h&&(a(h).trigger("click"),e||q.trigger("close"))}40==b.which&&(g=i.find("li.selected").length?i.find("li.selected").next("li:not(.disabled)")[0]:i.find("li:not(.disabled)")[0],r(i,g)),27==b.which&&q.trigger("close"),38==b.which&&(g=i.find("li.selected").prev("li:not(.disabled)")[0],g&&r(i,g)),setTimeout(function(){s=[]},1e3)}};q.on("keydown",t)}})}}(jQuery),function(a){var b={init:function(b){var c={indicators:!0,height:400,transition:500,interval:6e3};return b=a.extend(c,b),this.each(function(){function c(a,b){a.hasClass("center-align")?a.velocity({opacity:0,translateY:-100},{duration:b,queue:!1}):a.hasClass("right-align")?a.velocity({opacity:0,translateX:100},{duration:b,queue:!1}):a.hasClass("left-align")&&a.velocity({opacity:0,translateX:-100},{duration:b,queue:!1})}function d(a){a>=j.length?a=0:a<0&&(a=j.length-1),k=i.find(".active").index(),k!=a&&(e=j.eq(k),$caption=e.find(".caption"),e.removeClass("active"),e.velocity({opacity:0},{duration:b.transition,queue:!1,easing:"easeOutQuad",complete:function(){j.not(".active").velocity({opacity:0,translateX:0,translateY:0},{duration:0,queue:!1})}}),c($caption,b.transition),b.indicators&&f.eq(k).removeClass("active"),j.eq(a).velocity({opacity:1},{duration:b.transition,queue:!1,easing:"easeOutQuad"}),j.eq(a).find(".caption").velocity({opacity:1,translateX:0,translateY:0},{duration:b.transition,delay:b.transition,queue:!1,easing:"easeOutQuad"}),j.eq(a).addClass("active"),b.indicators&&f.eq(a).addClass("active"))}var e,f,g,h=a(this),i=h.find("ul.slides").first(),j=i.find("> li"),k=i.find(".active").index();k!=-1&&(e=j.eq(k)),h.hasClass("fullscreen")||(b.indicators?h.height(b.height+40):h.height(b.height),i.height(b.height)),j.find(".caption").each(function(){c(a(this),0)}),j.find("img").each(function(){var b="data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==";a(this).attr("src")!==b&&(a(this).css("background-image","url("+a(this).attr("src")+")"),a(this).attr("src",b))}),b.indicators&&(f=a('<ul class="indicators"></ul>'),j.each(function(c){var e=a('<li class="indicator-item"></li>');e.click(function(){var c=i.parent(),e=c.find(a(this)).index();d(e),clearInterval(g),g=setInterval(function(){k=i.find(".active").index(),j.length==k+1?k=0:k+=1,d(k)},b.transition+b.interval)}),f.append(e)}),h.append(f),f=h.find("ul.indicators").find("li.indicator-item")),e?e.show():(j.first().addClass("active").velocity({opacity:1},{duration:b.transition,queue:!1,easing:"easeOutQuad"}),k=0,e=j.eq(k),b.indicators&&f.eq(k).addClass("active")),e.find("img").each(function(){e.find(".caption").velocity({opacity:1,translateX:0,translateY:0},{duration:b.transition,queue:!1,easing:"easeOutQuad"})}),g=setInterval(function(){k=i.find(".active").index(),d(k+1)},b.transition+b.interval);var l=!1,m=!1,n=!1;h.hammer({prevent_default:!1}).bind("pan",function(a){if("touch"===a.gesture.pointerType){clearInterval(g);var b=a.gesture.direction,c=a.gesture.deltaX,d=a.gesture.velocityX,e=a.gesture.velocityY;$curr_slide=i.find(".active"),Math.abs(d)>Math.abs(e)&&$curr_slide.velocity({translateX:c},{duration:50,queue:!1,easing:"easeOutQuad"}),4===b&&(c>h.innerWidth()/2||d<-.65)?n=!0:2===b&&(c<-1*h.innerWidth()/2||d>.65)&&(m=!0);var f;m&&(f=$curr_slide.next(),0===f.length&&(f=j.first()),f.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad"})),n&&(f=$curr_slide.prev(),0===f.length&&(f=j.last()),f.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad"}))}}).bind("panend",function(a){"touch"===a.gesture.pointerType&&($curr_slide=i.find(".active"),l=!1,curr_index=i.find(".active").index(),!n&&!m||j.length<=1?$curr_slide.velocity({translateX:0},{duration:300,queue:!1,easing:"easeOutQuad"}):m?(d(curr_index+1),$curr_slide.velocity({translateX:-1*h.innerWidth()},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){$curr_slide.velocity({opacity:0,translateX:0},{duration:0,queue:!1})}})):n&&(d(curr_index-1),$curr_slide.velocity({translateX:h.innerWidth()},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){$curr_slide.velocity({opacity:0,translateX:0},{duration:0,queue:!1})}})),m=!1,n=!1,clearInterval(g),g=setInterval(function(){k=i.find(".active").index(),j.length==k+1?k=0:k+=1,d(k)},b.transition+b.interval))}),h.on("sliderPause",function(){clearInterval(g)}),h.on("sliderStart",function(){clearInterval(g),g=setInterval(function(){k=i.find(".active").index(),j.length==k+1?k=0:k+=1,d(k)},b.transition+b.interval)}),h.on("sliderNext",function(){k=i.find(".active").index(),d(k+1)}),h.on("sliderPrev",function(){k=i.find(".active").index(),d(k-1)})})},pause:function(){a(this).trigger("sliderPause")},start:function(){a(this).trigger("sliderStart")},next:function(){a(this).trigger("sliderNext")},prev:function(){a(this).trigger("sliderPrev")}};a.fn.slider=function(c){return b[c]?b[c].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof c&&c?void a.error("Method "+c+" does not exist on jQuery.tooltip"):b.init.apply(this,arguments)}}(jQuery),function(a){a(document).ready(function(){a(document).on("click.card",".card",function(b){a(this).find("> .card-reveal").length&&(a(b.target).is(a(".card-reveal .card-title"))||a(b.target).is(a(".card-reveal .card-title i"))?a(this).find(".card-reveal").velocity({translateY:0},{duration:225,queue:!1,easing:"easeInOutQuad",complete:function(){a(this).css({display:"none"})}}):(a(b.target).is(a(".card .activator"))||a(b.target).is(a(".card .activator i")))&&(a(b.target).closest(".card").css("overflow","hidden"),a(this).find(".card-reveal").css({display:"block"}).velocity("stop",!1).velocity({translateY:"-100%"},{duration:300,queue:!1,easing:"easeInOutQuad"})))})})}(jQuery),function(a){var b={data:[],placeholder:"",secondaryPlaceholder:"",autocompleteData:{},autocompleteLimit:1/0};a(document).ready(function(){a(document).on("click",".chip .close",function(b){var c=a(this).closest(".chips");c.attr("data-initialized")||a(this).closest(".chip").remove()})}),a.fn.material_chip=function(c){var d=this;if(this.$el=a(this),this.$document=a(document),this.SELS={CHIPS:".chips",CHIP:".chip",INPUT:"input",DELETE:".material-icons",SELECTED_CHIP:".selected"},"data"===c)return this.$el.data("chips");var e=a.extend({},b,c);d.hasAutocomplete=!a.isEmptyObject(e.autocompleteData),this.init=function(){var b=0;d.$el.each(function(){var c=a(this),f=Materialize.guid();d.chipId=f,e.data&&e.data instanceof Array||(e.data=[]),c.data("chips",e.data),c.attr("data-index",b),c.attr("data-initialized",!0),c.hasClass(d.SELS.CHIPS)||c.addClass("chips"),d.chips(c,f),b++})},this.handleEvents=function(){var b=d.SELS;d.$document.off("click.chips-focus",b.CHIPS).on("click.chips-focus",b.CHIPS,function(c){a(c.target).find(b.INPUT).focus()}),d.$document.off("click.chips-select",b.CHIP).on("click.chips-select",b.CHIP,function(c){var e=a(c.target);if(e.length){var f=e.hasClass("selected"),g=e.closest(b.CHIPS);a(b.CHIP).removeClass("selected"),f||d.selectChip(e.index(),g)}}),d.$document.off("keydown.chips").on("keydown.chips",function(c){if(!a(c.target).is("input, textarea")){var e,f=d.$document.find(b.CHIP+b.SELECTED_CHIP),g=f.closest(b.CHIPS),h=f.siblings(b.CHIP).length;if(f.length)if(8===c.which||46===c.which){c.preventDefault(),e=f.index(),d.deleteChip(e,g);var i=null;e+1<h?i=e:e!==h&&e+1!==h||(i=h-1),i<0&&(i=null),null!==i&&d.selectChip(i,g),h||g.find("input").focus()}else if(37===c.which){if(e=f.index()-1,e<0)return;a(b.CHIP).removeClass("selected"),d.selectChip(e,g)}else if(39===c.which){if(e=f.index()+1,a(b.CHIP).removeClass("selected"),e>h)return void g.find("input").focus();d.selectChip(e,g)}}}),d.$document.off("focusin.chips",b.CHIPS+" "+b.INPUT).on("focusin.chips",b.CHIPS+" "+b.INPUT,function(c){var d=a(c.target).closest(b.CHIPS);d.addClass("focus"),d.siblings("label, .prefix").addClass("active"),a(b.CHIP).removeClass("selected")}),d.$document.off("focusout.chips",b.CHIPS+" "+b.INPUT).on("focusout.chips",b.CHIPS+" "+b.INPUT,function(c){var d=a(c.target).closest(b.CHIPS);d.removeClass("focus"),d.data("chips").length||d.siblings("label").removeClass("active"),d.siblings(".prefix").removeClass("active")}),d.$document.off("keydown.chips-add",b.CHIPS+" "+b.INPUT).on("keydown.chips-add",b.CHIPS+" "+b.INPUT,function(c){var e=a(c.target),f=e.closest(b.CHIPS),g=f.children(b.CHIP).length;if(13===c.which){if(d.hasAutocomplete&&f.find(".autocomplete-content.dropdown-content").length&&f.find(".autocomplete-content.dropdown-content").children().length)return;return c.preventDefault(),d.addChip({tag:e.val()},f),void e.val("")}if((8===c.keyCode||37===c.keyCode)&&""===e.val()&&g)return c.preventDefault(),d.selectChip(g-1,f),void e.blur()}),d.$document.off("click.chips-delete",b.CHIPS+" "+b.DELETE).on("click.chips-delete",b.CHIPS+" "+b.DELETE,function(c){var e=a(c.target),f=e.closest(b.CHIPS),g=e.closest(b.CHIP);c.stopPropagation(),d.deleteChip(g.index(),f),f.find("input").focus()})},this.chips=function(b,c){var f="";b.data("chips").forEach(function(a){f+=d.renderChip(a)}),f+='<input id="'+c+'" class="input" placeholder="">',b.html(f),d.setPlaceholder(b);var g=b.next("label");g.length&&(g.attr("for",c),b.data("chips").length&&g.addClass("active"));var h=a("#"+c);d.hasAutocomplete&&h.autocomplete({data:e.autocompleteData,limit:e.autocompleteLimit,onAutocomplete:function(a){d.addChip({tag:a},b),h.val(""),h.focus()}})},this.renderChip=function(a){if(a.tag){var b='<div class="chip">'+a.tag;return a.image&&(b+=' <img src="'+a.image+'"> '),b+='<i class="material-icons close">close</i>',b+="</div>"}},this.setPlaceholder=function(a){a.data("chips").length&&e.placeholder?a.find("input").prop("placeholder",e.placeholder):!a.data("chips").length&&e.secondaryPlaceholder&&a.find("input").prop("placeholder",e.secondaryPlaceholder)},this.isValid=function(a,b){for(var c=a.data("chips"),d=!1,e=0;e<c.length;e++)if(c[e].tag===b.tag)return void(d=!0);return""!==b.tag&&!d},this.addChip=function(b,c){if(d.isValid(c,b)){for(var e=d.renderChip(b),f=[],g=c.data("chips"),h=0;h<g.length;h++)f.push(g[h]);f.push(b),c.data("chips",f),a(e).insertBefore(c.find("input")),c.trigger("chip.add",b),d.setPlaceholder(c)}},this.deleteChip=function(a,b){var c=b.data("chips")[a];b.find(".chip").eq(a).remove();for(var e=[],f=b.data("chips"),g=0;g<f.length;g++)g!==a&&e.push(f[g]);b.data("chips",e),b.trigger("chip.delete",c),d.setPlaceholder(b)},this.selectChip=function(a,b){var c=b.find(".chip").eq(a);c&&!1===c.hasClass("selected")&&(c.addClass("selected"),b.trigger("chip.select",b.data("chips")[a]))},this.getChipsElement=function(a,b){return b.eq(a)},this.init(),this.handleEvents()}}(jQuery),function(a){a.fn.pushpin=function(b){var c={top:0,bottom:1/0,offset:0};return"remove"===b?(this.each(function(){(id=a(this).data("pushpin-id"))&&(a(window).off("scroll."+id),a(this).removeData("pushpin-id").removeClass("pin-top pinned pin-bottom").removeAttr("style"))}),!1):(b=a.extend(c,b),$index=0,this.each(function(){function c(a){a.removeClass("pin-top"),a.removeClass("pinned"),a.removeClass("pin-bottom")}function d(d,e){d.each(function(){b.top<=e&&b.bottom>=e&&!a(this).hasClass("pinned")&&(c(a(this)),a(this).css("top",b.offset),a(this).addClass("pinned")),e<b.top&&!a(this).hasClass("pin-top")&&(c(a(this)),a(this).css("top",0),a(this).addClass("pin-top")),e>b.bottom&&!a(this).hasClass("pin-bottom")&&(c(a(this)),a(this).addClass("pin-bottom"),a(this).css("top",b.bottom-g))})}var e=Materialize.guid(),f=a(this),g=a(this).offset().top;a(this).data("pushpin-id",e),d(f,a(window).scrollTop()),a(window).on("scroll."+e,function(){var c=a(window).scrollTop()+b.offset;d(f,c)})}))}}(jQuery),function(a){a(document).ready(function(){a.fn.reverse=[].reverse,a(document).on("mouseenter.fixedActionBtn",".fixed-action-btn:not(.click-to-toggle):not(.toolbar)",function(c){var d=a(this);b(d)}),a(document).on("mouseleave.fixedActionBtn",".fixed-action-btn:not(.click-to-toggle):not(.toolbar)",function(b){var d=a(this);c(d)}),a(document).on("click.fabClickToggle",".fixed-action-btn.click-to-toggle > a",function(d){var e=a(this),f=e.parent();f.hasClass("active")?c(f):b(f)}),a(document).on("click.fabToolbar",".fixed-action-btn.toolbar > a",function(b){var c=a(this),e=c.parent();d(e)})}),a.fn.extend({openFAB:function(){b(a(this))},closeFAB:function(){c(a(this))},openToolbar:function(){d(a(this))},closeToolbar:function(){e(a(this))}});var b=function(b){var c=b;if(c.hasClass("active")===!1){var d,e,f=c.hasClass("horizontal");f===!0?e=40:d=40,c.addClass("active"),c.find("ul .btn-floating").velocity({scaleY:".4",scaleX:".4",translateY:d+"px",translateX:e+"px"},{duration:0});var g=0;c.find("ul .btn-floating").reverse().each(function(){a(this).velocity({opacity:"1",scaleX:"1",scaleY:"1",translateY:"0",translateX:"0"},{duration:80,delay:g}),g+=40})}},c=function(a){var b,c,d=a,e=d.hasClass("horizontal");e===!0?c=40:b=40,d.removeClass("active");d.find("ul .btn-floating").velocity("stop",!0),d.find("ul .btn-floating").velocity({opacity:"0",scaleX:".4",scaleY:".4",translateY:b+"px",translateX:c+"px"},{duration:80})},d=function(b){if("true"!==b.attr("data-open")){var c,d,f,g=window.innerWidth,h=window.innerHeight,i=b[0].getBoundingClientRect(),j=b.find("> a").first(),k=b.find("> ul").first(),l=a('<div class="fab-backdrop"></div>'),m=j.css("background-color");j.append(l),c=i.left-g/2+i.width/2,d=h-i.bottom,f=g/l.width(),b.attr("data-origin-bottom",i.bottom),b.attr("data-origin-left",i.left),b.attr("data-origin-width",i.width),b.addClass("active"),b.attr("data-open",!0),b.css({"text-align":"center",width:"100%",bottom:0,left:0,transform:"translateX("+c+"px)",transition:"none"}),j.css({transform:"translateY("+-d+"px)",transition:"none"}),l.css({"background-color":m}),setTimeout(function(){b.css({transform:"",transition:"transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s"}),j.css({overflow:"visible",transform:"",transition:"transform .2s"}),setTimeout(function(){b.css({overflow:"hidden","background-color":m}),l.css({transform:"scale("+f+")",transition:"transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)"}),k.find("> li > a").css({opacity:1}),a(window).on("scroll.fabToolbarClose",function(){e(b),a(window).off("scroll.fabToolbarClose"),a(document).off("click.fabToolbarClose")}),a(document).on("click.fabToolbarClose",function(c){a(c.target).closest(k).length||(e(b),a(window).off("scroll.fabToolbarClose"),a(document).off("click.fabToolbarClose"))})},100)},0)}},e=function(a){if("true"===a.attr("data-open")){var b,c,d,e=window.innerWidth,f=window.innerHeight,g=a.attr("data-origin-width"),h=a.attr("data-origin-bottom"),i=a.attr("data-origin-left"),j=a.find("> .btn-floating").first(),k=a.find("> ul").first(),l=a.find(".fab-backdrop"),m=j.css("background-color");b=i-e/2+g/2,c=f-h,d=e/l.width(),a.removeClass("active"),a.attr("data-open",!1),a.css({"background-color":"transparent",transition:"none"}),j.css({transition:"none"}),l.css({transform:"scale(0)","background-color":m}),k.find("> li > a").css({opacity:""}),setTimeout(function(){l.remove(),a.css({"text-align":"",width:"",bottom:"",left:"",overflow:"","background-color":"",transform:"translate3d("+-b+"px,0,0)"}),j.css({overflow:"",transform:"translate3d(0,"+c+"px,0)"}),setTimeout(function(){a.css({transform:"translate3d(0,0,0)",transition:"transform .2s"}),j.css({transform:"translate3d(0,0,0)",transition:"transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)"})},20)},200)}}}(jQuery),function(a){Materialize.fadeInImage=function(b){var c;if("string"==typeof b)c=a(b);else{if("object"!=typeof b)return;c=b}c.css({opacity:0}),a(c).velocity({opacity:1},{duration:650,queue:!1,easing:"easeOutSine"}),a(c).velocity({opacity:1},{duration:1300,queue:!1,easing:"swing",step:function(b,c){c.start=100;var d=b/100,e=150-(100-b)/1.75;e<100&&(e=100),b>=0&&a(this).css({"-webkit-filter":"grayscale("+d+")brightness("+e+"%)",filter:"grayscale("+d+")brightness("+e+"%)"})}})},Materialize.showStaggeredList=function(b){var c;if("string"==typeof b)c=a(b);else{if("object"!=typeof b)return;c=b}var d=0;c.find("li").velocity({translateX:"-100px"},{duration:0}),c.find("li").each(function(){a(this).velocity({opacity:"1",translateX:"0"},{duration:800,delay:d,easing:[60,10]}),d+=120})},a(document).ready(function(){var b=!1,c=!1;a(".dismissable").each(function(){a(this).hammer({prevent_default:!1}).bind("pan",function(d){if("touch"===d.gesture.pointerType){var e=a(this),f=d.gesture.direction,g=d.gesture.deltaX,h=d.gesture.velocityX;e.velocity({translateX:g},{duration:50,queue:!1,easing:"easeOutQuad"}),4===f&&(g>e.innerWidth()/2||h<-.75)&&(b=!0),2===f&&(g<-1*e.innerWidth()/2||h>.75)&&(c=!0)}}).bind("panend",function(d){if(Math.abs(d.gesture.deltaX)<a(this).innerWidth()/2&&(c=!1,b=!1),"touch"===d.gesture.pointerType){var e=a(this);if(b||c){var f;f=b?e.innerWidth():-1*e.innerWidth(),e.velocity({translateX:f},{duration:100,queue:!1,easing:"easeOutQuad",complete:function(){e.css("border","none"),e.velocity({height:0,padding:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){e.remove()}})}})}else e.velocity({translateX:0},{duration:100,queue:!1,easing:"easeOutQuad"});b=!1,c=!1}})})})}(jQuery),function(a){var b=!1;Materialize.scrollFire=function(a){var c=function(){for(var b=window.pageYOffset+window.innerHeight,c=0;c<a.length;c++){var d=a[c],e=d.selector,f=d.offset,g=d.callback,h=document.querySelector(e);if(null!==h){var i=h.getBoundingClientRect().top+window.pageYOffset;if(b>i+f&&d.done!==!0){if("function"==typeof g)g.call(this,h);else if("string"==typeof g){var j=new Function(g);j(h)}d.done=!0}}}},d=Materialize.throttle(function(){c()},a.throttle||100);b||(window.addEventListener("scroll",d),window.addEventListener("resize",d),b=!0),setTimeout(d,0)}}(jQuery),function(a){"function"==typeof define&&define.amd?define("picker",["jquery"],a):"object"==typeof exports?module.exports=a(require("jquery")):this.Picker=a(jQuery)}(function(a){function b(f,g,i,l){function m(){return b._.node("div",b._.node("div",b._.node("div",b._.node("div",y.component.nodes(t.open),v.box),v.wrap),v.frame),v.holder)}function n(){w.data(g,y).addClass(v.input).attr("tabindex",-1).val(w.data("value")?y.get("select",u.format):f.value),u.editable||w.on("focus."+t.id+" click."+t.id,function(a){a.preventDefault(),y.$root.eq(0).focus()}).on("keydown."+t.id,q),e(f,{haspopup:!0,expanded:!1,readonly:!1,owns:f.id+"_root"})}function o(){y.$root.on({keydown:q,focusin:function(a){y.$root.removeClass(v.focused),a.stopPropagation()},"mousedown click":function(b){var c=b.target;c!=y.$root.children()[0]&&(b.stopPropagation(),"mousedown"!=b.type||a(c).is("input, select, textarea, button, option")||(b.preventDefault(),y.$root.eq(0).focus()))}}).on({focus:function(){w.addClass(v.target)},blur:function(){w.removeClass(v.target)}}).on("focus.toOpen",r).on("click","[data-pick], [data-nav], [data-clear], [data-close]",function(){var b=a(this),c=b.data(),d=b.hasClass(v.navDisabled)||b.hasClass(v.disabled),e=h();e=e&&(e.type||e.href),(d||e&&!a.contains(y.$root[0],e))&&y.$root.eq(0).focus(),!d&&c.nav?y.set("highlight",y.component.item.highlight,{nav:c.nav}):!d&&"pick"in c?y.set("select",c.pick):c.clear?y.clear().close(!0):c.close&&y.close(!0)}),e(y.$root[0],"hidden",!0)}function p(){var b;u.hiddenName===!0?(b=f.name,f.name=""):(b=["string"==typeof u.hiddenPrefix?u.hiddenPrefix:"","string"==typeof u.hiddenSuffix?u.hiddenSuffix:"_submit"],b=b[0]+f.name+b[1]),y._hidden=a('<input type=hidden name="'+b+'"'+(w.data("value")||f.value?' value="'+y.get("select",u.formatSubmit)+'"':"")+">")[0],w.on("change."+t.id,function(){y._hidden.value=f.value?y.get("select",u.formatSubmit):""}),u.container?a(u.container).append(y._hidden):w.after(y._hidden)}function q(a){var b=a.keyCode,c=/^(8|46)$/.test(b);return 27==b?(y.close(),!1):void((32==b||c||!t.open&&y.component.key[b])&&(a.preventDefault(),a.stopPropagation(),c?y.clear().close():y.open()))}function r(a){a.stopPropagation(),"focus"==a.type&&y.$root.addClass(v.focused),y.open()}if(!f)return b;var s=!1,t={id:f.id||"P"+Math.abs(~~(Math.random()*new Date))},u=i?a.extend(!0,{},i.defaults,l):l||{},v=a.extend({},b.klasses(),u.klass),w=a(f),x=function(){return this.start()},y=x.prototype={constructor:x,$node:w,start:function(){return t&&t.start?y:(t.methods={},t.start=!0,t.open=!1,t.type=f.type,f.autofocus=f==h(),f.readOnly=!u.editable,f.id=f.id||t.id,"text"!=f.type&&(f.type="text"),y.component=new i(y,u),y.$root=a(b._.node("div",m(),v.picker,'id="'+f.id+'_root" tabindex="0"')),o(),u.formatSubmit&&p(),n(),u.container?a(u.container).append(y.$root):w.after(y.$root),y.on({start:y.component.onStart,render:y.component.onRender,stop:y.component.onStop,open:y.component.onOpen,close:y.component.onClose,set:y.component.onSet}).on({start:u.onStart,render:u.onRender,stop:u.onStop,open:u.onOpen,close:u.onClose,set:u.onSet}),s=c(y.$root.children()[0]),f.autofocus&&y.open(),y.trigger("start").trigger("render"))},render:function(a){return a?y.$root.html(m()):y.$root.find("."+v.box).html(y.component.nodes(t.open)),y.trigger("render")},stop:function(){return t.start?(y.close(),y._hidden&&y._hidden.parentNode.removeChild(y._hidden),y.$root.remove(),w.removeClass(v.input).removeData(g),setTimeout(function(){w.off("."+t.id)},0),f.type=t.type,f.readOnly=!1,y.trigger("stop"),t.methods={},t.start=!1,y):y},open:function(c){return t.open?y:(w.addClass(v.active),e(f,"expanded",!0),setTimeout(function(){y.$root.addClass(v.opened),e(y.$root[0],"hidden",!1)},0),c!==!1&&(t.open=!0,s&&k.css("overflow","hidden").css("padding-right","+="+d()),y.$root.eq(0).focus(),j.on("click."+t.id+" focusin."+t.id,function(a){var b=a.target;b!=f&&b!=document&&3!=a.which&&y.close(b===y.$root.children()[0])}).on("keydown."+t.id,function(c){var d=c.keyCode,e=y.component.key[d],f=c.target;27==d?y.close(!0):f!=y.$root[0]||!e&&13!=d?a.contains(y.$root[0],f)&&13==d&&(c.preventDefault(),f.click()):(c.preventDefault(),e?b._.trigger(y.component.key.go,y,[b._.trigger(e)]):y.$root.find("."+v.highlighted).hasClass(v.disabled)||y.set("select",y.component.item.highlight).close())})),y.trigger("open"))},close:function(a){return a&&(y.$root.off("focus.toOpen").eq(0).focus(),setTimeout(function(){y.$root.on("focus.toOpen",r)},0)),w.removeClass(v.active),e(f,"expanded",!1),setTimeout(function(){y.$root.removeClass(v.opened+" "+v.focused),e(y.$root[0],"hidden",!0)},0),t.open?(t.open=!1,s&&k.css("overflow","").css("padding-right","-="+d()),j.off("."+t.id),y.trigger("close")):y},clear:function(a){return y.set("clear",null,a)},set:function(b,c,d){var e,f,g=a.isPlainObject(b),h=g?b:{};if(d=g&&a.isPlainObject(c)?c:d||{},b){g||(h[b]=c);for(e in h)f=h[e],e in y.component.item&&(void 0===f&&(f=null),y.component.set(e,f,d)),"select"!=e&&"clear"!=e||w.val("clear"==e?"":y.get(e,u.format)).trigger("change");y.render()}return d.muted?y:y.trigger("set",h)},get:function(a,c){if(a=a||"value",null!=t[a])return t[a];if("valueSubmit"==a){if(y._hidden)return y._hidden.value;a="value"}if("value"==a)return f.value;if(a in y.component.item){if("string"==typeof c){var d=y.component.get(a);return d?b._.trigger(y.component.formats.toString,y.component,[c,d]):""}return y.component.get(a)}},on:function(b,c,d){var e,f,g=a.isPlainObject(b),h=g?b:{};if(b){g||(h[b]=c);for(e in h)f=h[e],d&&(e="_"+e),t.methods[e]=t.methods[e]||[],t.methods[e].push(f)}return y},off:function(){var a,b,c=arguments;for(a=0,namesCount=c.length;a<namesCount;a+=1)b=c[a],b in t.methods&&delete t.methods[b];return y},trigger:function(a,c){var d=function(a){var d=t.methods[a];d&&d.map(function(a){b._.trigger(a,y,[c])})};return d("_"+a),d(a),y}};return new x}function c(a){var b,c="position";return a.currentStyle?b=a.currentStyle[c]:window.getComputedStyle&&(b=getComputedStyle(a)[c]),"fixed"==b}function d(){if(k.height()<=i.height())return 0;var b=a('<div style="visibility:hidden;width:100px" />').appendTo("body"),c=b[0].offsetWidth;b.css("overflow","scroll");var d=a('<div style="width:100%" />').appendTo(b),e=d[0].offsetWidth;return b.remove(),c-e}function e(b,c,d){if(a.isPlainObject(c))for(var e in c)f(b,e,c[e]);else f(b,c,d)}function f(a,b,c){a.setAttribute(("role"==b?"":"aria-")+b,c)}function g(b,c){a.isPlainObject(b)||(b={attribute:c}),c="";for(var d in b){var e=("role"==d?"":"aria-")+d,f=b[d];c+=null==f?"":e+'="'+b[d]+'"'}return c}function h(){try{return document.activeElement}catch(a){}}var i=a(window),j=a(document),k=a(document.documentElement);return b.klasses=function(a){return a=a||"picker",{picker:a,opened:a+"--opened",focused:a+"--focused",input:a+"__input",active:a+"__input--active",target:a+"__input--target",holder:a+"__holder",frame:a+"__frame",wrap:a+"__wrap",box:a+"__box"}},b._={group:function(a){for(var c,d="",e=b._.trigger(a.min,a);e<=b._.trigger(a.max,a,[e]);e+=a.i)c=b._.trigger(a.item,a,[e]),d+=b._.node(a.node,c[0],c[1],c[2]);return d},node:function(b,c,d,e){return c?(c=a.isArray(c)?c.join(""):c,d=d?' class="'+d+'"':"",e=e?" "+e:"","<"+b+d+e+">"+c+"</"+b+">"):""},lead:function(a){return(a<10?"0":"")+a},trigger:function(a,b,c){return"function"==typeof a?a.apply(b,c||[]):a},digits:function(a){return/\d/.test(a[1])?2:1},isDate:function(a){return{}.toString.call(a).indexOf("Date")>-1&&this.isInteger(a.getDate())},isInteger:function(a){return{}.toString.call(a).indexOf("Number")>-1&&a%1===0},ariaAttr:g},b.extend=function(c,d){a.fn[c]=function(e,f){var g=this.data(c);return"picker"==e?g:g&&"string"==typeof e?b._.trigger(g[e],g,[f]):this.each(function(){var f=a(this);f.data(c)||new b(this,c,d,e)})},a.fn[c].defaults=d.defaults},b}),function(a){"function"==typeof define&&define.amd?define(["picker","jquery"],a):"object"==typeof exports?module.exports=a(require("./picker.js"),require("jquery")):a(Picker,jQuery)}(function(a,b){function c(a,b){var c=this,d=a.$node[0],e=d.value,f=a.$node.data("value"),g=f||e,h=f?b.formatSubmit:b.format,i=function(){return d.currentStyle?"rtl"==d.currentStyle.direction:"rtl"==getComputedStyle(a.$root[0]).direction};c.settings=b,c.$node=a.$node,c.queue={min:"measure create",max:"measure create",now:"now create",select:"parse create validate",highlight:"parse navigate create validate",view:"parse create validate viewset",disable:"deactivate",enable:"activate"},c.item={},c.item.clear=null,c.item.disable=(b.disable||[]).slice(0),c.item.enable=-function(a){return a[0]===!0?a.shift():-1}(c.item.disable),c.set("min",b.min).set("max",b.max).set("now"),g?c.set("select",g,{format:h}):c.set("select",null).set("highlight",c.item.now),c.key={40:7,38:-7,39:function(){return i()?-1:1},37:function(){return i()?1:-1},go:function(a){var b=c.item.highlight,d=new Date(b.year,b.month,b.date+a);c.set("highlight",d,{interval:a}),this.render()}},a.on("render",function(){a.$root.find("."+b.klass.selectMonth).on("change",function(){var c=this.value;c&&(a.set("highlight",[a.get("view").year,c,a.get("highlight").date]),a.$root.find("."+b.klass.selectMonth).trigger("focus"))}),a.$root.find("."+b.klass.selectYear).on("change",function(){var c=this.value;c&&(a.set("highlight",[c,a.get("view").month,a.get("highlight").date]),a.$root.find("."+b.klass.selectYear).trigger("focus"))})},1).on("open",function(){var d="";c.disabled(c.get("now"))&&(d=":not(."+b.klass.buttonToday+")"),a.$root.find("button"+d+", select").attr("disabled",!1)},1).on("close",function(){a.$root.find("button, select").attr("disabled",!0)},1)}var d=7,e=6,f=a._;c.prototype.set=function(a,b,c){var d=this,e=d.item;return null===b?("clear"==a&&(a="select"),e[a]=b,d):(e["enable"==a?"disable":"flip"==a?"enable":a]=d.queue[a].split(" ").map(function(e){return b=d[e](a,b,c)}).pop(),"select"==a?d.set("highlight",e.select,c):"highlight"==a?d.set("view",e.highlight,c):a.match(/^(flip|min|max|disable|enable)$/)&&(e.select&&d.disabled(e.select)&&d.set("select",e.select,c),e.highlight&&d.disabled(e.highlight)&&d.set("highlight",e.highlight,c)),d)},c.prototype.get=function(a){return this.item[a]},c.prototype.create=function(a,c,d){var e,g=this;return c=void 0===c?a:c,
+c==-(1/0)||c==1/0?e=c:b.isPlainObject(c)&&f.isInteger(c.pick)?c=c.obj:b.isArray(c)?(c=new Date(c[0],c[1],c[2]),c=f.isDate(c)?c:g.create().obj):c=f.isInteger(c)||f.isDate(c)?g.normalize(new Date(c),d):g.now(a,c,d),{year:e||c.getFullYear(),month:e||c.getMonth(),date:e||c.getDate(),day:e||c.getDay(),obj:e||c,pick:e||c.getTime()}},c.prototype.createRange=function(a,c){var d=this,e=function(a){return a===!0||b.isArray(a)||f.isDate(a)?d.create(a):a};return f.isInteger(a)||(a=e(a)),f.isInteger(c)||(c=e(c)),f.isInteger(a)&&b.isPlainObject(c)?a=[c.year,c.month,c.date+a]:f.isInteger(c)&&b.isPlainObject(a)&&(c=[a.year,a.month,a.date+c]),{from:e(a),to:e(c)}},c.prototype.withinRange=function(a,b){return a=this.createRange(a.from,a.to),b.pick>=a.from.pick&&b.pick<=a.to.pick},c.prototype.overlapRanges=function(a,b){var c=this;return a=c.createRange(a.from,a.to),b=c.createRange(b.from,b.to),c.withinRange(a,b.from)||c.withinRange(a,b.to)||c.withinRange(b,a.from)||c.withinRange(b,a.to)},c.prototype.now=function(a,b,c){return b=new Date,c&&c.rel&&b.setDate(b.getDate()+c.rel),this.normalize(b,c)},c.prototype.navigate=function(a,c,d){var e,f,g,h,i=b.isArray(c),j=b.isPlainObject(c),k=this.item.view;if(i||j){for(j?(f=c.year,g=c.month,h=c.date):(f=+c[0],g=+c[1],h=+c[2]),d&&d.nav&&k&&k.month!==g&&(f=k.year,g=k.month),e=new Date(f,g+(d&&d.nav?d.nav:0),1),f=e.getFullYear(),g=e.getMonth();new Date(f,g,h).getMonth()!==g;)h-=1;c=[f,g,h]}return c},c.prototype.normalize=function(a){return a.setHours(0,0,0,0),a},c.prototype.measure=function(a,b){var c=this;return b?"string"==typeof b?b=c.parse(a,b):f.isInteger(b)&&(b=c.now(a,b,{rel:b})):b="min"==a?-(1/0):1/0,b},c.prototype.viewset=function(a,b){return this.create([b.year,b.month,1])},c.prototype.validate=function(a,c,d){var e,g,h,i,j=this,k=c,l=d&&d.interval?d.interval:1,m=j.item.enable===-1,n=j.item.min,o=j.item.max,p=m&&j.item.disable.filter(function(a){if(b.isArray(a)){var d=j.create(a).pick;d<c.pick?e=!0:d>c.pick&&(g=!0)}return f.isInteger(a)}).length;if((!d||!d.nav)&&(!m&&j.disabled(c)||m&&j.disabled(c)&&(p||e||g)||!m&&(c.pick<=n.pick||c.pick>=o.pick)))for(m&&!p&&(!g&&l>0||!e&&l<0)&&(l*=-1);j.disabled(c)&&(Math.abs(l)>1&&(c.month<k.month||c.month>k.month)&&(c=k,l=l>0?1:-1),c.pick<=n.pick?(h=!0,l=1,c=j.create([n.year,n.month,n.date+(c.pick===n.pick?0:-1)])):c.pick>=o.pick&&(i=!0,l=-1,c=j.create([o.year,o.month,o.date+(c.pick===o.pick?0:1)])),!h||!i);)c=j.create([c.year,c.month,c.date+l]);return c},c.prototype.disabled=function(a){var c=this,d=c.item.disable.filter(function(d){return f.isInteger(d)?a.day===(c.settings.firstDay?d:d-1)%7:b.isArray(d)||f.isDate(d)?a.pick===c.create(d).pick:b.isPlainObject(d)?c.withinRange(d,a):void 0});return d=d.length&&!d.filter(function(a){return b.isArray(a)&&"inverted"==a[3]||b.isPlainObject(a)&&a.inverted}).length,c.item.enable===-1?!d:d||a.pick<c.item.min.pick||a.pick>c.item.max.pick},c.prototype.parse=function(a,b,c){var d=this,e={};return b&&"string"==typeof b?(c&&c.format||(c=c||{},c.format=d.settings.format),d.formats.toArray(c.format).map(function(a){var c=d.formats[a],g=c?f.trigger(c,d,[b,e]):a.replace(/^!/,"").length;c&&(e[a]=b.substr(0,g)),b=b.substr(g)}),[e.yyyy||e.yy,+(e.mm||e.m)-1,e.dd||e.d]):b},c.prototype.formats=function(){function a(a,b,c){var d=a.match(/\w+/)[0];return c.mm||c.m||(c.m=b.indexOf(d)+1),d.length}function b(a){return a.match(/\w+/)[0].length}return{d:function(a,b){return a?f.digits(a):b.date},dd:function(a,b){return a?2:f.lead(b.date)},ddd:function(a,c){return a?b(a):this.settings.weekdaysShort[c.day]},dddd:function(a,c){return a?b(a):this.settings.weekdaysFull[c.day]},m:function(a,b){return a?f.digits(a):b.month+1},mm:function(a,b){return a?2:f.lead(b.month+1)},mmm:function(b,c){var d=this.settings.monthsShort;return b?a(b,d,c):d[c.month]},mmmm:function(b,c){var d=this.settings.monthsFull;return b?a(b,d,c):d[c.month]},yy:function(a,b){return a?2:(""+b.year).slice(2)},yyyy:function(a,b){return a?4:b.year},toArray:function(a){return a.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g)},toString:function(a,b){var c=this;return c.formats.toArray(a).map(function(a){return f.trigger(c.formats[a],c,[0,b])||a.replace(/^!/,"")}).join("")}}}(),c.prototype.isDateExact=function(a,c){var d=this;return f.isInteger(a)&&f.isInteger(c)||"boolean"==typeof a&&"boolean"==typeof c?a===c:(f.isDate(a)||b.isArray(a))&&(f.isDate(c)||b.isArray(c))?d.create(a).pick===d.create(c).pick:!(!b.isPlainObject(a)||!b.isPlainObject(c))&&(d.isDateExact(a.from,c.from)&&d.isDateExact(a.to,c.to))},c.prototype.isDateOverlap=function(a,c){var d=this,e=d.settings.firstDay?1:0;return f.isInteger(a)&&(f.isDate(c)||b.isArray(c))?(a=a%7+e,a===d.create(c).day+1):f.isInteger(c)&&(f.isDate(a)||b.isArray(a))?(c=c%7+e,c===d.create(a).day+1):!(!b.isPlainObject(a)||!b.isPlainObject(c))&&d.overlapRanges(a,c)},c.prototype.flipEnable=function(a){var b=this.item;b.enable=a||(b.enable==-1?1:-1)},c.prototype.deactivate=function(a,c){var d=this,e=d.item.disable.slice(0);return"flip"==c?d.flipEnable():c===!1?(d.flipEnable(1),e=[]):c===!0?(d.flipEnable(-1),e=[]):c.map(function(a){for(var c,g=0;g<e.length;g+=1)if(d.isDateExact(a,e[g])){c=!0;break}c||(f.isInteger(a)||f.isDate(a)||b.isArray(a)||b.isPlainObject(a)&&a.from&&a.to)&&e.push(a)}),e},c.prototype.activate=function(a,c){var d=this,e=d.item.disable,g=e.length;return"flip"==c?d.flipEnable():c===!0?(d.flipEnable(1),e=[]):c===!1?(d.flipEnable(-1),e=[]):c.map(function(a){var c,h,i,j;for(i=0;i<g;i+=1){if(h=e[i],d.isDateExact(h,a)){c=e[i]=null,j=!0;break}if(d.isDateOverlap(h,a)){b.isPlainObject(a)?(a.inverted=!0,c=a):b.isArray(a)?(c=a,c[3]||c.push("inverted")):f.isDate(a)&&(c=[a.getFullYear(),a.getMonth(),a.getDate(),"inverted"]);break}}if(c)for(i=0;i<g;i+=1)if(d.isDateExact(e[i],a)){e[i]=null;break}if(j)for(i=0;i<g;i+=1)if(d.isDateOverlap(e[i],a)){e[i]=null;break}c&&e.push(c)}),e.filter(function(a){return null!=a})},c.prototype.nodes=function(a){var b=this,c=b.settings,g=b.item,h=g.now,i=g.select,j=g.highlight,k=g.view,l=g.disable,m=g.min,n=g.max,o=function(a,b){return c.firstDay&&(a.push(a.shift()),b.push(b.shift())),f.node("thead",f.node("tr",f.group({min:0,max:d-1,i:1,node:"th",item:function(d){return[a[d],c.klass.weekdays,'scope=col title="'+b[d]+'"']}})))}((c.showWeekdaysFull?c.weekdaysFull:c.weekdaysLetter).slice(0),c.weekdaysFull.slice(0)),p=function(a){return f.node("div"," ",c.klass["nav"+(a?"Next":"Prev")]+(a&&k.year>=n.year&&k.month>=n.month||!a&&k.year<=m.year&&k.month<=m.month?" "+c.klass.navDisabled:""),"data-nav="+(a||-1)+" "+f.ariaAttr({role:"button",controls:b.$node[0].id+"_table"})+' title="'+(a?c.labelMonthNext:c.labelMonthPrev)+'"')},q=function(d){var e=c.showMonthsShort?c.monthsShort:c.monthsFull;return"short_months"==d&&(e=c.monthsShort),c.selectMonths&&void 0==d?f.node("select",f.group({min:0,max:11,i:1,node:"option",item:function(a){return[e[a],0,"value="+a+(k.month==a?" selected":"")+(k.year==m.year&&a<m.month||k.year==n.year&&a>n.month?" disabled":"")]}}),c.klass.selectMonth+" browser-default",(a?"":"disabled")+" "+f.ariaAttr({controls:b.$node[0].id+"_table"})+' title="'+c.labelMonthSelect+'"'):"short_months"==d?null!=i?f.node("div",e[i.month]):f.node("div",e[k.month]):f.node("div",e[k.month],c.klass.month)},r=function(d){var e=k.year,g=c.selectYears===!0?5:~~(c.selectYears/2);if(g){var h=m.year,i=n.year,j=e-g,l=e+g;if(h>j&&(l+=h-j,j=h),i<l){var o=j-h,p=l-i;j-=o>p?p:o,l=i}if(c.selectYears&&void 0==d)return f.node("select",f.group({min:j,max:l,i:1,node:"option",item:function(a){return[a,0,"value="+a+(e==a?" selected":"")]}}),c.klass.selectYear+" browser-default",(a?"":"disabled")+" "+f.ariaAttr({controls:b.$node[0].id+"_table"})+' title="'+c.labelYearSelect+'"')}return"raw"==d?f.node("div",e):f.node("div",e,c.klass.year)};return createDayLabel=function(){return null!=i?f.node("div",i.date):f.node("div",h.date)},createWeekdayLabel=function(){var a;a=null!=i?i.day:h.day;var b=c.weekdaysFull[a];return b},f.node("div",f.node("div",createWeekdayLabel(),"picker__weekday-display")+f.node("div",q("short_months"),c.klass.month_display)+f.node("div",createDayLabel(),c.klass.day_display)+f.node("div",r("raw"),c.klass.year_display),c.klass.date_display)+f.node("div",f.node("div",(c.selectYears?q()+r():q()+r())+p()+p(1),c.klass.header)+f.node("table",o+f.node("tbody",f.group({min:0,max:e-1,i:1,node:"tr",item:function(a){var e=c.firstDay&&0===b.create([k.year,k.month,1]).day?-7:0;return[f.group({min:d*a-k.day+e+1,max:function(){return this.min+d-1},i:1,node:"td",item:function(a){a=b.create([k.year,k.month,a+(c.firstDay?1:0)]);var d=i&&i.pick==a.pick,e=j&&j.pick==a.pick,g=l&&b.disabled(a)||a.pick<m.pick||a.pick>n.pick,o=f.trigger(b.formats.toString,b,[c.format,a]);return[f.node("div",a.date,function(b){return b.push(k.month==a.month?c.klass.infocus:c.klass.outfocus),h.pick==a.pick&&b.push(c.klass.now),d&&b.push(c.klass.selected),e&&b.push(c.klass.highlighted),g&&b.push(c.klass.disabled),b.join(" ")}([c.klass.day]),"data-pick="+a.pick+" "+f.ariaAttr({role:"gridcell",label:o,selected:!(!d||b.$node.val()!==o)||null,activedescendant:!!e||null,disabled:!!g||null})),"",f.ariaAttr({role:"presentation"})]}})]}})),c.klass.table,'id="'+b.$node[0].id+'_table" '+f.ariaAttr({role:"grid",controls:b.$node[0].id,readonly:!0})),c.klass.calendar_container)+f.node("div",f.node("button",c.today,"btn-flat picker__today","type=button data-pick="+h.pick+(a&&!b.disabled(h)?"":" disabled")+" "+f.ariaAttr({controls:b.$node[0].id}))+f.node("button",c.clear,"btn-flat picker__clear","type=button data-clear=1"+(a?"":" disabled")+" "+f.ariaAttr({controls:b.$node[0].id}))+f.node("button",c.close,"btn-flat picker__close","type=button data-close=true "+(a?"":" disabled")+" "+f.ariaAttr({controls:b.$node[0].id})),c.klass.footer)},c.defaults=function(a){return{labelMonthNext:"Next month",labelMonthPrev:"Previous month",labelMonthSelect:"Select a month",labelYearSelect:"Select a year",monthsFull:["January","February","March","April","May","June","July","August","September","October","November","December"],monthsShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],weekdaysFull:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],weekdaysShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],weekdaysLetter:["S","M","T","W","T","F","S"],today:"Today",clear:"Clear",close:"Close",format:"d mmmm, yyyy",klass:{table:a+"table",header:a+"header",date_display:a+"date-display",day_display:a+"day-display",month_display:a+"month-display",year_display:a+"year-display",calendar_container:a+"calendar-container",navPrev:a+"nav--prev",navNext:a+"nav--next",navDisabled:a+"nav--disabled",month:a+"month",year:a+"year",selectMonth:a+"select--month",selectYear:a+"select--year",weekdays:a+"weekday",day:a+"day",disabled:a+"day--disabled",selected:a+"day--selected",highlighted:a+"day--highlighted",now:a+"day--today",infocus:a+"day--infocus",outfocus:a+"day--outfocus",footer:a+"footer",buttonClear:a+"button--clear",buttonToday:a+"button--today",buttonClose:a+"button--close"}}}(a.klasses().picker+"__"),a.extend("pickadate",c)}),function(a){function b(){var b=+a(this).attr("data-length"),c=+a(this).val().length,d=c<=b;a(this).parent().find('span[class="character-counter"]').html(c+"/"+b),e(d,a(this))}function c(b){var c=b.parent().find('span[class="character-counter"]');c.length||(c=a("<span/>").addClass("character-counter").css("float","right").css("font-size","12px").css("height",1),b.parent().append(c))}function d(){a(this).parent().find('span[class="character-counter"]').html("")}function e(a,b){var c=b.hasClass("invalid");a&&c?b.removeClass("invalid"):a||c||(b.removeClass("valid"),b.addClass("invalid"))}a.fn.characterCounter=function(){return this.each(function(){var e=a(this),f=e.parent().find('span[class="character-counter"]');if(!f.length){var g=void 0!==e.attr("data-length");g&&(e.on("input",b),e.on("focus",b),e.on("blur",d),c(e))}})},a(document).ready(function(){a("input, textarea").characterCounter()})}(jQuery),function(a){var b={init:function(b){var c={duration:200,dist:-100,shift:0,padding:0,fullWidth:!1,indicators:!1,noWrap:!1,onCycleTo:null};return b=a.extend(c,b),this.each(function(){function c(){"undefined"!=typeof window.ontouchstart&&(J[0].addEventListener("touchstart",l),J[0].addEventListener("touchmove",m),J[0].addEventListener("touchend",n)),J[0].addEventListener("mousedown",l),J[0].addEventListener("mousemove",m),J[0].addEventListener("mouseup",n),J[0].addEventListener("mouseleave",n),J[0].addEventListener("click",j)}function d(a){return a.targetTouches&&a.targetTouches.length>=1?a.targetTouches[0].clientX:a.clientX}function e(a){return a.targetTouches&&a.targetTouches.length>=1?a.targetTouches[0].clientY:a.clientY}function f(a){return a>=v?a%v:a<0?f(v+a%v):a}function g(c){var d,e,g,h,i,j,k,l=s;if(r="number"==typeof c?c:r,s=Math.floor((r+u/2)/u),g=r-s*u,h=g<0?1:-1,i=-h*g*2/u,e=v>>1,b.fullWidth?k="translateX(0)":(k="translateX("+(J[0].clientWidth-p)/2+"px) ",k+="translateY("+(J[0].clientHeight-q)/2+"px)"),K){var m=s%v,n=I.find(".indicator-item.active");n.index()!==m&&(n.removeClass("active"),I.find(".indicator-item").eq(m).addClass("active"))}for((!b.noWrap||s>=0&&s<v)&&(j=o[f(s)],a(j).hasClass("active")||(J.find(".carousel-item").removeClass("active"),a(j).addClass("active")),j.style[C]=k+" translateX("+-g/2+"px) translateX("+h*b.shift*i*d+"px) translateZ("+b.dist*i+"px)",j.style.zIndex=0,b.fullWidth?tweenedOpacity=1:tweenedOpacity=1-.2*i,j.style.opacity=tweenedOpacity,j.style.display="block"),d=1;d<=e;++d)b.fullWidth?(zTranslation=b.dist,tweenedOpacity=d===e&&g<0?1-i:1):(zTranslation=b.dist*(2*d+i*h),tweenedOpacity=1-.2*(2*d+i*h)),(!b.noWrap||s+d<v)&&(j=o[f(s+d)],j.style[C]=k+" translateX("+(b.shift+(u*d-g)/2)+"px) translateZ("+zTranslation+"px)",j.style.zIndex=-d,j.style.opacity=tweenedOpacity,j.style.display="block"),b.fullWidth?(zTranslation=b.dist,tweenedOpacity=d===e&&g>0?1-i:1):(zTranslation=b.dist*(2*d-i*h),tweenedOpacity=1-.2*(2*d-i*h)),(!b.noWrap||s-d>=0)&&(j=o[f(s-d)],j.style[C]=k+" translateX("+(-b.shift+(-u*d-g)/2)+"px) translateZ("+zTranslation+"px)",j.style.zIndex=-d,j.style.opacity=tweenedOpacity,j.style.display="block");if((!b.noWrap||s>=0&&s<v)&&(j=o[f(s)],j.style[C]=k+" translateX("+-g/2+"px) translateX("+h*b.shift*i+"px) translateZ("+b.dist*i+"px)",j.style.zIndex=0,b.fullWidth?tweenedOpacity=1:tweenedOpacity=1-.2*i,j.style.opacity=tweenedOpacity,j.style.display="block"),l!==s&&"function"==typeof b.onCycleTo){var t=J.find(".carousel-item").eq(f(s));b.onCycleTo.call(this,t,G)}}function h(){var a,b,c,d;a=Date.now(),b=a-E,E=a,c=r-D,D=r,d=1e3*c/(1+b),B=.8*d+.2*B}function i(){var a,c;z&&(a=Date.now()-E,c=z*Math.exp(-a/b.duration),c>2||c<-2?(g(A-c),requestAnimationFrame(i)):g(A))}function j(c){if(G)return c.preventDefault(),c.stopPropagation(),!1;if(!b.fullWidth){var d=a(c.target).closest(".carousel-item").index(),e=s%v-d;0!==e&&(c.preventDefault(),c.stopPropagation()),k(d)}}function k(a){var c=s%v-a;b.noWrap||(c<0?Math.abs(c+v)<Math.abs(c)&&(c+=v):c>0&&Math.abs(c-v)<c&&(c-=v)),c<0?J.trigger("carouselNext",[Math.abs(c)]):c>0&&J.trigger("carouselPrev",[c])}function l(a){t=!0,G=!1,H=!1,w=d(a),x=e(a),B=z=0,D=r,E=Date.now(),clearInterval(F),F=setInterval(h,100)}function m(a){var b,c,f;if(t)if(b=d(a),y=e(a),c=w-b,f=Math.abs(x-y),f<30&&!H)(c>2||c<-2)&&(G=!0,w=b,g(r+c));else{if(G)return a.preventDefault(),a.stopPropagation(),!1;H=!0}if(G)return a.preventDefault(),a.stopPropagation(),!1}function n(a){if(t)return t=!1,clearInterval(F),A=r,(B>10||B<-10)&&(z=.9*B,A=r+z),A=Math.round(A/u)*u,b.noWrap&&(A>=u*(v-1)?A=u*(v-1):A<0&&(A=0)),z=A-r,E=Date.now(),requestAnimationFrame(i),G&&(a.preventDefault(),a.stopPropagation()),!1}var o,p,q,r,s,t,u,v,w,x,z,A,B,C,D,E,F,G,H,I=a('<ul class="indicators"></ul>'),J=a(this),K=J.attr("data-indicators")||b.indicators;if(J.hasClass("initialized"))return a(this).trigger("carouselNext",[1e-6]),!0;if(b.fullWidth){b.dist=0;var L=J.find(".carousel-item img").first();L.length?imageHeight=L.on("load",function(){J.css("height",a(this).height())}):(imageHeight=J.find(".carousel-item").first().height(),J.css("height",imageHeight)),K&&J.find(".carousel-fixed-item").addClass("with-indicators")}J.addClass("initialized"),t=!1,r=A=0,o=[],p=J.find(".carousel-item").first().innerWidth(),q=J.find(".carousel-item").first().innerHeight(),u=2*p+b.padding,J.find(".carousel-item").each(function(b){if(o.push(a(this)[0]),K){var c=a('<li class="indicator-item"></li>');0===b&&c.addClass("active"),c.click(function(b){b.stopPropagation();var c=a(this).index();k(c)}),I.append(c)}}),K&&J.append(I),v=o.length,C="transform",["webkit","Moz","O","ms"].every(function(a){var b=a+"Transform";return"undefined"==typeof document.body.style[b]||(C=b,!1)}),a(window).on("resize.carousel",function(){b.fullWidth?(p=J.find(".carousel-item").first().innerWidth(),q=J.find(".carousel-item").first().innerHeight(),u=2*p+b.padding,r=2*s*p,A=r):g()}),c(),g(r),a(this).on("carouselNext",function(a,b){void 0===b&&(b=1),A=u*Math.round(r/u)+u*b,r!==A&&(z=A-r,E=Date.now(),requestAnimationFrame(i))}),a(this).on("carouselPrev",function(a,b){void 0===b&&(b=1),A=u*Math.round(r/u)-u*b,r!==A&&(z=A-r,E=Date.now(),requestAnimationFrame(i))}),a(this).on("carouselSet",function(a,b){void 0===b&&(b=0),k(b)})})},next:function(b){a(this).trigger("carouselNext",[b])},prev:function(b){a(this).trigger("carouselPrev",[b])},set:function(b){a(this).trigger("carouselSet",[b])}};a.fn.carousel=function(c){return b[c]?b[c].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof c&&c?void a.error("Method "+c+" does not exist on jQuery.carousel"):b.init.apply(this,arguments)}}(jQuery);
\ No newline at end of file
index 73f16b6..3ae20d1 100644 (file)
@@ -8,9 +8,20 @@
  *******************************************************************************/\r
 \r
 $(document).ready( function() {\r
+    $(".button-collapse").sideNav();\r
     $('#Search').click(function() {\r
         var tags = $('#Tags').val().toLowerCase().split(/[ ,]+/);\r
         window.location.href = '/search_projects?tags=' + tags;\r
         return false;\r
     });\r
+    $('#SearchSpan').click(function(){\r
+        var tags = $('#Tags').val().toLowerCase().split(/[ ,]+/);\r
+        window.location.href = '/search_projects?tags=' + tags;\r
+        return false;\r
+    });\r
+    $('div.form-group-custom i.material-icons').click(function(e){\r
+        var tags = $('#Tags').val().toLowerCase().split(/[ ,]+/);\r
+        window.location.href = '/search_projects?tags=' + tags;\r
+        return false;\r
+    });\r
 });\r
index b9c2396..6167622 100755 (executable)
@@ -1,13 +1,3 @@
-/*!
- * Bootstrap v3.3.7 (http://getbootstrap.com)
- * Copyright 2011-2017 Twitter, Inc.
- * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
- */
-
-/*!
- * Generated using the Bootstrap Customizer (http://getbootstrap.com/customize/?id=73eb1273dd80c57866adeff88f30374f)
- * Config saved to config.json and https://gist.github.com/73eb1273dd80c57866adeff88f30374f
- */
 /*!
  * Bootstrap v3.3.7 (http://getbootstrap.com)
  * Copyright 2011-2016 Twitter, Inc.
@@ -16,8 +6,8 @@
 /*! normalize.css v3.0.3 | MIT License | github.com/necolas/normalize.css */
 html {
   font-family: sans-serif;
-  -ms-text-size-adjust: 100%;
   -webkit-text-size-adjust: 100%;
+      -ms-text-size-adjust: 100%;
 }
 body {
   margin: 0;
@@ -70,28 +60,28 @@ dfn {
   font-style: italic;
 }
 h1 {
+  margin: .67em 0;
   font-size: 2em;
-  margin: 0.67em 0;
 }
 mark {
-  background: #ff0;
   color: #000;
+  background: #ff0;
 }
 small {
   font-size: 80%;
 }
 sub,
 sup {
+  position: relative;
   font-size: 75%;
   line-height: 0;
-  position: relative;
   vertical-align: baseline;
 }
 sup {
-  top: -0.5em;
+  top: -.5em;
 }
 sub {
-  bottom: -0.25em;
+  bottom: -.25em;
 }
 img {
   border: 0;
@@ -103,10 +93,10 @@ figure {
   margin: 1em 40px;
 }
 hr {
+  height: 0;
   -webkit-box-sizing: content-box;
      -moz-box-sizing: content-box;
           box-sizing: content-box;
-  height: 0;
 }
 pre {
   overflow: auto;
@@ -123,9 +113,9 @@ input,
 optgroup,
 select,
 textarea {
-  color: inherit;
-  font: inherit;
   margin: 0;
+  font: inherit;
+  color: inherit;
 }
 button {
   overflow: visible;
@@ -147,8 +137,8 @@ html input[disabled] {
 }
 button::-moz-focus-inner,
 input::-moz-focus-inner {
-  border: 0;
   padding: 0;
+  border: 0;
 }
 input {
   line-height: normal;
@@ -165,23 +155,23 @@ input[type="number"]::-webkit-outer-spin-button {
   height: auto;
 }
 input[type="search"] {
-  -webkit-appearance: textfield;
   -webkit-box-sizing: content-box;
      -moz-box-sizing: content-box;
           box-sizing: content-box;
+  -webkit-appearance: textfield;
 }
 input[type="search"]::-webkit-search-cancel-button,
 input[type="search"]::-webkit-search-decoration {
   -webkit-appearance: none;
 }
 fieldset {
-  border: 1px solid #c0c0c0;
+  padding: .35em .625em .75em;
   margin: 0 2px;
-  padding: 0.35em 0.625em 0.75em;
+  border: 1px solid #c0c0c0;
 }
 legend {
-  border: 0;
   padding: 0;
+  border: 0;
 }
 textarea {
   overflow: auto;
@@ -190,8 +180,8 @@ optgroup {
   font-weight: bold;
 }
 table {
-  border-collapse: collapse;
   border-spacing: 0;
+  border-collapse: collapse;
 }
 td,
 th {
@@ -202,11 +192,11 @@ th {
   *,
   *:before,
   *:after {
-    background: transparent !important;
     color: #000 !important;
+    text-shadow: none !important;
+    background: transparent !important;
     -webkit-box-shadow: none !important;
             box-shadow: none !important;
-    text-shadow: none !important;
   }
   a,
   a:visited {
@@ -225,6 +215,7 @@ th {
   pre,
   blockquote {
     border: 1px solid #999;
+
     page-break-inside: avoid;
   }
   thead {
@@ -269,795 +260,6261 @@ th {
     border: 1px solid #ddd !important;
   }
 }
-* {
-  -webkit-box-sizing: border-box;
-  -moz-box-sizing: border-box;
-  box-sizing: border-box;
+@font-face {
+  font-family: 'Glyphicons Halflings';
+
+  src: url('../fonts/glyphicons-halflings-regular.eot');
+  src: url('../fonts/glyphicons-halflings-regular.eot?#iefix') format('embedded-opentype'), url('../fonts/glyphicons-halflings-regular.woff2') format('woff2'), url('../fonts/glyphicons-halflings-regular.woff') format('woff'), url('../fonts/glyphicons-halflings-regular.ttf') format('truetype'), url('../fonts/glyphicons-halflings-regular.svg#glyphicons_halflingsregular') format('svg');
 }
-*:before,
-*:after {
-  -webkit-box-sizing: border-box;
-  -moz-box-sizing: border-box;
-  box-sizing: border-box;
+.glyphicon {
+  position: relative;
+  top: 1px;
+  display: inline-block;
+  font-family: 'Glyphicons Halflings';
+  font-style: normal;
+  font-weight: normal;
+  line-height: 1;
+
+  -webkit-font-smoothing: antialiased;
+  -moz-osx-font-smoothing: grayscale;
 }
-html {
-  font-size: 10px;
-  -webkit-tap-highlight-color: rgba(0, 0, 0, 0);
+.glyphicon-asterisk:before {
+  content: "\002a";
 }
-body {
-  font-family: "Helvetica Neue", Helvetica, Arial, sans-serif;
-  font-size: 14px;
-  line-height: 1.42857143;
-  color: #333333;
-  background-color: #ffffff;
+.glyphicon-plus:before {
+  content: "\002b";
 }
-input,
-button,
-select,
-textarea {
-  font-family: inherit;
-  font-size: inherit;
-  line-height: inherit;
+.glyphicon-euro:before,
+.glyphicon-eur:before {
+  content: "\20ac";
 }
-a {
-  color: #337ab7;
-  text-decoration: none;
+.glyphicon-minus:before {
+  content: "\2212";
 }
-a:hover,
-a:focus {
-  color: #23527c;
-  text-decoration: underline;
+.glyphicon-cloud:before {
+  content: "\2601";
 }
-a:focus {
-  outline: 5px auto -webkit-focus-ring-color;
-  outline-offset: -2px;
+.glyphicon-envelope:before {
+  content: "\2709";
 }
-figure {
-  margin: 0;
+.glyphicon-pencil:before {
+  content: "\270f";
 }
-img {
-  vertical-align: middle;
+.glyphicon-glass:before {
+  content: "\e001";
 }
-.img-responsive {
-  display: block;
-  max-width: 100%;
-  height: auto;
+.glyphicon-music:before {
+  content: "\e002";
 }
-.img-rounded {
-  border-radius: 6px;
+.glyphicon-search:before {
+  content: "\e003";
 }
-.img-thumbnail {
-  padding: 4px;
-  line-height: 1.42857143;
-  background-color: #ffffff;
-  border: 1px solid #dddddd;
-  border-radius: 4px;
-  -webkit-transition: all 0.2s ease-in-out;
-  -o-transition: all 0.2s ease-in-out;
-  transition: all 0.2s ease-in-out;
-  display: inline-block;
-  max-width: 100%;
-  height: auto;
+.glyphicon-heart:before {
+  content: "\e005";
 }
-.img-circle {
-  border-radius: 50%;
+.glyphicon-star:before {
+  content: "\e006";
 }
-hr {
-  margin-top: 20px;
-  margin-bottom: 20px;
-  border: 0;
-  border-top: 1px solid #eeeeee;
+.glyphicon-star-empty:before {
+  content: "\e007";
 }
-.sr-only {
-  position: absolute;
-  width: 1px;
-  height: 1px;
-  margin: -1px;
-  padding: 0;
-  overflow: hidden;
-  clip: rect(0, 0, 0, 0);
-  border: 0;
+.glyphicon-user:before {
+  content: "\e008";
 }
-.sr-only-focusable:active,
-.sr-only-focusable:focus {
-  position: static;
-  width: auto;
-  height: auto;
-  margin: 0;
-  overflow: visible;
-  clip: auto;
+.glyphicon-film:before {
+  content: "\e009";
 }
-[role="button"] {
-  cursor: pointer;
+.glyphicon-th-large:before {
+  content: "\e010";
 }
-.container {
-  margin-right: auto;
-  margin-left: auto;
-  padding-left: 15px;
-  padding-right: 15px;
+.glyphicon-th:before {
+  content: "\e011";
 }
-@media (min-width: 768px) {
-  .container {
-    width: 750px;
-  }
+.glyphicon-th-list:before {
+  content: "\e012";
 }
-@media (min-width: 992px) {
-  .container {
-    width: 970px;
-  }
+.glyphicon-ok:before {
+  content: "\e013";
 }
-@media (min-width: 1200px) {
-  .container {
-    width: 1170px;
-  }
+.glyphicon-remove:before {
+  content: "\e014";
 }
-.container-fluid {
-  margin-right: auto;
-  margin-left: auto;
-  padding-left: 15px;
-  padding-right: 15px;
+.glyphicon-zoom-in:before {
+  content: "\e015";
 }
-.row {
-  margin-left: -15px;
-  margin-right: -15px;
+.glyphicon-zoom-out:before {
+  content: "\e016";
 }
-.col-xs-1, .col-sm-1, .col-md-1, .col-lg-1, .col-xs-2, .col-sm-2, .col-md-2, .col-lg-2, .col-xs-3, .col-sm-3, .col-md-3, .col-lg-3, .col-xs-4, .col-sm-4, .col-md-4, .col-lg-4, .col-xs-5, .col-sm-5, .col-md-5, .col-lg-5, .col-xs-6, .col-sm-6, .col-md-6, .col-lg-6, .col-xs-7, .col-sm-7, .col-md-7, .col-lg-7, .col-xs-8, .col-sm-8, .col-md-8, .col-lg-8, .col-xs-9, .col-sm-9, .col-md-9, .col-lg-9, .col-xs-10, .col-sm-10, .col-md-10, .col-lg-10, .col-xs-11, .col-sm-11, .col-md-11, .col-lg-11, .col-xs-12, .col-sm-12, .col-md-12, .col-lg-12 {
-  position: relative;
-  min-height: 1px;
-  padding-left: 15px;
-  padding-right: 15px;
+.glyphicon-off:before {
+  content: "\e017";
 }
-.col-xs-1, .col-xs-2, .col-xs-3, .col-xs-4, .col-xs-5, .col-xs-6, .col-xs-7, .col-xs-8, .col-xs-9, .col-xs-10, .col-xs-11, .col-xs-12 {
-  float: left;
+.glyphicon-signal:before {
+  content: "\e018";
 }
-.col-xs-12 {
-  width: 100%;
+.glyphicon-cog:before {
+  content: "\e019";
 }
-.col-xs-11 {
-  width: 91.66666667%;
+.glyphicon-trash:before {
+  content: "\e020";
 }
-.col-xs-10 {
-  width: 83.33333333%;
+.glyphicon-home:before {
+  content: "\e021";
 }
-.col-xs-9 {
-  width: 75%;
+.glyphicon-file:before {
+  content: "\e022";
 }
-.col-xs-8 {
-  width: 66.66666667%;
+.glyphicon-time:before {
+  content: "\e023";
 }
-.col-xs-7 {
-  width: 58.33333333%;
+.glyphicon-road:before {
+  content: "\e024";
 }
-.col-xs-6 {
-  width: 50%;
+.glyphicon-download-alt:before {
+  content: "\e025";
 }
-.col-xs-5 {
-  width: 41.66666667%;
+.glyphicon-download:before {
+  content: "\e026";
 }
-.col-xs-4 {
-  width: 33.33333333%;
+.glyphicon-upload:before {
+  content: "\e027";
 }
-.col-xs-3 {
-  width: 25%;
+.glyphicon-inbox:before {
+  content: "\e028";
 }
-.col-xs-2 {
-  width: 16.66666667%;
+.glyphicon-play-circle:before {
+  content: "\e029";
 }
-.col-xs-1 {
-  width: 8.33333333%;
+.glyphicon-repeat:before {
+  content: "\e030";
 }
-.col-xs-pull-12 {
-  right: 100%;
+.glyphicon-refresh:before {
+  content: "\e031";
 }
-.col-xs-pull-11 {
-  right: 91.66666667%;
+.glyphicon-list-alt:before {
+  content: "\e032";
 }
-.col-xs-pull-10 {
-  right: 83.33333333%;
+.glyphicon-lock:before {
+  content: "\e033";
 }
-.col-xs-pull-9 {
-  right: 75%;
+.glyphicon-flag:before {
+  content: "\e034";
 }
-.col-xs-pull-8 {
-  right: 66.66666667%;
+.glyphicon-headphones:before {
+  content: "\e035";
 }
-.col-xs-pull-7 {
-  right: 58.33333333%;
+.glyphicon-volume-off:before {
+  content: "\e036";
 }
-.col-xs-pull-6 {
-  right: 50%;
+.glyphicon-volume-down:before {
+  content: "\e037";
 }
-.col-xs-pull-5 {
-  right: 41.66666667%;
+.glyphicon-volume-up:before {
+  content: "\e038";
 }
-.col-xs-pull-4 {
-  right: 33.33333333%;
+.glyphicon-qrcode:before {
+  content: "\e039";
 }
-.col-xs-pull-3 {
-  right: 25%;
+.glyphicon-barcode:before {
+  content: "\e040";
 }
-.col-xs-pull-2 {
-  right: 16.66666667%;
+.glyphicon-tag:before {
+  content: "\e041";
 }
-.col-xs-pull-1 {
-  right: 8.33333333%;
+.glyphicon-tags:before {
+  content: "\e042";
 }
-.col-xs-pull-0 {
-  right: auto;
+.glyphicon-book:before {
+  content: "\e043";
 }
-.col-xs-push-12 {
-  left: 100%;
+.glyphicon-bookmark:before {
+  content: "\e044";
 }
-.col-xs-push-11 {
-  left: 91.66666667%;
+.glyphicon-print:before {
+  content: "\e045";
 }
-.col-xs-push-10 {
-  left: 83.33333333%;
+.glyphicon-camera:before {
+  content: "\e046";
 }
-.col-xs-push-9 {
-  left: 75%;
+.glyphicon-font:before {
+  content: "\e047";
 }
-.col-xs-push-8 {
-  left: 66.66666667%;
+.glyphicon-bold:before {
+  content: "\e048";
 }
-.col-xs-push-7 {
-  left: 58.33333333%;
+.glyphicon-italic:before {
+  content: "\e049";
 }
-.col-xs-push-6 {
-  left: 50%;
+.glyphicon-text-height:before {
+  content: "\e050";
 }
-.col-xs-push-5 {
-  left: 41.66666667%;
+.glyphicon-text-width:before {
+  content: "\e051";
 }
-.col-xs-push-4 {
-  left: 33.33333333%;
+.glyphicon-align-left:before {
+  content: "\e052";
 }
-.col-xs-push-3 {
-  left: 25%;
+.glyphicon-align-center:before {
+  content: "\e053";
 }
-.col-xs-push-2 {
-  left: 16.66666667%;
+.glyphicon-align-right:before {
+  content: "\e054";
 }
-.col-xs-push-1 {
-  left: 8.33333333%;
+.glyphicon-align-justify:before {
+  content: "\e055";
 }
-.col-xs-push-0 {
-  left: auto;
+.glyphicon-list:before {
+  content: "\e056";
 }
-.col-xs-offset-12 {
-  margin-left: 100%;
+.glyphicon-indent-left:before {
+  content: "\e057";
 }
-.col-xs-offset-11 {
-  margin-left: 91.66666667%;
+.glyphicon-indent-right:before {
+  content: "\e058";
 }
-.col-xs-offset-10 {
-  margin-left: 83.33333333%;
+.glyphicon-facetime-video:before {
+  content: "\e059";
 }
-.col-xs-offset-9 {
-  margin-left: 75%;
+.glyphicon-picture:before {
+  content: "\e060";
 }
-.col-xs-offset-8 {
-  margin-left: 66.66666667%;
+.glyphicon-map-marker:before {
+  content: "\e062";
 }
-.col-xs-offset-7 {
-  margin-left: 58.33333333%;
+.glyphicon-adjust:before {
+  content: "\e063";
 }
-.col-xs-offset-6 {
-  margin-left: 50%;
+.glyphicon-tint:before {
+  content: "\e064";
 }
-.col-xs-offset-5 {
-  margin-left: 41.66666667%;
+.glyphicon-edit:before {
+  content: "\e065";
 }
-.col-xs-offset-4 {
-  margin-left: 33.33333333%;
+.glyphicon-share:before {
+  content: "\e066";
 }
-.col-xs-offset-3 {
-  margin-left: 25%;
+.glyphicon-check:before {
+  content: "\e067";
 }
-.col-xs-offset-2 {
-  margin-left: 16.66666667%;
+.glyphicon-move:before {
+  content: "\e068";
 }
-.col-xs-offset-1 {
-  margin-left: 8.33333333%;
+.glyphicon-step-backward:before {
+  content: "\e069";
 }
-.col-xs-offset-0 {
-  margin-left: 0%;
+.glyphicon-fast-backward:before {
+  content: "\e070";
 }
-@media (min-width: 768px) {
-  .col-sm-1, .col-sm-2, .col-sm-3, .col-sm-4, .col-sm-5, .col-sm-6, .col-sm-7, .col-sm-8, .col-sm-9, .col-sm-10, .col-sm-11, .col-sm-12 {
-    float: left;
-  }
-  .col-sm-12 {
-    width: 100%;
-  }
-  .col-sm-11 {
-    width: 91.66666667%;
-  }
-  .col-sm-10 {
-    width: 83.33333333%;
-  }
-  .col-sm-9 {
-    width: 75%;
-  }
-  .col-sm-8 {
+.glyphicon-backward:before {
+  content: "\e071";
+}
+.glyphicon-play:before {
+  content: "\e072";
+}
+.glyphicon-pause:before {
+  content: "\e073";
+}
+.glyphicon-stop:before {
+  content: "\e074";
+}
+.glyphicon-forward:before {
+  content: "\e075";
+}
+.glyphicon-fast-forward:before {
+  content: "\e076";
+}
+.glyphicon-step-forward:before {
+  content: "\e077";
+}
+.glyphicon-eject:before {
+  content: "\e078";
+}
+.glyphicon-chevron-left:before {
+  content: "\e079";
+}
+.glyphicon-chevron-right:before {
+  content: "\e080";
+}
+.glyphicon-plus-sign:before {
+  content: "\e081";
+}
+.glyphicon-minus-sign:before {
+  content: "\e082";
+}
+.glyphicon-remove-sign:before {
+  content: "\e083";
+}
+.glyphicon-ok-sign:before {
+  content: "\e084";
+}
+.glyphicon-question-sign:before {
+  content: "\e085";
+}
+.glyphicon-info-sign:before {
+  content: "\e086";
+}
+.glyphicon-screenshot:before {
+  content: "\e087";
+}
+.glyphicon-remove-circle:before {
+  content: "\e088";
+}
+.glyphicon-ok-circle:before {
+  content: "\e089";
+}
+.glyphicon-ban-circle:before {
+  content: "\e090";
+}
+.glyphicon-arrow-left:before {
+  content: "\e091";
+}
+.glyphicon-arrow-right:before {
+  content: "\e092";
+}
+.glyphicon-arrow-up:before {
+  content: "\e093";
+}
+.glyphicon-arrow-down:before {
+  content: "\e094";
+}
+.glyphicon-share-alt:before {
+  content: "\e095";
+}
+.glyphicon-resize-full:before {
+  content: "\e096";
+}
+.glyphicon-resize-small:before {
+  content: "\e097";
+}
+.glyphicon-exclamation-sign:before {
+  content: "\e101";
+}
+.glyphicon-gift:before {
+  content: "\e102";
+}
+.glyphicon-leaf:before {
+  content: "\e103";
+}
+.glyphicon-fire:before {
+  content: "\e104";
+}
+.glyphicon-eye-open:before {
+  content: "\e105";
+}
+.glyphicon-eye-close:before {
+  content: "\e106";
+}
+.glyphicon-warning-sign:before {
+  content: "\e107";
+}
+.glyphicon-plane:before {
+  content: "\e108";
+}
+.glyphicon-calendar:before {
+  content: "\e109";
+}
+.glyphicon-random:before {
+  content: "\e110";
+}
+.glyphicon-comment:before {
+  content: "\e111";
+}
+.glyphicon-magnet:before {
+  content: "\e112";
+}
+.glyphicon-chevron-up:before {
+  content: "\e113";
+}
+.glyphicon-chevron-down:before {
+  content: "\e114";
+}
+.glyphicon-retweet:before {
+  content: "\e115";
+}
+.glyphicon-shopping-cart:before {
+  content: "\e116";
+}
+.glyphicon-folder-close:before {
+  content: "\e117";
+}
+.glyphicon-folder-open:before {
+  content: "\e118";
+}
+.glyphicon-resize-vertical:before {
+  content: "\e119";
+}
+.glyphicon-resize-horizontal:before {
+  content: "\e120";
+}
+.glyphicon-hdd:before {
+  content: "\e121";
+}
+.glyphicon-bullhorn:before {
+  content: "\e122";
+}
+.glyphicon-bell:before {
+  content: "\e123";
+}
+.glyphicon-certificate:before {
+  content: "\e124";
+}
+.glyphicon-thumbs-up:before {
+  content: "\e125";
+}
+.glyphicon-thumbs-down:before {
+  content: "\e126";
+}
+.glyphicon-hand-right:before {
+  content: "\e127";
+}
+.glyphicon-hand-left:before {
+  content: "\e128";
+}
+.glyphicon-hand-up:before {
+  content: "\e129";
+}
+.glyphicon-hand-down:before {
+  content: "\e130";
+}
+.glyphicon-circle-arrow-right:before {
+  content: "\e131";
+}
+.glyphicon-circle-arrow-left:before {
+  content: "\e132";
+}
+.glyphicon-circle-arrow-up:before {
+  content: "\e133";
+}
+.glyphicon-circle-arrow-down:before {
+  content: "\e134";
+}
+.glyphicon-globe:before {
+  content: "\e135";
+}
+.glyphicon-wrench:before {
+  content: "\e136";
+}
+.glyphicon-tasks:before {
+  content: "\e137";
+}
+.glyphicon-filter:before {
+  content: "\e138";
+}
+.glyphicon-briefcase:before {
+  content: "\e139";
+}
+.glyphicon-fullscreen:before {
+  content: "\e140";
+}
+.glyphicon-dashboard:before {
+  content: "\e141";
+}
+.glyphicon-paperclip:before {
+  content: "\e142";
+}
+.glyphicon-heart-empty:before {
+  content: "\e143";
+}
+.glyphicon-link:before {
+  content: "\e144";
+}
+.glyphicon-phone:before {
+  content: "\e145";
+}
+.glyphicon-pushpin:before {
+  content: "\e146";
+}
+.glyphicon-usd:before {
+  content: "\e148";
+}
+.glyphicon-gbp:before {
+  content: "\e149";
+}
+.glyphicon-sort:before {
+  content: "\e150";
+}
+.glyphicon-sort-by-alphabet:before {
+  content: "\e151";
+}
+.glyphicon-sort-by-alphabet-alt:before {
+  content: "\e152";
+}
+.glyphicon-sort-by-order:before {
+  content: "\e153";
+}
+.glyphicon-sort-by-order-alt:before {
+  content: "\e154";
+}
+.glyphicon-sort-by-attributes:before {
+  content: "\e155";
+}
+.glyphicon-sort-by-attributes-alt:before {
+  content: "\e156";
+}
+.glyphicon-unchecked:before {
+  content: "\e157";
+}
+.glyphicon-expand:before {
+  content: "\e158";
+}
+.glyphicon-collapse-down:before {
+  content: "\e159";
+}
+.glyphicon-collapse-up:before {
+  content: "\e160";
+}
+.glyphicon-log-in:before {
+  content: "\e161";
+}
+.glyphicon-flash:before {
+  content: "\e162";
+}
+.glyphicon-log-out:before {
+  content: "\e163";
+}
+.glyphicon-new-window:before {
+  content: "\e164";
+}
+.glyphicon-record:before {
+  content: "\e165";
+}
+.glyphicon-save:before {
+  content: "\e166";
+}
+.glyphicon-open:before {
+  content: "\e167";
+}
+.glyphicon-saved:before {
+  content: "\e168";
+}
+.glyphicon-import:before {
+  content: "\e169";
+}
+.glyphicon-export:before {
+  content: "\e170";
+}
+.glyphicon-send:before {
+  content: "\e171";
+}
+.glyphicon-floppy-disk:before {
+  content: "\e172";
+}
+.glyphicon-floppy-saved:before {
+  content: "\e173";
+}
+.glyphicon-floppy-remove:before {
+  content: "\e174";
+}
+.glyphicon-floppy-save:before {
+  content: "\e175";
+}
+.glyphicon-floppy-open:before {
+  content: "\e176";
+}
+.glyphicon-credit-card:before {
+  content: "\e177";
+}
+.glyphicon-transfer:before {
+  content: "\e178";
+}
+.glyphicon-cutlery:before {
+  content: "\e179";
+}
+.glyphicon-header:before {
+  content: "\e180";
+}
+.glyphicon-compressed:before {
+  content: "\e181";
+}
+.glyphicon-earphone:before {
+  content: "\e182";
+}
+.glyphicon-phone-alt:before {
+  content: "\e183";
+}
+.glyphicon-tower:before {
+  content: "\e184";
+}
+.glyphicon-stats:before {
+  content: "\e185";
+}
+.glyphicon-sd-video:before {
+  content: "\e186";
+}
+.glyphicon-hd-video:before {
+  content: "\e187";
+}
+.glyphicon-subtitles:before {
+  content: "\e188";
+}
+.glyphicon-sound-stereo:before {
+  content: "\e189";
+}
+.glyphicon-sound-dolby:before {
+  content: "\e190";
+}
+.glyphicon-sound-5-1:before {
+  content: "\e191";
+}
+.glyphicon-sound-6-1:before {
+  content: "\e192";
+}
+.glyphicon-sound-7-1:before {
+  content: "\e193";
+}
+.glyphicon-copyright-mark:before {
+  content: "\e194";
+}
+.glyphicon-registration-mark:before {
+  content: "\e195";
+}
+.glyphicon-cloud-download:before {
+  content: "\e197";
+}
+.glyphicon-cloud-upload:before {
+  content: "\e198";
+}
+.glyphicon-tree-conifer:before {
+  content: "\e199";
+}
+.glyphicon-tree-deciduous:before {
+  content: "\e200";
+}
+.glyphicon-cd:before {
+  content: "\e201";
+}
+.glyphicon-save-file:before {
+  content: "\e202";
+}
+.glyphicon-open-file:before {
+  content: "\e203";
+}
+.glyphicon-level-up:before {
+  content: "\e204";
+}
+.glyphicon-copy:before {
+  content: "\e205";
+}
+.glyphicon-paste:before {
+  content: "\e206";
+}
+.glyphicon-alert:before {
+  content: "\e209";
+}
+.glyphicon-equalizer:before {
+  content: "\e210";
+}
+.glyphicon-king:before {
+  content: "\e211";
+}
+.glyphicon-queen:before {
+  content: "\e212";
+}
+.glyphicon-pawn:before {
+  content: "\e213";
+}
+.glyphicon-bishop:before {
+  content: "\e214";
+}
+.glyphicon-knight:before {
+  content: "\e215";
+}
+.glyphicon-baby-formula:before {
+  content: "\e216";
+}
+.glyphicon-tent:before {
+  content: "\26fa";
+}
+.glyphicon-blackboard:before {
+  content: "\e218";
+}
+.glyphicon-bed:before {
+  content: "\e219";
+}
+.glyphicon-apple:before {
+  content: "\f8ff";
+}
+.glyphicon-erase:before {
+  content: "\e221";
+}
+.glyphicon-hourglass:before {
+  content: "\231b";
+}
+.glyphicon-lamp:before {
+  content: "\e223";
+}
+.glyphicon-duplicate:before {
+  content: "\e224";
+}
+.glyphicon-piggy-bank:before {
+  content: "\e225";
+}
+.glyphicon-scissors:before {
+  content: "\e226";
+}
+.glyphicon-bitcoin:before {
+  content: "\e227";
+}
+.glyphicon-btc:before {
+  content: "\e227";
+}
+.glyphicon-xbt:before {
+  content: "\e227";
+}
+.glyphicon-yen:before {
+  content: "\00a5";
+}
+.glyphicon-jpy:before {
+  content: "\00a5";
+}
+.glyphicon-ruble:before {
+  content: "\20bd";
+}
+.glyphicon-rub:before {
+  content: "\20bd";
+}
+.glyphicon-scale:before {
+  content: "\e230";
+}
+.glyphicon-ice-lolly:before {
+  content: "\e231";
+}
+.glyphicon-ice-lolly-tasted:before {
+  content: "\e232";
+}
+.glyphicon-education:before {
+  content: "\e233";
+}
+.glyphicon-option-horizontal:before {
+  content: "\e234";
+}
+.glyphicon-option-vertical:before {
+  content: "\e235";
+}
+.glyphicon-menu-hamburger:before {
+  content: "\e236";
+}
+.glyphicon-modal-window:before {
+  content: "\e237";
+}
+.glyphicon-oil:before {
+  content: "\e238";
+}
+.glyphicon-grain:before {
+  content: "\e239";
+}
+.glyphicon-sunglasses:before {
+  content: "\e240";
+}
+.glyphicon-text-size:before {
+  content: "\e241";
+}
+.glyphicon-text-color:before {
+  content: "\e242";
+}
+.glyphicon-text-background:before {
+  content: "\e243";
+}
+.glyphicon-object-align-top:before {
+  content: "\e244";
+}
+.glyphicon-object-align-bottom:before {
+  content: "\e245";
+}
+.glyphicon-object-align-horizontal:before {
+  content: "\e246";
+}
+.glyphicon-object-align-left:before {
+  content: "\e247";
+}
+.glyphicon-object-align-vertical:before {
+  content: "\e248";
+}
+.glyphicon-object-align-right:before {
+  content: "\e249";
+}
+.glyphicon-triangle-right:before {
+  content: "\e250";
+}
+.glyphicon-triangle-left:before {
+  content: "\e251";
+}
+.glyphicon-triangle-bottom:before {
+  content: "\e252";
+}
+.glyphicon-triangle-top:before {
+  content: "\e253";
+}
+.glyphicon-console:before {
+  content: "\e254";
+}
+.glyphicon-superscript:before {
+  content: "\e255";
+}
+.glyphicon-subscript:before {
+  content: "\e256";
+}
+.glyphicon-menu-left:before {
+  content: "\e257";
+}
+.glyphicon-menu-right:before {
+  content: "\e258";
+}
+.glyphicon-menu-down:before {
+  content: "\e259";
+}
+.glyphicon-menu-up:before {
+  content: "\e260";
+}
+* {
+  -webkit-box-sizing: border-box;
+     -moz-box-sizing: border-box;
+          box-sizing: border-box;
+}
+*:before,
+*:after {
+  -webkit-box-sizing: border-box;
+     -moz-box-sizing: border-box;
+          box-sizing: border-box;
+}
+html {
+  font-size: 10px;
+
+  -webkit-tap-highlight-color: rgba(0, 0, 0, 0);
+}
+body {
+  font-family: "Helvetica Neue", Helvetica, Arial, sans-serif;
+  font-size: 14px;
+  line-height: 1.42857143;
+  color: #333;
+  background-color: #fff;
+}
+input,
+button,
+select,
+textarea {
+  font-family: inherit;
+  font-size: inherit;
+  line-height: inherit;
+}
+a {
+  color: #337ab7;
+  text-decoration: none;
+}
+a:hover,
+a:focus {
+  color: #23527c;
+  text-decoration: underline;
+}
+a:focus {
+  outline: 5px auto -webkit-focus-ring-color;
+  outline-offset: -2px;
+}
+figure {
+  margin: 0;
+}
+img {
+  vertical-align: middle;
+}
+.img-responsive,
+.thumbnail > img,
+.thumbnail a > img,
+.carousel-inner > .item > img,
+.carousel-inner > .item > a > img {
+  display: block;
+  max-width: 100%;
+  height: auto;
+}
+.img-rounded {
+  border-radius: 6px;
+}
+.img-thumbnail {
+  display: inline-block;
+  max-width: 100%;
+  height: auto;
+  padding: 4px;
+  line-height: 1.42857143;
+  background-color: #fff;
+  border: 1px solid #ddd;
+  border-radius: 4px;
+  -webkit-transition: all .2s ease-in-out;
+       -o-transition: all .2s ease-in-out;
+          transition: all .2s ease-in-out;
+}
+.img-circle {
+  border-radius: 50%;
+}
+hr {
+  margin-top: 20px;
+  margin-bottom: 20px;
+  border: 0;
+  border-top: 1px solid #eee;
+}
+.sr-only {
+  position: absolute;
+  width: 1px;
+  height: 1px;
+  padding: 0;
+  margin: -1px;
+  overflow: hidden;
+  clip: rect(0, 0, 0, 0);
+  border: 0;
+}
+.sr-only-focusable:active,
+.sr-only-focusable:focus {
+  position: static;
+  width: auto;
+  height: auto;
+  margin: 0;
+  overflow: visible;
+  clip: auto;
+}
+[role="button"] {
+  cursor: pointer;
+}
+h1,
+h2,
+h3,
+h4,
+h5,
+h6,
+.h1,
+.h2,
+.h3,
+.h4,
+.h5,
+.h6 {
+  font-family: inherit;
+  font-weight: 500;
+  line-height: 1.1;
+  color: inherit;
+}
+h1 small,
+h2 small,
+h3 small,
+h4 small,
+h5 small,
+h6 small,
+.h1 small,
+.h2 small,
+.h3 small,
+.h4 small,
+.h5 small,
+.h6 small,
+h1 .small,
+h2 .small,
+h3 .small,
+h4 .small,
+h5 .small,
+h6 .small,
+.h1 .small,
+.h2 .small,
+.h3 .small,
+.h4 .small,
+.h5 .small,
+.h6 .small {
+  font-weight: normal;
+  line-height: 1;
+  color: #777;
+}
+h1,
+.h1,
+h2,
+.h2,
+h3,
+.h3 {
+  margin-top: 20px;
+  margin-bottom: 10px;
+}
+h1 small,
+.h1 small,
+h2 small,
+.h2 small,
+h3 small,
+.h3 small,
+h1 .small,
+.h1 .small,
+h2 .small,
+.h2 .small,
+h3 .small,
+.h3 .small {
+  font-size: 65%;
+}
+h4,
+.h4,
+h5,
+.h5,
+h6,
+.h6 {
+  margin-top: 10px;
+  margin-bottom: 10px;
+}
+h4 small,
+.h4 small,
+h5 small,
+.h5 small,
+h6 small,
+.h6 small,
+h4 .small,
+.h4 .small,
+h5 .small,
+.h5 .small,
+h6 .small,
+.h6 .small {
+  font-size: 75%;
+}
+h1,
+.h1 {
+  font-size: 36px;
+}
+h2,
+.h2 {
+  font-size: 30px;
+}
+h3,
+.h3 {
+  font-size: 24px;
+}
+h4,
+.h4 {
+  font-size: 18px;
+}
+h5,
+.h5 {
+  font-size: 14px;
+}
+h6,
+.h6 {
+  font-size: 12px;
+}
+p {
+  margin: 0 0 10px;
+}
+.lead {
+  margin-bottom: 20px;
+  font-size: 16px;
+  font-weight: 300;
+  line-height: 1.4;
+}
+@media (min-width: 768px) {
+  .lead {
+    font-size: 21px;
+  }
+}
+small,
+.small {
+  font-size: 85%;
+}
+mark,
+.mark {
+  padding: .2em;
+  background-color: #fcf8e3;
+}
+.text-left {
+  text-align: left;
+}
+.text-right {
+  text-align: right;
+}
+.text-center {
+  text-align: center;
+}
+.text-justify {
+  text-align: justify;
+}
+.text-nowrap {
+  white-space: nowrap;
+}
+.text-lowercase {
+  text-transform: lowercase;
+}
+.text-uppercase {
+  text-transform: uppercase;
+}
+.text-capitalize {
+  text-transform: capitalize;
+}
+.text-muted {
+  color: #777;
+}
+.text-primary {
+  color: #337ab7;
+}
+a.text-primary:hover,
+a.text-primary:focus {
+  color: #286090;
+}
+.text-success {
+  color: #3c763d;
+}
+a.text-success:hover,
+a.text-success:focus {
+  color: #2b542c;
+}
+.text-info {
+  color: #31708f;
+}
+a.text-info:hover,
+a.text-info:focus {
+  color: #245269;
+}
+.text-warning {
+  color: #8a6d3b;
+}
+a.text-warning:hover,
+a.text-warning:focus {
+  color: #66512c;
+}
+.text-danger {
+  color: #a94442;
+}
+a.text-danger:hover,
+a.text-danger:focus {
+  color: #843534;
+}
+.bg-primary {
+  color: #fff;
+  background-color: #337ab7;
+}
+a.bg-primary:hover,
+a.bg-primary:focus {
+  background-color: #286090;
+}
+.bg-success {
+  background-color: #dff0d8;
+}
+a.bg-success:hover,
+a.bg-success:focus {
+  background-color: #c1e2b3;
+}
+.bg-info {
+  background-color: #d9edf7;
+}
+a.bg-info:hover,
+a.bg-info:focus {
+  background-color: #afd9ee;
+}
+.bg-warning {
+  background-color: #fcf8e3;
+}
+a.bg-warning:hover,
+a.bg-warning:focus {
+  background-color: #f7ecb5;
+}
+.bg-danger {
+  background-color: #f2dede;
+}
+a.bg-danger:hover,
+a.bg-danger:focus {
+  background-color: #e4b9b9;
+}
+.page-header {
+  padding-bottom: 9px;
+  margin: 40px 0 20px;
+  border-bottom: 1px solid #eee;
+}
+ul,
+ol {
+  margin-top: 0;
+  margin-bottom: 10px;
+}
+ul ul,
+ol ul,
+ul ol,
+ol ol {
+  margin-bottom: 0;
+}
+.list-unstyled {
+  padding-left: 0;
+  list-style: none;
+}
+.list-inline {
+  padding-left: 0;
+  margin-left: -5px;
+  list-style: none;
+}
+.list-inline > li {
+  display: inline-block;
+  padding-right: 5px;
+  padding-left: 5px;
+}
+dl {
+  margin-top: 0;
+  margin-bottom: 20px;
+}
+dt,
+dd {
+  line-height: 1.42857143;
+}
+dt {
+  font-weight: bold;
+}
+dd {
+  margin-left: 0;
+}
+@media (min-width: 768px) {
+  .dl-horizontal dt {
+    float: left;
+    width: 160px;
+    overflow: hidden;
+    clear: left;
+    text-align: right;
+    text-overflow: ellipsis;
+    white-space: nowrap;
+  }
+  .dl-horizontal dd {
+    margin-left: 180px;
+  }
+}
+abbr[title],
+abbr[data-original-title] {
+  cursor: help;
+  border-bottom: 1px dotted #777;
+}
+.initialism {
+  font-size: 90%;
+  text-transform: uppercase;
+}
+blockquote {
+  padding: 10px 20px;
+  margin: 0 0 20px;
+  font-size: 17.5px;
+  border-left: 5px solid #eee;
+}
+blockquote p:last-child,
+blockquote ul:last-child,
+blockquote ol:last-child {
+  margin-bottom: 0;
+}
+blockquote footer,
+blockquote small,
+blockquote .small {
+  display: block;
+  font-size: 80%;
+  line-height: 1.42857143;
+  color: #777;
+}
+blockquote footer:before,
+blockquote small:before,
+blockquote .small:before {
+  content: '\2014 \00A0';
+}
+.blockquote-reverse,
+blockquote.pull-right {
+  padding-right: 15px;
+  padding-left: 0;
+  text-align: right;
+  border-right: 5px solid #eee;
+  border-left: 0;
+}
+.blockquote-reverse footer:before,
+blockquote.pull-right footer:before,
+.blockquote-reverse small:before,
+blockquote.pull-right small:before,
+.blockquote-reverse .small:before,
+blockquote.pull-right .small:before {
+  content: '';
+}
+.blockquote-reverse footer:after,
+blockquote.pull-right footer:after,
+.blockquote-reverse small:after,
+blockquote.pull-right small:after,
+.blockquote-reverse .small:after,
+blockquote.pull-right .small:after {
+  content: '\00A0 \2014';
+}
+address {
+  margin-bottom: 20px;
+  font-style: normal;
+  line-height: 1.42857143;
+}
+code,
+kbd,
+pre,
+samp {
+  font-family: Menlo, Monaco, Consolas, "Courier New", monospace;
+}
+code {
+  padding: 2px 4px;
+  font-size: 90%;
+  color: #c7254e;
+  background-color: #f9f2f4;
+  border-radius: 4px;
+}
+kbd {
+  padding: 2px 4px;
+  font-size: 90%;
+  color: #fff;
+  background-color: #333;
+  border-radius: 3px;
+  -webkit-box-shadow: inset 0 -1px 0 rgba(0, 0, 0, .25);
+          box-shadow: inset 0 -1px 0 rgba(0, 0, 0, .25);
+}
+kbd kbd {
+  padding: 0;
+  font-size: 100%;
+  font-weight: bold;
+  -webkit-box-shadow: none;
+          box-shadow: none;
+}
+pre {
+  display: block;
+  padding: 9.5px;
+  margin: 0 0 10px;
+  font-size: 13px;
+  line-height: 1.42857143;
+  color: #333;
+  word-break: break-all;
+  word-wrap: break-word;
+  background-color: #f5f5f5;
+  border: 1px solid #ccc;
+  border-radius: 4px;
+}
+pre code {
+  padding: 0;
+  font-size: inherit;
+  color: inherit;
+  white-space: pre-wrap;
+  background-color: transparent;
+  border-radius: 0;
+}
+.pre-scrollable {
+  max-height: 340px;
+  overflow-y: scroll;
+}
+.container {
+  padding-right: 15px;
+  padding-left: 15px;
+  margin-right: auto;
+  margin-left: auto;
+}
+@media (min-width: 768px) {
+  .container {
+    width: 750px;
+  }
+}
+@media (min-width: 992px) {
+  .container {
+    width: 970px;
+  }
+}
+@media (min-width: 1200px) {
+  .container {
+    width: 1170px;
+  }
+}
+.container-fluid {
+  padding-right: 15px;
+  padding-left: 15px;
+  margin-right: auto;
+  margin-left: auto;
+}
+.row {
+  margin-right: -15px;
+  margin-left: -15px;
+}
+.col-xs-1, .col-sm-1, .col-md-1, .col-lg-1, .col-xs-2, .col-sm-2, .col-md-2, .col-lg-2, .col-xs-3, .col-sm-3, .col-md-3, .col-lg-3, .col-xs-4, .col-sm-4, .col-md-4, .col-lg-4, .col-xs-5, .col-sm-5, .col-md-5, .col-lg-5, .col-xs-6, .col-sm-6, .col-md-6, .col-lg-6, .col-xs-7, .col-sm-7, .col-md-7, .col-lg-7, .col-xs-8, .col-sm-8, .col-md-8, .col-lg-8, .col-xs-9, .col-sm-9, .col-md-9, .col-lg-9, .col-xs-10, .col-sm-10, .col-md-10, .col-lg-10, .col-xs-11, .col-sm-11, .col-md-11, .col-lg-11, .col-xs-12, .col-sm-12, .col-md-12, .col-lg-12 {
+  position: relative;
+  min-height: 1px;
+  padding-right: 15px;
+  padding-left: 15px;
+}
+.col-xs-1, .col-xs-2, .col-xs-3, .col-xs-4, .col-xs-5, .col-xs-6, .col-xs-7, .col-xs-8, .col-xs-9, .col-xs-10, .col-xs-11, .col-xs-12 {
+  float: left;
+}
+.col-xs-12 {
+  width: 100%;
+}
+.col-xs-11 {
+  width: 91.66666667%;
+}
+.col-xs-10 {
+  width: 83.33333333%;
+}
+.col-xs-9 {
+  width: 75%;
+}
+.col-xs-8 {
+  width: 66.66666667%;
+}
+.col-xs-7 {
+  width: 58.33333333%;
+}
+.col-xs-6 {
+  width: 50%;
+}
+.col-xs-5 {
+  width: 41.66666667%;
+}
+.col-xs-4 {
+  width: 33.33333333%;
+}
+.col-xs-3 {
+  width: 25%;
+}
+.col-xs-2 {
+  width: 16.66666667%;
+}
+.col-xs-1 {
+  width: 8.33333333%;
+}
+.col-xs-pull-12 {
+  right: 100%;
+}
+.col-xs-pull-11 {
+  right: 91.66666667%;
+}
+.col-xs-pull-10 {
+  right: 83.33333333%;
+}
+.col-xs-pull-9 {
+  right: 75%;
+}
+.col-xs-pull-8 {
+  right: 66.66666667%;
+}
+.col-xs-pull-7 {
+  right: 58.33333333%;
+}
+.col-xs-pull-6 {
+  right: 50%;
+}
+.col-xs-pull-5 {
+  right: 41.66666667%;
+}
+.col-xs-pull-4 {
+  right: 33.33333333%;
+}
+.col-xs-pull-3 {
+  right: 25%;
+}
+.col-xs-pull-2 {
+  right: 16.66666667%;
+}
+.col-xs-pull-1 {
+  right: 8.33333333%;
+}
+.col-xs-pull-0 {
+  right: auto;
+}
+.col-xs-push-12 {
+  left: 100%;
+}
+.col-xs-push-11 {
+  left: 91.66666667%;
+}
+.col-xs-push-10 {
+  left: 83.33333333%;
+}
+.col-xs-push-9 {
+  left: 75%;
+}
+.col-xs-push-8 {
+  left: 66.66666667%;
+}
+.col-xs-push-7 {
+  left: 58.33333333%;
+}
+.col-xs-push-6 {
+  left: 50%;
+}
+.col-xs-push-5 {
+  left: 41.66666667%;
+}
+.col-xs-push-4 {
+  left: 33.33333333%;
+}
+.col-xs-push-3 {
+  left: 25%;
+}
+.col-xs-push-2 {
+  left: 16.66666667%;
+}
+.col-xs-push-1 {
+  left: 8.33333333%;
+}
+.col-xs-push-0 {
+  left: auto;
+}
+.col-xs-offset-12 {
+  margin-left: 100%;
+}
+.col-xs-offset-11 {
+  margin-left: 91.66666667%;
+}
+.col-xs-offset-10 {
+  margin-left: 83.33333333%;
+}
+.col-xs-offset-9 {
+  margin-left: 75%;
+}
+.col-xs-offset-8 {
+  margin-left: 66.66666667%;
+}
+.col-xs-offset-7 {
+  margin-left: 58.33333333%;
+}
+.col-xs-offset-6 {
+  margin-left: 50%;
+}
+.col-xs-offset-5 {
+  margin-left: 41.66666667%;
+}
+.col-xs-offset-4 {
+  margin-left: 33.33333333%;
+}
+.col-xs-offset-3 {
+  margin-left: 25%;
+}
+.col-xs-offset-2 {
+  margin-left: 16.66666667%;
+}
+.col-xs-offset-1 {
+  margin-left: 8.33333333%;
+}
+.col-xs-offset-0 {
+  margin-left: 0;
+}
+@media (min-width: 768px) {
+  .col-sm-1, .col-sm-2, .col-sm-3, .col-sm-4, .col-sm-5, .col-sm-6, .col-sm-7, .col-sm-8, .col-sm-9, .col-sm-10, .col-sm-11, .col-sm-12 {
+    float: left;
+  }
+  .col-sm-12 {
+    width: 100%;
+  }
+  .col-sm-11 {
+    width: 91.66666667%;
+  }
+  .col-sm-10 {
+    width: 83.33333333%;
+  }
+  .col-sm-9 {
+    width: 75%;
+  }
+  .col-sm-8 {
+    width: 66.66666667%;
+  }
+  .col-sm-7 {
+    width: 58.33333333%;
+  }
+  .col-sm-6 {
+    width: 50%;
+  }
+  .col-sm-5 {
+    width: 41.66666667%;
+  }
+  .col-sm-4 {
+    width: 33.33333333%;
+  }
+  .col-sm-3 {
+    width: 25%;
+  }
+  .col-sm-2 {
+    width: 16.66666667%;
+  }
+  .col-sm-1 {
+    width: 8.33333333%;
+  }
+  .col-sm-pull-12 {
+    right: 100%;
+  }
+  .col-sm-pull-11 {
+    right: 91.66666667%;
+  }
+  .col-sm-pull-10 {
+    right: 83.33333333%;
+  }
+  .col-sm-pull-9 {
+    right: 75%;
+  }
+  .col-sm-pull-8 {
+    right: 66.66666667%;
+  }
+  .col-sm-pull-7 {
+    right: 58.33333333%;
+  }
+  .col-sm-pull-6 {
+    right: 50%;
+  }
+  .col-sm-pull-5 {
+    right: 41.66666667%;
+  }
+  .col-sm-pull-4 {
+    right: 33.33333333%;
+  }
+  .col-sm-pull-3 {
+    right: 25%;
+  }
+  .col-sm-pull-2 {
+    right: 16.66666667%;
+  }
+  .col-sm-pull-1 {
+    right: 8.33333333%;
+  }
+  .col-sm-pull-0 {
+    right: auto;
+  }
+  .col-sm-push-12 {
+    left: 100%;
+  }
+  .col-sm-push-11 {
+    left: 91.66666667%;
+  }
+  .col-sm-push-10 {
+    left: 83.33333333%;
+  }
+  .col-sm-push-9 {
+    left: 75%;
+  }
+  .col-sm-push-8 {
+    left: 66.66666667%;
+  }
+  .col-sm-push-7 {
+    left: 58.33333333%;
+  }
+  .col-sm-push-6 {
+    left: 50%;
+  }
+  .col-sm-push-5 {
+    left: 41.66666667%;
+  }
+  .col-sm-push-4 {
+    left: 33.33333333%;
+  }
+  .col-sm-push-3 {
+    left: 25%;
+  }
+  .col-sm-push-2 {
+    left: 16.66666667%;
+  }
+  .col-sm-push-1 {
+    left: 8.33333333%;
+  }
+  .col-sm-push-0 {
+    left: auto;
+  }
+  .col-sm-offset-12 {
+    margin-left: 100%;
+  }
+  .col-sm-offset-11 {
+    margin-left: 91.66666667%;
+  }
+  .col-sm-offset-10 {
+    margin-left: 83.33333333%;
+  }
+  .col-sm-offset-9 {
+    margin-left: 75%;
+  }
+  .col-sm-offset-8 {
+    margin-left: 66.66666667%;
+  }
+  .col-sm-offset-7 {
+    margin-left: 58.33333333%;
+  }
+  .col-sm-offset-6 {
+    margin-left: 50%;
+  }
+  .col-sm-offset-5 {
+    margin-left: 41.66666667%;
+  }
+  .col-sm-offset-4 {
+    margin-left: 33.33333333%;
+  }
+  .col-sm-offset-3 {
+    margin-left: 25%;
+  }
+  .col-sm-offset-2 {
+    margin-left: 16.66666667%;
+  }
+  .col-sm-offset-1 {
+    margin-left: 8.33333333%;
+  }
+  .col-sm-offset-0 {
+    margin-left: 0;
+  }
+}
+@media (min-width: 992px) {
+  .col-md-1, .col-md-2, .col-md-3, .col-md-4, .col-md-5, .col-md-6, .col-md-7, .col-md-8, .col-md-9, .col-md-10, .col-md-11, .col-md-12 {
+    float: left;
+  }
+  .col-md-12 {
+    width: 100%;
+  }
+  .col-md-11 {
+    width: 91.66666667%;
+  }
+  .col-md-10 {
+    width: 83.33333333%;
+  }
+  .col-md-9 {
+    width: 75%;
+  }
+  .col-md-8 {
+    width: 66.66666667%;
+  }
+  .col-md-7 {
+    width: 58.33333333%;
+  }
+  .col-md-6 {
+    width: 50%;
+  }
+  .col-md-5 {
+    width: 41.66666667%;
+  }
+  .col-md-4 {
+    width: 33.33333333%;
+  }
+  .col-md-3 {
+    width: 25%;
+  }
+  .col-md-2 {
+    width: 16.66666667%;
+  }
+  .col-md-1 {
+    width: 8.33333333%;
+  }
+  .col-md-pull-12 {
+    right: 100%;
+  }
+  .col-md-pull-11 {
+    right: 91.66666667%;
+  }
+  .col-md-pull-10 {
+    right: 83.33333333%;
+  }
+  .col-md-pull-9 {
+    right: 75%;
+  }
+  .col-md-pull-8 {
+    right: 66.66666667%;
+  }
+  .col-md-pull-7 {
+    right: 58.33333333%;
+  }
+  .col-md-pull-6 {
+    right: 50%;
+  }
+  .col-md-pull-5 {
+    right: 41.66666667%;
+  }
+  .col-md-pull-4 {
+    right: 33.33333333%;
+  }
+  .col-md-pull-3 {
+    right: 25%;
+  }
+  .col-md-pull-2 {
+    right: 16.66666667%;
+  }
+  .col-md-pull-1 {
+    right: 8.33333333%;
+  }
+  .col-md-pull-0 {
+    right: auto;
+  }
+  .col-md-push-12 {
+    left: 100%;
+  }
+  .col-md-push-11 {
+    left: 91.66666667%;
+  }
+  .col-md-push-10 {
+    left: 83.33333333%;
+  }
+  .col-md-push-9 {
+    left: 75%;
+  }
+  .col-md-push-8 {
+    left: 66.66666667%;
+  }
+  .col-md-push-7 {
+    left: 58.33333333%;
+  }
+  .col-md-push-6 {
+    left: 50%;
+  }
+  .col-md-push-5 {
+    left: 41.66666667%;
+  }
+  .col-md-push-4 {
+    left: 33.33333333%;
+  }
+  .col-md-push-3 {
+    left: 25%;
+  }
+  .col-md-push-2 {
+    left: 16.66666667%;
+  }
+  .col-md-push-1 {
+    left: 8.33333333%;
+  }
+  .col-md-push-0 {
+    left: auto;
+  }
+  .col-md-offset-12 {
+    margin-left: 100%;
+  }
+  .col-md-offset-11 {
+    margin-left: 91.66666667%;
+  }
+  .col-md-offset-10 {
+    margin-left: 83.33333333%;
+  }
+  .col-md-offset-9 {
+    margin-left: 75%;
+  }
+  .col-md-offset-8 {
+    margin-left: 66.66666667%;
+  }
+  .col-md-offset-7 {
+    margin-left: 58.33333333%;
+  }
+  .col-md-offset-6 {
+    margin-left: 50%;
+  }
+  .col-md-offset-5 {
+    margin-left: 41.66666667%;
+  }
+  .col-md-offset-4 {
+    margin-left: 33.33333333%;
+  }
+  .col-md-offset-3 {
+    margin-left: 25%;
+  }
+  .col-md-offset-2 {
+    margin-left: 16.66666667%;
+  }
+  .col-md-offset-1 {
+    margin-left: 8.33333333%;
+  }
+  .col-md-offset-0 {
+    margin-left: 0;
+  }
+}
+@media (min-width: 1200px) {
+  .col-lg-1, .col-lg-2, .col-lg-3, .col-lg-4, .col-lg-5, .col-lg-6, .col-lg-7, .col-lg-8, .col-lg-9, .col-lg-10, .col-lg-11, .col-lg-12 {
+    float: left;
+  }
+  .col-lg-12 {
+    width: 100%;
+  }
+  .col-lg-11 {
+    width: 91.66666667%;
+  }
+  .col-lg-10 {
+    width: 83.33333333%;
+  }
+  .col-lg-9 {
+    width: 75%;
+  }
+  .col-lg-8 {
     width: 66.66666667%;
   }
-  .col-sm-7 {
+  .col-lg-7 {
     width: 58.33333333%;
   }
-  .col-sm-6 {
+  .col-lg-6 {
     width: 50%;
   }
-  .col-sm-5 {
+  .col-lg-5 {
     width: 41.66666667%;
   }
-  .col-sm-4 {
+  .col-lg-4 {
     width: 33.33333333%;
   }
-  .col-sm-3 {
+  .col-lg-3 {
     width: 25%;
   }
-  .col-sm-2 {
+  .col-lg-2 {
     width: 16.66666667%;
   }
-  .col-sm-1 {
+  .col-lg-1 {
     width: 8.33333333%;
   }
-  .col-sm-pull-12 {
+  .col-lg-pull-12 {
     right: 100%;
   }
-  .col-sm-pull-11 {
+  .col-lg-pull-11 {
     right: 91.66666667%;
   }
-  .col-sm-pull-10 {
+  .col-lg-pull-10 {
     right: 83.33333333%;
   }
-  .col-sm-pull-9 {
+  .col-lg-pull-9 {
     right: 75%;
   }
-  .col-sm-pull-8 {
+  .col-lg-pull-8 {
     right: 66.66666667%;
   }
-  .col-sm-pull-7 {
+  .col-lg-pull-7 {
     right: 58.33333333%;
   }
-  .col-sm-pull-6 {
+  .col-lg-pull-6 {
     right: 50%;
   }
-  .col-sm-pull-5 {
+  .col-lg-pull-5 {
     right: 41.66666667%;
   }
-  .col-sm-pull-4 {
+  .col-lg-pull-4 {
     right: 33.33333333%;
   }
-  .col-sm-pull-3 {
+  .col-lg-pull-3 {
     right: 25%;
   }
-  .col-sm-pull-2 {
+  .col-lg-pull-2 {
     right: 16.66666667%;
   }
-  .col-sm-pull-1 {
+  .col-lg-pull-1 {
     right: 8.33333333%;
   }
-  .col-sm-pull-0 {
+  .col-lg-pull-0 {
     right: auto;
   }
-  .col-sm-push-12 {
+  .col-lg-push-12 {
     left: 100%;
   }
-  .col-sm-push-11 {
+  .col-lg-push-11 {
     left: 91.66666667%;
   }
-  .col-sm-push-10 {
+  .col-lg-push-10 {
     left: 83.33333333%;
   }
-  .col-sm-push-9 {
+  .col-lg-push-9 {
     left: 75%;
   }
-  .col-sm-push-8 {
+  .col-lg-push-8 {
     left: 66.66666667%;
   }
-  .col-sm-push-7 {
+  .col-lg-push-7 {
     left: 58.33333333%;
   }
-  .col-sm-push-6 {
+  .col-lg-push-6 {
     left: 50%;
   }
-  .col-sm-push-5 {
+  .col-lg-push-5 {
     left: 41.66666667%;
   }
-  .col-sm-push-4 {
+  .col-lg-push-4 {
     left: 33.33333333%;
   }
-  .col-sm-push-3 {
+  .col-lg-push-3 {
     left: 25%;
   }
-  .col-sm-push-2 {
+  .col-lg-push-2 {
     left: 16.66666667%;
   }
-  .col-sm-push-1 {
+  .col-lg-push-1 {
     left: 8.33333333%;
   }
-  .col-sm-push-0 {
+  .col-lg-push-0 {
     left: auto;
   }
-  .col-sm-offset-12 {
+  .col-lg-offset-12 {
     margin-left: 100%;
   }
-  .col-sm-offset-11 {
-    margin-left: 91.66666667%;
+  .col-lg-offset-11 {
+    margin-left: 91.66666667%;
+  }
+  .col-lg-offset-10 {
+    margin-left: 83.33333333%;
+  }
+  .col-lg-offset-9 {
+    margin-left: 75%;
+  }
+  .col-lg-offset-8 {
+    margin-left: 66.66666667%;
+  }
+  .col-lg-offset-7 {
+    margin-left: 58.33333333%;
+  }
+  .col-lg-offset-6 {
+    margin-left: 50%;
+  }
+  .col-lg-offset-5 {
+    margin-left: 41.66666667%;
+  }
+  .col-lg-offset-4 {
+    margin-left: 33.33333333%;
+  }
+  .col-lg-offset-3 {
+    margin-left: 25%;
+  }
+  .col-lg-offset-2 {
+    margin-left: 16.66666667%;
+  }
+  .col-lg-offset-1 {
+    margin-left: 8.33333333%;
+  }
+  .col-lg-offset-0 {
+    margin-left: 0;
+  }
+}
+table {
+  background-color: transparent;
+}
+caption {
+  padding-top: 8px;
+  padding-bottom: 8px;
+  color: #777;
+  text-align: left;
+}
+th {
+  text-align: left;
+}
+.table {
+  width: 100%;
+  max-width: 100%;
+  margin-bottom: 20px;
+}
+.table > thead > tr > th,
+.table > tbody > tr > th,
+.table > tfoot > tr > th,
+.table > thead > tr > td,
+.table > tbody > tr > td,
+.table > tfoot > tr > td {
+  padding: 8px;
+  line-height: 1.42857143;
+  vertical-align: top;
+  border-top: 1px solid #ddd;
+}
+.table > thead > tr > th {
+  vertical-align: bottom;
+  border-bottom: 2px solid #ddd;
+}
+.table > caption + thead > tr:first-child > th,
+.table > colgroup + thead > tr:first-child > th,
+.table > thead:first-child > tr:first-child > th,
+.table > caption + thead > tr:first-child > td,
+.table > colgroup + thead > tr:first-child > td,
+.table > thead:first-child > tr:first-child > td {
+  border-top: 0;
+}
+.table > tbody + tbody {
+  border-top: 2px solid #ddd;
+}
+.table .table {
+  background-color: #fff;
+}
+.table-condensed > thead > tr > th,
+.table-condensed > tbody > tr > th,
+.table-condensed > tfoot > tr > th,
+.table-condensed > thead > tr > td,
+.table-condensed > tbody > tr > td,
+.table-condensed > tfoot > tr > td {
+  padding: 5px;
+}
+.table-bordered {
+  border: 1px solid #ddd;
+}
+.table-bordered > thead > tr > th,
+.table-bordered > tbody > tr > th,
+.table-bordered > tfoot > tr > th,
+.table-bordered > thead > tr > td,
+.table-bordered > tbody > tr > td,
+.table-bordered > tfoot > tr > td {
+  border: 1px solid #ddd;
+}
+.table-bordered > thead > tr > th,
+.table-bordered > thead > tr > td {
+  border-bottom-width: 2px;
+}
+.table-striped > tbody > tr:nth-of-type(odd) {
+  background-color: #f9f9f9;
+}
+.table-hover > tbody > tr:hover {
+  background-color: #f5f5f5;
+}
+table col[class*="col-"] {
+  position: static;
+  display: table-column;
+  float: none;
+}
+table td[class*="col-"],
+table th[class*="col-"] {
+  position: static;
+  display: table-cell;
+  float: none;
+}
+.table > thead > tr > td.active,
+.table > tbody > tr > td.active,
+.table > tfoot > tr > td.active,
+.table > thead > tr > th.active,
+.table > tbody > tr > th.active,
+.table > tfoot > tr > th.active,
+.table > thead > tr.active > td,
+.table > tbody > tr.active > td,
+.table > tfoot > tr.active > td,
+.table > thead > tr.active > th,
+.table > tbody > tr.active > th,
+.table > tfoot > tr.active > th {
+  background-color: #f5f5f5;
+}
+.table-hover > tbody > tr > td.active:hover,
+.table-hover > tbody > tr > th.active:hover,
+.table-hover > tbody > tr.active:hover > td,
+.table-hover > tbody > tr:hover > .active,
+.table-hover > tbody > tr.active:hover > th {
+  background-color: #e8e8e8;
+}
+.table > thead > tr > td.success,
+.table > tbody > tr > td.success,
+.table > tfoot > tr > td.success,
+.table > thead > tr > th.success,
+.table > tbody > tr > th.success,
+.table > tfoot > tr > th.success,
+.table > thead > tr.success > td,
+.table > tbody > tr.success > td,
+.table > tfoot > tr.success > td,
+.table > thead > tr.success > th,
+.table > tbody > tr.success > th,
+.table > tfoot > tr.success > th {
+  background-color: #dff0d8;
+}
+.table-hover > tbody > tr > td.success:hover,
+.table-hover > tbody > tr > th.success:hover,
+.table-hover > tbody > tr.success:hover > td,
+.table-hover > tbody > tr:hover > .success,
+.table-hover > tbody > tr.success:hover > th {
+  background-color: #d0e9c6;
+}
+.table > thead > tr > td.info,
+.table > tbody > tr > td.info,
+.table > tfoot > tr > td.info,
+.table > thead > tr > th.info,
+.table > tbody > tr > th.info,
+.table > tfoot > tr > th.info,
+.table > thead > tr.info > td,
+.table > tbody > tr.info > td,
+.table > tfoot > tr.info > td,
+.table > thead > tr.info > th,
+.table > tbody > tr.info > th,
+.table > tfoot > tr.info > th {
+  background-color: #d9edf7;
+}
+.table-hover > tbody > tr > td.info:hover,
+.table-hover > tbody > tr > th.info:hover,
+.table-hover > tbody > tr.info:hover > td,
+.table-hover > tbody > tr:hover > .info,
+.table-hover > tbody > tr.info:hover > th {
+  background-color: #c4e3f3;
+}
+.table > thead > tr > td.warning,
+.table > tbody > tr > td.warning,
+.table > tfoot > tr > td.warning,
+.table > thead > tr > th.warning,
+.table > tbody > tr > th.warning,
+.table > tfoot > tr > th.warning,
+.table > thead > tr.warning > td,
+.table > tbody > tr.warning > td,
+.table > tfoot > tr.warning > td,
+.table > thead > tr.warning > th,
+.table > tbody > tr.warning > th,
+.table > tfoot > tr.warning > th {
+  background-color: #fcf8e3;
+}
+.table-hover > tbody > tr > td.warning:hover,
+.table-hover > tbody > tr > th.warning:hover,
+.table-hover > tbody > tr.warning:hover > td,
+.table-hover > tbody > tr:hover > .warning,
+.table-hover > tbody > tr.warning:hover > th {
+  background-color: #faf2cc;
+}
+.table > thead > tr > td.danger,
+.table > tbody > tr > td.danger,
+.table > tfoot > tr > td.danger,
+.table > thead > tr > th.danger,
+.table > tbody > tr > th.danger,
+.table > tfoot > tr > th.danger,
+.table > thead > tr.danger > td,
+.table > tbody > tr.danger > td,
+.table > tfoot > tr.danger > td,
+.table > thead > tr.danger > th,
+.table > tbody > tr.danger > th,
+.table > tfoot > tr.danger > th {
+  background-color: #f2dede;
+}
+.table-hover > tbody > tr > td.danger:hover,
+.table-hover > tbody > tr > th.danger:hover,
+.table-hover > tbody > tr.danger:hover > td,
+.table-hover > tbody > tr:hover > .danger,
+.table-hover > tbody > tr.danger:hover > th {
+  background-color: #ebcccc;
+}
+.table-responsive {
+  min-height: .01%;
+  overflow-x: auto;
+}
+@media screen and (max-width: 767px) {
+  .table-responsive {
+    width: 100%;
+    margin-bottom: 15px;
+    overflow-y: hidden;
+    -ms-overflow-style: -ms-autohiding-scrollbar;
+    border: 1px solid #ddd;
+  }
+  .table-responsive > .table {
+    margin-bottom: 0;
+  }
+  .table-responsive > .table > thead > tr > th,
+  .table-responsive > .table > tbody > tr > th,
+  .table-responsive > .table > tfoot > tr > th,
+  .table-responsive > .table > thead > tr > td,
+  .table-responsive > .table > tbody > tr > td,
+  .table-responsive > .table > tfoot > tr > td {
+    white-space: nowrap;
+  }
+  .table-responsive > .table-bordered {
+    border: 0;
+  }
+  .table-responsive > .table-bordered > thead > tr > th:first-child,
+  .table-responsive > .table-bordered > tbody > tr > th:first-child,
+  .table-responsive > .table-bordered > tfoot > tr > th:first-child,
+  .table-responsive > .table-bordered > thead > tr > td:first-child,
+  .table-responsive > .table-bordered > tbody > tr > td:first-child,
+  .table-responsive > .table-bordered > tfoot > tr > td:first-child {
+    border-left: 0;
+  }
+  .table-responsive > .table-bordered > thead > tr > th:last-child,
+  .table-responsive > .table-bordered > tbody > tr > th:last-child,
+  .table-responsive > .table-bordered > tfoot > tr > th:last-child,
+  .table-responsive > .table-bordered > thead > tr > td:last-child,
+  .table-responsive > .table-bordered > tbody > tr > td:last-child,
+  .table-responsive > .table-bordered > tfoot > tr > td:last-child {
+    border-right: 0;
+  }
+  .table-responsive > .table-bordered > tbody > tr:last-child > th,
+  .table-responsive > .table-bordered > tfoot > tr:last-child > th,
+  .table-responsive > .table-bordered > tbody > tr:last-child > td,
+  .table-responsive > .table-bordered > tfoot > tr:last-child > td {
+    border-bottom: 0;
+  }
+}
+fieldset {
+  min-width: 0;
+  padding: 0;
+  margin: 0;
+  border: 0;
+}
+legend {
+  display: block;
+  width: 100%;
+  padding: 0;
+  margin-bottom: 20px;
+  font-size: 21px;
+  line-height: inherit;
+  color: #333;
+  border: 0;
+  border-bottom: 1px solid #e5e5e5;
+}
+label {
+  display: inline-block;
+  max-width: 100%;
+  margin-bottom: 5px;
+  font-weight: bold;
+}
+input[type="search"] {
+  -webkit-box-sizing: border-box;
+     -moz-box-sizing: border-box;
+          box-sizing: border-box;
+}
+input[type="radio"],
+input[type="checkbox"] {
+  margin: 4px 0 0;
+  margin-top: 1px \9;
+  line-height: normal;
+}
+input[type="file"] {
+  display: block;
+}
+input[type="range"] {
+  display: block;
+  width: 100%;
+}
+select[multiple],
+select[size] {
+  height: auto;
+}
+input[type="file"]:focus,
+input[type="radio"]:focus,
+input[type="checkbox"]:focus {
+  outline: 5px auto -webkit-focus-ring-color;
+  outline-offset: -2px;
+}
+output {
+  display: block;
+  padding-top: 7px;
+  font-size: 14px;
+  line-height: 1.42857143;
+  color: #555;
+}
+.form-control {
+  display: block;
+  width: 100%;
+  height: 34px;
+  padding: 6px 12px;
+  font-size: 14px;
+  line-height: 1.42857143;
+  color: #555;
+  background-color: #fff;
+  background-image: none;
+  border: 1px solid #ccc;
+  border-radius: 4px;
+  -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075);
+          box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075);
+  -webkit-transition: border-color ease-in-out .15s, -webkit-box-shadow ease-in-out .15s;
+       -o-transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s;
+          transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s;
+}
+.form-control:focus {
+  border-color: #66afe9;
+  outline: 0;
+  -webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102, 175, 233, .6);
+          box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102, 175, 233, .6);
+}
+.form-control::-moz-placeholder {
+  color: #999;
+  opacity: 1;
+}
+.form-control:-ms-input-placeholder {
+  color: #999;
+}
+.form-control::-webkit-input-placeholder {
+  color: #999;
+}
+.form-control::-ms-expand {
+  background-color: transparent;
+  border: 0;
+}
+.form-control[disabled],
+.form-control[readonly],
+fieldset[disabled] .form-control {
+  background-color: #eee;
+  opacity: 1;
+}
+.form-control[disabled],
+fieldset[disabled] .form-control {
+  cursor: not-allowed;
+}
+textarea.form-control {
+  height: auto;
+}
+input[type="search"] {
+  -webkit-appearance: none;
+}
+@media screen and (-webkit-min-device-pixel-ratio: 0) {
+  input[type="date"].form-control,
+  input[type="time"].form-control,
+  input[type="datetime-local"].form-control,
+  input[type="month"].form-control {
+    line-height: 34px;
+  }
+  input[type="date"].input-sm,
+  input[type="time"].input-sm,
+  input[type="datetime-local"].input-sm,
+  input[type="month"].input-sm,
+  .input-group-sm input[type="date"],
+  .input-group-sm input[type="time"],
+  .input-group-sm input[type="datetime-local"],
+  .input-group-sm input[type="month"] {
+    line-height: 30px;
+  }
+  input[type="date"].input-lg,
+  input[type="time"].input-lg,
+  input[type="datetime-local"].input-lg,
+  input[type="month"].input-lg,
+  .input-group-lg input[type="date"],
+  .input-group-lg input[type="time"],
+  .input-group-lg input[type="datetime-local"],
+  .input-group-lg input[type="month"] {
+    line-height: 46px;
+  }
+}
+.form-group {
+  margin-bottom: 15px;
+}
+.radio,
+.checkbox {
+  position: relative;
+  display: block;
+  margin-top: 10px;
+  margin-bottom: 10px;
+}
+.radio label,
+.checkbox label {
+  min-height: 20px;
+  padding-left: 20px;
+  margin-bottom: 0;
+  font-weight: normal;
+  cursor: pointer;
+}
+.radio input[type="radio"],
+.radio-inline input[type="radio"],
+.checkbox input[type="checkbox"],
+.checkbox-inline input[type="checkbox"] {
+  position: absolute;
+  margin-top: 4px \9;
+  margin-left: -20px;
+}
+.radio + .radio,
+.checkbox + .checkbox {
+  margin-top: -5px;
+}
+.radio-inline,
+.checkbox-inline {
+  position: relative;
+  display: inline-block;
+  padding-left: 20px;
+  margin-bottom: 0;
+  font-weight: normal;
+  vertical-align: middle;
+  cursor: pointer;
+}
+.radio-inline + .radio-inline,
+.checkbox-inline + .checkbox-inline {
+  margin-top: 0;
+  margin-left: 10px;
+}
+input[type="radio"][disabled],
+input[type="checkbox"][disabled],
+input[type="radio"].disabled,
+input[type="checkbox"].disabled,
+fieldset[disabled] input[type="radio"],
+fieldset[disabled] input[type="checkbox"] {
+  cursor: not-allowed;
+}
+.radio-inline.disabled,
+.checkbox-inline.disabled,
+fieldset[disabled] .radio-inline,
+fieldset[disabled] .checkbox-inline {
+  cursor: not-allowed;
+}
+.radio.disabled label,
+.checkbox.disabled label,
+fieldset[disabled] .radio label,
+fieldset[disabled] .checkbox label {
+  cursor: not-allowed;
+}
+.form-control-static {
+  min-height: 34px;
+  padding-top: 7px;
+  padding-bottom: 7px;
+  margin-bottom: 0;
+}
+.form-control-static.input-lg,
+.form-control-static.input-sm {
+  padding-right: 0;
+  padding-left: 0;
+}
+.input-sm {
+  height: 30px;
+  padding: 5px 10px;
+  font-size: 12px;
+  line-height: 1.5;
+  border-radius: 3px;
+}
+select.input-sm {
+  height: 30px;
+  line-height: 30px;
+}
+textarea.input-sm,
+select[multiple].input-sm {
+  height: auto;
+}
+.form-group-sm .form-control {
+  height: 30px;
+  padding: 5px 10px;
+  font-size: 12px;
+  line-height: 1.5;
+  border-radius: 3px;
+}
+.form-group-sm select.form-control {
+  height: 30px;
+  line-height: 30px;
+}
+.form-group-sm textarea.form-control,
+.form-group-sm select[multiple].form-control {
+  height: auto;
+}
+.form-group-sm .form-control-static {
+  height: 30px;
+  min-height: 32px;
+  padding: 6px 10px;
+  font-size: 12px;
+  line-height: 1.5;
+}
+.input-lg {
+  height: 46px;
+  padding: 10px 16px;
+  font-size: 18px;
+  line-height: 1.3333333;
+  border-radius: 6px;
+}
+select.input-lg {
+  height: 46px;
+  line-height: 46px;
+}
+textarea.input-lg,
+select[multiple].input-lg {
+  height: auto;
+}
+.form-group-lg .form-control {
+  height: 46px;
+  padding: 10px 16px;
+  font-size: 18px;
+  line-height: 1.3333333;
+  border-radius: 6px;
+}
+.form-group-lg select.form-control {
+  height: 46px;
+  line-height: 46px;
+}
+.form-group-lg textarea.form-control,
+.form-group-lg select[multiple].form-control {
+  height: auto;
+}
+.form-group-lg .form-control-static {
+  height: 46px;
+  min-height: 38px;
+  padding: 11px 16px;
+  font-size: 18px;
+  line-height: 1.3333333;
+}
+.has-feedback {
+  position: relative;
+}
+.has-feedback .form-control {
+  padding-right: 42.5px;
+}
+.form-control-feedback {
+  position: absolute;
+  top: 0;
+  right: 0;
+  z-index: 2;
+  display: block;
+  width: 34px;
+  height: 34px;
+  line-height: 34px;
+  text-align: center;
+  pointer-events: none;
+}
+.input-lg + .form-control-feedback,
+.input-group-lg + .form-control-feedback,
+.form-group-lg .form-control + .form-control-feedback {
+  width: 46px;
+  height: 46px;
+  line-height: 46px;
+}
+.input-sm + .form-control-feedback,
+.input-group-sm + .form-control-feedback,
+.form-group-sm .form-control + .form-control-feedback {
+  width: 30px;
+  height: 30px;
+  line-height: 30px;
+}
+.has-success .help-block,
+.has-success .control-label,
+.has-success .radio,
+.has-success .checkbox,
+.has-success .radio-inline,
+.has-success .checkbox-inline,
+.has-success.radio label,
+.has-success.checkbox label,
+.has-success.radio-inline label,
+.has-success.checkbox-inline label {
+  color: #3c763d;
+}
+.has-success .form-control {
+  border-color: #3c763d;
+  -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075);
+          box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075);
+}
+.has-success .form-control:focus {
+  border-color: #2b542c;
+  -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075), 0 0 6px #67b168;
+          box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075), 0 0 6px #67b168;
+}
+.has-success .input-group-addon {
+  color: #3c763d;
+  background-color: #dff0d8;
+  border-color: #3c763d;
+}
+.has-success .form-control-feedback {
+  color: #3c763d;
+}
+.has-warning .help-block,
+.has-warning .control-label,
+.has-warning .radio,
+.has-warning .checkbox,
+.has-warning .radio-inline,
+.has-warning .checkbox-inline,
+.has-warning.radio label,
+.has-warning.checkbox label,
+.has-warning.radio-inline label,
+.has-warning.checkbox-inline label {
+  color: #8a6d3b;
+}
+.has-warning .form-control {
+  border-color: #8a6d3b;
+  -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075);
+          box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075);
+}
+.has-warning .form-control:focus {
+  border-color: #66512c;
+  -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075), 0 0 6px #c0a16b;
+          box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075), 0 0 6px #c0a16b;
+}
+.has-warning .input-group-addon {
+  color: #8a6d3b;
+  background-color: #fcf8e3;
+  border-color: #8a6d3b;
+}
+.has-warning .form-control-feedback {
+  color: #8a6d3b;
+}
+.has-error .help-block,
+.has-error .control-label,
+.has-error .radio,
+.has-error .checkbox,
+.has-error .radio-inline,
+.has-error .checkbox-inline,
+.has-error.radio label,
+.has-error.checkbox label,
+.has-error.radio-inline label,
+.has-error.checkbox-inline label {
+  color: #a94442;
+}
+.has-error .form-control {
+  border-color: #a94442;
+  -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075);
+          box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075);
+}
+.has-error .form-control:focus {
+  border-color: #843534;
+  -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075), 0 0 6px #ce8483;
+          box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075), 0 0 6px #ce8483;
+}
+.has-error .input-group-addon {
+  color: #a94442;
+  background-color: #f2dede;
+  border-color: #a94442;
+}
+.has-error .form-control-feedback {
+  color: #a94442;
+}
+.has-feedback label ~ .form-control-feedback {
+  top: 25px;
+}
+.has-feedback label.sr-only ~ .form-control-feedback {
+  top: 0;
+}
+.help-block {
+  display: block;
+  margin-top: 5px;
+  margin-bottom: 10px;
+  color: #737373;
+}
+@media (min-width: 768px) {
+  .form-inline .form-group {
+    display: inline-block;
+    margin-bottom: 0;
+    vertical-align: middle;
+  }
+  .form-inline .form-control {
+    display: inline-block;
+    width: auto;
+    vertical-align: middle;
+  }
+  .form-inline .form-control-static {
+    display: inline-block;
+  }
+  .form-inline .input-group {
+    display: inline-table;
+    vertical-align: middle;
+  }
+  .form-inline .input-group .input-group-addon,
+  .form-inline .input-group .input-group-btn,
+  .form-inline .input-group .form-control {
+    width: auto;
+  }
+  .form-inline .input-group > .form-control {
+    width: 100%;
+  }
+  .form-inline .control-label {
+    margin-bottom: 0;
+    vertical-align: middle;
+  }
+  .form-inline .radio,
+  .form-inline .checkbox {
+    display: inline-block;
+    margin-top: 0;
+    margin-bottom: 0;
+    vertical-align: middle;
+  }
+  .form-inline .radio label,
+  .form-inline .checkbox label {
+    padding-left: 0;
+  }
+  .form-inline .radio input[type="radio"],
+  .form-inline .checkbox input[type="checkbox"] {
+    position: relative;
+    margin-left: 0;
+  }
+  .form-inline .has-feedback .form-control-feedback {
+    top: 0;
+  }
+}
+.form-horizontal .radio,
+.form-horizontal .checkbox,
+.form-horizontal .radio-inline,
+.form-horizontal .checkbox-inline {
+  padding-top: 7px;
+  margin-top: 0;
+  margin-bottom: 0;
+}
+.form-horizontal .radio,
+.form-horizontal .checkbox {
+  min-height: 27px;
+}
+.form-horizontal .form-group {
+  margin-right: -15px;
+  margin-left: -15px;
+}
+@media (min-width: 768px) {
+  .form-horizontal .control-label {
+    padding-top: 7px;
+    margin-bottom: 0;
+    text-align: right;
+  }
+}
+.form-horizontal .has-feedback .form-control-feedback {
+  right: 15px;
+}
+@media (min-width: 768px) {
+  .form-horizontal .form-group-lg .control-label {
+    padding-top: 11px;
+    font-size: 18px;
   }
-  .col-sm-offset-10 {
-    margin-left: 83.33333333%;
+}
+@media (min-width: 768px) {
+  .form-horizontal .form-group-sm .control-label {
+    padding-top: 6px;
+    font-size: 12px;
   }
-  .col-sm-offset-9 {
-    margin-left: 75%;
+}
+.btn {
+  display: inline-block;
+  padding: 6px 12px;
+  margin-bottom: 0;
+  font-size: 14px;
+  font-weight: normal;
+  line-height: 1.42857143;
+  text-align: center;
+  white-space: nowrap;
+  vertical-align: middle;
+  -ms-touch-action: manipulation;
+      touch-action: manipulation;
+  cursor: pointer;
+  -webkit-user-select: none;
+     -moz-user-select: none;
+      -ms-user-select: none;
+          user-select: none;
+  background-image: none;
+  border: 1px solid transparent;
+  border-radius: 4px;
+}
+.btn:focus,
+.btn:active:focus,
+.btn.active:focus,
+.btn.focus,
+.btn:active.focus,
+.btn.active.focus {
+  outline: 5px auto -webkit-focus-ring-color;
+  outline-offset: -2px;
+}
+.btn:hover,
+.btn:focus,
+.btn.focus {
+  color: #333;
+  text-decoration: none;
+}
+.btn:active,
+.btn.active {
+  background-image: none;
+  outline: 0;
+  -webkit-box-shadow: inset 0 3px 5px rgba(0, 0, 0, .125);
+          box-shadow: inset 0 3px 5px rgba(0, 0, 0, .125);
+}
+.btn.disabled,
+.btn[disabled],
+fieldset[disabled] .btn {
+  cursor: not-allowed;
+  filter: alpha(opacity=65);
+  -webkit-box-shadow: none;
+          box-shadow: none;
+  opacity: .65;
+}
+a.btn.disabled,
+fieldset[disabled] a.btn {
+  pointer-events: none;
+}
+.btn-default {
+  color: #333;
+  background-color: #fff;
+  border-color: #ccc;
+}
+.btn-default:focus,
+.btn-default.focus {
+  color: #333;
+  background-color: #e6e6e6;
+  border-color: #8c8c8c;
+}
+.btn-default:hover {
+  color: #333;
+  background-color: #e6e6e6;
+  border-color: #adadad;
+}
+.btn-default:active,
+.btn-default.active,
+.open > .dropdown-toggle.btn-default {
+  color: #333;
+  background-color: #e6e6e6;
+  border-color: #adadad;
+}
+.btn-default:active:hover,
+.btn-default.active:hover,
+.open > .dropdown-toggle.btn-default:hover,
+.btn-default:active:focus,
+.btn-default.active:focus,
+.open > .dropdown-toggle.btn-default:focus,
+.btn-default:active.focus,
+.btn-default.active.focus,
+.open > .dropdown-toggle.btn-default.focus {
+  color: #333;
+  background-color: #d4d4d4;
+  border-color: #8c8c8c;
+}
+.btn-default:active,
+.btn-default.active,
+.open > .dropdown-toggle.btn-default {
+  background-image: none;
+}
+.btn-default.disabled:hover,
+.btn-default[disabled]:hover,
+fieldset[disabled] .btn-default:hover,
+.btn-default.disabled:focus,
+.btn-default[disabled]:focus,
+fieldset[disabled] .btn-default:focus,
+.btn-default.disabled.focus,
+.btn-default[disabled].focus,
+fieldset[disabled] .btn-default.focus {
+  background-color: #fff;
+  border-color: #ccc;
+}
+.btn-default .badge {
+  color: #fff;
+  background-color: #333;
+}
+.btn-primary {
+  color: #fff;
+  background-color: #337ab7;
+  border-color: #2e6da4;
+}
+.btn-primary:focus,
+.btn-primary.focus {
+  color: #fff;
+  background-color: #286090;
+  border-color: #122b40;
+}
+.btn-primary:hover {
+  color: #fff;
+  background-color: #286090;
+  border-color: #204d74;
+}
+.btn-primary:active,
+.btn-primary.active,
+.open > .dropdown-toggle.btn-primary {
+  color: #fff;
+  background-color: #286090;
+  border-color: #204d74;
+}
+.btn-primary:active:hover,
+.btn-primary.active:hover,
+.open > .dropdown-toggle.btn-primary:hover,
+.btn-primary:active:focus,
+.btn-primary.active:focus,
+.open > .dropdown-toggle.btn-primary:focus,
+.btn-primary:active.focus,
+.btn-primary.active.focus,
+.open > .dropdown-toggle.btn-primary.focus {
+  color: #fff;
+  background-color: #204d74;
+  border-color: #122b40;
+}
+.btn-primary:active,
+.btn-primary.active,
+.open > .dropdown-toggle.btn-primary {
+  background-image: none;
+}
+.btn-primary.disabled:hover,
+.btn-primary[disabled]:hover,
+fieldset[disabled] .btn-primary:hover,
+.btn-primary.disabled:focus,
+.btn-primary[disabled]:focus,
+fieldset[disabled] .btn-primary:focus,
+.btn-primary.disabled.focus,
+.btn-primary[disabled].focus,
+fieldset[disabled] .btn-primary.focus {
+  background-color: #337ab7;
+  border-color: #2e6da4;
+}
+.btn-primary .badge {
+  color: #337ab7;
+  background-color: #fff;
+}
+.btn-success {
+  color: #fff;
+  background-color: #5cb85c;
+  border-color: #4cae4c;
+}
+.btn-success:focus,
+.btn-success.focus {
+  color: #fff;
+  background-color: #449d44;
+  border-color: #255625;
+}
+.btn-success:hover {
+  color: #fff;
+  background-color: #449d44;
+  border-color: #398439;
+}
+.btn-success:active,
+.btn-success.active,
+.open > .dropdown-toggle.btn-success {
+  color: #fff;
+  background-color: #449d44;
+  border-color: #398439;
+}
+.btn-success:active:hover,
+.btn-success.active:hover,
+.open > .dropdown-toggle.btn-success:hover,
+.btn-success:active:focus,
+.btn-success.active:focus,
+.open > .dropdown-toggle.btn-success:focus,
+.btn-success:active.focus,
+.btn-success.active.focus,
+.open > .dropdown-toggle.btn-success.focus {
+  color: #fff;
+  background-color: #398439;
+  border-color: #255625;
+}
+.btn-success:active,
+.btn-success.active,
+.open > .dropdown-toggle.btn-success {
+  background-image: none;
+}
+.btn-success.disabled:hover,
+.btn-success[disabled]:hover,
+fieldset[disabled] .btn-success:hover,
+.btn-success.disabled:focus,
+.btn-success[disabled]:focus,
+fieldset[disabled] .btn-success:focus,
+.btn-success.disabled.focus,
+.btn-success[disabled].focus,
+fieldset[disabled] .btn-success.focus {
+  background-color: #5cb85c;
+  border-color: #4cae4c;
+}
+.btn-success .badge {
+  color: #5cb85c;
+  background-color: #fff;
+}
+.btn-info {
+  color: #fff;
+  background-color: #5bc0de;
+  border-color: #46b8da;
+}
+.btn-info:focus,
+.btn-info.focus {
+  color: #fff;
+  background-color: #31b0d5;
+  border-color: #1b6d85;
+}
+.btn-info:hover {
+  color: #fff;
+  background-color: #31b0d5;
+  border-color: #269abc;
+}
+.btn-info:active,
+.btn-info.active,
+.open > .dropdown-toggle.btn-info {
+  color: #fff;
+  background-color: #31b0d5;
+  border-color: #269abc;
+}
+.btn-info:active:hover,
+.btn-info.active:hover,
+.open > .dropdown-toggle.btn-info:hover,
+.btn-info:active:focus,
+.btn-info.active:focus,
+.open > .dropdown-toggle.btn-info:focus,
+.btn-info:active.focus,
+.btn-info.active.focus,
+.open > .dropdown-toggle.btn-info.focus {
+  color: #fff;
+  background-color: #269abc;
+  border-color: #1b6d85;
+}
+.btn-info:active,
+.btn-info.active,
+.open > .dropdown-toggle.btn-info {
+  background-image: none;
+}
+.btn-info.disabled:hover,
+.btn-info[disabled]:hover,
+fieldset[disabled] .btn-info:hover,
+.btn-info.disabled:focus,
+.btn-info[disabled]:focus,
+fieldset[disabled] .btn-info:focus,
+.btn-info.disabled.focus,
+.btn-info[disabled].focus,
+fieldset[disabled] .btn-info.focus {
+  background-color: #5bc0de;
+  border-color: #46b8da;
+}
+.btn-info .badge {
+  color: #5bc0de;
+  background-color: #fff;
+}
+.btn-warning {
+  color: #fff;
+  background-color: #f0ad4e;
+  border-color: #eea236;
+}
+.btn-warning:focus,
+.btn-warning.focus {
+  color: #fff;
+  background-color: #ec971f;
+  border-color: #985f0d;
+}
+.btn-warning:hover {
+  color: #fff;
+  background-color: #ec971f;
+  border-color: #d58512;
+}
+.btn-warning:active,
+.btn-warning.active,
+.open > .dropdown-toggle.btn-warning {
+  color: #fff;
+  background-color: #ec971f;
+  border-color: #d58512;
+}
+.btn-warning:active:hover,
+.btn-warning.active:hover,
+.open > .dropdown-toggle.btn-warning:hover,
+.btn-warning:active:focus,
+.btn-warning.active:focus,
+.open > .dropdown-toggle.btn-warning:focus,
+.btn-warning:active.focus,
+.btn-warning.active.focus,
+.open > .dropdown-toggle.btn-warning.focus {
+  color: #fff;
+  background-color: #d58512;
+  border-color: #985f0d;
+}
+.btn-warning:active,
+.btn-warning.active,
+.open > .dropdown-toggle.btn-warning {
+  background-image: none;
+}
+.btn-warning.disabled:hover,
+.btn-warning[disabled]:hover,
+fieldset[disabled] .btn-warning:hover,
+.btn-warning.disabled:focus,
+.btn-warning[disabled]:focus,
+fieldset[disabled] .btn-warning:focus,
+.btn-warning.disabled.focus,
+.btn-warning[disabled].focus,
+fieldset[disabled] .btn-warning.focus {
+  background-color: #f0ad4e;
+  border-color: #eea236;
+}
+.btn-warning .badge {
+  color: #f0ad4e;
+  background-color: #fff;
+}
+.btn-danger {
+  color: #fff;
+  background-color: #d9534f;
+  border-color: #d43f3a;
+}
+.btn-danger:focus,
+.btn-danger.focus {
+  color: #fff;
+  background-color: #c9302c;
+  border-color: #761c19;
+}
+.btn-danger:hover {
+  color: #fff;
+  background-color: #c9302c;
+  border-color: #ac2925;
+}
+.btn-danger:active,
+.btn-danger.active,
+.open > .dropdown-toggle.btn-danger {
+  color: #fff;
+  background-color: #c9302c;
+  border-color: #ac2925;
+}
+.btn-danger:active:hover,
+.btn-danger.active:hover,
+.open > .dropdown-toggle.btn-danger:hover,
+.btn-danger:active:focus,
+.btn-danger.active:focus,
+.open > .dropdown-toggle.btn-danger:focus,
+.btn-danger:active.focus,
+.btn-danger.active.focus,
+.open > .dropdown-toggle.btn-danger.focus {
+  color: #fff;
+  background-color: #ac2925;
+  border-color: #761c19;
+}
+.btn-danger:active,
+.btn-danger.active,
+.open > .dropdown-toggle.btn-danger {
+  background-image: none;
+}
+.btn-danger.disabled:hover,
+.btn-danger[disabled]:hover,
+fieldset[disabled] .btn-danger:hover,
+.btn-danger.disabled:focus,
+.btn-danger[disabled]:focus,
+fieldset[disabled] .btn-danger:focus,
+.btn-danger.disabled.focus,
+.btn-danger[disabled].focus,
+fieldset[disabled] .btn-danger.focus {
+  background-color: #d9534f;
+  border-color: #d43f3a;
+}
+.btn-danger .badge {
+  color: #d9534f;
+  background-color: #fff;
+}
+.btn-link {
+  font-weight: normal;
+  color: #337ab7;
+  border-radius: 0;
+}
+.btn-link,
+.btn-link:active,
+.btn-link.active,
+.btn-link[disabled],
+fieldset[disabled] .btn-link {
+  background-color: transparent;
+  -webkit-box-shadow: none;
+          box-shadow: none;
+}
+.btn-link,
+.btn-link:hover,
+.btn-link:focus,
+.btn-link:active {
+  border-color: transparent;
+}
+.btn-link:hover,
+.btn-link:focus {
+  color: #23527c;
+  text-decoration: underline;
+  background-color: transparent;
+}
+.btn-link[disabled]:hover,
+fieldset[disabled] .btn-link:hover,
+.btn-link[disabled]:focus,
+fieldset[disabled] .btn-link:focus {
+  color: #777;
+  text-decoration: none;
+}
+.btn-lg,
+.btn-group-lg > .btn {
+  padding: 10px 16px;
+  font-size: 18px;
+  line-height: 1.3333333;
+  border-radius: 6px;
+}
+.btn-sm,
+.btn-group-sm > .btn {
+  padding: 5px 10px;
+  font-size: 12px;
+  line-height: 1.5;
+  border-radius: 3px;
+}
+.btn-xs,
+.btn-group-xs > .btn {
+  padding: 1px 5px;
+  font-size: 12px;
+  line-height: 1.5;
+  border-radius: 3px;
+}
+.btn-block {
+  display: block;
+  width: 100%;
+}
+.btn-block + .btn-block {
+  margin-top: 5px;
+}
+input[type="submit"].btn-block,
+input[type="reset"].btn-block,
+input[type="button"].btn-block {
+  width: 100%;
+}
+.fade {
+  opacity: 0;
+  -webkit-transition: opacity .15s linear;
+       -o-transition: opacity .15s linear;
+          transition: opacity .15s linear;
+}
+.fade.in {
+  opacity: 1;
+}
+.collapse {
+  display: none;
+}
+.collapse.in {
+  display: block;
+}
+tr.collapse.in {
+  display: table-row;
+}
+tbody.collapse.in {
+  display: table-row-group;
+}
+.collapsing {
+  position: relative;
+  height: 0;
+  overflow: hidden;
+  -webkit-transition-timing-function: ease;
+       -o-transition-timing-function: ease;
+          transition-timing-function: ease;
+  -webkit-transition-duration: .35s;
+       -o-transition-duration: .35s;
+          transition-duration: .35s;
+  -webkit-transition-property: height, visibility;
+       -o-transition-property: height, visibility;
+          transition-property: height, visibility;
+}
+.caret {
+  display: inline-block;
+  width: 0;
+  height: 0;
+  margin-left: 2px;
+  vertical-align: middle;
+  border-top: 4px dashed;
+  border-top: 4px solid \9;
+  border-right: 4px solid transparent;
+  border-left: 4px solid transparent;
+}
+.dropup,
+.dropdown {
+  position: relative;
+}
+.dropdown-toggle:focus {
+  outline: 0;
+}
+.dropdown-menu {
+  position: absolute;
+  top: 100%;
+  left: 0;
+  z-index: 1000;
+  display: none;
+  float: left;
+  min-width: 160px;
+  padding: 5px 0;
+  margin: 2px 0 0;
+  font-size: 14px;
+  text-align: left;
+  list-style: none;
+  background-color: #fff;
+  -webkit-background-clip: padding-box;
+          background-clip: padding-box;
+  border: 1px solid #ccc;
+  border: 1px solid rgba(0, 0, 0, .15);
+  border-radius: 4px;
+  -webkit-box-shadow: 0 6px 12px rgba(0, 0, 0, .175);
+          box-shadow: 0 6px 12px rgba(0, 0, 0, .175);
+}
+.dropdown-menu.pull-right {
+  right: 0;
+  left: auto;
+}
+.dropdown-menu .divider {
+  height: 1px;
+  margin: 9px 0;
+  overflow: hidden;
+  background-color: #e5e5e5;
+}
+.dropdown-menu > li > a {
+  display: block;
+  padding: 3px 20px;
+  clear: both;
+  font-weight: normal;
+  line-height: 1.42857143;
+  color: #333;
+  white-space: nowrap;
+}
+.dropdown-menu > li > a:hover,
+.dropdown-menu > li > a:focus {
+  color: #262626;
+  text-decoration: none;
+  background-color: #f5f5f5;
+}
+.dropdown-menu > .active > a,
+.dropdown-menu > .active > a:hover,
+.dropdown-menu > .active > a:focus {
+  color: #fff;
+  text-decoration: none;
+  background-color: #337ab7;
+  outline: 0;
+}
+.dropdown-menu > .disabled > a,
+.dropdown-menu > .disabled > a:hover,
+.dropdown-menu > .disabled > a:focus {
+  color: #777;
+}
+.dropdown-menu > .disabled > a:hover,
+.dropdown-menu > .disabled > a:focus {
+  text-decoration: none;
+  cursor: not-allowed;
+  background-color: transparent;
+  background-image: none;
+  filter: progid:DXImageTransform.Microsoft.gradient(enabled = false);
+}
+.open > .dropdown-menu {
+  display: block;
+}
+.open > a {
+  outline: 0;
+}
+.dropdown-menu-right {
+  right: 0;
+  left: auto;
+}
+.dropdown-menu-left {
+  right: auto;
+  left: 0;
+}
+.dropdown-header {
+  display: block;
+  padding: 3px 20px;
+  font-size: 12px;
+  line-height: 1.42857143;
+  color: #777;
+  white-space: nowrap;
+}
+.dropdown-backdrop {
+  position: fixed;
+  top: 0;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  z-index: 990;
+}
+.pull-right > .dropdown-menu {
+  right: 0;
+  left: auto;
+}
+.dropup .caret,
+.navbar-fixed-bottom .dropdown .caret {
+  content: "";
+  border-top: 0;
+  border-bottom: 4px dashed;
+  border-bottom: 4px solid \9;
+}
+.dropup .dropdown-menu,
+.navbar-fixed-bottom .dropdown .dropdown-menu {
+  top: auto;
+  bottom: 100%;
+  margin-bottom: 2px;
+}
+@media (min-width: 768px) {
+  .navbar-right .dropdown-menu {
+    right: 0;
+    left: auto;
   }
-  .col-sm-offset-8 {
-    margin-left: 66.66666667%;
+  .navbar-right .dropdown-menu-left {
+    right: auto;
+    left: 0;
   }
-  .col-sm-offset-7 {
-    margin-left: 58.33333333%;
+}
+.btn-group,
+.btn-group-vertical {
+  position: relative;
+  display: inline-block;
+  vertical-align: middle;
+}
+.btn-group > .btn,
+.btn-group-vertical > .btn {
+  position: relative;
+  float: left;
+}
+.btn-group > .btn:hover,
+.btn-group-vertical > .btn:hover,
+.btn-group > .btn:focus,
+.btn-group-vertical > .btn:focus,
+.btn-group > .btn:active,
+.btn-group-vertical > .btn:active,
+.btn-group > .btn.active,
+.btn-group-vertical > .btn.active {
+  z-index: 2;
+}
+.btn-group .btn + .btn,
+.btn-group .btn + .btn-group,
+.btn-group .btn-group + .btn,
+.btn-group .btn-group + .btn-group {
+  margin-left: -1px;
+}
+.btn-toolbar {
+  margin-left: -5px;
+}
+.btn-toolbar .btn,
+.btn-toolbar .btn-group,
+.btn-toolbar .input-group {
+  float: left;
+}
+.btn-toolbar > .btn,
+.btn-toolbar > .btn-group,
+.btn-toolbar > .input-group {
+  margin-left: 5px;
+}
+.btn-group > .btn:not(:first-child):not(:last-child):not(.dropdown-toggle) {
+  border-radius: 0;
+}
+.btn-group > .btn:first-child {
+  margin-left: 0;
+}
+.btn-group > .btn:first-child:not(:last-child):not(.dropdown-toggle) {
+  border-top-right-radius: 0;
+  border-bottom-right-radius: 0;
+}
+.btn-group > .btn:last-child:not(:first-child),
+.btn-group > .dropdown-toggle:not(:first-child) {
+  border-top-left-radius: 0;
+  border-bottom-left-radius: 0;
+}
+.btn-group > .btn-group {
+  float: left;
+}
+.btn-group > .btn-group:not(:first-child):not(:last-child) > .btn {
+  border-radius: 0;
+}
+.btn-group > .btn-group:first-child:not(:last-child) > .btn:last-child,
+.btn-group > .btn-group:first-child:not(:last-child) > .dropdown-toggle {
+  border-top-right-radius: 0;
+  border-bottom-right-radius: 0;
+}
+.btn-group > .btn-group:last-child:not(:first-child) > .btn:first-child {
+  border-top-left-radius: 0;
+  border-bottom-left-radius: 0;
+}
+.btn-group .dropdown-toggle:active,
+.btn-group.open .dropdown-toggle {
+  outline: 0;
+}
+.btn-group > .btn + .dropdown-toggle {
+  padding-right: 8px;
+  padding-left: 8px;
+}
+.btn-group > .btn-lg + .dropdown-toggle {
+  padding-right: 12px;
+  padding-left: 12px;
+}
+.btn-group.open .dropdown-toggle {
+  -webkit-box-shadow: inset 0 3px 5px rgba(0, 0, 0, .125);
+          box-shadow: inset 0 3px 5px rgba(0, 0, 0, .125);
+}
+.btn-group.open .dropdown-toggle.btn-link {
+  -webkit-box-shadow: none;
+          box-shadow: none;
+}
+.btn .caret {
+  margin-left: 0;
+}
+.btn-lg .caret {
+  border-width: 5px 5px 0;
+  border-bottom-width: 0;
+}
+.dropup .btn-lg .caret {
+  border-width: 0 5px 5px;
+}
+.btn-group-vertical > .btn,
+.btn-group-vertical > .btn-group,
+.btn-group-vertical > .btn-group > .btn {
+  display: block;
+  float: none;
+  width: 100%;
+  max-width: 100%;
+}
+.btn-group-vertical > .btn-group > .btn {
+  float: none;
+}
+.btn-group-vertical > .btn + .btn,
+.btn-group-vertical > .btn + .btn-group,
+.btn-group-vertical > .btn-group + .btn,
+.btn-group-vertical > .btn-group + .btn-group {
+  margin-top: -1px;
+  margin-left: 0;
+}
+.btn-group-vertical > .btn:not(:first-child):not(:last-child) {
+  border-radius: 0;
+}
+.btn-group-vertical > .btn:first-child:not(:last-child) {
+  border-top-left-radius: 4px;
+  border-top-right-radius: 4px;
+  border-bottom-right-radius: 0;
+  border-bottom-left-radius: 0;
+}
+.btn-group-vertical > .btn:last-child:not(:first-child) {
+  border-top-left-radius: 0;
+  border-top-right-radius: 0;
+  border-bottom-right-radius: 4px;
+  border-bottom-left-radius: 4px;
+}
+.btn-group-vertical > .btn-group:not(:first-child):not(:last-child) > .btn {
+  border-radius: 0;
+}
+.btn-group-vertical > .btn-group:first-child:not(:last-child) > .btn:last-child,
+.btn-group-vertical > .btn-group:first-child:not(:last-child) > .dropdown-toggle {
+  border-bottom-right-radius: 0;
+  border-bottom-left-radius: 0;
+}
+.btn-group-vertical > .btn-group:last-child:not(:first-child) > .btn:first-child {
+  border-top-left-radius: 0;
+  border-top-right-radius: 0;
+}
+.btn-group-justified {
+  display: table;
+  width: 100%;
+  table-layout: fixed;
+  border-collapse: separate;
+}
+.btn-group-justified > .btn,
+.btn-group-justified > .btn-group {
+  display: table-cell;
+  float: none;
+  width: 1%;
+}
+.btn-group-justified > .btn-group .btn {
+  width: 100%;
+}
+.btn-group-justified > .btn-group .dropdown-menu {
+  left: auto;
+}
+[data-toggle="buttons"] > .btn input[type="radio"],
+[data-toggle="buttons"] > .btn-group > .btn input[type="radio"],
+[data-toggle="buttons"] > .btn input[type="checkbox"],
+[data-toggle="buttons"] > .btn-group > .btn input[type="checkbox"] {
+  position: absolute;
+  clip: rect(0, 0, 0, 0);
+  pointer-events: none;
+}
+.input-group {
+  position: relative;
+  display: table;
+  border-collapse: separate;
+}
+.input-group[class*="col-"] {
+  float: none;
+  padding-right: 0;
+  padding-left: 0;
+}
+.input-group .form-control {
+  position: relative;
+  z-index: 2;
+  float: left;
+  width: 100%;
+  margin-bottom: 0;
+}
+.input-group .form-control:focus {
+  z-index: 3;
+}
+.input-group-lg > .form-control,
+.input-group-lg > .input-group-addon,
+.input-group-lg > .input-group-btn > .btn {
+  height: 46px;
+  padding: 10px 16px;
+  font-size: 18px;
+  line-height: 1.3333333;
+  border-radius: 6px;
+}
+select.input-group-lg > .form-control,
+select.input-group-lg > .input-group-addon,
+select.input-group-lg > .input-group-btn > .btn {
+  height: 46px;
+  line-height: 46px;
+}
+textarea.input-group-lg > .form-control,
+textarea.input-group-lg > .input-group-addon,
+textarea.input-group-lg > .input-group-btn > .btn,
+select[multiple].input-group-lg > .form-control,
+select[multiple].input-group-lg > .input-group-addon,
+select[multiple].input-group-lg > .input-group-btn > .btn {
+  height: auto;
+}
+.input-group-sm > .form-control,
+.input-group-sm > .input-group-addon,
+.input-group-sm > .input-group-btn > .btn {
+  height: 30px;
+  padding: 5px 10px;
+  font-size: 12px;
+  line-height: 1.5;
+  border-radius: 3px;
+}
+select.input-group-sm > .form-control,
+select.input-group-sm > .input-group-addon,
+select.input-group-sm > .input-group-btn > .btn {
+  height: 30px;
+  line-height: 30px;
+}
+textarea.input-group-sm > .form-control,
+textarea.input-group-sm > .input-group-addon,
+textarea.input-group-sm > .input-group-btn > .btn,
+select[multiple].input-group-sm > .form-control,
+select[multiple].input-group-sm > .input-group-addon,
+select[multiple].input-group-sm > .input-group-btn > .btn {
+  height: auto;
+}
+.input-group-addon,
+.input-group-btn,
+.input-group .form-control {
+  display: table-cell;
+}
+.input-group-addon:not(:first-child):not(:last-child),
+.input-group-btn:not(:first-child):not(:last-child),
+.input-group .form-control:not(:first-child):not(:last-child) {
+  border-radius: 0;
+}
+.input-group-addon,
+.input-group-btn {
+  width: 1%;
+  white-space: nowrap;
+  vertical-align: middle;
+}
+.input-group-addon {
+  padding: 6px 12px;
+  font-size: 14px;
+  font-weight: normal;
+  line-height: 1;
+  color: #555;
+  text-align: center;
+  background-color: #eee;
+  border: 1px solid #ccc;
+  border-radius: 4px;
+}
+.input-group-addon.input-sm {
+  padding: 5px 10px;
+  font-size: 12px;
+  border-radius: 3px;
+}
+.input-group-addon.input-lg {
+  padding: 10px 16px;
+  font-size: 18px;
+  border-radius: 6px;
+}
+.input-group-addon input[type="radio"],
+.input-group-addon input[type="checkbox"] {
+  margin-top: 0;
+}
+.input-group .form-control:first-child,
+.input-group-addon:first-child,
+.input-group-btn:first-child > .btn,
+.input-group-btn:first-child > .btn-group > .btn,
+.input-group-btn:first-child > .dropdown-toggle,
+.input-group-btn:last-child > .btn:not(:last-child):not(.dropdown-toggle),
+.input-group-btn:last-child > .btn-group:not(:last-child) > .btn {
+  border-top-right-radius: 0;
+  border-bottom-right-radius: 0;
+}
+.input-group-addon:first-child {
+  border-right: 0;
+}
+.input-group .form-control:last-child,
+.input-group-addon:last-child,
+.input-group-btn:last-child > .btn,
+.input-group-btn:last-child > .btn-group > .btn,
+.input-group-btn:last-child > .dropdown-toggle,
+.input-group-btn:first-child > .btn:not(:first-child),
+.input-group-btn:first-child > .btn-group:not(:first-child) > .btn {
+  border-top-left-radius: 0;
+  border-bottom-left-radius: 0;
+}
+.input-group-addon:last-child {
+  border-left: 0;
+}
+.input-group-btn {
+  position: relative;
+  font-size: 0;
+  white-space: nowrap;
+}
+.input-group-btn > .btn {
+  position: relative;
+}
+.input-group-btn > .btn + .btn {
+  margin-left: -1px;
+}
+.input-group-btn > .btn:hover,
+.input-group-btn > .btn:focus,
+.input-group-btn > .btn:active {
+  z-index: 2;
+}
+.input-group-btn:first-child > .btn,
+.input-group-btn:first-child > .btn-group {
+  margin-right: -1px;
+}
+.input-group-btn:last-child > .btn,
+.input-group-btn:last-child > .btn-group {
+  z-index: 2;
+  margin-left: -1px;
+}
+.nav {
+  padding-left: 0;
+  margin-bottom: 0;
+  list-style: none;
+}
+.nav > li {
+  position: relative;
+  display: block;
+}
+.nav > li > a {
+  position: relative;
+  display: block;
+  padding: 10px 15px;
+}
+.nav > li > a:hover,
+.nav > li > a:focus {
+  text-decoration: none;
+  background-color: #eee;
+}
+.nav > li.disabled > a {
+  color: #777;
+}
+.nav > li.disabled > a:hover,
+.nav > li.disabled > a:focus {
+  color: #777;
+  text-decoration: none;
+  cursor: not-allowed;
+  background-color: transparent;
+}
+.nav .open > a,
+.nav .open > a:hover,
+.nav .open > a:focus {
+  background-color: #eee;
+  border-color: #337ab7;
+}
+.nav .nav-divider {
+  height: 1px;
+  margin: 9px 0;
+  overflow: hidden;
+  background-color: #e5e5e5;
+}
+.nav > li > a > img {
+  max-width: none;
+}
+.nav-tabs {
+  border-bottom: 1px solid #ddd;
+}
+.nav-tabs > li {
+  float: left;
+  margin-bottom: -1px;
+}
+.nav-tabs > li > a {
+  margin-right: 2px;
+  line-height: 1.42857143;
+  border: 1px solid transparent;
+  border-radius: 4px 4px 0 0;
+}
+.nav-tabs > li > a:hover {
+  border-color: #eee #eee #ddd;
+}
+.nav-tabs > li.active > a,
+.nav-tabs > li.active > a:hover,
+.nav-tabs > li.active > a:focus {
+  color: #555;
+  cursor: default;
+  background-color: #fff;
+  border: 1px solid #ddd;
+  border-bottom-color: transparent;
+}
+.nav-tabs.nav-justified {
+  width: 100%;
+  border-bottom: 0;
+}
+.nav-tabs.nav-justified > li {
+  float: none;
+}
+.nav-tabs.nav-justified > li > a {
+  margin-bottom: 5px;
+  text-align: center;
+}
+.nav-tabs.nav-justified > .dropdown .dropdown-menu {
+  top: auto;
+  left: auto;
+}
+@media (min-width: 768px) {
+  .nav-tabs.nav-justified > li {
+    display: table-cell;
+    width: 1%;
   }
-  .col-sm-offset-6 {
-    margin-left: 50%;
+  .nav-tabs.nav-justified > li > a {
+    margin-bottom: 0;
   }
-  .col-sm-offset-5 {
-    margin-left: 41.66666667%;
+}
+.nav-tabs.nav-justified > li > a {
+  margin-right: 0;
+  border-radius: 4px;
+}
+.nav-tabs.nav-justified > .active > a,
+.nav-tabs.nav-justified > .active > a:hover,
+.nav-tabs.nav-justified > .active > a:focus {
+  border: 1px solid #ddd;
+}
+@media (min-width: 768px) {
+  .nav-tabs.nav-justified > li > a {
+    border-bottom: 1px solid #ddd;
+    border-radius: 4px 4px 0 0;
   }
-  .col-sm-offset-4 {
-    margin-left: 33.33333333%;
+  .nav-tabs.nav-justified > .active > a,
+  .nav-tabs.nav-justified > .active > a:hover,
+  .nav-tabs.nav-justified > .active > a:focus {
+    border-bottom-color: #fff;
   }
-  .col-sm-offset-3 {
-    margin-left: 25%;
+}
+.nav-pills > li {
+  float: left;
+}
+.nav-pills > li > a {
+  border-radius: 4px;
+}
+.nav-pills > li + li {
+  margin-left: 2px;
+}
+.nav-pills > li.active > a,
+.nav-pills > li.active > a:hover,
+.nav-pills > li.active > a:focus {
+  color: #fff;
+  background-color: #337ab7;
+}
+.nav-stacked > li {
+  float: none;
+}
+.nav-stacked > li + li {
+  margin-top: 2px;
+  margin-left: 0;
+}
+.nav-justified {
+  width: 100%;
+}
+.nav-justified > li {
+  float: none;
+}
+.nav-justified > li > a {
+  margin-bottom: 5px;
+  text-align: center;
+}
+.nav-justified > .dropdown .dropdown-menu {
+  top: auto;
+  left: auto;
+}
+@media (min-width: 768px) {
+  .nav-justified > li {
+    display: table-cell;
+    width: 1%;
   }
-  .col-sm-offset-2 {
-    margin-left: 16.66666667%;
+  .nav-justified > li > a {
+    margin-bottom: 0;
   }
-  .col-sm-offset-1 {
-    margin-left: 8.33333333%;
+}
+.nav-tabs-justified {
+  border-bottom: 0;
+}
+.nav-tabs-justified > li > a {
+  margin-right: 0;
+  border-radius: 4px;
+}
+.nav-tabs-justified > .active > a,
+.nav-tabs-justified > .active > a:hover,
+.nav-tabs-justified > .active > a:focus {
+  border: 1px solid #ddd;
+}
+@media (min-width: 768px) {
+  .nav-tabs-justified > li > a {
+    border-bottom: 1px solid #ddd;
+    border-radius: 4px 4px 0 0;
   }
-  .col-sm-offset-0 {
-    margin-left: 0%;
+  .nav-tabs-justified > .active > a,
+  .nav-tabs-justified > .active > a:hover,
+  .nav-tabs-justified > .active > a:focus {
+    border-bottom-color: #fff;
   }
 }
-@media (min-width: 992px) {
-  .col-md-1, .col-md-2, .col-md-3, .col-md-4, .col-md-5, .col-md-6, .col-md-7, .col-md-8, .col-md-9, .col-md-10, .col-md-11, .col-md-12 {
+.tab-content > .tab-pane {
+  display: none;
+}
+.tab-content > .active {
+  display: block;
+}
+.nav-tabs .dropdown-menu {
+  margin-top: -1px;
+  border-top-left-radius: 0;
+  border-top-right-radius: 0;
+}
+.navbar {
+  position: relative;
+  min-height: 50px;
+  margin-bottom: 20px;
+  border: 1px solid transparent;
+}
+@media (min-width: 768px) {
+  .navbar {
+    border-radius: 4px;
+  }
+}
+@media (min-width: 768px) {
+  .navbar-header {
     float: left;
   }
-  .col-md-12 {
-    width: 100%;
+}
+.navbar-collapse {
+  padding-right: 15px;
+  padding-left: 15px;
+  overflow-x: visible;
+  -webkit-overflow-scrolling: touch;
+  border-top: 1px solid transparent;
+  -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, .1);
+          box-shadow: inset 0 1px 0 rgba(255, 255, 255, .1);
+}
+.navbar-collapse.in {
+  overflow-y: auto;
+}
+@media (min-width: 768px) {
+  .navbar-collapse {
+    width: auto;
+    border-top: 0;
+    -webkit-box-shadow: none;
+            box-shadow: none;
   }
-  .col-md-11 {
-    width: 91.66666667%;
+  .navbar-collapse.collapse {
+    display: block !important;
+    height: auto !important;
+    padding-bottom: 0;
+    overflow: visible !important;
   }
-  .col-md-10 {
-    width: 83.33333333%;
+  .navbar-collapse.in {
+    overflow-y: visible;
   }
-  .col-md-9 {
-    width: 75%;
+  .navbar-fixed-top .navbar-collapse,
+  .navbar-static-top .navbar-collapse,
+  .navbar-fixed-bottom .navbar-collapse {
+    padding-right: 0;
+    padding-left: 0;
   }
-  .col-md-8 {
-    width: 66.66666667%;
+}
+.navbar-fixed-top .navbar-collapse,
+.navbar-fixed-bottom .navbar-collapse {
+  max-height: 340px;
+}
+@media (max-device-width: 480px) and (orientation: landscape) {
+  .navbar-fixed-top .navbar-collapse,
+  .navbar-fixed-bottom .navbar-collapse {
+    max-height: 200px;
   }
-  .col-md-7 {
-    width: 58.33333333%;
+}
+.container > .navbar-header,
+.container-fluid > .navbar-header,
+.container > .navbar-collapse,
+.container-fluid > .navbar-collapse {
+  margin-right: -15px;
+  margin-left: -15px;
+}
+@media (min-width: 768px) {
+  .container > .navbar-header,
+  .container-fluid > .navbar-header,
+  .container > .navbar-collapse,
+  .container-fluid > .navbar-collapse {
+    margin-right: 0;
+    margin-left: 0;
   }
-  .col-md-6 {
-    width: 50%;
+}
+.navbar-static-top {
+  z-index: 1000;
+  border-width: 0 0 1px;
+}
+@media (min-width: 768px) {
+  .navbar-static-top {
+    border-radius: 0;
   }
-  .col-md-5 {
-    width: 41.66666667%;
+}
+.navbar-fixed-top,
+.navbar-fixed-bottom {
+  position: fixed;
+  right: 0;
+  left: 0;
+  z-index: 1030;
+}
+@media (min-width: 768px) {
+  .navbar-fixed-top,
+  .navbar-fixed-bottom {
+    border-radius: 0;
   }
-  .col-md-4 {
-    width: 33.33333333%;
+}
+.navbar-fixed-top {
+  top: 0;
+  border-width: 0 0 1px;
+}
+.navbar-fixed-bottom {
+  bottom: 0;
+  margin-bottom: 0;
+  border-width: 1px 0 0;
+}
+.navbar-brand {
+  float: left;
+  height: 50px;
+  padding: 15px 15px;
+  font-size: 18px;
+  line-height: 20px;
+}
+.navbar-brand:hover,
+.navbar-brand:focus {
+  text-decoration: none;
+}
+.navbar-brand > img {
+  display: block;
+}
+@media (min-width: 768px) {
+  .navbar > .container .navbar-brand,
+  .navbar > .container-fluid .navbar-brand {
+    margin-left: -15px;
   }
-  .col-md-3 {
-    width: 25%;
+}
+.navbar-toggle {
+  position: relative;
+  float: right;
+  padding: 9px 10px;
+  margin-top: 8px;
+  margin-right: 15px;
+  margin-bottom: 8px;
+  background-color: transparent;
+  background-image: none;
+  border: 1px solid transparent;
+  border-radius: 4px;
+}
+.navbar-toggle:focus {
+  outline: 0;
+}
+.navbar-toggle .icon-bar {
+  display: block;
+  width: 22px;
+  height: 2px;
+  border-radius: 1px;
+}
+.navbar-toggle .icon-bar + .icon-bar {
+  margin-top: 4px;
+}
+@media (min-width: 768px) {
+  .navbar-toggle {
+    display: none;
   }
-  .col-md-2 {
-    width: 16.66666667%;
+}
+.navbar-nav {
+  margin: 7.5px -15px;
+}
+.navbar-nav > li > a {
+  padding-top: 10px;
+  padding-bottom: 10px;
+  line-height: 20px;
+}
+@media (max-width: 767px) {
+  .navbar-nav .open .dropdown-menu {
+    position: static;
+    float: none;
+    width: auto;
+    margin-top: 0;
+    background-color: transparent;
+    border: 0;
+    -webkit-box-shadow: none;
+            box-shadow: none;
   }
-  .col-md-1 {
-    width: 8.33333333%;
+  .navbar-nav .open .dropdown-menu > li > a,
+  .navbar-nav .open .dropdown-menu .dropdown-header {
+    padding: 5px 15px 5px 25px;
   }
-  .col-md-pull-12 {
-    right: 100%;
+  .navbar-nav .open .dropdown-menu > li > a {
+    line-height: 20px;
   }
-  .col-md-pull-11 {
-    right: 91.66666667%;
+  .navbar-nav .open .dropdown-menu > li > a:hover,
+  .navbar-nav .open .dropdown-menu > li > a:focus {
+    background-image: none;
   }
-  .col-md-pull-10 {
-    right: 83.33333333%;
+}
+@media (min-width: 768px) {
+  .navbar-nav {
+    float: left;
+    margin: 0;
   }
-  .col-md-pull-9 {
-    right: 75%;
+  .navbar-nav > li {
+    float: left;
   }
-  .col-md-pull-8 {
-    right: 66.66666667%;
+  .navbar-nav > li > a {
+    padding-top: 15px;
+    padding-bottom: 15px;
   }
-  .col-md-pull-7 {
-    right: 58.33333333%;
+}
+.navbar-form {
+  padding: 10px 15px;
+  margin-top: 8px;
+  margin-right: -15px;
+  margin-bottom: 8px;
+  margin-left: -15px;
+  border-top: 1px solid transparent;
+  border-bottom: 1px solid transparent;
+  -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, .1), 0 1px 0 rgba(255, 255, 255, .1);
+          box-shadow: inset 0 1px 0 rgba(255, 255, 255, .1), 0 1px 0 rgba(255, 255, 255, .1);
+}
+@media (min-width: 768px) {
+  .navbar-form .form-group {
+    display: inline-block;
+    margin-bottom: 0;
+    vertical-align: middle;
   }
-  .col-md-pull-6 {
-    right: 50%;
+  .navbar-form .form-control {
+    display: inline-block;
+    width: auto;
+    vertical-align: middle;
   }
-  .col-md-pull-5 {
-    right: 41.66666667%;
+  .navbar-form .form-control-static {
+    display: inline-block;
   }
-  .col-md-pull-4 {
-    right: 33.33333333%;
+  .navbar-form .input-group {
+    display: inline-table;
+    vertical-align: middle;
   }
-  .col-md-pull-3 {
-    right: 25%;
+  .navbar-form .input-group .input-group-addon,
+  .navbar-form .input-group .input-group-btn,
+  .navbar-form .input-group .form-control {
+    width: auto;
   }
-  .col-md-pull-2 {
-    right: 16.66666667%;
+  .navbar-form .input-group > .form-control {
+    width: 100%;
   }
-  .col-md-pull-1 {
-    right: 8.33333333%;
+  .navbar-form .control-label {
+    margin-bottom: 0;
+    vertical-align: middle;
   }
-  .col-md-pull-0 {
-    right: auto;
+  .navbar-form .radio,
+  .navbar-form .checkbox {
+    display: inline-block;
+    margin-top: 0;
+    margin-bottom: 0;
+    vertical-align: middle;
   }
-  .col-md-push-12 {
-    left: 100%;
+  .navbar-form .radio label,
+  .navbar-form .checkbox label {
+    padding-left: 0;
   }
-  .col-md-push-11 {
-    left: 91.66666667%;
+  .navbar-form .radio input[type="radio"],
+  .navbar-form .checkbox input[type="checkbox"] {
+    position: relative;
+    margin-left: 0;
   }
-  .col-md-push-10 {
-    left: 83.33333333%;
+  .navbar-form .has-feedback .form-control-feedback {
+    top: 0;
   }
-  .col-md-push-9 {
-    left: 75%;
+}
+@media (max-width: 767px) {
+  .navbar-form .form-group {
+    margin-bottom: 5px;
   }
-  .col-md-push-8 {
-    left: 66.66666667%;
+  .navbar-form .form-group:last-child {
+    margin-bottom: 0;
   }
-  .col-md-push-7 {
-    left: 58.33333333%;
+}
+@media (min-width: 768px) {
+  .navbar-form {
+    width: auto;
+    padding-top: 0;
+    padding-bottom: 0;
+    margin-right: 0;
+    margin-left: 0;
+    border: 0;
+    -webkit-box-shadow: none;
+            box-shadow: none;
+  }
+}
+.navbar-nav > li > .dropdown-menu {
+  margin-top: 0;
+  border-top-left-radius: 0;
+  border-top-right-radius: 0;
+}
+.navbar-fixed-bottom .navbar-nav > li > .dropdown-menu {
+  margin-bottom: 0;
+  border-top-left-radius: 4px;
+  border-top-right-radius: 4px;
+  border-bottom-right-radius: 0;
+  border-bottom-left-radius: 0;
+}
+.navbar-btn {
+  margin-top: 8px;
+  margin-bottom: 8px;
+}
+.navbar-btn.btn-sm {
+  margin-top: 10px;
+  margin-bottom: 10px;
+}
+.navbar-btn.btn-xs {
+  margin-top: 14px;
+  margin-bottom: 14px;
+}
+.navbar-text {
+  margin-top: 15px;
+  margin-bottom: 15px;
+}
+@media (min-width: 768px) {
+  .navbar-text {
+    float: left;
+    margin-right: 15px;
+    margin-left: 15px;
   }
-  .col-md-push-6 {
-    left: 50%;
+}
+@media (min-width: 768px) {
+  .navbar-left {
+    float: left !important;
   }
-  .col-md-push-5 {
-    left: 41.66666667%;
+  .navbar-right {
+    float: right !important;
+    margin-right: -15px;
   }
-  .col-md-push-4 {
-    left: 33.33333333%;
+  .navbar-right ~ .navbar-right {
+    margin-right: 0;
   }
-  .col-md-push-3 {
-    left: 25%;
+}
+.navbar-default {
+  background-color: #f8f8f8;
+  border-color: #e7e7e7;
+}
+.navbar-default .navbar-brand {
+  color: #777;
+}
+.navbar-default .navbar-brand:hover,
+.navbar-default .navbar-brand:focus {
+  color: #5e5e5e;
+  background-color: transparent;
+}
+.navbar-default .navbar-text {
+  color: #777;
+}
+.navbar-default .navbar-nav > li > a {
+  color: #777;
+}
+.navbar-default .navbar-nav > li > a:hover,
+.navbar-default .navbar-nav > li > a:focus {
+  color: #333;
+  background-color: transparent;
+}
+.navbar-default .navbar-nav > .active > a,
+.navbar-default .navbar-nav > .active > a:hover,
+.navbar-default .navbar-nav > .active > a:focus {
+  color: #555;
+  background-color: #e7e7e7;
+}
+.navbar-default .navbar-nav > .disabled > a,
+.navbar-default .navbar-nav > .disabled > a:hover,
+.navbar-default .navbar-nav > .disabled > a:focus {
+  color: #ccc;
+  background-color: transparent;
+}
+.navbar-default .navbar-toggle {
+  border-color: #ddd;
+}
+.navbar-default .navbar-toggle:hover,
+.navbar-default .navbar-toggle:focus {
+  background-color: #ddd;
+}
+.navbar-default .navbar-toggle .icon-bar {
+  background-color: #888;
+}
+.navbar-default .navbar-collapse,
+.navbar-default .navbar-form {
+  border-color: #e7e7e7;
+}
+.navbar-default .navbar-nav > .open > a,
+.navbar-default .navbar-nav > .open > a:hover,
+.navbar-default .navbar-nav > .open > a:focus {
+  color: #555;
+  background-color: #e7e7e7;
+}
+@media (max-width: 767px) {
+  .navbar-default .navbar-nav .open .dropdown-menu > li > a {
+    color: #777;
   }
-  .col-md-push-2 {
-    left: 16.66666667%;
+  .navbar-default .navbar-nav .open .dropdown-menu > li > a:hover,
+  .navbar-default .navbar-nav .open .dropdown-menu > li > a:focus {
+    color: #333;
+    background-color: transparent;
   }
-  .col-md-push-1 {
-    left: 8.33333333%;
+  .navbar-default .navbar-nav .open .dropdown-menu > .active > a,
+  .navbar-default .navbar-nav .open .dropdown-menu > .active > a:hover,
+  .navbar-default .navbar-nav .open .dropdown-menu > .active > a:focus {
+    color: #555;
+    background-color: #e7e7e7;
   }
-  .col-md-push-0 {
-    left: auto;
+  .navbar-default .navbar-nav .open .dropdown-menu > .disabled > a,
+  .navbar-default .navbar-nav .open .dropdown-menu > .disabled > a:hover,
+  .navbar-default .navbar-nav .open .dropdown-menu > .disabled > a:focus {
+    color: #ccc;
+    background-color: transparent;
   }
-  .col-md-offset-12 {
-    margin-left: 100%;
+}
+.navbar-default .navbar-link {
+  color: #777;
+}
+.navbar-default .navbar-link:hover {
+  color: #333;
+}
+.navbar-default .btn-link {
+  color: #777;
+}
+.navbar-default .btn-link:hover,
+.navbar-default .btn-link:focus {
+  color: #333;
+}
+.navbar-default .btn-link[disabled]:hover,
+fieldset[disabled] .navbar-default .btn-link:hover,
+.navbar-default .btn-link[disabled]:focus,
+fieldset[disabled] .navbar-default .btn-link:focus {
+  color: #ccc;
+}
+.navbar-inverse {
+  background-color: #222;
+  border-color: #080808;
+}
+.navbar-inverse .navbar-brand {
+  color: #9d9d9d;
+}
+.navbar-inverse .navbar-brand:hover,
+.navbar-inverse .navbar-brand:focus {
+  color: #fff;
+  background-color: transparent;
+}
+.navbar-inverse .navbar-text {
+  color: #9d9d9d;
+}
+.navbar-inverse .navbar-nav > li > a {
+  color: #9d9d9d;
+}
+.navbar-inverse .navbar-nav > li > a:hover,
+.navbar-inverse .navbar-nav > li > a:focus {
+  color: #fff;
+  background-color: transparent;
+}
+.navbar-inverse .navbar-nav > .active > a,
+.navbar-inverse .navbar-nav > .active > a:hover,
+.navbar-inverse .navbar-nav > .active > a:focus {
+  color: #fff;
+  background-color: #080808;
+}
+.navbar-inverse .navbar-nav > .disabled > a,
+.navbar-inverse .navbar-nav > .disabled > a:hover,
+.navbar-inverse .navbar-nav > .disabled > a:focus {
+  color: #444;
+  background-color: transparent;
+}
+.navbar-inverse .navbar-toggle {
+  border-color: #333;
+}
+.navbar-inverse .navbar-toggle:hover,
+.navbar-inverse .navbar-toggle:focus {
+  background-color: #333;
+}
+.navbar-inverse .navbar-toggle .icon-bar {
+  background-color: #fff;
+}
+.navbar-inverse .navbar-collapse,
+.navbar-inverse .navbar-form {
+  border-color: #101010;
+}
+.navbar-inverse .navbar-nav > .open > a,
+.navbar-inverse .navbar-nav > .open > a:hover,
+.navbar-inverse .navbar-nav > .open > a:focus {
+  color: #fff;
+  background-color: #080808;
+}
+@media (max-width: 767px) {
+  .navbar-inverse .navbar-nav .open .dropdown-menu > .dropdown-header {
+    border-color: #080808;
   }
-  .col-md-offset-11 {
-    margin-left: 91.66666667%;
+  .navbar-inverse .navbar-nav .open .dropdown-menu .divider {
+    background-color: #080808;
   }
-  .col-md-offset-10 {
-    margin-left: 83.33333333%;
+  .navbar-inverse .navbar-nav .open .dropdown-menu > li > a {
+    color: #9d9d9d;
   }
-  .col-md-offset-9 {
-    margin-left: 75%;
+  .navbar-inverse .navbar-nav .open .dropdown-menu > li > a:hover,
+  .navbar-inverse .navbar-nav .open .dropdown-menu > li > a:focus {
+    color: #fff;
+    background-color: transparent;
   }
-  .col-md-offset-8 {
-    margin-left: 66.66666667%;
+  .navbar-inverse .navbar-nav .open .dropdown-menu > .active > a,
+  .navbar-inverse .navbar-nav .open .dropdown-menu > .active > a:hover,
+  .navbar-inverse .navbar-nav .open .dropdown-menu > .active > a:focus {
+    color: #fff;
+    background-color: #080808;
+  }
+  .navbar-inverse .navbar-nav .open .dropdown-menu > .disabled > a,
+  .navbar-inverse .navbar-nav .open .dropdown-menu > .disabled > a:hover,
+  .navbar-inverse .navbar-nav .open .dropdown-menu > .disabled > a:focus {
+    color: #444;
+    background-color: transparent;
+  }
+}
+.navbar-inverse .navbar-link {
+  color: #9d9d9d;
+}
+.navbar-inverse .navbar-link:hover {
+  color: #fff;
+}
+.navbar-inverse .btn-link {
+  color: #9d9d9d;
+}
+.navbar-inverse .btn-link:hover,
+.navbar-inverse .btn-link:focus {
+  color: #fff;
+}
+.navbar-inverse .btn-link[disabled]:hover,
+fieldset[disabled] .navbar-inverse .btn-link:hover,
+.navbar-inverse .btn-link[disabled]:focus,
+fieldset[disabled] .navbar-inverse .btn-link:focus {
+  color: #444;
+}
+.breadcrumb {
+  padding: 8px 15px;
+  margin-bottom: 20px;
+  list-style: none;
+  background-color: #f5f5f5;
+  border-radius: 4px;
+}
+.breadcrumb > li {
+  display: inline-block;
+}
+.breadcrumb > li + li:before {
+  padding: 0 5px;
+  color: #ccc;
+  content: "/\00a0";
+}
+.breadcrumb > .active {
+  color: #777;
+}
+.pagination {
+  display: inline-block;
+  padding-left: 0;
+  margin: 20px 0;
+  border-radius: 4px;
+}
+.pagination > li {
+  display: inline;
+}
+.pagination > li > a,
+.pagination > li > span {
+  position: relative;
+  float: left;
+  padding: 6px 12px;
+  margin-left: -1px;
+  line-height: 1.42857143;
+  color: #337ab7;
+  text-decoration: none;
+  background-color: #fff;
+  border: 1px solid #ddd;
+}
+.pagination > li:first-child > a,
+.pagination > li:first-child > span {
+  margin-left: 0;
+  border-top-left-radius: 4px;
+  border-bottom-left-radius: 4px;
+}
+.pagination > li:last-child > a,
+.pagination > li:last-child > span {
+  border-top-right-radius: 4px;
+  border-bottom-right-radius: 4px;
+}
+.pagination > li > a:hover,
+.pagination > li > span:hover,
+.pagination > li > a:focus,
+.pagination > li > span:focus {
+  z-index: 2;
+  color: #23527c;
+  background-color: #eee;
+  border-color: #ddd;
+}
+.pagination > .active > a,
+.pagination > .active > span,
+.pagination > .active > a:hover,
+.pagination > .active > span:hover,
+.pagination > .active > a:focus,
+.pagination > .active > span:focus {
+  z-index: 3;
+  color: #fff;
+  cursor: default;
+  background-color: #337ab7;
+  border-color: #337ab7;
+}
+.pagination > .disabled > span,
+.pagination > .disabled > span:hover,
+.pagination > .disabled > span:focus,
+.pagination > .disabled > a,
+.pagination > .disabled > a:hover,
+.pagination > .disabled > a:focus {
+  color: #777;
+  cursor: not-allowed;
+  background-color: #fff;
+  border-color: #ddd;
+}
+.pagination-lg > li > a,
+.pagination-lg > li > span {
+  padding: 10px 16px;
+  font-size: 18px;
+  line-height: 1.3333333;
+}
+.pagination-lg > li:first-child > a,
+.pagination-lg > li:first-child > span {
+  border-top-left-radius: 6px;
+  border-bottom-left-radius: 6px;
+}
+.pagination-lg > li:last-child > a,
+.pagination-lg > li:last-child > span {
+  border-top-right-radius: 6px;
+  border-bottom-right-radius: 6px;
+}
+.pagination-sm > li > a,
+.pagination-sm > li > span {
+  padding: 5px 10px;
+  font-size: 12px;
+  line-height: 1.5;
+}
+.pagination-sm > li:first-child > a,
+.pagination-sm > li:first-child > span {
+  border-top-left-radius: 3px;
+  border-bottom-left-radius: 3px;
+}
+.pagination-sm > li:last-child > a,
+.pagination-sm > li:last-child > span {
+  border-top-right-radius: 3px;
+  border-bottom-right-radius: 3px;
+}
+.pager {
+  padding-left: 0;
+  margin: 20px 0;
+  text-align: center;
+  list-style: none;
+}
+.pager li {
+  display: inline;
+}
+.pager li > a,
+.pager li > span {
+  display: inline-block;
+  padding: 5px 14px;
+  background-color: #fff;
+  border: 1px solid #ddd;
+  border-radius: 15px;
+}
+.pager li > a:hover,
+.pager li > a:focus {
+  text-decoration: none;
+  background-color: #eee;
+}
+.pager .next > a,
+.pager .next > span {
+  float: right;
+}
+.pager .previous > a,
+.pager .previous > span {
+  float: left;
+}
+.pager .disabled > a,
+.pager .disabled > a:hover,
+.pager .disabled > a:focus,
+.pager .disabled > span {
+  color: #777;
+  cursor: not-allowed;
+  background-color: #fff;
+}
+.label {
+  display: inline;
+  padding: .2em .6em .3em;
+  font-size: 75%;
+  font-weight: bold;
+  line-height: 1;
+  color: #fff;
+  text-align: center;
+  white-space: nowrap;
+  vertical-align: baseline;
+  border-radius: .25em;
+}
+a.label:hover,
+a.label:focus {
+  color: #fff;
+  text-decoration: none;
+  cursor: pointer;
+}
+.label:empty {
+  display: none;
+}
+.btn .label {
+  position: relative;
+  top: -1px;
+}
+.label-default {
+  background-color: #777;
+}
+.label-default[href]:hover,
+.label-default[href]:focus {
+  background-color: #5e5e5e;
+}
+.label-primary {
+  background-color: #337ab7;
+}
+.label-primary[href]:hover,
+.label-primary[href]:focus {
+  background-color: #286090;
+}
+.label-success {
+  background-color: #5cb85c;
+}
+.label-success[href]:hover,
+.label-success[href]:focus {
+  background-color: #449d44;
+}
+.label-info {
+  background-color: #5bc0de;
+}
+.label-info[href]:hover,
+.label-info[href]:focus {
+  background-color: #31b0d5;
+}
+.label-warning {
+  background-color: #f0ad4e;
+}
+.label-warning[href]:hover,
+.label-warning[href]:focus {
+  background-color: #ec971f;
+}
+.label-danger {
+  background-color: #d9534f;
+}
+.label-danger[href]:hover,
+.label-danger[href]:focus {
+  background-color: #c9302c;
+}
+.badge {
+  display: inline-block;
+  min-width: 10px;
+  padding: 3px 7px;
+  font-size: 12px;
+  font-weight: bold;
+  line-height: 1;
+  color: #fff;
+  text-align: center;
+  white-space: nowrap;
+  vertical-align: middle;
+  background-color: #777;
+  border-radius: 10px;
+}
+.badge:empty {
+  display: none;
+}
+.btn .badge {
+  position: relative;
+  top: -1px;
+}
+.btn-xs .badge,
+.btn-group-xs > .btn .badge {
+  top: 0;
+  padding: 1px 5px;
+}
+a.badge:hover,
+a.badge:focus {
+  color: #fff;
+  text-decoration: none;
+  cursor: pointer;
+}
+.list-group-item.active > .badge,
+.nav-pills > .active > a > .badge {
+  color: #337ab7;
+  background-color: #fff;
+}
+.list-group-item > .badge {
+  float: right;
+}
+.list-group-item > .badge + .badge {
+  margin-right: 5px;
+}
+.nav-pills > li > a > .badge {
+  margin-left: 3px;
+}
+.jumbotron {
+  padding-top: 30px;
+  padding-bottom: 30px;
+  margin-bottom: 30px;
+  color: inherit;
+  background-color: #eee;
+}
+.jumbotron h1,
+.jumbotron .h1 {
+  color: inherit;
+}
+.jumbotron p {
+  margin-bottom: 15px;
+  font-size: 21px;
+  font-weight: 200;
+}
+.jumbotron > hr {
+  border-top-color: #d5d5d5;
+}
+.container .jumbotron,
+.container-fluid .jumbotron {
+  padding-right: 15px;
+  padding-left: 15px;
+  border-radius: 6px;
+}
+.jumbotron .container {
+  max-width: 100%;
+}
+@media screen and (min-width: 768px) {
+  .jumbotron {
+    padding-top: 48px;
+    padding-bottom: 48px;
   }
-  .col-md-offset-7 {
-    margin-left: 58.33333333%;
+  .container .jumbotron,
+  .container-fluid .jumbotron {
+    padding-right: 60px;
+    padding-left: 60px;
   }
-  .col-md-offset-6 {
-    margin-left: 50%;
+  .jumbotron h1,
+  .jumbotron .h1 {
+    font-size: 63px;
   }
-  .col-md-offset-5 {
-    margin-left: 41.66666667%;
+}
+.thumbnail {
+  display: block;
+  padding: 4px;
+  margin-bottom: 20px;
+  line-height: 1.42857143;
+  background-color: #fff;
+  border: 1px solid #ddd;
+  border-radius: 4px;
+  -webkit-transition: border .2s ease-in-out;
+       -o-transition: border .2s ease-in-out;
+          transition: border .2s ease-in-out;
+}
+.thumbnail > img,
+.thumbnail a > img {
+  margin-right: auto;
+  margin-left: auto;
+}
+a.thumbnail:hover,
+a.thumbnail:focus,
+a.thumbnail.active {
+  border-color: #337ab7;
+}
+.thumbnail .caption {
+  padding: 9px;
+  color: #333;
+}
+.alert {
+  padding: 15px;
+  margin-bottom: 20px;
+  border: 1px solid transparent;
+  border-radius: 4px;
+}
+.alert h4 {
+  margin-top: 0;
+  color: inherit;
+}
+.alert .alert-link {
+  font-weight: bold;
+}
+.alert > p,
+.alert > ul {
+  margin-bottom: 0;
+}
+.alert > p + p {
+  margin-top: 5px;
+}
+.alert-dismissable,
+.alert-dismissible {
+  padding-right: 35px;
+}
+.alert-dismissable .close,
+.alert-dismissible .close {
+  position: relative;
+  top: -2px;
+  right: -21px;
+  color: inherit;
+}
+.alert-success {
+  color: #3c763d;
+  background-color: #dff0d8;
+  border-color: #d6e9c6;
+}
+.alert-success hr {
+  border-top-color: #c9e2b3;
+}
+.alert-success .alert-link {
+  color: #2b542c;
+}
+.alert-info {
+  color: #31708f;
+  background-color: #d9edf7;
+  border-color: #bce8f1;
+}
+.alert-info hr {
+  border-top-color: #a6e1ec;
+}
+.alert-info .alert-link {
+  color: #245269;
+}
+.alert-warning {
+  color: #8a6d3b;
+  background-color: #fcf8e3;
+  border-color: #faebcc;
+}
+.alert-warning hr {
+  border-top-color: #f7e1b5;
+}
+.alert-warning .alert-link {
+  color: #66512c;
+}
+.alert-danger {
+  color: #a94442;
+  background-color: #f2dede;
+  border-color: #ebccd1;
+}
+.alert-danger hr {
+  border-top-color: #e4b9c0;
+}
+.alert-danger .alert-link {
+  color: #843534;
+}
+@-webkit-keyframes progress-bar-stripes {
+  from {
+    background-position: 40px 0;
   }
-  .col-md-offset-4 {
-    margin-left: 33.33333333%;
+  to {
+    background-position: 0 0;
   }
-  .col-md-offset-3 {
-    margin-left: 25%;
+}
+@-o-keyframes progress-bar-stripes {
+  from {
+    background-position: 40px 0;
   }
-  .col-md-offset-2 {
-    margin-left: 16.66666667%;
+  to {
+    background-position: 0 0;
   }
-  .col-md-offset-1 {
-    margin-left: 8.33333333%;
+}
+@keyframes progress-bar-stripes {
+  from {
+    background-position: 40px 0;
   }
-  .col-md-offset-0 {
-    margin-left: 0%;
+  to {
+    background-position: 0 0;
   }
 }
-@media (min-width: 1200px) {
-  .col-lg-1, .col-lg-2, .col-lg-3, .col-lg-4, .col-lg-5, .col-lg-6, .col-lg-7, .col-lg-8, .col-lg-9, .col-lg-10, .col-lg-11, .col-lg-12 {
-    float: left;
-  }
-  .col-lg-12 {
-    width: 100%;
-  }
-  .col-lg-11 {
-    width: 91.66666667%;
-  }
-  .col-lg-10 {
-    width: 83.33333333%;
-  }
-  .col-lg-9 {
-    width: 75%;
-  }
-  .col-lg-8 {
-    width: 66.66666667%;
-  }
-  .col-lg-7 {
-    width: 58.33333333%;
-  }
-  .col-lg-6 {
-    width: 50%;
-  }
-  .col-lg-5 {
-    width: 41.66666667%;
-  }
-  .col-lg-4 {
-    width: 33.33333333%;
-  }
-  .col-lg-3 {
-    width: 25%;
-  }
-  .col-lg-2 {
-    width: 16.66666667%;
-  }
-  .col-lg-1 {
-    width: 8.33333333%;
-  }
-  .col-lg-pull-12 {
-    right: 100%;
-  }
-  .col-lg-pull-11 {
-    right: 91.66666667%;
-  }
-  .col-lg-pull-10 {
-    right: 83.33333333%;
-  }
-  .col-lg-pull-9 {
-    right: 75%;
-  }
-  .col-lg-pull-8 {
-    right: 66.66666667%;
-  }
-  .col-lg-pull-7 {
-    right: 58.33333333%;
-  }
-  .col-lg-pull-6 {
-    right: 50%;
-  }
-  .col-lg-pull-5 {
-    right: 41.66666667%;
-  }
-  .col-lg-pull-4 {
-    right: 33.33333333%;
-  }
-  .col-lg-pull-3 {
-    right: 25%;
-  }
-  .col-lg-pull-2 {
-    right: 16.66666667%;
-  }
-  .col-lg-pull-1 {
-    right: 8.33333333%;
-  }
-  .col-lg-pull-0 {
-    right: auto;
-  }
-  .col-lg-push-12 {
-    left: 100%;
-  }
-  .col-lg-push-11 {
-    left: 91.66666667%;
-  }
-  .col-lg-push-10 {
-    left: 83.33333333%;
-  }
-  .col-lg-push-9 {
-    left: 75%;
-  }
-  .col-lg-push-8 {
-    left: 66.66666667%;
-  }
-  .col-lg-push-7 {
-    left: 58.33333333%;
-  }
-  .col-lg-push-6 {
-    left: 50%;
-  }
-  .col-lg-push-5 {
-    left: 41.66666667%;
-  }
-  .col-lg-push-4 {
-    left: 33.33333333%;
-  }
-  .col-lg-push-3 {
-    left: 25%;
-  }
-  .col-lg-push-2 {
-    left: 16.66666667%;
-  }
-  .col-lg-push-1 {
-    left: 8.33333333%;
-  }
-  .col-lg-push-0 {
-    left: auto;
-  }
-  .col-lg-offset-12 {
-    margin-left: 100%;
-  }
-  .col-lg-offset-11 {
-    margin-left: 91.66666667%;
-  }
-  .col-lg-offset-10 {
-    margin-left: 83.33333333%;
-  }
-  .col-lg-offset-9 {
-    margin-left: 75%;
-  }
-  .col-lg-offset-8 {
-    margin-left: 66.66666667%;
+.progress {
+  height: 20px;
+  margin-bottom: 20px;
+  overflow: hidden;
+  background-color: #f5f5f5;
+  border-radius: 4px;
+  -webkit-box-shadow: inset 0 1px 2px rgba(0, 0, 0, .1);
+          box-shadow: inset 0 1px 2px rgba(0, 0, 0, .1);
+}
+.progress-bar {
+  float: left;
+  width: 0;
+  height: 100%;
+  font-size: 12px;
+  line-height: 20px;
+  color: #fff;
+  text-align: center;
+  background-color: #337ab7;
+  -webkit-box-shadow: inset 0 -1px 0 rgba(0, 0, 0, .15);
+          box-shadow: inset 0 -1px 0 rgba(0, 0, 0, .15);
+  -webkit-transition: width .6s ease;
+       -o-transition: width .6s ease;
+          transition: width .6s ease;
+}
+.progress-striped .progress-bar,
+.progress-bar-striped {
+  background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+  background-image:      -o-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+  background-image:         linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+  -webkit-background-size: 40px 40px;
+          background-size: 40px 40px;
+}
+.progress.active .progress-bar,
+.progress-bar.active {
+  -webkit-animation: progress-bar-stripes 2s linear infinite;
+       -o-animation: progress-bar-stripes 2s linear infinite;
+          animation: progress-bar-stripes 2s linear infinite;
+}
+.progress-bar-success {
+  background-color: #5cb85c;
+}
+.progress-striped .progress-bar-success {
+  background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+  background-image:      -o-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+  background-image:         linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+}
+.progress-bar-info {
+  background-color: #5bc0de;
+}
+.progress-striped .progress-bar-info {
+  background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+  background-image:      -o-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+  background-image:         linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+}
+.progress-bar-warning {
+  background-color: #f0ad4e;
+}
+.progress-striped .progress-bar-warning {
+  background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+  background-image:      -o-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+  background-image:         linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+}
+.progress-bar-danger {
+  background-color: #d9534f;
+}
+.progress-striped .progress-bar-danger {
+  background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+  background-image:      -o-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+  background-image:         linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+}
+.media {
+  margin-top: 15px;
+}
+.media:first-child {
+  margin-top: 0;
+}
+.media,
+.media-body {
+  overflow: hidden;
+  zoom: 1;
+}
+.media-body {
+  width: 10000px;
+}
+.media-object {
+  display: block;
+}
+.media-object.img-thumbnail {
+  max-width: none;
+}
+.media-right,
+.media > .pull-right {
+  padding-left: 10px;
+}
+.media-left,
+.media > .pull-left {
+  padding-right: 10px;
+}
+.media-left,
+.media-right,
+.media-body {
+  display: table-cell;
+  vertical-align: top;
+}
+.media-middle {
+  vertical-align: middle;
+}
+.media-bottom {
+  vertical-align: bottom;
+}
+.media-heading {
+  margin-top: 0;
+  margin-bottom: 5px;
+}
+.media-list {
+  padding-left: 0;
+  list-style: none;
+}
+.list-group {
+  padding-left: 0;
+  margin-bottom: 20px;
+}
+.list-group-item {
+  position: relative;
+  display: block;
+  padding: 10px 15px;
+  margin-bottom: -1px;
+  background-color: #fff;
+  border: 1px solid #ddd;
+}
+.list-group-item:first-child {
+  border-top-left-radius: 4px;
+  border-top-right-radius: 4px;
+}
+.list-group-item:last-child {
+  margin-bottom: 0;
+  border-bottom-right-radius: 4px;
+  border-bottom-left-radius: 4px;
+}
+a.list-group-item,
+button.list-group-item {
+  color: #555;
+}
+a.list-group-item .list-group-item-heading,
+button.list-group-item .list-group-item-heading {
+  color: #333;
+}
+a.list-group-item:hover,
+button.list-group-item:hover,
+a.list-group-item:focus,
+button.list-group-item:focus {
+  color: #555;
+  text-decoration: none;
+  background-color: #f5f5f5;
+}
+button.list-group-item {
+  width: 100%;
+  text-align: left;
+}
+.list-group-item.disabled,
+.list-group-item.disabled:hover,
+.list-group-item.disabled:focus {
+  color: #777;
+  cursor: not-allowed;
+  background-color: #eee;
+}
+.list-group-item.disabled .list-group-item-heading,
+.list-group-item.disabled:hover .list-group-item-heading,
+.list-group-item.disabled:focus .list-group-item-heading {
+  color: inherit;
+}
+.list-group-item.disabled .list-group-item-text,
+.list-group-item.disabled:hover .list-group-item-text,
+.list-group-item.disabled:focus .list-group-item-text {
+  color: #777;
+}
+.list-group-item.active,
+.list-group-item.active:hover,
+.list-group-item.active:focus {
+  z-index: 2;
+  color: #fff;
+  background-color: #337ab7;
+  border-color: #337ab7;
+}
+.list-group-item.active .list-group-item-heading,
+.list-group-item.active:hover .list-group-item-heading,
+.list-group-item.active:focus .list-group-item-heading,
+.list-group-item.active .list-group-item-heading > small,
+.list-group-item.active:hover .list-group-item-heading > small,
+.list-group-item.active:focus .list-group-item-heading > small,
+.list-group-item.active .list-group-item-heading > .small,
+.list-group-item.active:hover .list-group-item-heading > .small,
+.list-group-item.active:focus .list-group-item-heading > .small {
+  color: inherit;
+}
+.list-group-item.active .list-group-item-text,
+.list-group-item.active:hover .list-group-item-text,
+.list-group-item.active:focus .list-group-item-text {
+  color: #c7ddef;
+}
+.list-group-item-success {
+  color: #3c763d;
+  background-color: #dff0d8;
+}
+a.list-group-item-success,
+button.list-group-item-success {
+  color: #3c763d;
+}
+a.list-group-item-success .list-group-item-heading,
+button.list-group-item-success .list-group-item-heading {
+  color: inherit;
+}
+a.list-group-item-success:hover,
+button.list-group-item-success:hover,
+a.list-group-item-success:focus,
+button.list-group-item-success:focus {
+  color: #3c763d;
+  background-color: #d0e9c6;
+}
+a.list-group-item-success.active,
+button.list-group-item-success.active,
+a.list-group-item-success.active:hover,
+button.list-group-item-success.active:hover,
+a.list-group-item-success.active:focus,
+button.list-group-item-success.active:focus {
+  color: #fff;
+  background-color: #3c763d;
+  border-color: #3c763d;
+}
+.list-group-item-info {
+  color: #31708f;
+  background-color: #d9edf7;
+}
+a.list-group-item-info,
+button.list-group-item-info {
+  color: #31708f;
+}
+a.list-group-item-info .list-group-item-heading,
+button.list-group-item-info .list-group-item-heading {
+  color: inherit;
+}
+a.list-group-item-info:hover,
+button.list-group-item-info:hover,
+a.list-group-item-info:focus,
+button.list-group-item-info:focus {
+  color: #31708f;
+  background-color: #c4e3f3;
+}
+a.list-group-item-info.active,
+button.list-group-item-info.active,
+a.list-group-item-info.active:hover,
+button.list-group-item-info.active:hover,
+a.list-group-item-info.active:focus,
+button.list-group-item-info.active:focus {
+  color: #fff;
+  background-color: #31708f;
+  border-color: #31708f;
+}
+.list-group-item-warning {
+  color: #8a6d3b;
+  background-color: #fcf8e3;
+}
+a.list-group-item-warning,
+button.list-group-item-warning {
+  color: #8a6d3b;
+}
+a.list-group-item-warning .list-group-item-heading,
+button.list-group-item-warning .list-group-item-heading {
+  color: inherit;
+}
+a.list-group-item-warning:hover,
+button.list-group-item-warning:hover,
+a.list-group-item-warning:focus,
+button.list-group-item-warning:focus {
+  color: #8a6d3b;
+  background-color: #faf2cc;
+}
+a.list-group-item-warning.active,
+button.list-group-item-warning.active,
+a.list-group-item-warning.active:hover,
+button.list-group-item-warning.active:hover,
+a.list-group-item-warning.active:focus,
+button.list-group-item-warning.active:focus {
+  color: #fff;
+  background-color: #8a6d3b;
+  border-color: #8a6d3b;
+}
+.list-group-item-danger {
+  color: #a94442;
+  background-color: #f2dede;
+}
+a.list-group-item-danger,
+button.list-group-item-danger {
+  color: #a94442;
+}
+a.list-group-item-danger .list-group-item-heading,
+button.list-group-item-danger .list-group-item-heading {
+  color: inherit;
+}
+a.list-group-item-danger:hover,
+button.list-group-item-danger:hover,
+a.list-group-item-danger:focus,
+button.list-group-item-danger:focus {
+  color: #a94442;
+  background-color: #ebcccc;
+}
+a.list-group-item-danger.active,
+button.list-group-item-danger.active,
+a.list-group-item-danger.active:hover,
+button.list-group-item-danger.active:hover,
+a.list-group-item-danger.active:focus,
+button.list-group-item-danger.active:focus {
+  color: #fff;
+  background-color: #a94442;
+  border-color: #a94442;
+}
+.list-group-item-heading {
+  margin-top: 0;
+  margin-bottom: 5px;
+}
+.list-group-item-text {
+  margin-bottom: 0;
+  line-height: 1.3;
+}
+.panel {
+  margin-bottom: 20px;
+  background-color: #fff;
+  border: 1px solid transparent;
+  border-radius: 4px;
+  -webkit-box-shadow: 0 1px 1px rgba(0, 0, 0, .05);
+          box-shadow: 0 1px 1px rgba(0, 0, 0, .05);
+}
+.panel-body {
+  padding: 15px;
+}
+.panel-heading {
+  padding: 10px 15px;
+  border-bottom: 1px solid transparent;
+  border-top-left-radius: 3px;
+  border-top-right-radius: 3px;
+}
+.panel-heading > .dropdown .dropdown-toggle {
+  color: inherit;
+}
+.panel-title {
+  margin-top: 0;
+  margin-bottom: 0;
+  font-size: 16px;
+  color: inherit;
+}
+.panel-title > a,
+.panel-title > small,
+.panel-title > .small,
+.panel-title > small > a,
+.panel-title > .small > a {
+  color: inherit;
+}
+.panel-footer {
+  padding: 10px 15px;
+  background-color: #f5f5f5;
+  border-top: 1px solid #ddd;
+  border-bottom-right-radius: 3px;
+  border-bottom-left-radius: 3px;
+}
+.panel > .list-group,
+.panel > .panel-collapse > .list-group {
+  margin-bottom: 0;
+}
+.panel > .list-group .list-group-item,
+.panel > .panel-collapse > .list-group .list-group-item {
+  border-width: 1px 0;
+  border-radius: 0;
+}
+.panel > .list-group:first-child .list-group-item:first-child,
+.panel > .panel-collapse > .list-group:first-child .list-group-item:first-child {
+  border-top: 0;
+  border-top-left-radius: 3px;
+  border-top-right-radius: 3px;
+}
+.panel > .list-group:last-child .list-group-item:last-child,
+.panel > .panel-collapse > .list-group:last-child .list-group-item:last-child {
+  border-bottom: 0;
+  border-bottom-right-radius: 3px;
+  border-bottom-left-radius: 3px;
+}
+.panel > .panel-heading + .panel-collapse > .list-group .list-group-item:first-child {
+  border-top-left-radius: 0;
+  border-top-right-radius: 0;
+}
+.panel-heading + .list-group .list-group-item:first-child {
+  border-top-width: 0;
+}
+.list-group + .panel-footer {
+  border-top-width: 0;
+}
+.panel > .table,
+.panel > .table-responsive > .table,
+.panel > .panel-collapse > .table {
+  margin-bottom: 0;
+}
+.panel > .table caption,
+.panel > .table-responsive > .table caption,
+.panel > .panel-collapse > .table caption {
+  padding-right: 15px;
+  padding-left: 15px;
+}
+.panel > .table:first-child,
+.panel > .table-responsive:first-child > .table:first-child {
+  border-top-left-radius: 3px;
+  border-top-right-radius: 3px;
+}
+.panel > .table:first-child > thead:first-child > tr:first-child,
+.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child,
+.panel > .table:first-child > tbody:first-child > tr:first-child,
+.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child {
+  border-top-left-radius: 3px;
+  border-top-right-radius: 3px;
+}
+.panel > .table:first-child > thead:first-child > tr:first-child td:first-child,
+.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child td:first-child,
+.panel > .table:first-child > tbody:first-child > tr:first-child td:first-child,
+.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child td:first-child,
+.panel > .table:first-child > thead:first-child > tr:first-child th:first-child,
+.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child th:first-child,
+.panel > .table:first-child > tbody:first-child > tr:first-child th:first-child,
+.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child th:first-child {
+  border-top-left-radius: 3px;
+}
+.panel > .table:first-child > thead:first-child > tr:first-child td:last-child,
+.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child td:last-child,
+.panel > .table:first-child > tbody:first-child > tr:first-child td:last-child,
+.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child td:last-child,
+.panel > .table:first-child > thead:first-child > tr:first-child th:last-child,
+.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child th:last-child,
+.panel > .table:first-child > tbody:first-child > tr:first-child th:last-child,
+.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child th:last-child {
+  border-top-right-radius: 3px;
+}
+.panel > .table:last-child,
+.panel > .table-responsive:last-child > .table:last-child {
+  border-bottom-right-radius: 3px;
+  border-bottom-left-radius: 3px;
+}
+.panel > .table:last-child > tbody:last-child > tr:last-child,
+.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child,
+.panel > .table:last-child > tfoot:last-child > tr:last-child,
+.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child {
+  border-bottom-right-radius: 3px;
+  border-bottom-left-radius: 3px;
+}
+.panel > .table:last-child > tbody:last-child > tr:last-child td:first-child,
+.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child td:first-child,
+.panel > .table:last-child > tfoot:last-child > tr:last-child td:first-child,
+.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child td:first-child,
+.panel > .table:last-child > tbody:last-child > tr:last-child th:first-child,
+.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child th:first-child,
+.panel > .table:last-child > tfoot:last-child > tr:last-child th:first-child,
+.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child th:first-child {
+  border-bottom-left-radius: 3px;
+}
+.panel > .table:last-child > tbody:last-child > tr:last-child td:last-child,
+.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child td:last-child,
+.panel > .table:last-child > tfoot:last-child > tr:last-child td:last-child,
+.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child td:last-child,
+.panel > .table:last-child > tbody:last-child > tr:last-child th:last-child,
+.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child th:last-child,
+.panel > .table:last-child > tfoot:last-child > tr:last-child th:last-child,
+.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child th:last-child {
+  border-bottom-right-radius: 3px;
+}
+.panel > .panel-body + .table,
+.panel > .panel-body + .table-responsive,
+.panel > .table + .panel-body,
+.panel > .table-responsive + .panel-body {
+  border-top: 1px solid #ddd;
+}
+.panel > .table > tbody:first-child > tr:first-child th,
+.panel > .table > tbody:first-child > tr:first-child td {
+  border-top: 0;
+}
+.panel > .table-bordered,
+.panel > .table-responsive > .table-bordered {
+  border: 0;
+}
+.panel > .table-bordered > thead > tr > th:first-child,
+.panel > .table-responsive > .table-bordered > thead > tr > th:first-child,
+.panel > .table-bordered > tbody > tr > th:first-child,
+.panel > .table-responsive > .table-bordered > tbody > tr > th:first-child,
+.panel > .table-bordered > tfoot > tr > th:first-child,
+.panel > .table-responsive > .table-bordered > tfoot > tr > th:first-child,
+.panel > .table-bordered > thead > tr > td:first-child,
+.panel > .table-responsive > .table-bordered > thead > tr > td:first-child,
+.panel > .table-bordered > tbody > tr > td:first-child,
+.panel > .table-responsive > .table-bordered > tbody > tr > td:first-child,
+.panel > .table-bordered > tfoot > tr > td:first-child,
+.panel > .table-responsive > .table-bordered > tfoot > tr > td:first-child {
+  border-left: 0;
+}
+.panel > .table-bordered > thead > tr > th:last-child,
+.panel > .table-responsive > .table-bordered > thead > tr > th:last-child,
+.panel > .table-bordered > tbody > tr > th:last-child,
+.panel > .table-responsive > .table-bordered > tbody > tr > th:last-child,
+.panel > .table-bordered > tfoot > tr > th:last-child,
+.panel > .table-responsive > .table-bordered > tfoot > tr > th:last-child,
+.panel > .table-bordered > thead > tr > td:last-child,
+.panel > .table-responsive > .table-bordered > thead > tr > td:last-child,
+.panel > .table-bordered > tbody > tr > td:last-child,
+.panel > .table-responsive > .table-bordered > tbody > tr > td:last-child,
+.panel > .table-bordered > tfoot > tr > td:last-child,
+.panel > .table-responsive > .table-bordered > tfoot > tr > td:last-child {
+  border-right: 0;
+}
+.panel > .table-bordered > thead > tr:first-child > td,
+.panel > .table-responsive > .table-bordered > thead > tr:first-child > td,
+.panel > .table-bordered > tbody > tr:first-child > td,
+.panel > .table-responsive > .table-bordered > tbody > tr:first-child > td,
+.panel > .table-bordered > thead > tr:first-child > th,
+.panel > .table-responsive > .table-bordered > thead > tr:first-child > th,
+.panel > .table-bordered > tbody > tr:first-child > th,
+.panel > .table-responsive > .table-bordered > tbody > tr:first-child > th {
+  border-bottom: 0;
+}
+.panel > .table-bordered > tbody > tr:last-child > td,
+.panel > .table-responsive > .table-bordered > tbody > tr:last-child > td,
+.panel > .table-bordered > tfoot > tr:last-child > td,
+.panel > .table-responsive > .table-bordered > tfoot > tr:last-child > td,
+.panel > .table-bordered > tbody > tr:last-child > th,
+.panel > .table-responsive > .table-bordered > tbody > tr:last-child > th,
+.panel > .table-bordered > tfoot > tr:last-child > th,
+.panel > .table-responsive > .table-bordered > tfoot > tr:last-child > th {
+  border-bottom: 0;
+}
+.panel > .table-responsive {
+  margin-bottom: 0;
+  border: 0;
+}
+.panel-group {
+  margin-bottom: 20px;
+}
+.panel-group .panel {
+  margin-bottom: 0;
+  border-radius: 4px;
+}
+.panel-group .panel + .panel {
+  margin-top: 5px;
+}
+.panel-group .panel-heading {
+  border-bottom: 0;
+}
+.panel-group .panel-heading + .panel-collapse > .panel-body,
+.panel-group .panel-heading + .panel-collapse > .list-group {
+  border-top: 1px solid #ddd;
+}
+.panel-group .panel-footer {
+  border-top: 0;
+}
+.panel-group .panel-footer + .panel-collapse .panel-body {
+  border-bottom: 1px solid #ddd;
+}
+.panel-default {
+  border-color: #ddd;
+}
+.panel-default > .panel-heading {
+  color: #333;
+  background-color: #f5f5f5;
+  border-color: #ddd;
+}
+.panel-default > .panel-heading + .panel-collapse > .panel-body {
+  border-top-color: #ddd;
+}
+.panel-default > .panel-heading .badge {
+  color: #f5f5f5;
+  background-color: #333;
+}
+.panel-default > .panel-footer + .panel-collapse > .panel-body {
+  border-bottom-color: #ddd;
+}
+.panel-primary {
+  border-color: #337ab7;
+}
+.panel-primary > .panel-heading {
+  color: #fff;
+  background-color: #337ab7;
+  border-color: #337ab7;
+}
+.panel-primary > .panel-heading + .panel-collapse > .panel-body {
+  border-top-color: #337ab7;
+}
+.panel-primary > .panel-heading .badge {
+  color: #337ab7;
+  background-color: #fff;
+}
+.panel-primary > .panel-footer + .panel-collapse > .panel-body {
+  border-bottom-color: #337ab7;
+}
+.panel-success {
+  border-color: #d6e9c6;
+}
+.panel-success > .panel-heading {
+  color: #3c763d;
+  background-color: #dff0d8;
+  border-color: #d6e9c6;
+}
+.panel-success > .panel-heading + .panel-collapse > .panel-body {
+  border-top-color: #d6e9c6;
+}
+.panel-success > .panel-heading .badge {
+  color: #dff0d8;
+  background-color: #3c763d;
+}
+.panel-success > .panel-footer + .panel-collapse > .panel-body {
+  border-bottom-color: #d6e9c6;
+}
+.panel-info {
+  border-color: #bce8f1;
+}
+.panel-info > .panel-heading {
+  color: #31708f;
+  background-color: #d9edf7;
+  border-color: #bce8f1;
+}
+.panel-info > .panel-heading + .panel-collapse > .panel-body {
+  border-top-color: #bce8f1;
+}
+.panel-info > .panel-heading .badge {
+  color: #d9edf7;
+  background-color: #31708f;
+}
+.panel-info > .panel-footer + .panel-collapse > .panel-body {
+  border-bottom-color: #bce8f1;
+}
+.panel-warning {
+  border-color: #faebcc;
+}
+.panel-warning > .panel-heading {
+  color: #8a6d3b;
+  background-color: #fcf8e3;
+  border-color: #faebcc;
+}
+.panel-warning > .panel-heading + .panel-collapse > .panel-body {
+  border-top-color: #faebcc;
+}
+.panel-warning > .panel-heading .badge {
+  color: #fcf8e3;
+  background-color: #8a6d3b;
+}
+.panel-warning > .panel-footer + .panel-collapse > .panel-body {
+  border-bottom-color: #faebcc;
+}
+.panel-danger {
+  border-color: #ebccd1;
+}
+.panel-danger > .panel-heading {
+  color: #a94442;
+  background-color: #f2dede;
+  border-color: #ebccd1;
+}
+.panel-danger > .panel-heading + .panel-collapse > .panel-body {
+  border-top-color: #ebccd1;
+}
+.panel-danger > .panel-heading .badge {
+  color: #f2dede;
+  background-color: #a94442;
+}
+.panel-danger > .panel-footer + .panel-collapse > .panel-body {
+  border-bottom-color: #ebccd1;
+}
+.embed-responsive {
+  position: relative;
+  display: block;
+  height: 0;
+  padding: 0;
+  overflow: hidden;
+}
+.embed-responsive .embed-responsive-item,
+.embed-responsive iframe,
+.embed-responsive embed,
+.embed-responsive object,
+.embed-responsive video {
+  position: absolute;
+  top: 0;
+  bottom: 0;
+  left: 0;
+  width: 100%;
+  height: 100%;
+  border: 0;
+}
+.embed-responsive-16by9 {
+  padding-bottom: 56.25%;
+}
+.embed-responsive-4by3 {
+  padding-bottom: 75%;
+}
+.well {
+  min-height: 20px;
+  padding: 19px;
+  margin-bottom: 20px;
+  background-color: #f5f5f5;
+  border: 1px solid #e3e3e3;
+  border-radius: 4px;
+  -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, .05);
+          box-shadow: inset 0 1px 1px rgba(0, 0, 0, .05);
+}
+.well blockquote {
+  border-color: #ddd;
+  border-color: rgba(0, 0, 0, .15);
+}
+.well-lg {
+  padding: 24px;
+  border-radius: 6px;
+}
+.well-sm {
+  padding: 9px;
+  border-radius: 3px;
+}
+.close {
+  float: right;
+  font-size: 21px;
+  font-weight: bold;
+  line-height: 1;
+  color: #000;
+  text-shadow: 0 1px 0 #fff;
+  filter: alpha(opacity=20);
+  opacity: .2;
+}
+.close:hover,
+.close:focus {
+  color: #000;
+  text-decoration: none;
+  cursor: pointer;
+  filter: alpha(opacity=50);
+  opacity: .5;
+}
+button.close {
+  -webkit-appearance: none;
+  padding: 0;
+  cursor: pointer;
+  background: transparent;
+  border: 0;
+}
+.modal-open {
+  overflow: hidden;
+}
+.modal {
+  position: fixed;
+  top: 0;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  z-index: 1050;
+  display: none;
+  overflow: hidden;
+  -webkit-overflow-scrolling: touch;
+  outline: 0;
+}
+.modal.fade .modal-dialog {
+  -webkit-transition: -webkit-transform .3s ease-out;
+       -o-transition:      -o-transform .3s ease-out;
+          transition:         transform .3s ease-out;
+  -webkit-transform: translate(0, -25%);
+      -ms-transform: translate(0, -25%);
+       -o-transform: translate(0, -25%);
+          transform: translate(0, -25%);
+}
+.modal.in .modal-dialog {
+  -webkit-transform: translate(0, 0);
+      -ms-transform: translate(0, 0);
+       -o-transform: translate(0, 0);
+          transform: translate(0, 0);
+}
+.modal-open .modal {
+  overflow-x: hidden;
+  overflow-y: auto;
+}
+.modal-dialog {
+  position: relative;
+  width: auto;
+  margin: 10px;
+}
+.modal-content {
+  position: relative;
+  background-color: #fff;
+  -webkit-background-clip: padding-box;
+          background-clip: padding-box;
+  border: 1px solid #999;
+  border: 1px solid rgba(0, 0, 0, .2);
+  border-radius: 6px;
+  outline: 0;
+  -webkit-box-shadow: 0 3px 9px rgba(0, 0, 0, .5);
+          box-shadow: 0 3px 9px rgba(0, 0, 0, .5);
+}
+.modal-backdrop {
+  position: fixed;
+  top: 0;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  z-index: 1040;
+  background-color: #000;
+}
+.modal-backdrop.fade {
+  filter: alpha(opacity=0);
+  opacity: 0;
+}
+.modal-backdrop.in {
+  filter: alpha(opacity=50);
+  opacity: .5;
+}
+.modal-header {
+  padding: 15px;
+  border-bottom: 1px solid #e5e5e5;
+}
+.modal-header .close {
+  margin-top: -2px;
+}
+.modal-title {
+  margin: 0;
+  line-height: 1.42857143;
+}
+.modal-body {
+  position: relative;
+  padding: 15px;
+}
+.modal-footer {
+  padding: 15px;
+  text-align: right;
+  border-top: 1px solid #e5e5e5;
+}
+.modal-footer .btn + .btn {
+  margin-bottom: 0;
+  margin-left: 5px;
+}
+.modal-footer .btn-group .btn + .btn {
+  margin-left: -1px;
+}
+.modal-footer .btn-block + .btn-block {
+  margin-left: 0;
+}
+.modal-scrollbar-measure {
+  position: absolute;
+  top: -9999px;
+  width: 50px;
+  height: 50px;
+  overflow: scroll;
+}
+@media (min-width: 768px) {
+  .modal-dialog {
+    width: 600px;
+    margin: 30px auto;
   }
-  .col-lg-offset-7 {
-    margin-left: 58.33333333%;
+  .modal-content {
+    -webkit-box-shadow: 0 5px 15px rgba(0, 0, 0, .5);
+            box-shadow: 0 5px 15px rgba(0, 0, 0, .5);
   }
-  .col-lg-offset-6 {
-    margin-left: 50%;
+  .modal-sm {
+    width: 300px;
   }
-  .col-lg-offset-5 {
-    margin-left: 41.66666667%;
+}
+@media (min-width: 992px) {
+  .modal-lg {
+    width: 900px;
   }
-  .col-lg-offset-4 {
-    margin-left: 33.33333333%;
+}
+.tooltip {
+  position: absolute;
+  z-index: 1070;
+  display: block;
+  font-family: "Helvetica Neue", Helvetica, Arial, sans-serif;
+  font-size: 12px;
+  font-style: normal;
+  font-weight: normal;
+  line-height: 1.42857143;
+  text-align: left;
+  text-align: start;
+  text-decoration: none;
+  text-shadow: none;
+  text-transform: none;
+  letter-spacing: normal;
+  word-break: normal;
+  word-spacing: normal;
+  word-wrap: normal;
+  white-space: normal;
+  filter: alpha(opacity=0);
+  opacity: 0;
+
+  line-break: auto;
+}
+.tooltip.in {
+  filter: alpha(opacity=90);
+  opacity: .9;
+}
+.tooltip.top {
+  padding: 5px 0;
+  margin-top: -3px;
+}
+.tooltip.right {
+  padding: 0 5px;
+  margin-left: 3px;
+}
+.tooltip.bottom {
+  padding: 5px 0;
+  margin-top: 3px;
+}
+.tooltip.left {
+  padding: 0 5px;
+  margin-left: -3px;
+}
+.tooltip-inner {
+  max-width: 200px;
+  padding: 3px 8px;
+  color: #fff;
+  text-align: center;
+  background-color: #000;
+  border-radius: 4px;
+}
+.tooltip-arrow {
+  position: absolute;
+  width: 0;
+  height: 0;
+  border-color: transparent;
+  border-style: solid;
+}
+.tooltip.top .tooltip-arrow {
+  bottom: 0;
+  left: 50%;
+  margin-left: -5px;
+  border-width: 5px 5px 0;
+  border-top-color: #000;
+}
+.tooltip.top-left .tooltip-arrow {
+  right: 5px;
+  bottom: 0;
+  margin-bottom: -5px;
+  border-width: 5px 5px 0;
+  border-top-color: #000;
+}
+.tooltip.top-right .tooltip-arrow {
+  bottom: 0;
+  left: 5px;
+  margin-bottom: -5px;
+  border-width: 5px 5px 0;
+  border-top-color: #000;
+}
+.tooltip.right .tooltip-arrow {
+  top: 50%;
+  left: 0;
+  margin-top: -5px;
+  border-width: 5px 5px 5px 0;
+  border-right-color: #000;
+}
+.tooltip.left .tooltip-arrow {
+  top: 50%;
+  right: 0;
+  margin-top: -5px;
+  border-width: 5px 0 5px 5px;
+  border-left-color: #000;
+}
+.tooltip.bottom .tooltip-arrow {
+  top: 0;
+  left: 50%;
+  margin-left: -5px;
+  border-width: 0 5px 5px;
+  border-bottom-color: #000;
+}
+.tooltip.bottom-left .tooltip-arrow {
+  top: 0;
+  right: 5px;
+  margin-top: -5px;
+  border-width: 0 5px 5px;
+  border-bottom-color: #000;
+}
+.tooltip.bottom-right .tooltip-arrow {
+  top: 0;
+  left: 5px;
+  margin-top: -5px;
+  border-width: 0 5px 5px;
+  border-bottom-color: #000;
+}
+.popover {
+  position: absolute;
+  top: 0;
+  left: 0;
+  z-index: 1060;
+  display: none;
+  max-width: 276px;
+  padding: 1px;
+  font-family: "Helvetica Neue", Helvetica, Arial, sans-serif;
+  font-size: 14px;
+  font-style: normal;
+  font-weight: normal;
+  line-height: 1.42857143;
+  text-align: left;
+  text-align: start;
+  text-decoration: none;
+  text-shadow: none;
+  text-transform: none;
+  letter-spacing: normal;
+  word-break: normal;
+  word-spacing: normal;
+  word-wrap: normal;
+  white-space: normal;
+  background-color: #fff;
+  -webkit-background-clip: padding-box;
+          background-clip: padding-box;
+  border: 1px solid #ccc;
+  border: 1px solid rgba(0, 0, 0, .2);
+  border-radius: 6px;
+  -webkit-box-shadow: 0 5px 10px rgba(0, 0, 0, .2);
+          box-shadow: 0 5px 10px rgba(0, 0, 0, .2);
+
+  line-break: auto;
+}
+.popover.top {
+  margin-top: -10px;
+}
+.popover.right {
+  margin-left: 10px;
+}
+.popover.bottom {
+  margin-top: 10px;
+}
+.popover.left {
+  margin-left: -10px;
+}
+.popover-title {
+  padding: 8px 14px;
+  margin: 0;
+  font-size: 14px;
+  background-color: #f7f7f7;
+  border-bottom: 1px solid #ebebeb;
+  border-radius: 5px 5px 0 0;
+}
+.popover-content {
+  padding: 9px 14px;
+}
+.popover > .arrow,
+.popover > .arrow:after {
+  position: absolute;
+  display: block;
+  width: 0;
+  height: 0;
+  border-color: transparent;
+  border-style: solid;
+}
+.popover > .arrow {
+  border-width: 11px;
+}
+.popover > .arrow:after {
+  content: "";
+  border-width: 10px;
+}
+.popover.top > .arrow {
+  bottom: -11px;
+  left: 50%;
+  margin-left: -11px;
+  border-top-color: #999;
+  border-top-color: rgba(0, 0, 0, .25);
+  border-bottom-width: 0;
+}
+.popover.top > .arrow:after {
+  bottom: 1px;
+  margin-left: -10px;
+  content: " ";
+  border-top-color: #fff;
+  border-bottom-width: 0;
+}
+.popover.right > .arrow {
+  top: 50%;
+  left: -11px;
+  margin-top: -11px;
+  border-right-color: #999;
+  border-right-color: rgba(0, 0, 0, .25);
+  border-left-width: 0;
+}
+.popover.right > .arrow:after {
+  bottom: -10px;
+  left: 1px;
+  content: " ";
+  border-right-color: #fff;
+  border-left-width: 0;
+}
+.popover.bottom > .arrow {
+  top: -11px;
+  left: 50%;
+  margin-left: -11px;
+  border-top-width: 0;
+  border-bottom-color: #999;
+  border-bottom-color: rgba(0, 0, 0, .25);
+}
+.popover.bottom > .arrow:after {
+  top: 1px;
+  margin-left: -10px;
+  content: " ";
+  border-top-width: 0;
+  border-bottom-color: #fff;
+}
+.popover.left > .arrow {
+  top: 50%;
+  right: -11px;
+  margin-top: -11px;
+  border-right-width: 0;
+  border-left-color: #999;
+  border-left-color: rgba(0, 0, 0, .25);
+}
+.popover.left > .arrow:after {
+  right: 1px;
+  bottom: -10px;
+  content: " ";
+  border-right-width: 0;
+  border-left-color: #fff;
+}
+.carousel {
+  position: relative;
+}
+.carousel-inner {
+  position: relative;
+  width: 100%;
+  overflow: hidden;
+}
+.carousel-inner > .item {
+  position: relative;
+  display: none;
+  -webkit-transition: .6s ease-in-out left;
+       -o-transition: .6s ease-in-out left;
+          transition: .6s ease-in-out left;
+}
+.carousel-inner > .item > img,
+.carousel-inner > .item > a > img {
+  line-height: 1;
+}
+@media all and (transform-3d), (-webkit-transform-3d) {
+  .carousel-inner > .item {
+    -webkit-transition: -webkit-transform .6s ease-in-out;
+         -o-transition:      -o-transform .6s ease-in-out;
+            transition:         transform .6s ease-in-out;
+
+    -webkit-backface-visibility: hidden;
+            backface-visibility: hidden;
+    -webkit-perspective: 1000px;
+            perspective: 1000px;
+  }
+  .carousel-inner > .item.next,
+  .carousel-inner > .item.active.right {
+    left: 0;
+    -webkit-transform: translate3d(100%, 0, 0);
+            transform: translate3d(100%, 0, 0);
+  }
+  .carousel-inner > .item.prev,
+  .carousel-inner > .item.active.left {
+    left: 0;
+    -webkit-transform: translate3d(-100%, 0, 0);
+            transform: translate3d(-100%, 0, 0);
+  }
+  .carousel-inner > .item.next.left,
+  .carousel-inner > .item.prev.right,
+  .carousel-inner > .item.active {
+    left: 0;
+    -webkit-transform: translate3d(0, 0, 0);
+            transform: translate3d(0, 0, 0);
+  }
+}
+.carousel-inner > .active,
+.carousel-inner > .next,
+.carousel-inner > .prev {
+  display: block;
+}
+.carousel-inner > .active {
+  left: 0;
+}
+.carousel-inner > .next,
+.carousel-inner > .prev {
+  position: absolute;
+  top: 0;
+  width: 100%;
+}
+.carousel-inner > .next {
+  left: 100%;
+}
+.carousel-inner > .prev {
+  left: -100%;
+}
+.carousel-inner > .next.left,
+.carousel-inner > .prev.right {
+  left: 0;
+}
+.carousel-inner > .active.left {
+  left: -100%;
+}
+.carousel-inner > .active.right {
+  left: 100%;
+}
+.carousel-control {
+  position: absolute;
+  top: 0;
+  bottom: 0;
+  left: 0;
+  width: 15%;
+  font-size: 20px;
+  color: #fff;
+  text-align: center;
+  text-shadow: 0 1px 2px rgba(0, 0, 0, .6);
+  background-color: rgba(0, 0, 0, 0);
+  filter: alpha(opacity=50);
+  opacity: .5;
+}
+.carousel-control.left {
+  background-image: -webkit-linear-gradient(left, rgba(0, 0, 0, .5) 0%, rgba(0, 0, 0, .0001) 100%);
+  background-image:      -o-linear-gradient(left, rgba(0, 0, 0, .5) 0%, rgba(0, 0, 0, .0001) 100%);
+  background-image: -webkit-gradient(linear, left top, right top, from(rgba(0, 0, 0, .5)), to(rgba(0, 0, 0, .0001)));
+  background-image:         linear-gradient(to right, rgba(0, 0, 0, .5) 0%, rgba(0, 0, 0, .0001) 100%);
+  filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#80000000', endColorstr='#00000000', GradientType=1);
+  background-repeat: repeat-x;
+}
+.carousel-control.right {
+  right: 0;
+  left: auto;
+  background-image: -webkit-linear-gradient(left, rgba(0, 0, 0, .0001) 0%, rgba(0, 0, 0, .5) 100%);
+  background-image:      -o-linear-gradient(left, rgba(0, 0, 0, .0001) 0%, rgba(0, 0, 0, .5) 100%);
+  background-image: -webkit-gradient(linear, left top, right top, from(rgba(0, 0, 0, .0001)), to(rgba(0, 0, 0, .5)));
+  background-image:         linear-gradient(to right, rgba(0, 0, 0, .0001) 0%, rgba(0, 0, 0, .5) 100%);
+  filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#00000000', endColorstr='#80000000', GradientType=1);
+  background-repeat: repeat-x;
+}
+.carousel-control:hover,
+.carousel-control:focus {
+  color: #fff;
+  text-decoration: none;
+  filter: alpha(opacity=90);
+  outline: 0;
+  opacity: .9;
+}
+.carousel-control .icon-prev,
+.carousel-control .icon-next,
+.carousel-control .glyphicon-chevron-left,
+.carousel-control .glyphicon-chevron-right {
+  position: absolute;
+  top: 50%;
+  z-index: 5;
+  display: inline-block;
+  margin-top: -10px;
+}
+.carousel-control .icon-prev,
+.carousel-control .glyphicon-chevron-left {
+  left: 50%;
+  margin-left: -10px;
+}
+.carousel-control .icon-next,
+.carousel-control .glyphicon-chevron-right {
+  right: 50%;
+  margin-right: -10px;
+}
+.carousel-control .icon-prev,
+.carousel-control .icon-next {
+  width: 20px;
+  height: 20px;
+  font-family: serif;
+  line-height: 1;
+}
+.carousel-control .icon-prev:before {
+  content: '\2039';
+}
+.carousel-control .icon-next:before {
+  content: '\203a';
+}
+.carousel-indicators {
+  position: absolute;
+  bottom: 10px;
+  left: 50%;
+  z-index: 15;
+  width: 60%;
+  padding-left: 0;
+  margin-left: -30%;
+  text-align: center;
+  list-style: none;
+}
+.carousel-indicators li {
+  display: inline-block;
+  width: 10px;
+  height: 10px;
+  margin: 1px;
+  text-indent: -999px;
+  cursor: pointer;
+  background-color: #000 \9;
+  background-color: rgba(0, 0, 0, 0);
+  border: 1px solid #fff;
+  border-radius: 10px;
+}
+.carousel-indicators .active {
+  width: 12px;
+  height: 12px;
+  margin: 0;
+  background-color: #fff;
+}
+.carousel-caption {
+  position: absolute;
+  right: 15%;
+  bottom: 20px;
+  left: 15%;
+  z-index: 10;
+  padding-top: 20px;
+  padding-bottom: 20px;
+  color: #fff;
+  text-align: center;
+  text-shadow: 0 1px 2px rgba(0, 0, 0, .6);
+}
+.carousel-caption .btn {
+  text-shadow: none;
+}
+@media screen and (min-width: 768px) {
+  .carousel-control .glyphicon-chevron-left,
+  .carousel-control .glyphicon-chevron-right,
+  .carousel-control .icon-prev,
+  .carousel-control .icon-next {
+    width: 30px;
+    height: 30px;
+    margin-top: -10px;
+    font-size: 30px;
   }
-  .col-lg-offset-3 {
-    margin-left: 25%;
+  .carousel-control .glyphicon-chevron-left,
+  .carousel-control .icon-prev {
+    margin-left: -10px;
   }
-  .col-lg-offset-2 {
-    margin-left: 16.66666667%;
+  .carousel-control .glyphicon-chevron-right,
+  .carousel-control .icon-next {
+    margin-right: -10px;
   }
-  .col-lg-offset-1 {
-    margin-left: 8.33333333%;
+  .carousel-caption {
+    right: 20%;
+    left: 20%;
+    padding-bottom: 30px;
   }
-  .col-lg-offset-0 {
-    margin-left: 0%;
+  .carousel-indicators {
+    bottom: 20px;
   }
 }
 .clearfix:before,
 .clearfix:after,
+.dl-horizontal dd:before,
+.dl-horizontal dd:after,
 .container:before,
 .container:after,
 .container-fluid:before,
 .container-fluid:after,
 .row:before,
-.row:after {
-  content: " ";
+.row:after,
+.form-horizontal .form-group:before,
+.form-horizontal .form-group:after,
+.btn-toolbar:before,
+.btn-toolbar:after,
+.btn-group-vertical > .btn-group:before,
+.btn-group-vertical > .btn-group:after,
+.nav:before,
+.nav:after,
+.navbar:before,
+.navbar:after,
+.navbar-header:before,
+.navbar-header:after,
+.navbar-collapse:before,
+.navbar-collapse:after,
+.pager:before,
+.pager:after,
+.panel-body:before,
+.panel-body:after,
+.modal-header:before,
+.modal-header:after,
+.modal-footer:before,
+.modal-footer:after {
   display: table;
+  content: " ";
 }
 .clearfix:after,
+.dl-horizontal dd:after,
 .container:after,
 .container-fluid:after,
-.row:after {
+.row:after,
+.form-horizontal .form-group:after,
+.btn-toolbar:after,
+.btn-group-vertical > .btn-group:after,
+.nav:after,
+.navbar:after,
+.navbar-header:after,
+.navbar-collapse:after,
+.pager:after,
+.panel-body:after,
+.modal-header:after,
+.modal-footer:after {
   clear: both;
 }
 .center-block {
   display: block;
-  margin-left: auto;
   margin-right: auto;
+  margin-left: auto;
 }
 .pull-right {
   float: right !important;
@@ -1297,3 +6754,4 @@ hr {
     display: none !important;
   }
 }
+/*# sourceMappingURL=bootstrap.css.map */
diff --git a/vnfcatalogue/VNF_Catalogue/public/stylesheets/search_projects.css b/vnfcatalogue/VNF_Catalogue/public/stylesheets/search_projects.css
new file mode 100644 (file)
index 0000000..8875f7f
--- /dev/null
@@ -0,0 +1,132 @@
+/*******************************************************************************
+ * Copyright (c) 2017 Kumar Rishabh and others.
+ *
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Apache License, Version 2.0
+ * which accompanies this distribution, and is available at
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *******************************************************************************/
+
+input[type="text"]:focus:not([readonly]) {
+  transition: all 0s !important;
+  border-radius: 5px;
+  border: 2px solid #333333;
+  box-shadow: 0 0 15px 1px rgba(0,0,0,0.50);
+  color: #333333;
+}
+.gray {
+  background: rgb(249,249,249);
+}
+.material-search-custom {
+  left : -30px;
+
+  padding-left: 10px;
+}
+.form-group-custom {
+  width : 400px;
+  position: relative;
+  float: right;
+  left: -40%;
+}
+.form-control-custom {
+  padding-top: 10px;
+  padding-left: 50px;
+}
+.card-shadow-custom {
+  box-shadow: 0 2px 3px 0 rgba(0,0,0,0.50);
+  border-bottom: 2px solid #8B19A2;
+}
+.row-custom {
+  width: 100%;
+  margin: 1em 1em 1em 1em;
+  padding-right: 20px;
+}
+.card-title-div-custom {
+  margin: 0.5em 0 0.5em 0;
+  text-align: left;
+  display: inline-block;
+}
+.card-title-span-custom {
+  margin: 0 0 0 2em;
+  display: inline-block;
+}
+.card-title-div-custom-right {
+  margin: 0.5em 0em 0.5em 0;
+  text-align: right;
+  display: inline-block;
+}
+.card-image-picture-custom {
+  margin: 1em 0em 0em 3.5em;
+  display: inline-block;
+}
+.collection .collection-item.active {
+  background-color: rgb(255,245,114);
+  text-decoration: none;
+  transition: none;
+}
+.collection a.collection-item:not(.active):hover {
+  background-color: rgb(255,245,114);
+  text-decoration: none;
+  transition: none;
+}
+.collection .collection-item {
+  padding: 1px 25px;
+  border-bottom: 0px;
+  transition: none;
+}
+.chip > a {
+  display: block;
+  text-decoration: none;
+  text-align: center;
+  display:inline-block;
+    font-size:13px;
+    font-weight:500;
+    color:rgba(0, 0, 0, 0.6) !important;
+    margin-right: 15px !important;
+    margin-left: 15px !important;
+    text-transform: none !important;
+}
+.chip > a:hover {
+  background-color: transparent;
+  text-decoration: none;
+  transition: none;
+}
+a.a-custom-more {
+  display: block;
+  text-decoration: none;
+  text-align: center;
+  display:inline-block;
+    font-size: 20px;
+    font-weight:500;
+    color:rgba(0, 0, 0, 0.6) !important;
+    margin-right: 15px !important;
+    text-transform: none !important;
+}
+a.a-custom-more:hover {
+  background-color: transparent;
+}
+.collection-custom {
+  margin: 0em 0em 0em 1em;
+}
+.card .row .card-action-custom {
+  margin-left: 20px;
+}
+.rating {
+  color: rgb(253,225,109) !important;
+}
+.filled-stars .star i {
+  color: rgb(253,225,109) !important;
+}
+.glyphicon-star-empty {
+  color: rgb(221,221,221);
+}
+.star {
+}
+span.glyphicon.glyphicon-search.form-control-feedback,
+    div.form-group-custom i.material-icons {
+      top: 0.5em;
+      left: 16.5em;
+      cursor:pointer;
+      z-index: 30;
+      position: absolute;
+}
index e9b3c2d..4769cfc 100644 (file)
@@ -6,6 +6,7 @@
  * which accompanies this distribution, and is available at
  * http://www.apache.org/licenses/LICENSE-2.0
  *******************************************************************************/
+
 @import url('https://fonts.googleapis.com/css?family=Muli:300,400,600,700,800');
 *
 {
@@ -39,15 +40,32 @@ header ul li
 }
 header .logo
 {
-  background: url(../../images/logo.png) no-repeat;
+  background: url(../images/logo.png) no-repeat;
   background-size: cover;
-  width: 155px;
+
+}
+header .brand-logo-extends
+{
+  background: url(../images/logo.png) no-repeat;
+  background-size: cover;
+  width: 154px;
   height: 34px;
-  display: inline-block;
-  margin-right: 20px;
+  margin-top: 11%;
+  margin-right: 0%;
+  padding: 0;
+  position: relative !important;
+  /*margin-right: 20px;
   margin-left: 0;
-  float: left;
+  float: left;*/
+  /*display: inline-block;
+  */
 }
+
+nav
+{
+  height: 10px;
+}
+
 header ul li.links
 {
   margin: 7px 10px 0 0;
@@ -66,32 +84,32 @@ header ul.navigation-right
   float: right;
   padding-top: 8px;
 }
-header ul.navigation-right li.signup > a
+header li.signup > a
 {
   border: 2px solid #333333;
   border-radius: 4px;
-  font-size: 13px;
+  font-size: 14px;
   font-weigt: 700;
-  padding: 9px 15px;
+  padding: 2px 10px;
 }
-header ul.navigation-right li.signin > a
+header li.signin > a
 {
   border-bottom: 2px solid #333333;
   font-size: 13px;
   font-weight: 700;
-  padding: 9px 2px;
+  padding: 0px 2px;
 }
-header ul.navigation-right li.option
+header li.option
 {
   font-weight: 800;
   padding: 0 10px;
 }
 header ul li > a:hover,
-header ul.navigation-right li.signin > a:hover,
-header ul.navigation-right li.signup > a:hover,
+header li.signin > a:hover,
+header li.signup > a:hover,
 header ul li > a:focus,
-header ul.navigation-right li.signin > a:focus,
-header ul.navigation-right li.signup > a:focus,
+header li.signin > a:focus,
+header li.signup > a:focus,
 .content ul.most-menu li a:hover,
 .content ul.most-menu li a:focus
 {
@@ -99,7 +117,7 @@ header ul.navigation-right li.signup > a:focus,
   cursor: pointer;
   color: #333333;
 }
-header ul.navigation-right li.signup > a:hover
+header li.signup > a:hover
 {
   background: #333333;
   color: #ffffff;
@@ -134,6 +152,24 @@ form.search-form input.search-input
   color: #333333;
   font-size: 22px;
 }
+input.search-input-rest
+{
+  font-weight: 400;
+  margin: 0px 0;
+  height: 30px;
+  padding: 10px 30px;
+    min-width: 90%;
+    max-width: 90%;
+  /*max-width: 500px;
+  */
+  border-radius: 5px;
+  border: 2px solid #333333;
+  box-shadow: 0 0 15px 1px rgba(0,0,0,0.50);
+  color: #333333;
+  font-size: 22px;
+}
+
+
 form.search-form button.search-button
 {
   padding: 18px 35px;
@@ -167,13 +203,13 @@ form.search-form input:-moz-placeholder
 {
   font-weight: 400;
   letter-spacing: 5px;
-  color: #333333;
+    color: #333333;
 }
 form.search-form input:-ms-input-placeholder
 {
   font-weight: 400;
   letter-spacing: 1px;
-  color: #333333;
+    color: #333333;
 }
 .content
 {
@@ -195,7 +231,7 @@ form.search-form input:-ms-input-placeholder
 }
 .content ul.most-menu li.active
 {
-  background: #FFF572;
+  /*background: #FFF572;*/
 }
 .content-box
 {
@@ -238,6 +274,22 @@ form.search-form input:-ms-input-placeholder
   color: #333333;
   letter-spacing: 0.03px;
 }
+.content-height-overwrite
+{
+  height: 110px;
+}
+.float-center-magic
+{
+  float: right;
+  position: relative;
+  left: -30%;
+}
+nav ul li:hover, nav ul li.active, nav ul li a.active, nav ul li a:hover {
+  background-color: rgb(255,245,114);
+}
+a:hover, a.active {
+  background-color: rgb(255,245,114);
+}
 footer
 {
   font-size: 12px;
@@ -250,3 +302,17 @@ footer
 {
   height: 10px;
 }
+.space-30
+{
+  height: 100px;
+}
+input[type="text"]:focus:not([readonly]) {
+  transition: all 0s !important;
+  border-radius: 5px;
+  border: 2px solid #333333;
+  box-shadow: 0 0 15px 1px rgba(0,0,0,0.50);
+  color: #333333;
+}
+.gray {
+  background: rgb(249,249,249);
+}
index b183f36..e60c3ba 100644 (file)
-doctype html
+extends layout
+
 //
   Copyright (c) 2017 Kumar Rishabh and others.
   All rights reserved. This program and the accompanying materials
   are made available under the terms of the Apache License, Version 2.0
   which accompanies this distribution, and is available at
   http://www.apache.org/licenses/LICENSE-2.0
-html(lang='en')
-  head
-    meta(charset='UTF-8')
-    title Document
-    link(rel='stylesheet', href='/stylesheets/3rd_party/bootstrap.css')
-    link(rel='stylesheet', href='/stylesheets/style.css')
-  body
-    script(type='text/javascript' src='http://code.jquery.com/jquery.min.js')
-    script(src='/javascripts/global.js')
-    header
-      ul.navigation
-        li.logo
-        li.links
-          a(href='#') Projects
-        li.links
-          a(href='#') People
-        li.links
-          a(href='#') About
-      ul.navigation-right
-        li.signup
-          a(href='#') Sign up
-        li.option or
-        li.signin
-          a(href='#') Sign in
-    .search-box
-      h1 VNF Catalogue
-      form.search-form
-        input.search-input(type='text', placeholder='Search...', id='Tags')
-        .space-10
-        button.search-button(type='submit', value='Search', id='Search') Search
-    .content
-      ul.most-menu
-        li.items.active
-          a(href='#') Most Popular
-        li.items
-          a(href='#') Most Active
-        li.items
-          a(href='#') Most Active Contributions
-      .container
-        .row
-          .box-container
-            .col-md-3
-              .content-box
-                .content-data
-                  h1.content-title AAA
-                  .box
-                    img.commit-icon(src='/images/3rd_party/commits.png')
-                    h3.commits
-                      | 4,845
-                      br
-                      | commits
+block content
+  .search-box
+    h1 VNF Catalogue
+    form.search-form
+      input.search-input(type='text', placeholder='Search...', id='Tags')
+      .space-10
+      button.search-button(type='submit', value='Search', id='Search') Search
+  .content.content-height-overwrite
+    nav.z-depth-0.transparent
+      .nav-wrapper
+        ul#nav-mobile.float-center-magic.hide-on-med-and-down.most-menu
+          li.items
+            a(href='#') Most Popular
+          li.items
+            a(href='#') Most Active
+          li.items
+            a(href='#') Most Active Contributions
+  .content
+    .container
+      .row
+        .box-container
           .col-md-3
             .content-box
               .content-data
-                h1.content-title AAA
+                h1.content-title Beacon
                 .box
                   img.commit-icon(src='/images/3rd_party/commits.png')
                   h3.commits
                     | 4,845
                     br
                     | commits
-          .col-md-3
-            .content-box
-              .content-data
-                h1.content-title AAA
-                .box
-                  img.commit-icon(src='/images/3rd_party/commits.png')
-                  h3.commits
-                    | 4,845
-                    br
-                    | commits
-          .col-md-3
-            .content-box
-              .content-data
-                h1.content-title AAA
-                .box
-                  img.commit-icon(src='/images/3rd_party/commits.png')
-                  h3.commits
-                    | 4,845
-                    br
-                    | commits
-          .col-md-3
-            .content-box
-              .content-data
-                h1.content-title AAA
-                .box
-                  img.commit-icon(src='/images/3rd_party/commits.png')
-                  h3.commits
-                    | 4,845
-                    br
-                    | commits
-          .col-md-3
-            .content-box
-              .content-data
-                h1.content-title AAA
-                .box
-                  img.commit-icon(src='/images/3rd_party/commits.png')
-                  h3.commits
-                    | 4,845
-                    br
-                    | commits
-          .col-md-3
-            .content-box
-              .content-data
-                h1.content-title AAA
-                .box
-                  img.commit-icon(src='/images/3rd_party/commits.png')
-                  h3.commits
-                    | 4,845
-                    br
-                    | commits
-          .col-md-3
-            .content-box
-              .content-data
-                h1.content-title AAA
-                .box
-                  img.commit-icon(src='/images/3rd_party/commits.png')
-                  h3.commits
-                    | 4,845
-                    br
-                    | commits
-      footer
-        | © 2017 OPNFV
-script.
+        .col-md-3
+          .content-box
+            .content-data
+              h1.content-title Beacon
+              .box
+                img.commit-icon(src='/images/3rd_party/commits.png')
+                h3.commits
+                  | 4,845
+                  br
+                  | commits
+        .col-md-3
+          .content-box
+            .content-data
+              h1.content-title Beacon
+              .box
+                img.commit-icon(src='/images/3rd_party/commits.png')
+                h3.commits
+                  | 4,845
+                  br
+                  | commits
+        .col-md-3
+          .content-box
+            .content-data
+              h1.content-title Beacon
+              .box
+                img.commit-icon(src='/images/3rd_party/commits.png')
+                h3.commits
+                  | 4,845
+                  br
+                  | commits
+        .col-md-3
+          .content-box
+            .content-data
+              h1.content-title Beacon
+              .box
+                img.commit-icon(src='/images/3rd_party/commits.png')
+                h3.commits
+                  | 4,845
+                  br
+                  | commits
+        .col-md-3
+          .content-box
+            .content-data
+              h1.content-title Beacon
+              .box
+                img.commit-icon(src='/images/3rd_party/commits.png')
+                h3.commits
+                  | 4,845
+                  br
+                  | commits
+        .col-md-3
+          .content-box
+            .content-data
+              h1.content-title Beacon
+              .box
+                img.commit-icon(src='/images/3rd_party/commits.png')
+                h3.commits
+                  | 4,845
+                  br
+                  | commits
+        .col-md-3
+          .content-box
+            .content-data
+              h1.content-title Beacon
+              .box
+                img.commit-icon(src='/images/3rd_party/commits.png')
+                h3.commits
+                  | 4,845
+                  br
+                  | commits
+    footer
+      | © 2017 XYZ Company
+  style(type='text/css').
+    input[type="text"]:focus:not([readonly]) {
+      transition: all 0s !important;
+      border-radius: 5px;
+      border: 2px solid #333333;
+      box-shadow: 0 0 15px 1px rgba(0,0,0,0.50);
+      color: #333333;
+    }
+    .gray {
+      background: rgb(249,249,249);
+    }
index 7cc7dfc..89142f8 100644 (file)
@@ -5,11 +5,49 @@ doctype html
   are made available under the terms of the Apache License, Version 2.0
   which accompanies this distribution, and is available at
   http://www.apache.org/licenses/LICENSE-2.0
+html(lang='en')
 html
     head
         title= title
+        link(rel='stylesheet', href='/stylesheets/3rd_party/bootstrap.css')
+        link(rel='stylesheet', href='/3rd_party/materialize/css/materialize.css')
+        script(type='text/javascript', src='https://code.jquery.com/jquery-3.1.1.min.js')
+        script(src='/javascripts/global.js')
+        script(src='/3rd_party/materialize/js/materialize.js')
+        link(href='https://fonts.googleapis.com/icon?family=Material+Icons', rel='stylesheet')
         link(rel='stylesheet', href='/stylesheets/style.css')
     body
+        header
+          nav.transparent.z-depth-0
+            .nav-wrapper
+              a.button-collapse(href='#', data-activates='mobile-demo')
+                i.material-icons menu
+              ul#nav-mobile.left.hide-on-med-and-down
+                li
+                  a(href='#')
+                    img.left.brand-logo.brand-logo-extends
+                li
+                  a(href='#') Projects
+                li
+                  a(href='#') People
+                li
+                  a(href='#') About
+              ul#nav-mobile.right.hide-on-med-and-down
+                li.signup
+                  a(href='#') Sign up
+                li.option or
+                li.signin
+                  a(href='#') Sign in
+              ul#mobile-demo.side-nav
+                li
+                  a(href='#') Projects
+                li
+                  a(href='#') People
+                li
+                  a(href='#') About
+                li.signup
+                  a(href='#') Sign up
+                li.signin
+                  a(href='#') Sign in
         block content
-        script(src='http://ajax.googleapis.com/ajax/libs/jquery/2.1.1/jquery.min.js')
-        script(src='/javascripts/global.js')
+
index 3076543..6670d21 100644 (file)
-doctype html
+extends layout
+
 //
   Copyright (c) 2017 Kumar Rishabh and others.
   All rights reserved. This program and the accompanying materials
   are made available under the terms of the Apache License, Version 2.0
   which accompanies this distribution, and is available at
   http://www.apache.org/licenses/LICENSE-2.0
-html(lang='en')
-  head
-    meta(charset='UTF-8')
-    title Document
-    link(rel='stylesheet', href='/stylesheets/3rd_party/bootstrap.css')
-    link(rel='stylesheet', href='/stylesheets/style.css')
-  body
-    header
-      ul.navigation
-        li.logo
-        li.links
-          a(href='#') Projects
-        li.links
-          a(href='#') People
-        li.links
-          a(href='#') About
-      ul.navigation-right
-        li.signup
-          a(href='#') Sign up
-        li.option or
-        li.signin
-          a(href='#') Sign in
-    .search-box
-      h1 VNF Catalogue
-      form.search-form
-        input.search-input(type='text', placeholder='Search...')
-        .space-10
-        button.search-button(type='submit', value='Search') Search
-    .content
-      ul.most-menu
-        li.items.active
-          a(href='#') Most Popular
-        li.items
-          a(href='#') Most Active
-        li.items
-          a(href='#') Most Active Contributions
-      .container
-        .row
-          .box-container
-            .col-md-3
-              .content-box
-                .content-data
-                  h1.content-title AAA
-                  .box
-                    img.commit-icon(src='/images/3rd_party/commits.png')
-                    h3.commits
-                      | 4,845
-                      br
-                      | commits
-          .col-md-3
-            .content-box
-              .content-data
-                h1.content-title AAA
-                .box
-                  img.commit-icon(src='/images/3rd_party/commits.png')
-                  h3.commits
-                    | 4,845
-                    br
-                    | commits
-          .col-md-3
-            .content-box
-              .content-data
-                h1.content-title AAA
-                .box
-                  img.commit-icon(src='/images/3rd_party/commits.png')
-                  h3.commits
-                    | 4,845
-                    br
-                    | commits
-          .col-md-3
-            .content-box
-              .content-data
-                h1.content-title AAA
-                .box
-                  img.commit-icon(src='/images/3rd_party/commits.png')
-                  h3.commits
-                    | 4,845
-                    br
-                    | commits
-          .col-md-3
-            .content-box
-              .content-data
-                h1.content-title AAA
-                .box
-                  img.commit-icon(src='/images/3rd_party/commits.png')
-                  h3.commits
-                    | 4,845
-                    br
-                    | commits
-          .col-md-3
-            .content-box
-              .content-data
-                h1.content-title AAA
-                .box
-                  img.commit-icon(src='/images/3rd_party/commits.png')
-                  h3.commits
-                    | 4,845
-                    br
-                    | commits
-          .col-md-3
-            .content-box
-              .content-data
-                h1.content-title AAA
-                .box
-                  img.commit-icon(src='/images/3rd_party/commits.png')
-                  h3.commits
-                    | 4,845
-                    br
-                    | commits
-          .col-md-3
-            .content-box
-              .content-data
-                h1.content-title AAA
-                .box
-                  img.commit-icon(src='/images/3rd_party/commits.png')
-                  h3.commits
-                    | 4,845
-                    br
-                    | commits
-      footer
-        | © 2017 OPNFV
+block content
+  .search-box
+    .form-group-custom.form-group.has-feedback
+      input.search-input-rest.form-control(type='text', placeholder='Search...', id='Tags')
+      i.material-icons search
+  .content
+    .container
+      .card.card-shadow-custom.horizontal
+        .row.row-custom
+          .col.s5.card-title-div-custom
+            span.card-title.card-title-span-custom Card Title
+          .col.s5.card-title-div-custom
+            i.material-icons grade
+            span.card-title PenguinScore: 42
+          .col.s2.card-title-div-custom-right
+            form(action='#')
+              input#search_result_1(type='checkbox')
+              label(for='search_result_1') Compare
+          //
+            <div class="card-action">
+            <a href="#">This is a link</a>
+            </div>
+          .col.s4.card-image
+            img.card-image-picture-custom(src='/images/logo.png')
+          .col.s8.card-stacked
+            .card-content
+              p
+                .collection.collection-custom
+                  a.collection-item(href='#!')
+                    span
+                      i.material-icons code
+                      |                             Lines Of Code: 1.03M
+                  a.collection-item(href='#!')
+                    span
+                      i.material-icons code
+                      |                             Lines Of Code: 1.03M
+                  a.collection-item(href='#!')
+                    span
+                      i.material-icons code
+                      |                             Lines Of Code: 1.03M
+                  a.collection-item(href='#!')
+                    span
+                      i.material-icons code
+                      |                             Lines Of Code: 1.03M
+            .card-action
+              | Tags: 
+              .chip
+                a.a-custom(href='#!') Tag1
+              .chip
+                a.a-custom(href='#!') Tag2
+              .chip
+                a.a-custom(href='#!') Tag3
+              .chip
+                a.a-custom(href='#!') Tag4
+              .chip
+                a.a-custom(href='#!') Tag5
+              a.a-custom-more(href='#!') more
+          .divider
+          .card-action-custom.col.s12.card-action
+            | License: 
+            a(href='#') MIT
+            |                     Complexity: 
+            a(href='#') Atomic
+  footer
+    | © 2017 XYZ Company
+    link(rel='stylesheet', href='/stylesheets/search_projects.css')
+